{"version":3,"sources":["webpack:///webpack/bootstrap 806f95e892df7fd2edbb","webpack:///./main.js","webpack:///../~/famous/core/Engine.js","webpack:///../~/famous/core/Context.js","webpack:///../~/famous/core/RenderNode.js","webpack:///../~/famous/core/Entity.js","webpack:///../~/famous/core/SpecParser.js","webpack:///../~/famous/core/Transform.js","webpack:///../~/famous/core/EventHandler.js","webpack:///../~/famous/core/EventEmitter.js","webpack:///../~/famous/core/ElementAllocator.js","webpack:///../~/famous/transitions/Transitionable.js","webpack:///../~/famous/transitions/MultipleTransition.js","webpack:///../~/famous/utilities/Utility.js","webpack:///../~/famous/transitions/TweenTransition.js","webpack:///../~/famous/core/OptionsManager.js","webpack:///../~/famous-polyfills/index.js","webpack:///../~/famous-polyfills/classList.js","webpack:///../~/famous-polyfills/functionPrototypeBind.js","webpack:///../~/famous-polyfills/requestAnimationFrame.js","webpack:///../~/famous/core/famous.css?6045","webpack:///../~/style-loader/addStyle.js","webpack:///../~/famous/core/famous.css","webpack:///../~/famous-flex/src/widgets/styles.css?275b","webpack:///../~/famous-flex/src/widgets/styles.css","webpack:///./styles.css?6fa5","webpack:///./styles.css","webpack:///./fonts/montserrat/Montserrat-Hairline.otf","webpack:///./fonts/montserrat/Montserrat-Light.otf","webpack:///./fonts/dancing-script-ot/DancingScript-Regular.otf","webpack:///./index.html","webpack:///../~/codemirror/lib/codemirror.css?93d6","webpack:///../~/codemirror/lib/codemirror.css","webpack:///./mode/vfl/vfl.css?b13e","webpack:///./mode/vfl/vfl.css","webpack:///../~/fastclick/lib/fastclick.js","webpack:///../~/famous-flex/src/LayoutController.js","webpack:///../~/famous/core/ViewSequence.js","webpack:///../~/famous-flex/src/LayoutUtility.js","webpack:///../~/famous-flex/src/LayoutNodeManager.js","webpack:///../~/famous-flex/src/LayoutContext.js","webpack:///../~/famous/core/Surface.js","webpack:///../~/famous/core/ElementOutput.js","webpack:///../~/famous-flex/src/LayoutNode.js","webpack:///../~/famous-flex/src/FlowLayoutNode.js","webpack:///../~/famous/physics/forces/Spring.js","webpack:///../~/famous/physics/forces/Force.js","webpack:///../~/famous/math/Vector.js","webpack:///../~/famous/physics/bodies/Particle.js","webpack:///../~/famous/physics/integrators/SymplecticEuler.js","webpack:///../~/famous/physics/PhysicsEngine.js","webpack:///../~/famous-flex/src/helpers/LayoutDockHelper.js","webpack:////Users/hein/repos/autolayout/autolayout.js/dist/autolayout.kiwi.js","webpack:///./views/InputView.js","webpack:///../~/famous-flex/src/widgets/TabBarController.js","webpack:///../~/famous/core/View.js","webpack:///../~/famous-flex/src/AnimationController.js","webpack:///../~/famous/modifiers/StateModifier.js","webpack:///../~/famous/core/Modifier.js","webpack:///../~/famous/transitions/TransitionableTransform.js","webpack:///../~/famous/utilities/Timer.js","webpack:///../~/famous/transitions/Easing.js","webpack:///../~/famous-flex/src/widgets/TabBar.js","webpack:///../~/famous-flex/src/layouts/TabBarLayout.js","webpack:///./vflToLayout.js","webpack:///./views/EditorView.js","webpack:///../~/codemirror/lib/codemirror.js","webpack:///./mode/vfl/vfl.js","webpack:///../~/codemirror/addon/mode/simple.js","webpack:///./views/SettingsView.js","webpack:///../~/famous/surfaces/InputSurface.js","webpack:///./views/OutputView.js","webpack:///./views/VisualOutputView.js","webpack:///../~/colors.js/index.js","webpack:///../~/colors.js/colors.js"],"names":[],"mappings":";AAAA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,uBAAe;AACf;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;;AAGA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;;;;;;;;;;;;;;;;;;;;;;;AC3BA,oBAAO,CAAC,0BAAkB,CAAC,CAAC;AAC5B,oBAAO,CAAC,gCAAwB,CAAC,CAAC;AAClC,oBAAO,CAAC,wCAAgC,CAAC,CAAC;AAC1C,oBAAO,CAAC,sBAAc,CAAC,CAAC;AACxB,oBAAO,CAAC,sBAAc,CAAC,CAAC;AACxB,oBAAO,CAAC,uCAA+B,CAAC,CAAC;AACzC,oBAAO,CAAC,4BAAoB,CAAC,CAAC;;;AAG9B,UAAS,kBAAkB,CAAC,IAAI,EAAE;AAC9B,SAAI,GAAG,IAAI,CAAC,OAAO,CAAC,MAAM,EAAE,KAAK,CAAC,CAAC,OAAO,CAAC,MAAM,EAAE,KAAK,CAAC,CAAC;AAC1D,SAAI,KAAK,GAAG,IAAI,MAAM,CAAC,QAAQ,GAAG,IAAI,GAAG,WAAW,CAAC,CAAC;AACtD,SAAI,OAAO,GAAG,KAAK,CAAC,IAAI,CAAC,QAAQ,CAAC,MAAM,CAAC,CAAC;AAC1C,YAAO,OAAO,KAAK,IAAI,GAAG,EAAE,GAAG,kBAAkB,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,KAAK,EAAE,GAAG,CAAC,CAAC,CAAC;EACrF;;;AAGD,KAAI,SAAS,GAAG,mBAAO,CAAC,iCAAyB,CAAC,CAAC;AACnD,UAAS,CAAC,MAAM,CAAC,QAAQ,CAAC,IAAI,CAAC,CAAC;;;AAGhC,KAAI,MAAM,GAAG,mBAAO,CAAC,2BAAoB,CAAC,CAAC;AAC3C,KAAI,gBAAgB,GAAG,mBAAO,CAAC,sCAA8B,CAAC,CAAC;AAC/D,KAAI,UAAU,GAAG,mBAAO,CAAC,oBAAY,CAAC,CAAC;AACvC,KAAI,SAAS,GAAG,mBAAO,CAAC,2BAAmB,CAAC,CAAC;AAC7C,KAAI,UAAU,GAAG,mBAAO,CAAC,4BAAoB,CAAC,CAAC;AAC/C,KAAI,gBAAgB,GAAG,mBAAO,CAAC,kCAA0B,CAAC,CAAC;AAC3D,KAAI,WAAW,GAAG,mBAAO,CAAC,uBAAe,CAAC,CAAC;AAC3C,KAAI,OAAO,GAAG,mBAAO,CAAC,6BAAqB,CAAC,CAAC;;;AAG7C,KAAI,WAAW,GAAG,MAAM,CAAC,aAAa,EAAE,CAAC;AACzC,KAAI,MAAM,CAAC;AACX,SAAQ,kBAAkB,CAAC,MAAM,CAAC;AAC9B,UAAK,SAAS;AACV,eAAM,GAAG,WAAW,wDAGlB,CAAC;AACH,eAAM;AACV,UAAK,SAAS;AACV,eAAM,GAAG,WAAW,mJAKjB,EAAC,OAAO,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,EAAC,CAAC,CAAC;AACxB,eAAM;AACV,UAAK,OAAO;AACR,eAAM,GAAG,WAAW,8FAIjB,EAAC,OAAO,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,EAAC,CAAC,CAAC;AACxB,eAAM;AACV;AACI,eAAM,GAAG,WAAW,0MAOjB,EAAC,OAAO,EAAE,CAAC,EAAE,EAAE,EAAE,CAAC,EAAC,CAAC,CAAC;AAAA,EAC/B;AACD,KAAI,MAAM,GAAG,IAAI,gBAAgB,CAAC;AAC9B,WAAM,EAAE,MAAM;EACjB,CAAC,CAAC;AACH,YAAW,CAAC,GAAG,CAAC,MAAM,CAAC,CAAC;;;AAGxB,KAAI,MAAM,GAAG,IAAI,OAAO,CAAC;AACrB,YAAO,EAAE,CAAC,QAAQ,CAAC;AACnB,YAAO,EAAE,qFAAqF,IAC7F,QAAQ,CAAC,kBAAkB,CAAC,MAAM,CAAC,IAAI,GAAG,CAAC,GAAG,8cAA8c,GAAG,EAAE,CAAC;AACngB,SAAI,EAAE,CAAC,SAAS,EAAE,GAAG,CAAC;EACzB,CAAC,CAAC;AACH,OAAM,CAAC,MAAM,CAAC,QAAQ,EAAE,MAAM,CAAC,CAAC;;;AAGhC,KAAI,SAAS,GAAG,IAAI,SAAS,EAAE,CAAC;AAChC,OAAM,CAAC,MAAM,CAAC,OAAO,EAAE,SAAS,CAAC,CAAC;AAClC,UAAS,CAAC,MAAM,CAAC,EAAE,CAAC,QAAQ,EAAE,OAAO,CAAC,CAAC;AACvC,UAAS,CAAC,QAAQ,CAAC,EAAE,CAAC,QAAQ,EAAE,eAAe,CAAC,CAAC;;;AAGjD,KAAI,UAAU,GAAG,IAAI,UAAU,EAAE,CAAC;AAClC,OAAM,CAAC,MAAM,CAAC,QAAQ,EAAE,UAAU,CAAC,CAAC;;;AAGpC,KAAI,gBAAgB,GAAG,IAAI,gBAAgB,EAAE,CAAC;AAC9C,OAAM,CAAC,MAAM,CAAC,cAAc,EAAE,gBAAgB,CAAC,CAAC;;;AAGhD,UAAS,OAAO,GAAG;AACf,SAAI,WAAW,GAAG,UAAU,CAAC,KAAK,CAAC,SAAS,CAAC,MAAM,CAAC,YAAY,EAAE,SAAS,CAAC,QAAQ,CAAC,WAAW,EAAE,CAAC,CAAC;AACpG,SAAI,WAAW,EAAE;AACb,aAAI,IAAI,GAAG,IAAI,UAAU,CAAC,IAAI,EAAE,CAAC;AACjC,aAAI,CAAC,cAAc,CAAC,WAAW,CAAC,CAAC;AACjC,yBAAgB,CAAC,IAAI,GAAG,IAAI,CAAC;MAChC;AACD,oBAAe,EAAE,CAAC;AAClB,oBAAe,EAAE,CAAC;EACrB;AACD,UAAS,eAAe,GAAG;AACvB,SAAI,QAAQ,GAAG,UAAU,CAAC,YAAY,CAAC,aAAa,CAAC,SAAS,CAAC,MAAM,CAAC,YAAY,EAAE,EAAC,MAAM,EAAE,GAAG,EAAC,CAAC,CAAC;AACnG,qBAAgB,CAAC,QAAQ,GAAG,QAAQ,CAAC,QAAQ,CAAC;AAC9C,qBAAgB,CAAC,OAAO,GAAG,QAAQ,CAAC,OAAO,CAAC;AAC5C,qBAAgB,CAAC,MAAM,GAAG,QAAQ,CAAC,MAAM,CAAC;AAC1C,qBAAgB,CAAC,MAAM,GAAG,QAAQ,CAAC,MAAM,CAAC;AAC1C,qBAAgB,CAAC,MAAM,GAAG,QAAQ,CAAC,MAAM,CAAC;AAC1C,qBAAgB,CAAC,OAAO,GAAG,QAAQ,CAAC,OAAO,CAAC;EAC/C;AACD,UAAS,eAAe,CAAC,UAAU,EAAE;AACjC,SAAI,UAAU,EAAE;AACZ,gBAAO,OAAO,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC;MAC7B;AACD,SAAI,IAAI,GAAG,gBAAgB,CAAC,IAAI,CAAC;AACjC,SAAI,IAAI,EAAE;AACN,kBAAS,CAAC,QAAQ,CAAC,oBAAoB,CAAC,IAAI,CAAC,CAAC;AAC9C,yBAAgB,CAAC,IAAI,GAAG,IAAI,CAAC;MAChC;EACJ;AACD,QAAO,EAAE,C;;;;;;;;;ACtIT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,qBAAqB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,oBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC;AACD,yB;;;;;;;;;ACjLA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0B;;;;;;;;;AC/GA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,qBAAqB;AAC5C;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,6B;;;;;;;;;ACvGA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,G;;;;;;;;;AC3BA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,MAAK;AACL,wBAAuB,iBAAiB;AACxC;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA,6B;;;;;;;;;AClIA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,OAAO;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4B;;;;;;;;;AC/rBA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,4BAA4B;AAC3C;AACA;AACA;AACA,gBAAe,8BAA8B;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,0BAA0B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+B;;;;;;;;;AC1GA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,qBAAqB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+B;;;;;;;;;ACzCA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mC;;;;;;;;;ACnDA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;ACtIA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,4BAA4B;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,qBAAqB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA,qC;;;;;;;;;ACnCA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAmC,mBAAmB;AACtD;AACA;AACA,kBAAiB;AACjB;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,0B;;;;;;;;;AC/DA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,mBAAkB;AAClB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,oBAAoB;AAC3C;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kC;;;;;;;;;ACpPA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB;AACrB,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iC;;;;;;;;;AChFA;AACA;AACA,2D;;;;;;;;;;ACDA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;;AAEA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAc,SAAS;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAc,SAAS;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK,aAAa;AAClB;AACA;AACA;AACA;AACA;AACA,EAAC;AACD;AACA;;AAEA,EAAC;;AAED;;;;;;;;;;ACzIA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,8BAA6B;AAC7B;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;;;;;;;;;ACtBA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH,EAAC;;;;;;;;;;ACZD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,E;;;;;;;;;ACRA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,GAAE;AACF;AACA;AACA;AACA;AACA;AACA;;;;;;;;;;ACpBA;AAAA,6/C;;;;;;;;;ACAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,E;;;;;;;;;ACRA;AAAA,wtC;;;;;;;;;ACAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,E;;;;;;;;;ACRA;AAAA,ogE;;;;;;;;;ACAA,oF;;;;;;;;;ACAA,iF;;;;;;;;;ACAA,6F;;;;;;;;;ACAA,sD;;;;;;;;;ACAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,E;;;;;;;;;ACRA;AAAA,q6P;;;;;;;;;ACAA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,E;;;;;;;;;ACRA;AAAA,oa;;;;;;;;;ACAA,oCAAC;AACD;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA;AACA,aAAY,QAAQ;AACpB,aAAY,OAAO,YAAY;AAC/B;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,uBAAsB,yCAAyC;AAC/D;;;AAGA;AACA;AACA,sCAAqC,OAAO;AAC5C;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,OAAM;AACN,MAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,KAAI;AACJ;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,aAAY,oBAAoB;AAChC,eAAc,QAAQ;AACtB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,oBAAoB;AAChC,eAAc,QAAQ;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,oBAAoB;AAChC,aAAY,MAAM;AAClB;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA,aAAY,oBAAoB;AAChC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,oBAAoB;AAChC;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,KAAI;AACJ;;AAEA;AACA;AACA;AACA;AACA;;;AAGA;AACA,aAAY,YAAY;AACxB,eAAc;AACd;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,MAAM;AAClB,eAAc;AACd;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,MAAM;AAClB,eAAc;AACd;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,MAAM;AAClB,eAAc;AACd;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,6BAA6B;AACzC,eAAc;AACd;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,MAAM;AAClB,eAAc;AACd;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB;AACnB;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA,eAAc;AACd;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,MAAM;AAClB,eAAc;AACd;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,KAAI;;AAEJ;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA,aAAY,MAAM;AAClB,eAAc;AACd;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;;AAGA;AACA;AACA;AACA,eAAc;AACd;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,QAAQ;AACpB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,KAAI;AACJ;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;;AAGA;AACA;AACA;AACA,aAAY,QAAQ;AACpB,aAAY,OAAO,YAAY;AAC/B;AACA;AACA;AACA;;;AAGA;;AAEA;AACA;AACA;AACA,IAAG;AACH,GAAE;AACF;AACA;AACA,GAAE;AACF;AACA;AACA,EAAC;;;;;;;;;;ACx0BD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,gBAAgB;AAC/B,gBAAe,OAAO;AACtB,gBAAe,0BAA0B;AACzC,gBAAe,kBAAkB;AACjC,gBAAe,KAAK;AACpB,gBAAe,OAAO;AACtB,gBAAe,KAAK;AACpB,gBAAe,OAAO,sFAAsF,+BAA+B;AAC3I,gBAAe,OAAO;AACtB,gBAAe,KAAK,gIAAgI;AACpJ,gBAAe,KAAK,2HAA2H;AAC/I,gBAAe,KAAK;AACpB,gBAAe,KAAK;AACpB,gBAAe,OAAO,oIAAoI,kBAAkB,4CAA4C;AACxN;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA,UAAS;;AAET;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,sCAAqC;AACrC;AACA;AACA;AACA;AACA;AACA,UAAS;;AAET;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,QAAQ;AACvB,gBAAe,gBAAgB;AAC/B,gBAAe,OAAO;AACtB,gBAAe,0BAA0B;AACzC,gBAAe,kBAAkB;AACjC,gBAAe,OAAO;AACtB,gBAAe,KAAK;AACpB,gBAAe,OAAO,sFAAsF,+BAA+B;AAC3I,gBAAe,OAAO;AACtB,gBAAe,KAAK,gIAAgI;AACpJ,gBAAe,KAAK,2HAA2H;AAC/I,gBAAe,KAAK;AACpB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAkD,OAAO;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,0BAA0B;AACzC,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,0BAA0B;AAC1C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,gBAAgB;AAC/B,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,mDAAkD;AAClD;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,gBAAgB;AAChC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA,gCAA+B,gDAAgD;AAC/E;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,kBAAkB;AACjC,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,QAAQ;AACvB,iBAAgB,kBAAkB;AAClC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,kBAAkB;AACjC,gBAAe,KAAK;AACpB,gBAAe,KAAK;AACpB,iBAAgB,KAAK;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,wBAAwB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,cAAc;AAC7B,gBAAe,OAAO;AACtB,gBAAe,KAAK;AACpB,iBAAgB,iBAAiB;AACjC;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,KAAK;AACpB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,cAAc;AAC7B,iBAAgB,WAAW;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,cAAc;AAC7B,gBAAe,WAAW;AAC1B,gBAAe,KAAK;AACpB,iBAAgB,WAAW;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,yBAAyB;AACxC,gBAAe,KAAK;AACpB,iBAAgB,WAAW;AAC3B;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,KAAK;AACpB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,aAAa;AAC7B;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,QAAQ;AACvB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,qCAAoC;AACpC;AACA;AACA;AACA,mCAAkC;AAClC;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;;AAEA;AACA;AACA,2CAA0C,OAAO;AACjD;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,QAAQ;AACvB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;AC/lCD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,WAAW;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,iBAAiB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,iBAAiB;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,cAAa;AACb;AACA,UAAS;AACT;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,cAAa;AACb;AACA,UAAS;AACT;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+B;;;;;;;;;ACvPA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,aAAa;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,KAAK;AACpB,iBAAgB,KAAK;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,KAAK;AACpB,gBAAe,KAAK;AACpB,iBAAgB,QAAQ;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,KAAK;AACpB,gBAAe,KAAK;AACpB,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,oBAAoB;AACnC;AACA;AACA;AACA,wBAAuB,sBAAsB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,KAAK;AACpB,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAkD;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAkB;AAClB;AACA;AACA;AACA,YAAW;AACX;AACA,iCAAgC,kBAAkB;AAClD,iCAAgC,kBAAkB;AAClD,kCAAiC,mBAAmB;AACpD;AACA,SAAQ;AACR;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,SAAS;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,iBAAgB,SAAS;AACzB;AACA;AACA;AACA;;AAEA;AACA;AACA,EAAC;;;;;;;;;;AChSD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,gBAAe,WAAW;AAC1B,gBAAe,SAAS;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA,mCAAkC;AAClC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,aAAa;AAC5B,gBAAe,OAAO;AACtB,iBAAgB,cAAc;AAC9B;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,gBAAe,KAAK;AACpB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,iBAAgB,WAAW;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,iBAAgB,WAAW;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,WAAW;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,KAAK;AACpB;AACA;AACA;AACA,wBAAuB,WAAW;AAClC;AACA;AACA,oBAAmB,WAAW;AAC9B;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,iBAAgB,WAAW;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,KAAK;AACpB,iBAAgB,WAAW;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,uDAAsD,OAAO;AAC7D;AACA;AACA;AACA,sBAAqB;AACrB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAgE;AAChE;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;AC5xBD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,SAAQ,SAAS;AACjB;AACA;;AAEA;AACA,SAAQ,SAAS;AACjB;AACA;;AAEA;AACA,SAAQ,SAAS,EAAE,OAAO;AAC1B;AACA;;AAEA;AACA,SAAQ,SAAS,EAAE,OAAO;AAC1B;AACA;;AAEA;AACA,SAAQ,SAAS,EAAE,OAAO;AAC1B;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAmC;AACnC;AACA;AACA;AACA;AACA,aAAY;AACZ;AACA,kCAAiC;AACjC;AACA;AACA;AACA;AACA,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAmC;AACnC;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ,kCAAiC;AACjC;AACA;AACA;AACA;AACA,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA8B,uBAAuB;AACrD;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ,WAAU;AACV;AACA,+BAA8B,gBAAgB;AAC9C,gCAA+B,iBAAiB;AAChD,iCAAgC,kBAAkB;AAClD;AACA,SAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAiC,uBAAuB;AACxD;AACA;AACA;AACA;AACA,2BAA0B,sBAAsB;AAChD;AACA;AACA;AACA;AACA,eAAc;AACd;AACA;AACA,WAAU;AACV;AACA,gCAA+B,iBAAiB;AAChD;AACA,2BAA0B,iBAAiB;AAC3C,2BAA0B,iBAAiB;AAC3C;AACA;AACA,SAAQ;AACR;AACA;AACA,gBAAe,cAAc;AAC7B,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAU;AACV;AACA;AACA;AACA,gBAAe,cAAc;AAC7B,gBAAe,OAAO;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAkC,mBAAmB;AACrD;AACA;AACA;AACA,aAAY;AACZ,WAAU;AACV;AACA,iCAAgC,kBAAkB;AAClD,sCAAqC,uBAAuB;AAC5D;AACA,SAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,cAAc;AAC7B,iBAAgB,KAAK;AACrB;AACA;AACA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;ACrQD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,2BAA2B;AAC1C;AACA;AACA;AACA,gBAAe,oBAAoB;AACnC;AACA,gBAAe,sBAAsB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,+BAA+B;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,8BAA8B;AACzD;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,sBAAsB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,sBAAsB;AACrC;AACA;AACA;AACA,wBAAuB,8BAA8B;AACrD;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0B;;;;;;;;;ACpTA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,QAAQ;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC;AACD;AACA;AACA;AACA;AACA;AACA,EAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;ACrLA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA;AACA;AACA;AACA,4CAA2C;AAC3C;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B,QAAQ;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;ACvMD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,KAAK;AACpB,gBAAe,OAAO;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,kBAAkB;AAC7C;AACA;AACA;AACA;AACA;AACA,4BAA2B,kBAAkB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAmC;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;AC9iBD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,oBAAoB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,oBAAoB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA,yB;;;;;;;;;ACjIA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wB;;;;;;;;;AC1BA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yB;;;;;;;;;ACzJA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2B;;;;;;;;;AC1MA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kC;;;;;;;;;ACrCA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,mBAAmB;AAC1C;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAA+C,aAAa;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA,6CAA4C,aAAa;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,YAAY;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAsD,YAAY;AAClE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;ACjRA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAc;AACd;AACA;AACA;AACA,QAAO;AACP;AACA,6BAA4B,kBAAkB;AAC9C,6BAA4B,kBAAkB;AAC9C,8BAA6B,mBAAmB;AAChD;AACA,KAAI;AACJ;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA,gBAAe,cAAc;AAC7B,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA,wBAAuB,iBAAiB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,kBAAkB;AACjC,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,kBAAkB;AACjC,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,kBAAkB;AACjC,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,kBAAkB;AACjC,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,kBAAkB;AACjC,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;;AAEA;AACA;AACA;AACA,gBAAe,aAAa;AAC5B,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,OAAO,GAAG,2CAA2C;AACrE;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;ACnRD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa,2DAA2D,mBAAmB,gDAAgD,aAAa,KAAK,MAAM,gCAAgC,SAAS,qCAAqC,SAAS,mCAAmC,OAAO,KAAK,OAAO,oBAAoB,aAAa,0BAA0B,0BAA0B,gBAAgB,UAAU,UAAU,0CAA0C,wBAAwB,oBAAoB,8CAA8C,kCAAkC,YAAY,YAAY,mCAAmC,iBAAiB,gBAAgB,sBAAsB,oBAAoB,0CAA0C,YAAY,WAAW,YAAY,SAAS,GAAG;AAC9yB;;AAEA,kCAAiC,2CAA2C,gBAAgB,kBAAkB,OAAO,2BAA2B,wDAAwD,gCAAgC,uDAAuD,2DAA2D,EAAE,EAAE,yDAAyD,qEAAqE,6DAA6D,oBAAoB,GAAG,EAAE;;AAEljB,kDAAiD,0CAA0C,0DAA0D,EAAE;;AAEvJ;AACA;;AAEA;AACA;AACA,WAAU;AACV;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,WAAU;AACV;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,WAAU;AACV;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA,2DAA0D;AAC1D,wBAAuB;AACvB,mCAAkC,kDAAkD;AACpF;AACA;AACA;AACA;AACA,mBAAkB,oDAAoD;AACtE;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,mBAAkB,oDAAoD;AACtE;AACA,mBAAkB,oDAAoD;AACtE;AACA;AACA,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,oBAAmB,oDAAoD;AACvE;AACA,yCAAwC,0BAA0B,KAAK;AACvE,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA,MAAK;AACL;AACA,gBAAe,gEAAgE;AAC/E,MAAK;AACL;AACA;AACA,gBAAe,wDAAwD;AACvE,MAAK;AACL;AACA,gBAAe,wDAAwD;AACvE,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,oBAAmB,oDAAoD;AACvE;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA;AACA,QAAO;AACP,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,sBAAqB,kBAAkB,SAAS,kBAAkB;AAClE,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,eAAc;AACd,MAAK;AACL;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,8DAA8D;AACjF;AACA,oBAAmB,oEAAoE;AACvF;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,iCAAgC,oCAAoC;AACpE;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA,wCAAuC,0CAA0C;AACjF;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,2BAA0B,YAAY;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,mCAAkC;AAClC;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW;AACX;AACA,YAAW;AACX;AACA;AACA,UAAS;;AAET;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,YAAW;AACX;AACA,YAAW;AACX;AACA,YAAW;AACX;AACA,YAAW;AACX;;AAEA;AACA;AACA;AACA;;AAEA,oBAAmB,qBAAqB;AACxC;AACA;;AAEA;;AAEA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA,sBAAqB,sBAAsB;AAC3C;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,MAAK;AACL;AACA,mBAAkB,2CAA2C;AAC7D;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,EAAC;;AAED;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA,2DAA0D;AAC1D,wBAAuB;AACvB,mCAAkC,wDAAwD;AAC1F;AACA;AACA;AACA,mBAAkB,sDAAsD;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,eAAc;AACd,MAAK;AACL;AACA,mBAAkB,oDAAoD;AACtE;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA;AACA,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,oBAAmB,sDAAsD;AACzE,oBAAmB,4CAA4C;AAC/D;AACA,oBAAmB,oDAAoD;AACvE;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,oBAAmB,oDAAoD;AACvE;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA,MAAK;AACL;AACA,gDAA+C,0BAA0B,KAAK;AAC9E;AACA,QAAO,KAAK;AACZ,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,gBAAe,mBAAmB;AAClC,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA,MAAK;AACL;AACA,gBAAe,uCAAuC;AACtD,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,gBAAe,sCAAsC;AACrD,MAAK;AACL;AACA;AACA,gBAAe,+BAA+B;AAC9C,MAAK;AACL;AACA,gBAAe,4CAA4C;AAC3D,MAAK;AACL;AACA,gBAAe,+BAA+B;AAC9C,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,oBAAmB,oDAAoD;AACvE;AACA;AACA;AACA,QAAO;AACP,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,sBAAqB,kBAAkB,SAAS,kBAAkB;AAClE,MAAK;AACL;AACA,sBAAqB,sCAAsC,SAAS,kBAAkB;AACtF,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,sDAAsD;AACzE;AACA,eAAc;AACd,MAAK;AACL;AACA,eAAc;AACd,MAAK;AACL;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,oDAAoD;AACvE;AACA,oBAAmB,oDAAoD;AACvE;AACA,eAAc;AACd,MAAK;AACL;AACA,eAAc;AACd,MAAK;AACL;AACA,eAAc;AACd,MAAK;AACL;AACA,oBAAmB,4DAA4D;AAC/E;AACA;AACA,MAAK;AACL;AACA,oBAAmB,8DAA8D;AACjF;AACA;AACA,MAAK;AACL;AACA,oBAAmB,0DAA0D;AAC7E;AACA;AACA,MAAK;AACL;AACA,oBAAmB,gEAAgE;AACnF;AACA;AACA,MAAK;AACL;AACA,oBAAmB,8DAA8D;AACjF;AACA;AACA,MAAK;AACL;AACA,oBAAmB,gEAAgE;AACnF;AACA;AACA,MAAK;AACL;AACA,qBAAoB,kEAAkE;AACtF;AACA;AACA,MAAK;AACL;AACA,qBAAoB,kEAAkE;AACtF;AACA;AACA,MAAK;AACL;AACA,qBAAoB,oDAAoD;AACxE;AACA;AACA,MAAK;AACL;AACA,qBAAoB,sDAAsD;AAC1E;AACA,qBAAoB,sDAAsD;AAC1E;AACA;AACA,MAAK;AACL;AACA,qBAAoB,oDAAoD;AACxE;AACA;AACA,MAAK;AACL;AACA,qBAAoB,sDAAsD;AAC1E;AACA,qBAAoB,sDAAsD;AAC1E;AACA;AACA,MAAK;AACL;AACA,qBAAoB,8DAA8D;AAClF;AACA,qBAAoB,oEAAoE;AACxF;AACA,eAAc;AACd,MAAK;AACL;AACA,eAAc;AACd,MAAK;AACL;AACA,qBAAoB,sDAAsD;AAC1E;AACA;AACA,MAAK;AACL;AACA,qBAAoB,oDAAoD;AACxE;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,iCAAgC,oCAAoC;AACpE;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA,wCAAuC,0CAA0C;AACjF;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,2BAA0B,YAAY;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,mCAAkC;AAClC;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,YAAW;AACX;AACA,YAAW;AACX;AACA;AACA,UAAS;;AAET;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,YAAW;AACX;AACA,YAAW;AACX;AACA,YAAW;AACX;AACA,YAAW;AACX;;AAEA;AACA;AACA;AACA;;AAEA,oBAAmB,qBAAqB;AACxC;AACA;;AAEA;;AAEA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB;AACnB;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA,sBAAqB,sBAAsB;AAC3C;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,MAAK;AACL;AACA,mBAAkB,2CAA2C;AAC7D;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,EAAC;;AAED;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;;AAEA;AACA,kBAAiB,8BAA8B;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;AAEA;AACA,kBAAiB,8BAA8B;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,kBAAkB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA,yDAAwD,OAAO;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA6B,YAAY;AACzC;AACA;AACA,IAAG;AACH;AACA,gBAAe,YAAY;AAC3B;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mBAAkB,kBAAkB;AACpC;AACA;AACA,kBAAiB,oBAAoB;AACrC;AACA;AACA;AACA,sBAAqB,kBAAkB;AACvC;AACA;AACA,wBAAuB,sBAAsB;AAC7C;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,8BAA6B,8BAA8B;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,4BAA2B,wBAAwB;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,kBAAiB;AACjB;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,QAAQ;AACvB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,MAAM;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,2BAA2B;AAClD;AACA,0BAAyB,4BAA4B;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,aAAa;AAC5B,gBAAe,OAAO;AACtB,gBAAe,QAAQ;AACvB,gBAAe,QAAQ;AACvB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,MAAM;AACtB;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,yBAAyB;AAChD;AACA,0BAAyB,kBAAkB;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAkC,MAAM,EAAE,OAAO;AACjD,mBAAkB,OAAO;AACzB,oBAAmB,OAAO;AAC1B,sBAAqB,OAAO;AAC5B,sBAAqB,OAAO;AAC5B,uBAAsB,OAAO;AAC7B,uBAAsB,OAAO;AAC7B,sBAAqB,OAAO;AAC5B,oBAAmB,UAAU,GAAG,OAAO;AACvC,qBAAoB,UAAU,GAAG,OAAO;AACxC,oBAAmB,UAAU,EAAE,MAAM;AACrC,oBAAmB,UAAU;AAC7B;AACA,gBAAe,aAAa;AAC5B,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,OAAO;AACvB;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB,yBAAyB;AAC9C;AACA,wBAAuB,kBAAkB;AACzC;AACA,0BAAyB,+BAA+B;AACxD,4BAA2B,sBAAsB;AACjD;AACA;AACA;AACA;AACA,gCAA+B,kBAAkB;AACjD;AACA;AACA;AACA,kCAAiC,kBAAkB;AACnD;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAgD,YAAY;AAC5D;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA,EAAC;;AAED;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA,gBAAe,iBAAiB;AAChC,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAQ;AACR;AACA,mEAAkE;AAClE;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA,EAAC;;AAED;;AAEA;AACA;AACA,8BAA6B,eAAe;AAC5C;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,IAAG;AACH;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA,IAAG;AACH;AACA,IAAG;AACH;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,QAAO;AACP;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,QAAO;AACP;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB,OAAO;AACxB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,cAAa,OAAO;AACpB,cAAa,OAAO;AACpB,cAAa,OAAO;AACpB,cAAa,cAAc;AAC3B,cAAa,MAAM;AACnB;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,iBAAgB,UAAU;AAC1B,iBAAgB,SAAS;AACzB,iBAAgB,SAAS;AACzB,iBAAgB,aAAa;AAC7B,iBAAgB,KAAK;AACrB,iBAAgB,QAAQ;AACxB;;AAEA;AACA;AACA;AACA,cAAa,OAAO;AACpB,cAAa,OAAO;AACpB,eAAc,KAAK;AACnB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B;AAC3B,qCAAoC;AACpC,gDAA+C;AAC/C,mDAAkD;AAClD;AACA;AACA,gBAAe,aAAa;AAC5B,iBAAgB,KAAK;AACrB;AACA;AACA;AACA;AACA;AACA,+EAA8E;AAC9E;AACA,iGAAgG;AAChG;AACA,iGAAgG;AAChG;AACA,0GAAyG;AACzG;AACA,iGAAgG;AAChG;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAAyB,8BAA8B;AACvD;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB,OAAO;AACxB,kBAAiB,qBAAqB;AACtC,qBAAoB,oBAAoB;AACxC,kBAAiB,OAAO;AACxB,kBAAiB,qBAAqB;AACtC,uBAAsB,OAAO;AAC7B,qBAAoB,OAAO;AAC3B,qBAAoB,OAAO;AAC3B;AACA;AACA,gBAAe,OAAO;AACtB,iBAAgB,KAAK;AACrB;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB,OAAO;AACxB,kBAAiB,qBAAqB;AACtC,qBAAoB,oBAAoB;AACxC,kBAAiB,OAAO;AACxB,kBAAiB,qBAAqB;AACtC,uBAAsB,OAAO;AAC7B,qBAAoB,OAAO;AAC3B,qBAAoB,OAAO;AAC3B;AACA;AACA,gBAAe,MAAM;AACrB,iBAAgB,KAAK;AACrB;AACA,IAAG;AACH;AACA;AACA,sBAAqB,wBAAwB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,SAAQ;AACR;AACA;AACA,0DAAyD;AACzD;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAc;AACd;AACA,IAAG;AACH;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA,EAAC;;AAED;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA,EAAC,EAAE,qBAAqB;AACxB;AACA;AACA;AACA;AACA;AACA,MAAK;AACL,IAAG;AACH;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA,EAAC;;AAED;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAA+C,WAAW;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gDAA+C,sBAAsB;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;;;AAIA;AACA;AACA;AACA;AACA;AACA;AACA;;;;AAIA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA,+CAA8C,OAAO;AACrD;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,EAAC,kBAAkB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,EAAC,kBAAkB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,EAAC,kBAAkB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,EAAC,kBAAkB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA,kBAAiB;AACjB;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAiD,OAAO;AACxD;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC,kBAAkB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,eAAc;AACd;AACA;AACA;AACA;AACA,6CAA4C;AAC5C,MAAK,sCAAsC;AAC3C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,WAAW;AAC1B,gBAAe,SAAS;AACxB,gBAAe,WAAW;AAC1B,gBAAe,OAAO;AACtB;AACA;AACA;AACA,uCAAsC,mCAAmC;AACzE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB,SAAS;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB,OAAO;AAC3B;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,EAAC,oBAAoB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC,oBAAoB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,OAAO;AACtB;AACA;AACA;AACA,mCAAkC,WAAW;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB,OAAO;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,OAAO;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB,OAAO;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,2BAA2B;AAC9C,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,2BAA2B;AAC9C,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,OAAO;AAC1B,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,OAAO;AAC1B,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,EAAC,oBAAoB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,sCAAsC;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB,OAAO;AAC3B;AACA;AACA;AACA,oDAAmD,OAAO;AAC1D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,2BAA2B;AAC9C,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,2BAA2B;AAC9C,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,OAAO;AAC1B,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,OAAO;AAC1B,qBAAoB,WAAW;AAC/B;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAmC,YAAY;AAC/C;AACA,yCAAwC,OAAO;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mDAAkD,OAAO;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uDAAsD,OAAO;AAC7D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAgB;AAChB;AACA,EAAC,oBAAoB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,OAAO;AAC1B,oBAAmB,OAAO;AAC1B,oBAAmB,OAAO;AAC1B,oBAAmB,OAAO;AAC1B,qBAAoB,OAAO;AAC3B;AACA;AACA,gCAA+B,SAAS;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK,iDAAiD;AACtD,EAAC,oBAAoB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,oBAAoB;AACvC,oBAAmB,SAAS;AAC5B,oBAAmB,2BAA2B;AAC9C,oBAAmB,OAAO;AAC1B;AACA;AACA,uCAAsC,mCAAmC;AACzE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,WAAW;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,WAAW;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,WAAW;AAC9B,qBAAoB,KAAK;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,SAAS;AAC5B,oBAAmB,OAAO;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAwB;AACxB;AACA;AACA;AACA;AACA;AACA,oBAAmB,SAAS;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,SAAS;AAC5B,qBAAoB,KAAK;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,SAAS;AAC5B,oBAAmB,OAAO;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA4C,OAAO;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA4C,OAAO;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAuC,4CAA4C;AACnF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6DAA4D;AAC5D,6DAA4D;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAiC;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA4C,OAAO;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA4C,OAAO;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA4C,OAAO;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6CAA4C,OAAO;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK,gCAAgC;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAsC,gBAAgB;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAAyC,mBAAmB;AAC5D,sEAAqE,YAAY,EAAE;AACnF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAAyC,mBAAmB;AAC5D;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,OAAO;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL,EAAC,oBAAoB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA,EAAC;;AAED,EAAC,GAAG,EAAE,GAAG;AACT,EAAC,E;;;;;;;;;;;;;;;;;;;;;;;2CCnsOgB,0BAAkB;;;;uDACN,sCAA8B;;;;wCACnC,wBAAgB;;;;8DACX,8CAAsC;;;;uCAC5C,sBAAc;;;;yCACZ,wBAAgB;;;;AAEzC,UAAS,kBAAkB,CAAC,IAAI,EAAE;AAC9B,SAAI,GAAG,IAAI,CAAC,OAAO,CAAC,MAAM,EAAE,KAAK,CAAC,CAAC,OAAO,CAAC,MAAM,EAAE,KAAK,CAAC,CAAC;AAC1D,SAAI,KAAK,GAAG,IAAI,MAAM,CAAC,QAAQ,GAAG,IAAI,GAAG,WAAW,CAAC,CAAC;AACtD,SAAI,OAAO,GAAG,KAAK,CAAC,IAAI,CAAC,QAAQ,CAAC,MAAM,CAAC,CAAC;AAC1C,YAAO,OAAO,KAAK,IAAI,GAAG,EAAE,GAAG,kBAAkB,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,KAAK,EAAE,GAAG,CAAC,CAAC,CAAC;EACrF;;KAEK,SAAS;AACA,cADT,SAAS,CACC,OAAO,EAAE;+BADnB,SAAS;;AAEP,oCAFF,SAAS,6CAED,OAAO,EAAE;;AAEf,aAAI,CAAC,gBAAgB,GAAG,mDAAqB;AACzC,uBAAU,EAAE,EAAE;AACd,2BAAc,EAAE,+CAAiB,QAAQ,CAAC,GAAG;AAC7C,mBAAM,EAAE;AACJ,kCAAiB,EAAE;AACf,wCAAmB,EAAE,IAAI;kBAC5B;cACJ;UACJ,CAAC,CAAC;;AAEH,aAAI,CAAC,MAAM,GAAG,6BAAgB,CAAC;AAC/B,aAAI,CAAC,QAAQ,GAAG,+BAAkB,CAAC;;AAEnC,aAAI,CAAC,gBAAgB,CAAC,QAAQ,CAAC,CAC3B,EAAC,OAAO,EAAE,eAAe,EAAE,IAAI,EAAE,IAAI,CAAC,MAAM,EAAC,EAC7C,EAAC,OAAO,EAAE,UAAU,EAAE,IAAI,EAAE,IAAI,CAAC,QAAQ,EAAC,CAC7C,CAAC,CAAC;;AAEH,aAAI,CAAC,MAAM,GAAG,4CAAqB;AAC/B,mBAAM,EAAE,2GAGN;AACF,uBAAU,EAAE;AACR,wBAAO,EAAE,QAAQ,CAAC,kBAAkB,CAAC,UAAU,CAAC,IAAI,GAAG,CAAC,GAAG,IAAI,CAAC,gBAAgB,GAAG,IAAI,CAAC,MAAM;cACjG;UACJ,CAAC,CAAC;;AAEH,aAAI,CAAC,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;MACzB;;eAjCC,SAAS;;YAAT,SAAS;;;sBAoCP,SAAS;;;;;;;;;;AClDjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,0BAA0B;AACzC,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA,0BAAyB,uCAAuC;AAChE;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb,UAAS;AACT;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,0BAA0B;AACzC,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,WAAU,4CAA4C;AACtD,WAAU,oCAAoC;AAC9C,WAAU;AACV,WAAU;AACV;AACA;AACA;AACA,gBAAe,MAAM;AACrB,iBAAgB,iBAAiB;AACjC;AACA;AACA;AACA;AACA,wBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,MAAM;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;AClPD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,uB;;;;;;;;;AC1CA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,OAAO,qDAAqD,uCAAuC;AAClH,gBAAe,SAAS;AACxB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,SAAS;AACxB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,SAAS;AACxB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,KAAK;AACpB,gBAAe,MAAM;AACrB;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAwB;AACxB,cAAa;AACb;AACA,yBAAwB;AACxB,cAAa;AACb;AACA,yBAAwB;AACxB,cAAa;AACb;AACA,yBAAwB;AACxB;AACA,UAAS;AACT;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAwB;AACxB,cAAa;AACb;AACA,yBAAwB;AACxB,cAAa;AACb;AACA,yBAAwB;AACxB,cAAa;AACb;AACA,yBAAwB;AACxB;AACA,UAAS;AACT;;AAEA;AACA,sBAAqB,uCAAuC;AAC5D;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB;AACrB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA,wCAAuC,0BAA0B;AACjE,4CAA2C,+BAA+B;AAC1E;AACA;AACA;AACA;AACA,sCAAqC;AACrC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB;AACrB;AACA;AACA,sBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,mBAAmB;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+DAA8D,WAAW;AACzE;AACA;;AAEA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB;AACrB,kBAAiB;AACjB,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,+BAA+B;AACtD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,+BAA+B;AACtD;AACA,4BAA2B,4CAA4C;AACvE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,wBAAuB,4BAA4B;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B,qCAAqC;AACpE;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA,cAAa;AACb;AACA;AACA,yDAAwD;AACxD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B,4BAA4B;AAC3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAiC,+EAA+E;AAChH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,wBAAuB,yCAAyC;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,WAAW;AAC1B,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,SAAS;AACxB,gBAAe,QAAQ;AACvB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,SAAS;AACxB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,SAAS;AACxB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,MAAM;AACrB,gBAAe,SAAS;AACxB,iBAAgB,oBAAoB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,SAAS;AACxB,gBAAe,SAAS;AACxB,iBAAgB,oBAAoB;AACpC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,QAAQ;AACvB,gBAAe,OAAO;AACtB,iBAAgB,oBAAoB;AACpC;AACA;AACA;AACA,wBAAuB,4BAA4B;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,SAAS;AACxB,iBAAgB,oBAAoB;AACpC;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;;AAEb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;;AAEb;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,WAAW;AAC3B;AACA;AACA,wBAAuB,4BAA4B;AACnD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,aAAa;AAC7B;AACA;AACA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;ACj5BD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gC;;;;;;;;;ACzJA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2B;;;;;;;;;AC3PA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0C;;;;;;;;;AC3HA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC;AACD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,G;;;;;;;;;AClGA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,UAAS;AACT;AACA,UAAS;AACT;AACA,UAAS;AACT;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,yB;;;;;;;;;ACrKA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,KAAI;AACJ;AACA;AACA;AACA;AACA;AACA,qBAAoB;AACpB;AACA;AACA;AACA,KAAI;AACJ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,aAAa;AAC5B,gBAAe,OAAO;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB;AACjB;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,gBAAe,OAAO;AACtB,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe,MAAM;AACrB,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,kBAAkB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,MAAM;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,iBAAgB,KAAK;AACrB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gBAAe,OAAO;AACtB,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,OAAO;AACvB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,iBAAgB,MAAM;AACtB;AACA;AACA;AACA;;AAEA;AACA,EAAC;;;;;;;;;;ACtUD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,OAAM;AACN;AACA,iCAAgC,aAAa,0BAA0B;AACvE;AACA,uBAAsB,iBAAiB;AACvC,uBAAsB,iBAAiB;AACvC,uBAAsB,mBAAmB;AACzC;AACA;AACA,uBAAsB,aAAa,yBAAyB;AAC5D,uBAAsB,aAAa,yBAAyB;AAC5D;AACA;AACA,uBAAsB,cAAc,gCAAgC;AACpE;AACA;AACA,KAAI;AACJ;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,kBAAkB;;AAEzC;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,EAAC;;;;;;;;;;;;;;;;;;;;;;;ACpLD,KAAI,UAAU,GAAG,mBAAO,CAAC,oBAAY,CAAC,CAAC;;AAEvC,UAAS,WAAW,CAAC,IAAI,EAAE,OAAO,EAAE;AAChC,SAAI,CAAC,UAAU,CAAC,OAAO,CAAC,CAAC;EAC5B;;AAED,UAAS,mBAAmB,CAAC,OAAO,EAAE,IAAI,EAAE,MAAM,EAAE;AAChD,UAAK,IAAI,GAAG,IAAI,MAAM,EAAE;AACpB,aAAI,OAAO,GAAG,IAAI,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC;AACjC,aAAI,OAAO,EAAE;AACT,oBAAO,CAAC,cAAc,GAAI,MAAM,CAAC,GAAG,CAAC,KAAK,IAAI,GAAI,OAAO,CAAC,WAAW,CAAC,GAAG,EAAE,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,GAAG,MAAM,CAAC,GAAG,CAAC,CAAC;UAC7G;MACJ;EACJ;;AAED,UAAS,oBAAoB,CAAC,OAAO,EAAE,IAAI,EAAE,OAAO,EAAE;AAClD,UAAK,IAAI,GAAG,IAAI,OAAO,EAAE;AACrB,aAAI,OAAO,GAAG,IAAI,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC;AACjC,aAAI,OAAO,EAAE;AACT,oBAAO,CAAC,eAAe,GAAI,OAAO,CAAC,GAAG,CAAC,KAAK,IAAI,GAAI,OAAO,CAAC,WAAW,CAAC,GAAG,EAAE,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,GAAG,OAAO,CAAC,GAAG,CAAC,CAAC;UAChH;MACJ;EACJ;;AAED,UAAS,gBAAgB,CAAC,OAAO,EAAE,IAAI,EAAE,EAAE,EAAE;AACzC,SAAI,IAAI,GAAG,CACL,EAAE,CAAC,KAAK,KAAK,SAAS,IAAM,EAAE,CAAC,KAAK,KAAK,IAAK,GAAI,EAAE,CAAC,KAAK,GAAG,IAAI,CAAC,GAAG,CAAC,IAAI,CAAC,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,WAAW,CAAC,IAAI,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC,EAC1J,EAAE,CAAC,MAAM,KAAK,SAAS,IAAM,EAAE,CAAC,MAAM,KAAK,IAAK,GAAI,EAAE,CAAC,MAAM,GAAG,IAAI,CAAC,GAAG,CAAC,IAAI,CAAC,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,YAAY,CAAC,IAAI,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,YAAY,CAAC,IAAI,CAAC,CAAC,CACpK,CAAC;AACF,SAAK,EAAE,CAAC,KAAK,KAAK,IAAI,IAAM,EAAE,CAAC,MAAM,KAAK,IAAK,EAAE;AAC7C,aAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,YAAY,CAAC;AAC5B,aAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,aAAa,CAAC;MAChC,MACI,IAAI,EAAE,CAAC,KAAK,KAAK,IAAI,EAAE;AACxB,aAAI,CAAC,OAAO,CAAC,SAAS,EAAE,IAAI,CAAC,CAAC,CAAC,CAAC,CAAC;AACjC,aAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,YAAY,CAAC;;MAE/B,MACI,IAAI,EAAE,CAAC,MAAM,KAAK,IAAI,EAAE;AACzB,aAAI,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,SAAS,CAAC,CAAC;AACjC,aAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,aAAa,CAAC;;MAEhC,MACI;AACD,aAAI,GAAG,EAAE,CAAC,cAAc,CAAC,GAAG,CACxB,IAAI,CAAC,GAAG,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,IAAI,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,cAAc,CAAC,CAAC,EAC/C,IAAI,CAAC,GAAG,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,IAAI,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,cAAc,CAAC,CAAC,CAClD,GAAG,IAAI,CAAC;AACT,aAAI,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,IAAI,CAAC,CAAC,CAAC,CAAC,CAAC;MAClC;AACD,YAAO,IAAI,CAAC;EACf;;AAED,UAAS,WAAW,CAAC,YAAY,EAAE,WAAW,EAAE;AAC5C,SAAI,IAAI,GAAG,IAAI,UAAU,CAAC,IAAI,CAAC,WAAW,CAAC,CAAC;AAC5C,SAAI;AACA,aAAI,WAAW,GAAG,UAAU,CAAC,YAAY,CAAC,KAAK,CAAC,YAAY,EAAE,EAAC,QAAQ,EAAE,IAAI,EAAE,MAAM,EAAE,KAAK,EAAC,CAAC,CAAC;AAC/F,aAAI,QAAQ,GAAG,UAAU,CAAC,YAAY,CAAC,aAAa,GAAG,UAAU,CAAC,YAAY,CAAC,aAAa,CAAC,YAAY,CAAC,GAAG,EAAE,CAAC;AAChH,aAAI,CAAC,cAAc,CAAC,WAAW,CAAC,CAAC;AACjC,aAAI,YAAY,GAAG,EAAE,CAAC;AACtB,gBAAO,UAAS,OAAO,EAAE,OAAO,EAAE;AAC9B,oBAAO,GAAG,OAAO,IAAI,YAAY,CAAC;AAClC,iBAAI,GAAG,CAAC;AACR,iBAAI,OAAO,CAAC;AACZ,iBAAI,CAAC,CAAC;AACN,iBAAI,CAAC,CAAC;AACN,iBAAI,MAAM,GAAG,OAAO,CAAC,MAAM,IAAI,CAAC,CAAC;AACjC,iBAAI,OAAO,CAAC,OAAO,IAAI,QAAQ,CAAC,OAAO,EAAE;AACrC,4BAAW,CAAC,IAAI,EAAE,OAAO,CAAC,OAAO,IAAI,QAAQ,CAAC,OAAO,CAAC,CAAC;cAC1D;AACD,iBAAI,OAAO,CAAC,MAAM,IAAI,QAAQ,CAAC,MAAM,EAAE;AACnC,oCAAmB,CAAC,OAAO,EAAE,IAAI,EAAE,OAAO,CAAC,MAAM,IAAI,QAAQ,CAAC,MAAM,CAAC,CAAC;cACzE;AACD,iBAAI,OAAO,CAAC,OAAO,IAAI,QAAQ,CAAC,OAAO,EAAE;AACrC,qCAAoB,CAAC,OAAO,EAAE,IAAI,EAAE,OAAO,CAAC,OAAO,IAAI,QAAQ,CAAC,OAAO,CAAC,CAAC;cAC5E;AACD,iBAAI,OAAO,CAAC,QAAQ,IAAI,QAAQ,CAAC,QAAQ,EAAE;AACvC,qBAAI,IAAI,GAAG,gBAAgB,CAAC,OAAO,EAAE,IAAI,EAAE,OAAO,CAAC,QAAQ,IAAI,QAAQ,CAAC,QAAQ,CAAC,CAAC;AAClF,kBAAC,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,CAAC,CAAC,IAAI,CAAC,CAAC;AACpC,kBAAC,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,GAAG,IAAI,CAAC,CAAC,CAAC,IAAI,CAAC,CAAC;cACvC,MACI;AACD,qBAAI,CAAC,OAAO,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,CAAC;AAC/C,kBAAC,GAAG,CAAC,CAAC;AACN,kBAAC,GAAG,CAAC,CAAC;cACT;AACD,kBAAK,GAAG,IAAI,IAAI,CAAC,QAAQ,EAAE;AACvB,wBAAO,GAAG,IAAI,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC;AAC7B,qBAAK,GAAG,CAAC,OAAO,CAAC,GAAG,CAAC,KAAK,CAAC,IAAM,OAAO,CAAC,IAAI,KAAK,OAAQ,EAAE;AACxD,4BAAO,CAAC,GAAG,CAAC,OAAO,CAAC,IAAI,EAAE;AACtB,6BAAI,EAAE,CAAC,OAAO,CAAC,KAAK,EAAE,OAAO,CAAC,MAAM,CAAC;AACrC,kCAAS,EAAE,CAAC,CAAC,GAAG,OAAO,CAAC,IAAI,EAAE,CAAC,GAAG,OAAO,CAAC,GAAG,EAAE,MAAM,GAAI,OAAO,CAAC,MAAM,GAAG,CAAE,CAAC;sBAChF,CAAC,CAAC;kBACN;cACJ;UACJ,CAAC;MACL,CACD,OAAO,GAAG,EAAE;AACR,gBAAO,CAAC,GAAG,CAAC,GAAG,CAAC,CAAC;MACpB;EACJ;;AAED,OAAM,CAAC,OAAO,GAAG,WAAW,C;;;;;;;;;;;;;;;;;;;;;;;;;2CCjHX,0BAAkB;;;;uDACN,sCAA8B;;;;wCACnC,wBAAgB;;;;8CACpB,6BAAqB;;;;uCAClB,oBAAY;;;;uCACf,yBAAiB;;;;;;AAErC,UAAS,kBAAkB,CAAC,IAAI,EAAE;AAC9B,SAAI,GAAG,IAAI,CAAC,OAAO,CAAC,MAAM,EAAE,KAAK,CAAC,CAAC,OAAO,CAAC,MAAM,EAAE,KAAK,CAAC,CAAC;AAC1D,SAAI,KAAK,GAAG,IAAI,MAAM,CAAC,QAAQ,GAAG,IAAI,GAAG,WAAW,CAAC,CAAC;AACtD,SAAI,OAAO,GAAG,KAAK,CAAC,IAAI,CAAC,QAAQ,CAAC,MAAM,CAAC,CAAC;AAC1C,YAAO,OAAO,KAAK,IAAI,GAAG,EAAE,GAAG,kBAAkB,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,KAAK,EAAE,GAAG,CAAC,CAAC,CAAC;EACrF;;AAED,KAAI,GAAG,GAAG,kBAAkB,CAAC,KAAK,CAAC,CAAC;AACpC,KAAI,GAAG,KAAK,SAAS,EAAE;AACnB,QAAG,uKAIyC,CAAC;EAChD;AACD,KAAI,GAAG,KAAK,OAAO,EAAE;AACjB,QAAG,8HAEmB,CAAC;EAC1B;AACD,KAAI,GAAG,KAAK,KAAK,EAAE;AACf,QAAG,uMAIG,CAAC;EACV;AACD,IAAG,GAAG,GAAG,qEAEM,CAAC;;KAEV,UAAU;AACD,cADT,UAAU,CACA,OAAO,EAAE;;;+BADnB,UAAU;;AAER,oCAFF,UAAU,6CAEF,OAAO,EAAE;;AAEf,aAAI,CAAC,GAAG,GAAG,QAAQ,CAAC,aAAa,CAAC,KAAK,CAAC,CAAC;AACzC,aAAI,CAAC,OAAO,GAAG,mCAAY;AACvB,oBAAO,EAAE,IAAI,CAAC,GAAG;AACjB,oBAAO,EAAE,CAAC,QAAQ,CAAC;UACtB,CAAC,CAAC;AACH,aAAI,CAAC,OAAO,CAAC,EAAE,CAAC,QAAQ,EAAE,YAAM;AAC5B,iBAAI,CAAC,MAAK,MAAM,EAAE;AACd,uBAAK,MAAM,GAAG,4BAAe,MAAK,GAAG,EAAE;AACnC,gCAAW,EAAE,IAAI;AACjB,0BAAK,EAAE,KAAK;kBACf,CAAC,CAAC;AACH,uBAAK,MAAM,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC;AAC1B,uBAAK,MAAM,CAAC,EAAE,CAAC,QAAQ,EAAE,MAAK,SAAS,CAAC,IAAI,OAAM,CAAC,CAAC;cACvD;UACJ,CAAC,CAAC;;AAEH,aAAI,CAAC,MAAM,GAAG,4CAAqB;AAC/B,mBAAM,EAAE,2GAGN;AACF,uBAAU,EAAE;AACR,wBAAO,EAAE,IAAI,CAAC,OAAO;cACxB;UACJ,CAAC,CAAC;AACH,aAAI,CAAC,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;MACzB;;eA9BC,UAAU;;kBAAV,UAAU;;gBAgCH,qBAAG;AACR,iBAAI,GAAG,GAAG,IAAI,CAAC,MAAM,CAAC,QAAQ,EAAE,CAAC;AACjC,iBAAI,GAAG,KAAK,IAAI,CAAC,IAAI,EAAE;AACnB,qBAAI,CAAC,IAAI,GAAG,GAAG,CAAC;AAChB,qBAAI,CAAC,YAAY,CAAC,IAAI,CAAC,QAAQ,CAAC,CAAC;cACpC;UACJ;;;cAEe,YAAG;AACf,oBAAO,IAAI,CAAC,MAAM,GAAG,IAAI,CAAC,MAAM,CAAC,QAAQ,EAAE,GAAG,GAAG,CAAC;UACrD;;;YA1CC,UAAU;;;sBA6CR,UAAU;;;;;;;;;;ACnFlB;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC;AACD;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA,uCAAsC,GAAG;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,gDAA+C,gBAAgB,eAAe;AAC9E;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,uDAAsD,8BAA8B,EAAE;;AAEtF;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAgE;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAgD;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAgE,+BAA+B,YAAY;AAC3G;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,gCAA+B,6BAA6B,mCAAmC;AAC/F;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,2BAA0B,sBAAsB;AAChD;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,wCAAuC,yBAAyB;AAChE;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,2BAA0B,uBAAuB;AACjD;;AAEA;AACA;AACA;AACA;AACA;AACA,oBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,+EAA8E;AAC9E,iBAAgB;;AAEhB;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA,eAAc;AACd,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;;AAEA;AACA,yBAAwB,SAAS,qBAAqB,EAAE;AACxD,iCAAgC;AAChC,gCAA+B;AAC/B;AACA,IAAG;;AAEH,gCAA+B;;AAE/B;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,sDAAqD,0BAA0B,EAAE;AACjF,QAAO;AACP;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,mFAAmF;AACtG;AACA;AACA;AACA,wCAAuC;AACvC;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,qBAAoB,OAAO,SAAS,OAAO,UAAU;AACrD;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA,aAAY;AACZ;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA;AACA,iCAAgC,kBAAkB;AAClD;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,oBAAmB,wBAAwB;AAC3C;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA,4BAA2B;AAC3B;AACA;AACA;AACA,uBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,yDAAwD;AACxD;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,oBAAmB,yBAAyB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sCAAqC,qBAAqB;AAC1D;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,sCAAqC,yBAAyB;AAC9D;AACA;;AAEA;AACA;AACA;AACA,kCAAiC;AACjC;AACA,8CAA6C,GAAG;AAChD;AACA;AACA;AACA,aAAY;AACZ;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA,QAAO,oEAAoE;AAC3E;AACA;AACA,QAAO,OAAO;AACd;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,6BAA6B;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,aAAY,iEAAiE,4BAA4B;AACzG,MAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAiD;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0EAAyE;AACzE;AACA,mCAAkC,+BAA+B;AACjE;AACA;AACA;AACA,gEAA+D;AAC/D;AACA;AACA;;AAEA;AACA;AACA,oDAAmD,MAAM;AACzD;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,uCAAsC,0BAA0B;AAChE;AACA;;AAEA;AACA;AACA;AACA,uCAAsC,eAAe;AACrD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,sBAAqB;AACrB;;AAEA;AACA;AACA,iDAAgD,uCAAuC;;AAEvF,wBAAuB;AACvB,0BAAyB,8BAA8B;AACvD,0BAAyB,8BAA8B;;AAEvD;;AAEA;AACA,6BAA4B,0BAA0B,aAAa;AACnE;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAiD,YAAY,EAAE;AAC/D;;AAEA;AACA,wCAAuC,QAAQ;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA,wCAAuC,QAAQ;AAC/C;AACA;AACA;AACA;AACA;AACA,wBAAuB,+BAA+B;AACtD;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,oBAAmB,8BAA8B;AACjD;AACA,wBAAuB;AACvB;AACA;AACA;AACA,aAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,8DAA6D,YAAY,YAAY,aAAa;AAClG,wDAAuD,oBAAoB,YAAY,aAAa;AACpG;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB;AACpB;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA,QAAO;;AAEP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;;AAEP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA,UAAS;AACT;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;;AAEP;AACA;AACA;AACA,QAAO;;AAEP;AACA;AACA;AACA;AACA,0DAAyD,kCAAkC;AAC3F;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA,MAAK;;AAEL,2BAA0B,sBAAsB,EAAE;;AAElD,gCAA+B,cAAc,EAAE;;AAE/C;AACA;AACA,cAAa,uBAAuB;AACpC,qBAAoB;AACpB;AACA,MAAK;;AAEL,uBAAsB,sBAAsB,EAAE;;AAE9C;AACA;AACA,MAAK;;AAEL,gCAA+B,iBAAiB,EAAE;;AAElD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAkC,cAAc;AAChD,eAAc,0BAA0B;AACxC;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,+BAA8B,cAAc,oCAAoC;AAChF;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,+CAA8C,kCAAkC;AAChF;AACA,QAAO;AACP;AACA,MAAK;;AAEL;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,kCAAiC;;AAEjC;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,2CAA0C,aAAa,cAAc;AACrE,aAAY,iCAAiC,eAAe;AAC5D;AACA,WAAU,eAAe,iBAAiB,eAAe,kBAAkB,cAAc,0BAA0B;AACnH,mDAAkD;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+BAA8B;AAC9B;AACA;AACA,iCAAgC;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA,MAAK;;AAEL;;AAEA;AACA,IAAG;;AAEH;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;;AAEP;AACA;AACA,4BAA2B;AAC3B;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT,QAAO;;AAEP;AACA;AACA,QAAO;;AAEP;AACA;AACA;AACA,yCAAwC,eAAe;AACvD,QAAO;;AAEP;AACA;AACA;AACA;AACA,UAAS;AACT;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,kBAAiB;AACjB,QAAO,iBAAiB;AACxB;AACA;AACA,gBAAe;AACf;;AAEA,YAAW,iEAAiE;AAC5E,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA,0CAAyC,wCAAwC,EAAE;AACnF,QAAO;AACP,MAAK;;AAEL;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,4CAA2C;AAC3C,0CAAyC;AACzC,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,MAAK;AACL,uBAAsB,iBAAiB,EAAE;AACzC,2BAA0B,iBAAiB,EAAE;;AAE7C,gCAA+B,aAAa,EAAE;;AAE9C;AACA;AACA;AACA;AACA;AACA,sCAAqC,wCAAwC,EAAE;;AAE/E;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA,MAAK;;AAEL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;AACA;AACA,4CAA2C,eAAe,eAAe,UAAU;AACnF,6CAA4C,iBAAiB,iBAAiB,YAAY;AAC1F;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,MAAK;;AAEL;AACA;;AAEA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,8BAA6B,yBAAyB,YAAY;;AAElE;AACA;AACA;AACA;AACA;AACA,mBAAkB;AAClB,MAAK;AACL,6BAA4B;AAC5B;AACA;AACA;AACA;AACA,oBAAmB,4BAA4B;AAC/C;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,uBAAsB,8BAA8B;AACpD;AACA,wBAAuB,gBAAgB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,oGAAmG,OAAO;AAC1G;AACA;AACA;AACA;AACA;AACA;AACA,8DAA6D,QAAQ;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,mCAAkC,0BAA0B,wBAAwB,GAAG;AACvF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,4BAA4B;AACnD;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;;AAEA,6BAA4B;;AAE5B;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,0BAAyB,oCAAoC,EAAE;AAC/D;AACA;AACA;AACA,sBAAqB,wBAAwB;AAC7C;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,gCAA+B,wBAAwB;AACvD;AACA;AACA,MAAK;AACL;AACA,sBAAqB,wBAAwB;AAC7C;AACA;AACA,MAAK;AACL;AACA;AACA,sBAAqB,wBAAwB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,0BAAyB;AACzB;;AAEA;AACA,uBAAsB,uCAAuC,EAAE;AAC/D,qBAAoB,uCAAuC,EAAE;AAC7D;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,iCAAgC,gCAAgC,EAAE;AAClE;AACA,oBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,8BAA6B;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B;AAC3B;AACA,8BAA6B,kBAAkB;AAC/C;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,8BAA6B,2BAA2B;AACxD;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,mBAAmB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,oBAAmB;AACnB;AACA;AACA,wBAAuB,6BAA6B;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAsB,IAAI;AAC1B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gBAAe;AACf;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B,cAAc;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA,oBAAmB,2BAA2B;AAC9C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,wFAAuF;AACvF,oCAAmC,oBAAoB;AACvD,oCAAmC;AACnC;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA,8BAA6B,mBAAmB,oBAAoB,gBAAgB;AACpF;AACA;AACA;AACA;AACA,8CAA6C;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,eAAc;AACd;;AAEA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,iDAAgD;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,mCAAmC;AAC1D;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,sBAAqB,yBAAyB;AAC9C;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAwB,cAAc;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;;AAEA,iCAAgC;AAChC,kCAAiC;AACjC;AACA;AACA;AACA;AACA,iBAAgB;AAChB;AACA;AACA;;AAEA,2BAA0B,gDAAgD;AAC1E;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,sBAAsB;AAC7C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,eAAc;AACd,oBAAmB,0BAA0B;AAC7C;AACA,iBAAgB;AAChB,oBAAmB,0BAA0B;AAC7C;AACA,iBAAgB;AAChB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,aAAY,yBAAyB;AACrC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ;AACA;AACA;;AAEA,mBAAkB;;AAElB;AACA;AACA;AACA;AACA,oBAAmB,gBAAgB;AACnC;AACA;AACA,mBAAkB;AAClB;AACA,QAAO;AACP;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ;;AAEA;AACA;AACA;;AAEA;AACA,8BAA6B;AAC7B,sBAAqB,OAAO,OAAO;AACnC;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK,OAAO;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAgB;AAChB;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,wBAAwB;AAC3C;AACA;AACA,mBAAkB;AAClB;AACA;AACA;AACA,iDAAgD,oBAAoB,uBAAuB;;AAE3F;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ;AACA;;AAEA;AACA;AACA;AACA;AACA,yCAAwC,0BAA0B;AAClE;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,4BAA4B;AAC/C;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA,2BAA0B,qFAAqF;AAC/G,2BAA0B,oFAAoF;;AAE9G,kBAAiB,yBAAyB;AAC1C;AACA;AACA;AACA;AACA,yCAAwC,4BAA4B;AACpE;AACA,wBAAuB;AACvB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAwB;AACxB;AACA,sBAAqB;AACrB;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;;AAEA;AACA,aAAY;AACZ;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,mCAAkC;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,UAAU;AACjC;AACA;AACA,yBAAwB,YAAY,eAAe,wCAAwC;AAC3F,aAAY,cAAc,iBAAiB,yBAAyB;AACpE;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB,QAAQ;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,aAAY,sBAAsB;AAClC;AACA,sBAAqB,sBAAsB;AAC3C;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;;AAEA,UAAS,4BAA4B;AACrC;AACA;AACA,sBAAqB,sBAAsB;AAC3C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,gBAAgB;AACnC;AACA,oBAAmB,gBAAgB;AACnC;AACA,oBAAmB,gBAAgB;AACnC;AACA,oBAAmB,gBAAgB;AACnC;AACA,oBAAmB,gBAAgB;AACnC;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,+CAA8C,0CAA0C;AACxF;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gCAA+B,mBAAmB;AAClD;AACA,kCAAiC,qBAAqB;AACtD;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,UAAS,YAAY;AACrB,cAAa,kBAAkB;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,+BAA+B;AAC1C,gBAAe,kBAAkB;AACjC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,iCAAiC;AAC5C,gBAAe,oBAAoB;AACnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW,iCAAiC;AAC5C,gBAAe,kBAAkB;AACjC;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,yBAAwB,UAAU;AAClC;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;;AAEA,kCAAiC;AACjC;AACA;AACA,MAAK,mCAAmC;AACxC;AACA;AACA,QAAO;AACP;AACA;AACA;AACA,MAAK,6DAA6D;AAClE;AACA,MAAK,qCAAqC;AAC1C;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA,MAAK,iCAAiC;AACtC;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA,MAAK,OAAO;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd,6CAA4C,WAAW;AACvD;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA,oBAAmB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,iBAAiB;AACpC;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA,+CAA8C,8CAA8C,EAAE;AAC9F;AACA;AACA;AACA,wEAAuE,sBAAsB;;AAE7F;AACA,qCAAoC;AACpC;AACA;AACA,gDAA+C,sBAAsB;AACrE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA,8CAA6C,sBAAsB;AACnE,kDAAiD,sBAAsB;;AAEvE;AACA,yCAAwC,gDAAgD,EAAE;;AAE1F;AACA,4BAA2B,uCAAuC;AAClE,0BAAyB,oBAAoB;AAC7C;AACA;;AAEA;AACA,mCAAkC,qBAAqB,EAAE;AACzD;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,8BAA6B,sBAAsB;AACnD;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,UAAS,4BAA4B,2BAA2B;AAChE,gBAAe,aAAa;AAC5B;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,+BAA8B,mCAAmC;AACjE;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8BAA6B,uBAAuB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,MAAK;AACL;AACA,0BAAyB;AACzB,MAAK;AACL;AACA,oBAAmB;AACnB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAiC,sBAAsB,wBAAwB;AAC/E;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;;AAEA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,qBAAoB,gCAAgC;AACpD,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,0BAAyB;AACzB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAsB,gCAAgC;AACtD;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+CAA8C,oCAAoC;AAClF,QAAO;AACP;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,UAAS,oCAAoC;AAC7C,eAAc,cAAc;AAC5B;AACA;;AAEA;AACA;;AAEA;AACA;;AAEA,oBAAmB,+BAA+B;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA0B;AAC1B;AACA;AACA;AACA,UAAS;AACT;AACA;AACA,sBAAqB,OAAO;AAC5B,MAAK,OAAO;AACZ;AACA;AACA;AACA;AACA,gCAA+B,0BAA0B;AACzD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAuC,qBAAqB;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,wEAAuE,WAAW,QAAQ;AAC1F;;AAEA;;AAEA;AACA;AACA;AACA,yDAAwD,SAAS,QAAQ;AACzE,iCAAgC;AAChC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA,0CAAyC,SAAS;AAClD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,aAAY;AACZ;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,2DAA0D,eAAe;AACzE,wBAAuB,iBAAiB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,kCAAiC;AACjC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B,sBAAsB;AACrD;;AAEA;AACA;AACA,iDAAgD;AAChD,8BAA6B;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT,QAAO;AACP,+BAA8B;AAC9B;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;;AAEA;AACA,oBAAmB,6BAA6B;AAChD;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,+DAA8D,qCAAqC;AACnG;AACA;AACA;AACA,eAAc;AACd,MAAK;AACL,oDAAmD,+BAA+B,EAAE;AACpF;AACA;;AAEA;AACA;AACA;AACA,qCAAoC,qCAAqC,EAAE;AAC3E;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,+CAA8C,sBAAsB,qBAAqB;AACzF;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4CAA2C,8BAA8B,EAAE,MAAM;AACjF;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,iDAAiD;AAC5E;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA,oBAAmB,2BAA2B;AAC9C;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,oBAAmB,oBAAoB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA0B,sBAAsB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,aAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,qCAAoC,QAAQ;AAC5C,+BAA8B,mEAAmE;AACjG,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA,oBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;;AAEA,YAAW;AACX;AACA;AACA;AACA;AACA,qCAAoC,iBAAiB;AACrD;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,gBAAe,kDAAkD;AACjE;;AAEA;;AAEA,2CAA0C,QAAQ;AAClD;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,gDAA+C,yCAAyC;AACxF;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,mDAAkD,cAAc;AAChE;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,iBAAgB;AAChB;AACA;AACA;AACA;AACA,iBAAgB;AAChB;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;;AAEA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,6BAA4B,cAAc,WAAW,YAAY;AACjE;AACA,sBAAqB,+CAA+C;AACpE;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,uEAAsE;AACtE,6FAA4F;AAC5F,mGAAkG;AAClG,8CAA6C,YAAY;AACzD;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,wBAAuB,WAAW;AAClC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA4B;AAC5B;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,MAAK;AACL;AACA,MAAK;AACL;AACA;AACA;;AAEA;AACA;AACA,sDAAqD,GAAG,OAAO,eAAe;AAC9E;;AAEA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,sBAAqB,2BAA2B;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,mBAAmB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oCAAmC,QAAQ;AAC3C;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT,QAAO;AACP;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,8BAA6B;AAC7B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,yBAAwB,QAAQ;AAChC;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,YAAW;AACX;AACA;AACA,gDAA+C,uBAAuB,OAAO;AAC7E;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA,uBAAsB,eAAe,6BAA6B;;AAElE;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL,kCAAiC,6BAA6B;AAC9D,yBAAwB,iBAAiB;;AAEzC;AACA;AACA,MAAK;AACL;AACA;AACA,sBAAqB,iBAAiB;AACtC;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,iCAAgC,8DAA8D;AAC9F;AACA;AACA,MAAK;AACL;AACA;AACA,sBAAqB,qBAAqB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,sBAAqB,mBAAmB;AACxC;AACA;AACA;AACA;AACA;AACA,8BAA6B,SAAS;AACtC;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA,mBAAkB;AAClB;AACA;AACA;AACA,eAAc,4BAA4B,OAAO;AACjD;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,wBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA,QAAO;AACP;AACA,QAAO;AACP;AACA;AACA,sBAAqB,yBAAyB;AAC9C;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,MAAK;;AAEL;AACA,uCAAsC,qBAAqB;AAC3D;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,gCAA+B,aAAa,YAAY;AACxD;AACA,QAAO;AACP;AACA;AACA,8CAA6C,gBAAgB;AAC7D;AACA,MAAK;;AAEL,oCAAmC,iCAAiC,EAAE;AACtE,mCAAkC,gCAAgC,EAAE;;AAEpE;AACA;AACA,qEAAoE;AACpE;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA,eAAc;AACd;AACA;AACA,MAAK;;AAEL,8BAA6B,SAAS,uDAAuD;;AAE7F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA,qEAAoE;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;;AAEA;AACA;AACA;AACA,MAAK;;AAEL,+CAA8C,6BAA6B,EAAE;;AAE7E;AACA;AACA,wBAAuB,UAAU,kBAAkB;AACnD,qDAAoD,YAAY;AAChE;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA4B,4BAA4B,IAAI;AAC5D,UAAS;AACT,MAAK;;AAEL;AACA;AACA,wBAAuB,UAAU,kBAAkB;AACnD,qDAAoD,YAAY;AAChE;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,wCAAuC,2BAA2B;AAClE;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA,oEAAmE;AACnE;AACA;AACA,2BAA0B,+BAA+B;AACzD,kDAAiD;AACjD,2BAA0B;AAC1B;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,MAAK;AACL,2BAA0B,qDAAqD,EAAE;;AAEjF;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,eAAc;AACd;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,kBAAiB;AACjB;AACA,QAAO;AACP,kBAAiB;AACjB,QAAO;AACP,kBAAiB;AACjB;AACA;AACA;;AAEA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAAyC,yBAAyB;AAClE,2CAA0C,qCAAqC,OAAO;AACtF;AACA,QAAO;AACP;AACA;AACA,MAAK;;AAEL,4BAA2B,yBAAyB;;AAEpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL,+BAA8B,sCAAsC;AACpE,mCAAkC,6BAA6B;AAC/D,oCAAmC,8BAA8B;AACjE,kCAAiC;AACjC;AACA;;AAEA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,2CAA0C,uCAAuC;AACjF;;AAEA;AACA,iCAAgC,qBAAqB;;AAErD;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA,IAAG;AACH,iFAAgF,cAAc;AAC9F;AACA;AACA,gFAA+E;AAC/E,IAAG;AACH;AACA;;AAEA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;;AAEA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA,IAAG;AACH,6DAA4D,sBAAsB;AAClF;AACA;AACA;AACA;AACA;AACA,IAAG;AACH;AACA;AACA;AACA,IAAG;AACH;AACA,oDAAmD,gBAAgB;AACnE;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,IAAG;AACH,oDAAmD,oCAAoC;AACvF;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,8CAA6C,gCAAgC;AAC7E;AACA,6CAA4C,cAAc;AAC1D;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA,IAAG;AACH;;AAEA;;AAEA;AACA,oCAAmC;;AAEnC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA,4BAA2B,iBAAiB;AAC5C;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,8CAA6C;AAC7C;AACA;AACA,MAAK;AACL;AACA;AACA,0CAAyC;AACzC,0BAAyB;AACzB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA,aAAY,yBAAyB;AACrC,IAAG;AACH;;AAEA;AACA;AACA;AACA;AACA,uGAAsG;AACtG;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,4CAA2C;;AAE3C;AACA;AACA,4EAA2E;AAC3E;AACA;AACA;AACA;AACA,iCAAgC,4BAA4B;AAC5D;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB;AACpB;;AAEA;;AAEA;AACA;AACA;AACA,8BAA6B,6EAA6E;AAC1G;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,qBAAoB;AACpB;AACA,qBAAoB;AACpB,UAAS;AACT,mBAAkB;AAClB;AACA,QAAO;AACP,MAAK;AACL;AACA;AACA,iBAAgB;AAChB;AACA,QAAO;AACP,MAAK;AACL;AACA;AACA,iBAAgB;AAChB,QAAO;AACP,MAAK;AACL;AACA;AACA;AACA,sCAAqC,kBAAkB;AACvD,iBAAgB;AAChB,QAAO;AACP,MAAK;AACL;AACA;AACA;AACA,uCAAsC,qDAAqD;AAC3F,iBAAgB;AAChB,QAAO;AACP,MAAK;AACL,yBAAwB,WAAW;AACnC,yBAAwB,WAAW;AACnC,kCAAiC,oBAAoB;AACrD,kCAAiC,oBAAoB;AACrD,+BAA8B,4CAA4C;AAC1E,6BAA4B,wCAAwC;AACpE;AACA,8CAA6C,uCAAuC,EAAE;AACtF,8BAA6B,yBAAyB;AACtD,MAAK;AACL;AACA;AACA;AACA,QAAO,GAAG,yBAAyB;AACnC,MAAK;AACL;AACA,8CAA6C,qCAAqC,EAAE;AACpF,8BAA6B,0BAA0B;AACvD,MAAK;AACL;AACA;AACA;AACA,+BAA8B,qDAAqD;AACnF,QAAO;AACP,MAAK;AACL;AACA;AACA;AACA,+BAA8B,kBAAkB;AAChD,QAAO;AACP,MAAK;AACL;AACA;AACA;AACA,kCAAiC,kBAAkB;AACnD;AACA;AACA,QAAO;AACP,MAAK;AACL,6BAA4B,sBAAsB;AAClD,+BAA8B,qBAAqB;AACnD,6BAA4B,sBAAsB;AAClD,+BAA8B,qBAAqB;AACnD,+BAA8B,sBAAsB;AACpD,gCAA+B,qBAAqB;AACpD,iCAAgC,wBAAwB;AACxD,kCAAiC,uBAAuB;AACxD,+BAA8B,sBAAsB;AACpD,iCAAgC,sBAAsB;AACtD,gCAA+B,uBAAuB;AACtD,gCAA+B,qBAAqB;AACpD,kCAAiC,wBAAwB;AACzD,iCAAgC,uBAAuB;AACvD,kCAAiC,wBAAwB;AACzD,iCAAgC,uBAAuB;AACvD,mCAAkC,yBAAyB;AAC3D,kCAAiC,wBAAwB;AACzD,+BAA8B,6BAA6B;AAC3D,+BAA8B,2BAA2B;AACzD,+BAA8B,gCAAgC;AAC9D,8BAA6B,2BAA2B;AACxD;AACA;AACA,sBAAqB,mBAAmB;AACxC;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,wBAAuB,mBAAmB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;AACL;AACA;AACA;AACA,wBAAuB,SAAS;AAChC;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;AACL,oCAAmC;AACnC;;;AAGA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,oBAAmB,sBAAsB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,wBAAwB,UAAU;;AAE7D;AACA,sBAAqB,iBAAiB;AACtC;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,sBAAqB,4BAA4B;AACjD;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,sBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;;AAEA;AACA;AACA,oCAAmC,iBAAiB;AACpD;AACA,+BAA8B;AAC9B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,MAAK;AACL;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,sBAAqB,uCAAuC;AAC5D,sBAAqB,mCAAmC;AACxD,uBAAsB,kDAAkD;AACxE;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,gBAAe,WAAW;AAC1B,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL,4BAA2B,+BAA+B;AAC1D;AACA;AACA,wBAAuB,iBAAiB;AACxC,MAAK;AACL,0BAAyB,eAAe;AACxC;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,oCAAmC;AACnC;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA,MAAK;AACL,yBAAwB,gDAAgD;AACxE;AACA;AACA,YAAW,gBAAgB;AAC3B,gBAAe,qBAAqB;AACpC;AACA;;AAEA;;AAEA;AACA;AACA;AACA,OAAM,iBAAiB;AACvB;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0EAAyE,uBAAuB;AAChG;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,kEAAiE;AACjE,SAAQ;AACR;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,uBAAuB;AAC1C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB;AACpB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,gCAA+B,uCAAuC;;AAEtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,MAAK;;AAEL,0EAAyE,gBAAgB,EAAE;;AAE3F;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B,cAAc;AAC7C;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,oBAAoB;AACvC;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,yBAAyB;AAC5C;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB,uBAAuB;AAC5C;AACA;AACA,MAAK;AACL;AACA;;AAEA;AACA;AACA,uCAAsC,iBAAiB,EAAE;AACzD;;AAEA;AACA,oBAAmB,oBAAoB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,oBAAmB,oBAAoB;AACvC;AACA,mDAAkD,gBAAgB,EAAE;AACpE,sBAAqB,2BAA2B;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA,sBAAqB;AACrB;;AAEA;AACA;AACA,+BAA8B,kBAAkB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uBAAsB,kBAAkB;AACxC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,iCAAgC,gBAAgB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAgC,gBAAgB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,sBAAqB,kBAAkB;AACvC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB,iBAAiB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,wBAAuB,kBAAkB;AACzC;AACA;AACA,sBAAqB,SAAS;AAC9B;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,oBAAmB,gBAAgB;AACnC;AACA;AACA,+BAA8B,uBAAuB;AACrD;AACA,0BAAyB,mBAAmB;AAC5C;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,4CAA2C,6BAA6B;AACxE;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,mBAAkB,mBAAmB;AACrC,oBAAmB,oBAAoB;AACvC;AACA,sBAAqB,kBAAkB;AACvC;AACA;AACA;AACA;AACA,0BAAyB,yBAAyB;AAClD;AACA,0BAAyB,qBAAqB;AAC9C;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA,oBAAmB,kBAAkB;AACrC;AACA;AACA;;AAEA;AACA;AACA,+BAA8B,sCAAsC;AACpE,gCAA+B,sCAAsC;;AAErE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,iCAAgC,gBAAgB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wCAAuC,wCAAwC;AAC/E,sCAAqC,yCAAyC;;AAE9E;AACA;AACA;AACA;AACA;AACA;AACA,6BAA4B,gBAAgB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,iCAAgC,gBAAgB;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wBAAuB,6BAA6B;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,eAAe;AAClC;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA;AACA,6CAA4C;AAC5C;AACA,gFAA+E;AAC/E;AACA,yEAAwE;AACxE;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,uCAAsC,qBAAqB;;AAE3D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA,sBAAqB;AACrB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,oBAAmB,QAAQ;AAC3B;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,eAAc;AACd;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA,oBAAmB,8BAA8B;AACjD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT,iBAAgB,WAAW;AAC3B;AACA;AACA;AACA;AACA,QAAO;AACP;;AAEA,aAAY;AACZ;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,6BAA4B;AAC5B;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB;AACnB;AACA;AACA;;AAEA;AACA,oBAAmB,iDAAiD;AACpE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA,4EAA2E;AAC3E;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,6DAA4D,GAAG;AAC/D;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,oBAAmB,oBAAoB;AACvC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA,wBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,sBAAqB,mBAAmB;AACxC;AACA;AACA;;AAEA;AACA;AACA,YAAW;AACX,+BAA8B;AAC9B;AACA,0BAAyB;AACzB;AACA,wBAAuB,kBAAkB;AACzC;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iEAAgE,2BAA2B;AAC3F;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,6BAA4B,8BAA8B,YAAY;AACtE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,2BAA0B;AAC1B;AACA;AACA;AACA;AACA;AACA,uCAAsC,SAAS;AAC/C;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gCAA+B,kBAAkB;AACjD;AACA;AACA;AACA;AACA;;AAEA;AACA,4BAA2B,0BAA0B,EAAE;AACvD;AACA;AACA,mCAAkC,OAAO;AACzC;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,sBAAqB,kBAAkB;AACvC,MAAK;AACL;AACA;AACA,2BAA0B,QAAQ;AAClC;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,qBAAqB;AACxC;AACA,8BAA6B;AAC7B;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,4BAA2B,kBAAkB,EAAE;AAC/C;AACA;AACA,sBAAqB,0BAA0B;AAC/C;AACA;AACA;AACA;AACA;AACA,0BAAyB,8BAA8B,qBAAqB;AAC5E;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,sBAAqB,0BAA0B;AAC/C,MAAK;AACL;AACA;AACA;AACA,sBAAqB,0BAA0B;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0BAAyB;AACzB;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA,MAAK;AACL;AACA,sBAAqB,0BAA0B;AAC/C;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,sBAAqB,mCAAmC;AACxD;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA,sBAAqB,kBAAkB;AACvC;AACA,MAAK;AACL,8BAA6B,sCAAsC,EAAE;;AAErE;AACA;;AAEA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,yBAAwB;AACxB,gFAA+E;AAC/E;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;;AAEL,8BAA6B,iCAAiC,qBAAqB;;AAEnF,oCAAmC,oDAAoD;AACvF,oCAAmC,qBAAqB;;AAExD;AACA;AACA;AACA,MAAK;;AAEL,4BAA2B,kBAAkB;AAC7C,4BAA2B,mBAAmB;AAC9C,2BAA0B,mCAAmC;;AAE7D,6BAA4B,2BAA2B;;AAEvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL,iCAAgC,wBAAwB,EAAE;AAC1D,oCAAmC,qCAAqC;;AAExE;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;AACL;AACA;AACA,gCAA+B,mBAAmB;AAClD;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA,sBAAqB,mBAAmB;AACxC;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,sBAAqB,mBAAmB;AACxC;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,sBAAqB,4BAA4B;AACjD;AACA;AACA,MAAK;AACL;AACA;AACA,sBAAqB,uBAAuB;AAC5C;AACA,uBAAsB;AACtB;AACA;AACA,uCAAsC,QAAQ;AAC9C;AACA;AACA;AACA,MAAK;AACL,mCAAkC,qCAAqC;AACvE,mCAAkC,qCAAqC;AACvE,4CAA2C,2CAA2C;AACtF,4CAA2C,2CAA2C;;AAEtF,kCAAiC,mBAAmB;AACpD,+BAA8B,oBAAoB;;AAElD;AACA;AACA,sBAAqB,sBAAsB;AAC3C,sBAAqB,wBAAwB;AAC7C,eAAc;AACd,MAAK;AACL,+BAA8B,wDAAwD;;AAEtF;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA,MAAK;;AAEL;AACA,eAAc;AACd;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;;AAEL;AACA;AACA,MAAK;AACL,yCAAwC,gBAAgB,EAAE;;AAE1D;AACA;AACA,MAAK;AACL;AACA,uBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA,iCAAgC,kBAAkB;AAClD;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,kCAAiC;AACjC;AACA;AACA;AACA,mCAAkC,kBAAkB;AACpD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,iCAAgC,gBAAgB;AAChD;AACA,QAAO;AACP;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA,wBAAuB,UAAU,aAAa;AAC9C;AACA;AACA,QAAO;AACP;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA,MAAK;;AAEL;AACA;AACA,sCAAqC;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;;AAEL;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAgD,0CAA0C;AAC1F,uBAAsB,0DAA0D;AAChF;AACA;AACA,MAAK;AACL;AACA;AACA,uCAAsC,wBAAwB;AAC9D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0CAAyC,uBAAuB;AAChE;AACA;AACA;AACA;AACA,MAAK;AACL,kCAAiC,qBAAqB;;AAEtD,0BAAyB,kBAAkB;AAC3C,4BAA2B;AAC3B,IAAG;;AAEH;AACA;;AAEA;AACA;AACA;AACA;AACA,0BAAyB;AACzB,MAAK;;AAEL;;AAEA;AACA;AACA;AACA,sCAAqC,uBAAuB;AAC5D;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,0BAAyB,cAAc;AACvC,uBAAsB;AACtB;AACA,sBAAqB,eAAe,OAAO;AAC3C;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA,wCAAuC,qBAAqB,EAAE;AAC9D;AACA;;AAEA;AACA;AACA;AACA;AACA,iCAAgC,GAAG;AACnC;;AAEA;AACA;AACA;AACA;AACA;AACA,iCAAgC,OAAO;AACvC,uBAAsB;AACtB;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,sBAAqB,2BAA2B;AAChD;AACA,sBAAqB,eAAe,gBAAgB;AACpD;AACA;AACA;AACA;AACA,MAAK;AACL,oBAAmB,wBAAwB;AAC3C;AACA;AACA;AACA;AACA;AACA;;;AAGA;AACA;AACA;;AAEA;AACA,oBAAmB,wBAAwB;AAC3C;AACA;AACA;AACA;AACA,+BAA8B,GAAG;AACjC,sBAAqB,uBAAuB;AAC5C;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB;AACnB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,uBAAsB;AACtB;AACA,oCAAmC,yEAAyE;AAC5G;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,MAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,gEAA+D;AAC/D;AACA,MAAK;AACL;;AAEA;AACA;AACA;AACA;AACA,yBAAwB,kBAAkB;AAC1C,+CAA8C,mCAAmC;AACjF;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,6BAA4B,wBAAwB;AACpD;AACA;AACA;;AAEA;AACA;AACA;AACA,+BAA8B,mBAAmB;AACjD;AACA;AACA;AACA;AACA;AACA;AACA,kBAAiB,oBAAoB;AACrC,sBAAqB,oBAAoB;AACzC;AACA,0BAAyB,oDAAoD;AAC7E;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,kBAAkB;AACrC;AACA;AACA,2BAA0B,iCAAiC,mBAAmB;AAC9E,wBAAuB,uBAAuB;AAC9C;AACA;AACA;AACA;AACA;AACA,sBAAqB,wBAAwB;AAC7C;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iDAAgD,oBAAoB;;AAEpE,yBAAwB;AACxB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,6DAA4D;AAC5D;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB,gBAAgB;AACrC,2BAA0B,kBAAkB,OAAO;AACnD;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,gBAAgB;AACnC;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA,MAAK;AACL;AACA;AACA;AACA,sBAAqB,kBAAkB;AACvC,oBAAmB,gBAAgB;AACnC;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,oBAAoB;AACvC;;AAEA;AACA;AACA;AACA;AACA;AACA,YAAW,qCAAqC,8BAA8B;AAC9E;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,gBAAgB;AACnC;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,4CAA2C;AAC3C,6CAA4C;AAC5C;;AAEA;;AAEA;AACA;;AAEA;AACA;AACA,iCAAgC,qBAAqB;;AAErD;AACA,yBAAwB,cAAc,eAAe,iBAAiB,cAAc;;AAEpF,uBAAsB;AACtB;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,wDAAuD;AACvD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,gCAA+B;AAC/B;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA,sBAAqB,0BAA0B;;AAE/C,qCAAoC,eAAe;AACnD;AACA,mCAAkC,yBAAyB,uCAAuC;AAClG;AACA,mCAAkC,MAAM,eAAe,EAAE,aAAa;;AAEtE;AACA,oBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA,oBAAmB,kBAAkB;AACrC;AACA;;AAEA;;AAEA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,uBAAsB;AACtB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,iCAAgC,2DAA2D;;AAE3F;;AAEA;AACA;AACA;AACA;AACA;AACA,sCAAqC,oBAAoB;AACzD;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS,sCAAsC;AAC/C,eAAc,UAAU;AACxB;AACA;AACA;AACA;AACA;;AAEA;AACA,0CAAyC,WAAW;AACpD;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;;AAEA,yBAAwB,+BAA+B;AACvD;AACA;AACA;AACA,UAAS,+BAA+B;AACxC,eAAc,sBAAsB;AACpC;;AAEA,4BAA2B,sDAAsD;AACjF;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,oBAAmB,eAAe;AAClC;AACA;AACA;;AAEA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA,oBAAmB,oBAAoB;AACvC;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP,MAAK;AACL;AACA;AACA;AACA,MAAK;AACL;;AAEA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,0DAAyD,YAAY;AACrE;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,kDAAiD;AACjD;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA,IAAG,oBAAoB;;AAEvB;AACA,UAAS,6CAA6C;AACtD,eAAc,cAAc;AAC5B,IAAG;AACH,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA,sCAAqC;AACrC;AACA,IAAG;;AAEH;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;;AAEA,mBAAkB;AAClB;AACA;AACA,uCAAsC;AACtC,oCAAmC;AACnC;AACA;AACA;AACA;AACA;AACA,oBAAmB,QAAQ;AAC3B;AACA,qBAAoB,SAAS;AAC7B;AACA,oBAAmB,SAAS;AAC5B,IAAG;;AAEH;;AAEA;AACA;AACA;AACA,oBAAmB,kBAAkB;AACrC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,4BAA2B,6CAA6C;AACxE,6BAA4B,6CAA6C;;AAEzE,4BAA2B,4BAA4B,uCAAuC;AAC9F;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,2BAA0B,kBAAkB;AAC5C;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA,QAAO;AACP;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,iDAAgD;AAChD;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA,wBAAuB;AACvB;;AAEA;AACA;AACA;AACA,4BAA2B,SAAS;AACpC;;AAEA;AACA;AACA;AACA;AACA,wCAAuC,SAAS;AAChD;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,uCAAsC,SAAS;AAC/C;AACA;AACA,wCAAuC,YAAY,iCAAiC;AACpF;;AAEA;AACA;AACA;AACA,uCAAsC,aAAa;AACnD;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,sBAAqB,SAAS;AAC9B;AACA;AACA;AACA,gCAA+B,gCAAgC;AAC/D;AACA,0BAAyB,SAAS;AAClC;AACA;AACA;;AAEA;AACA;AACA;AACA,uCAAsC,SAAS;AAC/C;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB,SAAS;AAC9B;AACA,gCAA+B,yCAAyC;AACxE;AACA;AACA;AACA,0BAAyB,SAAS;AAClC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,sBAAqB,SAAS;AAC9B;AACA;AACA,oBAAmB,wCAAwC;AAC3D;AACA,UAAS;AACT;AACA,oBAAmB,4BAA4B;AAC/C,4BAA2B,OAAO;AAClC;AACA;AACA;AACA,wBAAuB,qCAAqC;AAC5D;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,IAAG;;AAEH;;AAEA;;AAEA;AACA,EAAC;;;;;;;;;;;;;;;ACriRD,KAAI,UAAU,GAAG,mBAAO,CAAC,oBAAY,CAAC,CAAC;AACvC,oBAAO,CAAC,sCAA8B,CAAC,CAAC;AACxC,WAAU,CAAC,gBAAgB,CAAC,KAAK,EAAE;;AAE/B,UAAK,EAAE,CACH,EAAC,KAAK,EAAE,eAAe,EAAE,KAAK,EAAE,MAAM,EAAE,IAAI,EAAE,aAAa,EAAC,EAC5D,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,SAAS,EAAC,EAC/B,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,KAAK,EAAC,EAC3B,EAAC,KAAK,EAAE,GAAG,EAAE,KAAK,EAAE,KAAK,EAAE,IAAI,EAAE,YAAY,EAAC,EAC9C,EAAC,KAAK,EAAE,GAAG,EAAE,KAAK,EAAE,KAAK,EAAE,IAAI,EAAE,YAAY,EAAC,EAC9C,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,SAAS,EAAE,IAAI,EAAE,MAAM,EAAC,EAC7C,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,MAAM,EAAE,IAAI,EAAE,YAAY,EAAC,EAChD,EAAC,KAAK,EAAE,KAAK,EAAE,KAAK,EAAE,UAAU,EAAC,EACjC,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,MAAM,EAAE,IAAI,EAAE,WAAW,EAAC,EAC/C,EAAC,KAAK,EAAE,UAAU,EAAE,KAAK,EAAE,SAAS,EAAC,CACxC;AACD,gBAAW,EAAE,CACT,EAAC,KAAK,EAAE,GAAG,EAAE,KAAK,EAAE,KAAK,EAAE,GAAG,EAAE,IAAI,EAAC,CACxC;AACD,eAAU,EAAE,CACR,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,MAAM,EAAE,IAAI,EAAE,YAAY,EAAC,EAChD,EAAC,KAAK,EAAE,QAAQ,EAAE,KAAK,EAAE,QAAQ,EAAC,EAClC,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,SAAS,EAAE,GAAG,EAAE,IAAI,EAAE,IAAI,EAAE,MAAM,EAAC,EACxD,EAAC,KAAK,EAAE,GAAG,EAAE,KAAK,EAAE,SAAS,EAAE,GAAG,EAAE,IAAI,EAAC,EACzC,EAAC,KAAK,EAAE,GAAG,EAAE,KAAK,EAAE,KAAK,EAAE,GAAG,EAAE,IAAI,EAAC,EACrC,EAAC,KAAK,EAAE,GAAG,EAAE,KAAK,EAAE,KAAK,EAAE,GAAG,EAAE,IAAI,EAAC,CACxC;AACD,SAAI,EAAE,CACF,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,SAAS,EAAE,GAAG,EAAE,IAAI,EAAC,EAC1C,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,MAAM,EAAE,IAAI,EAAE,YAAY,EAAC,EAChD,EAAC,KAAK,EAAE,cAAc,EAAE,KAAK,EAAE,UAAU,EAAC,CAC7C;AACD,eAAU,EAAE,CACR,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,EACvC,EAAC,KAAK,EAAE,QAAQ,EAAE,KAAK,EAAE,QAAQ,EAAC,EAClC,EAAC,KAAK,EAAE,QAAQ,EAAE,KAAK,EAAE,UAAU,EAAC,EACpC,EAAC,KAAK,EAAE,QAAQ,EAAE,KAAK,EAAE,UAAU,EAAE,IAAI,EAAE,UAAU,EAAC,EACtD,EAAC,KAAK,EAAE,IAAI,EAAE,KAAK,EAAE,MAAM,EAAE,IAAI,EAAE,WAAW,EAAC,EAC/C,EAAC,KAAK,EAAE,KAAK,EAAE,KAAK,EAAE,UAAU,EAAC,CACpC;AACD,aAAQ,EAAE,CACN,EAAC,KAAK,EAAE,KAAK,EAAE,KAAK,EAAE,QAAQ,EAAE,GAAG,EAAE,IAAI,EAAC,CAC7C;AACD,cAAS,EAAE,CACP,EAAC,KAAK,EAAE,MAAM,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,EACzC,EAAC,KAAK,EAAE,KAAK,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,EACxC,EAAC,KAAK,EAAE,OAAO,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,EAC1C,EAAC,KAAK,EAAE,QAAQ,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,EAC3C,EAAC,KAAK,EAAE,OAAO,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,EAC1C,EAAC,KAAK,EAAE,QAAQ,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,EAC3C,EAAC,KAAK,EAAE,SAAS,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,EAC5C,EAAC,KAAK,EAAE,SAAS,EAAE,KAAK,EAAE,MAAM,EAAE,GAAG,EAAE,IAAI,EAAC,CAC/C;EACJ,CAAC,C;;;;;;;;;ACxDF;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC;AACD;;AAEA;AACA;AACA;AACA,MAAK;AACL;;AAEA;AACA;AACA,qBAAoB,0BAA0B;AAC9C;AACA;AACA,sBAAqB,iBAAiB;AACtC;AACA;AACA;AACA;AACA;AACA;AACA;AACA,iBAAgB;AAChB;AACA;AACA,QAAO;AACP;AACA,kBAAiB;AACjB;AACA;AACA;AACA;AACA;AACA;AACA,gDAA+C,MAAM;AACrD,iCAAgC;AAChC;AACA;AACA;AACA;AACA,QAAO;AACP;AACA,mCAAkC,wBAAwB,iDAAiD,EAAE;AAC7G;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,oBAAmB,gBAAgB;AACnC;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,sBAAqB,qBAAqB;AAC1C;AACA;AACA;AACA;AACA;AACA,YAAW;AACX;AACA;AACA,YAAW;AACX;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,4BAA2B,oBAAoB;AAC/C;AACA,qCAAoC,2CAA2C;AAC/E;AACA;AACA,YAAW;AACX;AACA,YAAW;AACX;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA,8DAA6D,YAAY;AACzE;AACA;AACA;AACA;AACA,iCAAgC;;AAEhC;AACA,oBAAmB;AACnB;AACA;AACA;AACA;;AAEA;AACA,oBAAmB,gBAAgB;AACnC;;AAEA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,oBAAmB;AACnB,wBAAuB,kBAAkB;AACzC;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,EAAC;;;;;;;;;;;;;;;;;;;;;;;;;;2CCpNgB,0BAAkB;;;;uDACV,sCAA8B;;;;8CACnC,6BAAqB;;;;uDACZ,sCAA8B;;;;wCACnC,wBAAgB;;;;AAExC,UAAS,kBAAkB,CAAC,IAAI,EAAE;AAC9B,SAAI,GAAG,IAAI,CAAC,OAAO,CAAC,MAAM,EAAE,KAAK,CAAC,CAAC,OAAO,CAAC,MAAM,EAAE,KAAK,CAAC,CAAC;AAC1D,SAAI,KAAK,GAAG,IAAI,MAAM,CAAC,QAAQ,GAAG,IAAI,GAAG,WAAW,CAAC,CAAC;AACtD,SAAI,OAAO,GAAG,KAAK,CAAC,IAAI,CAAC,QAAQ,CAAC,MAAM,CAAC,CAAC;AAC1C,YAAO,OAAO,KAAK,IAAI,GAAG,EAAE,GAAG,kBAAkB,CAAC,OAAO,CAAC,CAAC,CAAC,CAAC,OAAO,CAAC,KAAK,EAAE,GAAG,CAAC,CAAC,CAAC;EACrF;;KAEK,YAAY;AACH,cADT,YAAY,CACF,OAAO,EAAE;+BADnB,YAAY;;AAEV,oCAFF,YAAY,6CAEJ,OAAO,EAAE;;AAEf,aAAI,CAAC,eAAe,GAAI,kBAAkB,CAAC,UAAU,CAAC,KAAK,EAAE,GAAK,QAAQ,CAAC,kBAAkB,CAAC,UAAU,CAAC,CAAC,KAAK,CAAC,GAAI,CAAC,CAAC;;AAEtH,aAAI,CAAC,QAAQ,GAAG,CAAC,CAAC;AAClB,aAAI;AACA,iBAAI,CAAC,QAAQ,GAAG,IAAI,CAAC,KAAK,CAAC,kBAAkB,CAAC,SAAS,CAAC,CAAC,CAAC;UAC7D,CACD,OAAO,GAAG,EAAE,EAEX;;AAED,aAAI,CAAC,WAAW,GAAG;AACf,sBAAS,EAAE,mCAAY;AACnB,wBAAO,EAAE,8BAA8B;cAC1C,CAAC;AACF,uBAAU,EAAE,4CAAiB;AACzB,4BAAW,EAAE,MAAM;cACtB,CAAC;AACF,uBAAU,EAAE,mCAAY;AACpB,wBAAO,EAAE,+BAA+B;cAC3C,CAAC;AACF,wBAAW,EAAE,4CAAiB;AAC1B,4BAAW,EAAE,MAAM;cACtB,CAAC;AACF,wBAAW,EAAE,mCAAY;AACrB,wBAAO,EAAE,gCAAgC;AACzC,wBAAO,EAAE,CAAC,SAAS,EAAE,MAAM,CAAC;cAC/B,CAAC;AACF,yBAAY,EAAE,4CAAiB;AAC3B,sBAAK,EAAE,IAAI,CAAC,SAAS,CAAC,IAAI,CAAC,QAAQ,CAAC;AACpC,wBAAO,EAAE,CAAC,SAAS,EAAE,OAAO,CAAC;cAChC,CAAC;AACF,yBAAY,EAAE,mCAAY;AACtB,wBAAO,EAAE,+CAA+C;AACxD,wBAAO,EAAE,CAAC,SAAS,EAAE,MAAM,CAAC;cAC/B,CAAC;AACF,0BAAa,EAAE,4CAAiB;AAC5B,qBAAI,EAAE,UAAU;AAChB,wBAAO,EAAE,CAAC,SAAS,EAAE,OAAO,CAAC;cAChC,CAAC;UACL,CAAC;AACF,aAAI,IAAI,CAAC,eAAe,EAAE;AACtB,iBAAI,CAAC,WAAW,CAAC,aAAa,CAAC,aAAa,CAAC;AACzC,wBAAO,EAAE,IAAI;cAChB,CAAC,CAAC;UACN;AACD,aAAI,CAAC,MAAM,GAAG,4CAAqB;AAC/B,mBAAM,EAAE,qMAIN;AACF,uBAAU,EAAE,IAAI,CAAC,WAAW;UAC/B,CAAC,CAAC;AACH,aAAI,CAAC,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;AACtB,aAAI,CAAC,WAAW,CAAC,YAAY,CAAC,EAAE,CAAC,QAAQ,EAAE,IAAI,CAAC,cAAc,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC;AAC3E,aAAI,CAAC,WAAW,CAAC,YAAY,CAAC,EAAE,CAAC,OAAO,EAAE,IAAI,CAAC,cAAc,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC;;AAE1E,aAAI,CAAC,WAAW,CAAC,aAAa,CAAC,EAAE,CAAC,QAAQ,EAAE,IAAI,CAAC,eAAe,CAAC,IAAI,CAAC,IAAI,CAAC,CAAC,CAAC;MAChF;;eA9DC,YAAY;;kBAAZ,YAAY;;gBAgEA,0BAAG;AACb,iBAAI;AACA,qBAAM,OAAO,GAAG,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,WAAW,CAAC,YAAY,CAAC,QAAQ,EAAE,CAAC,CAAC;AACrE,qBAAI,OAAO,KAAK,IAAI,CAAC,QAAQ,EAAE;AAC3B,yBAAI,CAAC,QAAQ,GAAG,OAAO,CAAC;AACxB,yBAAI,CAAC,YAAY,CAAC,IAAI,CAAC,QAAQ,CAAC,CAAC;kBACpC;cACJ,CACD,OAAO,GAAG,EAAE,EAEX;UACJ;;;gBAEc,2BAAG;AACd,iBAAI,CAAC,eAAe,GAAG,IAAI,CAAC,WAAW,CAAC,aAAa,CAAC,aAAa,EAAE,CAAC,OAAO,CAAC;AAC9E,iBAAI,IAAI,CAAC,WAAW,CAAC,aAAa,CAAC,cAAc,EAAE;AAC/C,qBAAI,CAAC,eAAe,GAAG,IAAI,CAAC,WAAW,CAAC,aAAa,CAAC,cAAc,CAAC,OAAO,GAAG,IAAI,GAAG,KAAK,CAAC;cAC/F;AACD,iBAAI,CAAC,YAAY,CAAC,IAAI,CAAC,QAAQ,EAAE,IAAI,CAAC,CAAC;UAC1C;;;gBAEmB,8BAAC,MAAM,EAAE;AACzB,iBAAI,IAAI,CAAC,QAAQ,KAAK,SAAS,EAAE;AAC7B,uBAAM,CAAC,UAAU,CAAC,IAAI,CAAC,QAAQ,CAAC,CAAC;cACpC;UACJ;;;gBAEU,uBAAG;AACV,oBAAO,IAAI,CAAC,eAAe,CAAC;UAC/B;;;YA7FC,YAAY;;;sBAgGV,YAAY;;;;;;;;;;;;;;AC7GpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,MAAK;AACL;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,+B;;;;;;;;;;;;;;;;;;;;;;;;;2CCvEiB,0BAAkB;;;;8CACf,6BAAqB;;;;uDACZ,sCAA8B;;;;8DAC9B,8CAAsC;;;;wCAC3C,wBAAgB;;;;uCACjB,oBAAY;;;;KAE7B,UAAU;AACD,cADT,UAAU,CACA,OAAO,EAAE;+BADnB,UAAU;;AAER,oCAFF,UAAU,6CAEF,OAAO,EAAE;;AAEf,aAAI,CAAC,gBAAgB,GAAG,mDAAqB;AACzC,uBAAU,EAAE,EAAE;AACd,2BAAc,EAAE,+CAAiB,QAAQ,CAAC,GAAG;AAC7C,mBAAM,EAAE;AACJ,kCAAiB,EAAE;AACf,wCAAmB,EAAE,IAAI;kBAC5B;cACJ;UACJ,CAAC,CAAC;;AAEH,aAAI,CAAC,WAAW,GAAG,mCAAY;AAC3B,oBAAO,EAAE,CAAC,aAAa,CAAC;UAC3B,CAAC,CAAC;AACH,aAAI,CAAC,UAAU,GAAG,EAAE,CAAC;AACrB,aAAI,CAAC,GAAG,GAAG,mCAAY;AACnB,oBAAO,EAAE,CAAC,KAAK,CAAC;UACnB,CAAC,CAAC;AACH,aAAI,CAAC,GAAG,CAAC,MAAM,GAAG,aAAW;AACzB,iBAAM,GAAG,GAAG,+BAAQ,SAAS,CAAC,MAAM,CAAC,KAAK,CAAC,IAAI,CAAC,GAAG,EAAE,SAAS,CAAC,CAAC;AAChE,iBAAI,IAAI,CAAC,eAAe,EAAE;AACtB,qBAAI,CAAC,eAAe,GAAG,KAAK,CAAC;AAC7B,qBAAI,CAAC,GAAG,CAAC,cAAc,CAAC,SAAS,GAAG,IAAI,CAAC,GAAG,CAAC,CAAC,EAAE,IAAI,CAAC,GAAG,CAAC,cAAc,CAAC,YAAY,GAAG,IAAI,CAAC,GAAG,CAAC,cAAc,CAAC,YAAY,CAAC,CAAC;cAChI;AACD,oBAAO,GAAG,CAAC;UACd,EAAC,IAAI,CAAC,IAAI,CAAC,CAAC;AACb,aAAI,CAAC,GAAG,GAAG,mCAAY;AACnB,oBAAO,EAAE,CAAC,KAAK,CAAC;UACnB,CAAC,CAAC;AACH,aAAI,CAAC,gBAAgB,CAAC,QAAQ,CAAC,CAC3B,EAAC,OAAO,EAAE,KAAK,EAAE,IAAI,EAAE,IAAI,CAAC,GAAG,EAAC,EAChC,EAAC,OAAO,EAAE,aAAa,EAAE,IAAI,EAAE,IAAI,CAAC,WAAW,EAAC,EAChD,EAAC,OAAO,EAAE,KAAK,EAAE,IAAI,EAAE,IAAI,CAAC,GAAG,EAAC,CACnC,CAAC,CAAC;;AAEH,aAAI,CAAC,MAAM,GAAG,4CAAqB;AAC/B,mBAAM,EAAE,2GAGN;AACF,uBAAU,EAAE;AACR,wBAAO,EAAE,IAAI,CAAC,gBAAgB;cACjC;UACJ,CAAC,CAAC;AACH,aAAI,CAAC,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;MACzB;;eAhDC,UAAU;;kBAAV,UAAU;;gBAkDR,cAAC,OAAO,EAAE;AACV,iBAAI,CAAC,UAAU,IAAI,OAAO,CAAC;AAC3B,iBAAI,CAAC,GAAG,CAAC,UAAU,CAAC,IAAI,CAAC,UAAU,CAAC,CAAC;AACrC,iBAAI,CAAC,eAAe,GAAG,IAAI,CAAC;UAC/B;;;gBAEI,eAAC,YAAY,EAAE,QAAQ,EAAE;AAC1B,yBAAY,GAAG,YAAY,CAAC,OAAO,CAAC,OAAO,EAAE,IAAI,CAAC,CAAC;AACnD,iBAAI;AACA,qBAAM,IAAI,GAAG,YAAY,CAAC,OAAO,CAAC,OAAO,EAAE,GAAI,CAAC,CAAC;AACjD,6BAAY,GAAG,IAAI,CAAC,KAAK,CAAC,IAAI,CAAC,CAAC;cACnC,CAAC,OAAO,GAAG,EAAE,EAEb;AACD,iBAAI;;AAEA,qBAAM,WAAW,GAAG,wBAAW,YAAY,CAAC,KAAK,CAAC,YAAY,EAAE,EAAC,QAAQ,EAAE,QAAQ,EAAE,MAAM,EAAE,KAAK,EAAC,CAAC,CAAC;AACrG,qBAAI,CAAC,WAAW,CAAC,UAAU,CAAC,OAAO,GAAG,IAAI,CAAC,SAAS,CAAC,WAAW,EAAE,SAAS,EAAE,CAAC,CAAC,GAAG,QAAQ,CAAC,CAAC;;AAE5F,qBAAM,GAAG,GAAG,wBAAW,YAAY,CAAC,KAAK,CAAC,YAAY,EAAE,EAAC,QAAQ,EAAE,QAAQ,EAAE,SAAS,EAAE,KAAK,EAAC,CAAC,CAAC;AAChG,qBAAI,CAAC,GAAG,CAAC,UAAU,CAAC,OAAO,GAAG,IAAI,CAAC,SAAS,CAAC,GAAG,EAAE,SAAS,EAAE,CAAC,CAAC,GAAG,QAAQ,CAAC,CAAC;;AAE5E,qBAAI,CAAC,IAAI,CAAC,qDAAqD,CAAC,CAAC;AACjE,wBAAO,WAAW,CAAC;cACtB,CACD,OAAO,GAAG,EAAE;AACR,qBAAK,GAAG,YAAY,WAAW,IAC1B,GAAG,CAAC,IAAI,KAAK,aAAc,IAC3B,GAAG,CAAC,IAAI,IAAI,GAAG,CAAC,MAAO,EAAE;AAC1B,yBAAI,CAAC,WAAW,CAAC,UAAU,CAAC,EAAE,CAAC,CAAC;AAChC,yBAAI,CAAC,GAAG,CAAC,UAAU,CAAC,EAAE,CAAC,CAAC;AACxB,yBAAI,KAAK,GAAI,GAAG,CAAC,MAAM,GAAG,EAAE,GAAI,OAAO,GAAG,EAAE,CAAC;AAC7C,yBAAI,CAAC,IAAI,CAAC,sCAAsC,GAC5C,SAAS,GACT,8BAA8B,GAAG,GAAG,CAAC,MAAM,CAAC,SAAS,CAAC,CAAC,EAAE,GAAG,CAAC,MAAM,GAAG,CAAC,CAAC,GAAG,SAAS,GACpF,GAAG,CAAC,MAAM,CAAC,SAAS,CAAC,GAAG,CAAC,MAAM,GAAG,CAAC,CAAC,GAAG,IAAI,GAC3C,OAAO,GAAG,GAAG,CAAC,IAAI,GAAG,KAAK,GAAI,IAAI,KAAK,CAAC,CAAC,GAAG,GAAG,CAAC,MAAM,GAAG,KAAK,CAAC,MAAM,GAAG,CAAC,EAAE,GAAG,GAAG,CAAC,IAAI,EAAE,MAAM,CAAC,CAAE,IAAI,CAAC,GAAG,CAAC,GAAG,IAAI,GAAG,GAAG,CAAC,OAAO,GAC/H,QAAQ,CACX,CAAC;kBACL,MACI;AACD,yBAAI,CAAC,IAAI,CAAC,6CAA6C,GAAG,GAAG,CAAC,QAAQ,EAAE,GAAG,QAAQ,CAAC,CAAC;kBACxF;cACJ;UACJ;;;YA9FC,UAAU;;;sBAiGR,UAAU;;;;;;;;;;;;;;;;;;;;;;;;;;;;2CCxGD,0BAAkB;;;;8CACf,6BAAqB;;;;uDACZ,sCAA8B;;;;qCACxC,mBAAW;;;;KAExB,gBAAgB;AACP,cADT,gBAAgB,CACN,OAAO,EAAE;;;+BADnB,gBAAgB;;AAEd,oCAFF,gBAAgB,6CAER,OAAO,EAAE;;AAEf,aAAI,CAAC,QAAQ,GAAG,SAAS,CAAC;AAC1B,aAAI,CAAC,SAAS,GAAG,EAAE,CAAC;AACpB,aAAI,CAAC,OAAO,GAAG,EAAE,CAAC;AAClB,aAAI,CAAC,OAAO,GAAG,EAAE,CAAC;AAClB,aAAI,CAAC,gBAAgB,GAAG,EAAE,CAAC;AAC3B,aAAI,CAAC,gBAAgB,GAAG,EAAE,CAAC;;AAE3B,aAAI,CAAC,MAAM,GAAG,4CAAqB;AAC/B,iBAAI,EAAE,IAAI;AACV,wBAAW,EAAE;AACT,+BAAc,EAAE,KAAK;cACxB;AACD,mBAAM,EAAE,gBAAC,OAAO,EAAK;AACjB,qBAAI,CAAC,MAAK,MAAM,EAAE;AACd,4BAAO;kBACV;AACD,qBAAI,MAAK,QAAQ,EAAE;AACf,2BAAK,MAAM,CAAC,UAAU,CAAC,MAAK,QAAQ,CAAC,CAAC;kBACzC;AACD,qBAAM,EAAE,GAAG,MAAK,OAAO,CAAC;AACxB,qBAAI,GAAG,CAAC;AACR,sBAAK,GAAG,IAAI,EAAE,EAAE;AACZ,yBAAM,OAAO,GAAG,MAAK,MAAM,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC;AAC1C,yBAAI,OAAO,EAAE;AACT,gCAAO,CAAC,cAAc,GAAG,EAAE,CAAC,GAAG,CAAC,CAAC;sBACpC;kBACJ;AACD,qBAAM,EAAE,GAAG,MAAK,QAAQ,CAAC;AACzB,sBAAK,GAAG,IAAI,EAAE,EAAE;AACZ,yBAAM,OAAO,GAAG,MAAK,MAAM,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC;AAC1C,yBAAI,OAAO,EAAE;AACT,gCAAO,CAAC,eAAe,GAAG,EAAE,CAAC,GAAG,CAAC,CAAC;sBACrC;kBACJ;AACD,qBAAM,EAAE,GAAG,MAAK,SAAS,CAAC;AAC1B,qBAAI,WAAW,GAAG,CACZ,EAAE,CAAC,KAAK,KAAK,SAAS,IAAM,EAAE,CAAC,KAAK,KAAK,IAAK,GAAI,EAAE,CAAC,KAAK,GAAG,IAAI,CAAC,GAAG,CAAC,IAAI,CAAC,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,WAAW,CAAC,IAAI,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,WAAW,CAAC,IAAI,CAAC,CAAC,EAC1J,EAAE,CAAC,MAAM,KAAK,SAAS,IAAM,EAAE,CAAC,MAAM,KAAK,IAAK,GAAI,EAAE,CAAC,MAAM,GAAG,IAAI,CAAC,GAAG,CAAC,IAAI,CAAC,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,YAAY,CAAC,IAAI,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,CAAC,EAAE,EAAE,CAAC,YAAY,CAAC,IAAI,CAAC,CAAC,CACpK,CAAC;AACF,qBAAK,EAAE,CAAC,KAAK,KAAK,IAAI,IAAM,EAAE,CAAC,MAAM,KAAK,IAAK,EAAE;AAC7C,gCAAW,CAAC,CAAC,CAAC,GAAG,MAAK,MAAM,CAAC,YAAY,CAAC;AAC1C,gCAAW,CAAC,CAAC,CAAC,GAAG,MAAK,MAAM,CAAC,aAAa,CAAC;kBAC9C,MACI,IAAI,EAAE,CAAC,KAAK,KAAK,IAAI,EAAE;AACxB,2BAAK,MAAM,CAAC,OAAO,CAAC,SAAS,EAAE,WAAW,CAAC,CAAC,CAAC,CAAC,CAAC;AAC/C,gCAAW,CAAC,CAAC,CAAC,GAAG,MAAK,MAAM,CAAC,YAAY,CAAC;;kBAE7C,MACI,IAAI,EAAE,CAAC,MAAM,KAAK,IAAI,EAAE;AACzB,2BAAK,MAAM,CAAC,OAAO,CAAC,WAAW,CAAC,CAAC,CAAC,EAAE,SAAS,CAAC,CAAC;AAC/C,gCAAW,CAAC,CAAC,CAAC,GAAG,MAAK,MAAM,CAAC,aAAa,CAAC;;kBAE9C,MACI;AACD,gCAAW,GAAG,EAAE,CAAC,cAAc,CAAC,GAAG,CAC/B,IAAI,CAAC,GAAG,CAAC,WAAW,CAAC,CAAC,CAAC,EAAE,WAAW,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,cAAc,CAAC,CAAC,EAC7D,IAAI,CAAC,GAAG,CAAC,WAAW,CAAC,CAAC,CAAC,EAAE,WAAW,CAAC,CAAC,CAAC,GAAG,EAAE,CAAC,cAAc,CAAC,CAAC,CAChE,GAAG,WAAW,CAAC;AAChB,2BAAK,MAAM,CAAC,OAAO,CAAC,WAAW,CAAC,CAAC,CAAC,EAAE,WAAW,CAAC,CAAC,CAAC,CAAC,CAAC;kBACvD;AACD,qBAAI,IAAI,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,GAAG,WAAW,CAAC,CAAC,CAAC,IAAI,CAAC,CAAC;AAClD,qBAAI,GAAG,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC,CAAC,GAAG,WAAW,CAAC,CAAC,CAAC,IAAI,CAAC,CAAC;AACjD,sBAAK,GAAG,IAAI,MAAK,MAAM,CAAC,QAAQ,EAAE;AAC9B,yBAAM,OAAO,GAAG,MAAK,MAAM,CAAC,QAAQ,CAAC,GAAG,CAAC,CAAC;AAC1C,yBAAK,OAAO,CAAC,IAAI,KAAK,OAAO,IAAM,GAAG,CAAC,OAAO,CAAC,GAAG,CAAC,KAAK,CAAE,EAAE;AACxD,6BAAM,IAAI,GAAG,OAAO,CAAC,GAAG,CAAC,OAAO,CAAC,IAAI,CAAC,CAAC;AACvC,gCAAO,CAAC,GAAG,CAAC,IAAI,EAAE;AACd,iCAAI,EAAE,CAAC,OAAO,CAAC,KAAK,EAAE,OAAO,CAAC,MAAM,CAAC;AACrC,sCAAS,EAAE,CAAC,IAAI,GAAG,OAAO,CAAC,IAAI,EAAE,GAAG,GAAG,OAAO,CAAC,GAAG,EAAE,OAAO,CAAC,MAAM,GAAG,CAAC,CAAC;0BAC1E,CAAC,CAAC;AACH,6BAAI,KAAK,GAAG,GAAG,GAAI,OAAO,CAAC,MAAM,GAAG,EAAG,CAAC;AACxC,6BAAI,eAAe,GAAG,MAAK,OAAO,CAAC,GAAG,CAAC,IAAI,sBAAO,OAAO,CAAC,KAAK,EAAE,KAAK,EAAE,KAAK,CAAC,CAAC;AAC/E,6BAAI,SAAS,GAAG,sBAAO,UAAU,CAAC,eAAe,CAAC,CAAC;AACnD,6BAAI,CAAC,UAAU,CAAC,aAAa,CAAC;AAC1B,4CAAe,EAAE,eAAe;AAChC,kCAAK,EAAE,SAAS;0BACnB,CAAC,CAAC;sBACN;kBACJ;cACJ;UACJ,CAAC,CAAC;AACH,aAAI,CAAC,GAAG,CAAC,IAAI,CAAC,MAAM,CAAC,CAAC;MACzB;;eAtFC,gBAAgB;;kBAAhB,gBAAgB;;cAwFV,UAAC,MAAM,EAAE;AACb,iBAAI,CAAC,MAAM,GAAG,MAAM,CAAC;AACrB,iBAAI,CAAC,kBAAkB,GAAG,IAAI,CAAC,kBAAkB,IAAI,EAAE,CAAC;AACxD,iBAAI,CAAC,WAAW,GAAG,IAAI,CAAC,WAAW,IAAI,EAAE,CAAC;AAC1C,kBAAK,IAAI,GAAG,IAAI,IAAI,CAAC,kBAAkB,EAAE;AACrC,qBAAI,CAAC,WAAW,CAAC,GAAG,CAAC,GAAG,IAAI,CAAC,kBAAkB,CAAC,GAAG,CAAC,CAAC;cACxD;AACD,iBAAI,CAAC,kBAAkB,GAAG,EAAE,CAAC;AAC7B,iBAAI,IAAI,CAAC,MAAM,EAAE;AACb,sBAAK,IAAI,OAAO,IAAI,IAAI,CAAC,MAAM,CAAC,QAAQ,EAAE;AACtC,yBAAI,OAAO,CAAC,OAAO,CAAC,GAAG,CAAC,KAAK,CAAC,EAAE;AAC5B,6BAAI,CAAC,kBAAkB,CAAC,OAAO,CAAC,GAAG,IAAI,CAAC,WAAW,CAAC,OAAO,CAAC,IAAI,mCAAY;AACxE,oCAAO,EAAE,kBAAkB,GAAG,OAAO,GAAG,QAAQ;AAChD,oCAAO,EAAE,CAAC,SAAS,CAAC;0BACvB,CAAC,CAAC;sBACN;kBACJ;cACJ;AACD,iBAAI,CAAC,MAAM,CAAC,aAAa,CAAC,IAAI,CAAC,kBAAkB,CAAC,CAAC;UACtD;cAEO,YAAG;AACP,oBAAO,IAAI,CAAC,MAAM,CAAC;UACtB;;;cAEW,YAAG;AACX,oBAAO,IAAI,CAAC,SAAS,CAAC;UACzB;cAEW,UAAC,KAAK,EAAE;AAChB,iBAAI,CAAC,SAAS,GAAG,KAAK,IAAI,EAAE,CAAC;AAC7B,iBAAI,CAAC,MAAM,CAAC,YAAY,EAAE,CAAC;UAC9B;;;cAEU,YAAG;AACV,oBAAO,IAAI,CAAC,QAAQ,CAAC;UACxB;cAEU,UAAC,KAAK,EAAE;AACf,iBAAI,CAAC,QAAQ,GAAG,KAAK,CAAC;AACtB,iBAAI,CAAC,MAAM,CAAC,YAAY,EAAE,CAAC;UAC9B;;;cAES,YAAG;AACT,oBAAO,IAAI,CAAC,OAAO,CAAC;UACvB;cAES,UAAC,KAAK,EAAE;AACd,iBAAI,CAAC,OAAO,GAAG,KAAK,IAAI,EAAE,CAAC;AAC3B,iBAAI,CAAC,MAAM,CAAC,YAAY,EAAE,CAAC;UAC9B;;;cAEU,YAAG;AACV,oBAAO,IAAI,CAAC,QAAQ,CAAC;UACxB;cAEU,UAAC,KAAK,EAAE;AACf,iBAAI,CAAC,QAAQ,GAAG,KAAK,IAAI,EAAE,CAAC;AAC5B,iBAAI,CAAC,MAAM,CAAC,YAAY,EAAE,CAAC;UAC9B;;;cAES,YAAG;AACT,oBAAO,IAAI,CAAC,OAAO,CAAC;UACvB;cAES,UAAC,MAAM,EAAE;AACf,iBAAI,CAAC,OAAO,GAAG,MAAM,IAAI,EAAE,CAAC;AAC5B,iBAAI,CAAC,MAAM,CAAC,YAAY,EAAE,CAAC;UAC9B;;;cAES,YAAG;AACT,oBAAO,IAAI,CAAC,OAAO,CAAC;UACvB;cAES,UAAC,MAAM,EAAE;AACf,iBAAI,CAAC,OAAO,GAAG,MAAM,IAAI,EAAE,CAAC;AAC5B,kBAAK,IAAI,GAAG,IAAI,IAAI,CAAC,kBAAkB,EAAE;AACrC,qBAAI,IAAI,CAAC,OAAO,CAAC,GAAG,CAAC,KAAK,QAAQ,EAAE;AAChC,yBAAI,CAAC,kBAAkB,CAAC,GAAG,CAAC,CAAC,QAAQ,CAAC,QAAQ,CAAC,CAAC;kBACnD,MACI;AACD,yBAAI,CAAC,kBAAkB,CAAC,GAAG,CAAC,CAAC,WAAW,CAAC,QAAQ,CAAC,CAAC;kBACtD;cACJ;UACJ;;;YA5KC,gBAAgB;;;sBA+Kd,gBAAgB;;;;;;;;;;ACpLxB;;AAEA;;AAEA;;;;;;;;;;;;ACJA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA,mBAAkB;AAClB;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,qBAAoB;AACpB;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;;;;AAKA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;;;AAGA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA;;AAEA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,cAAa;AACb;AACA;AACA;AACA;AACA,cAAa;AACb;AACA,cAAa;AACb;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B,EAAE;AACjC;;AAEA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,gCAA+B,EAAE;AACjC;AACA;AACA;AACA;;AAEA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,sDAAqD,EAAE,eAAe,EAAE;AACxE;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA,UAAS;AACT;AACA;AACA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;;AAEA,wBAAuB,mBAAmB;AAC1C;AACA;AACA;AACA;AACA;;AAEA;AACA;AACA;AACA;AACA;AACA;AACA;;AAEA;AACA;;AAEA,EAAC","file":"bundle.js","sourcesContent":[" \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n/** WEBPACK FOOTER **\n ** webpack/bootstrap 806f95e892df7fd2edbb\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2015\n */\n\n//<webpack>\nrequire('famous-polyfills');\nrequire('famous/core/famous.css');\nrequire('famous-flex/widgets/styles.css');\nrequire('./styles.css');\nrequire('./index.html');\nrequire('codemirror/lib/codemirror.css');\nrequire('./mode/vfl/vfl.css');\n//</webpack>\n\nfunction getParameterByName(name) {\n    name = name.replace(/[\\[]/, '\\\\[').replace(/[\\]]/, '\\\\]');\n    var regex = new RegExp('[\\\\?&]' + name + '=([^&#]*)');\n    var results = regex.exec(location.search);\n    return results === null ? '' : decodeURIComponent(results[1].replace(/\\+/g, ' '));\n}\n\n// Fast-click\nvar FastClick = require('fastclick/lib/fastclick');\nFastClick.attach(document.body);\n\n// import dependencies\nvar Engine = require('famous/core/Engine');\nvar LayoutController = require('famous-flex/LayoutController');\nvar AutoLayout = require('autolayout');\nvar InputView = require('./views/InputView');\nvar OutputView = require('./views/OutputView');\nvar VisualOutputView = require('./views/VisualOutputView');\nvar vflToLayout = require('./vflToLayout');\nvar Surface = require('famous/core/Surface');\n\n// create the main context and layout\nvar mainContext = Engine.createContext();\nvar layout;\nswitch (getParameterByName('mode')) {\n    case 'preview':\n        layout = vflToLayout(`\n|-[visualOutput]-|\nV:|-[visualOutput]-|\n        `);\n        break;\n    case 'compact':\n        layout = vflToLayout(`\nV:|-[input(output)]-[output]-|\nV:|-[visualOutput]-|\n|-[input(output,visualOutput)]-[visualOutput]-|\n|-[output]-[visualOutput]-|\n        `, {spacing: [10, 10]});\n        break;\n    case 'nolog':\n        layout = vflToLayout(`\nV:|-[input]-|\nV:|-[visualOutput]-|\n|-[input(visualOutput)]-[visualOutput]-|\n        `, {spacing: [10, 10]});\n        break;\n    default:\n        layout = vflToLayout(`\n//heights banner:intrinsic\n|[banner]|\nV:|[banner]-[input(output)]-[output]-|\nV:[banner]-[visualOutput]-|\n|-[input(output,visualOutput)]-[visualOutput]-|\n|-[output]-[visualOutput]-|\n        `, {spacing: [10, 10]});\n}\nvar mainLC = new LayoutController({\n    layout: layout\n});\nmainContext.add(mainLC);\n\n// Create banner\nvar banner = new Surface({\n    classes: ['banner'],\n    content: '<div class=\"va\">AUTOLAYOUT.JS<div class=\"subTitle\">Visual Format Editor</div></div>' +\n    (parseInt(getParameterByName('fork') || '1') ? '<a href=\"https://github.com/ijzerenhein/autolayout.js\"><img style=\"position: absolute; top: 0; right: 0; border: 0;\" src=\"https://camo.githubusercontent.com/652c5b9acfaddf3a9c326fa6bde407b87f7be0f4/68747470733a2f2f73332e616d617a6f6e6177732e636f6d2f6769746875622f726962626f6e732f666f726b6d655f72696768745f6f72616e67655f6666373630302e706e67\" alt=\"Fork me on GitHub\" data-canonical-src=\"https://s3.amazonaws.com/github/ribbons/forkme_right_orange_ff7600.png\"></a>' : ''),\n    size: [undefined, 124]\n});\nmainLC.insert('banner', banner);\n\n// Create input view\nvar inputView = new InputView();\nmainLC.insert('input', inputView);\ninputView.editor.on('update', _update); //eslint-disable-line no-use-before-define\ninputView.settings.on('update', _updateSettings); //eslint-disable-line no-use-before-define\n\n// Create output view\nvar outputView = new OutputView();\nmainLC.insert('output', outputView);\n\n// Create visualoutput view\nvar visualOutputView = new VisualOutputView();\nmainLC.insert('visualOutput', visualOutputView);\n\n// Update handling\nfunction _update() {\n    var constraints = outputView.parse(inputView.editor.visualFormat, inputView.settings.getExtended());\n    if (constraints) {\n        var view = new AutoLayout.View();\n        view.addConstraints(constraints);\n        visualOutputView.view = view;\n    }\n    _updateSettings(); //eslint-disable-line no-use-before-define\n    _updateMetaInfo(); //eslint-disable-line no-use-before-define\n}\nfunction _updateMetaInfo() {\n    var metaInfo = AutoLayout.VisualFormat.parseMetaInfo(inputView.editor.visualFormat, {prefix: '-'});\n    visualOutputView.viewPort = metaInfo.viewport;\n    visualOutputView.spacing = metaInfo.spacing;\n    visualOutputView.colors = metaInfo.colors;\n    visualOutputView.shapes = metaInfo.shapes;\n    visualOutputView.widths = metaInfo.widths;\n    visualOutputView.heights = metaInfo.heights;\n}\nfunction _updateSettings(forceParse) {\n    if (forceParse) {\n        return _update.call(this);\n    }\n    var view = visualOutputView.view;\n    if (view) {\n        inputView.settings.updateAutoLayoutView(view);\n        visualOutputView.view = view;\n    }\n}\n_update();\n\n\n\n/** WEBPACK FOOTER **\n ** ./main.js\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Context = require('./Context');\nvar EventHandler = require('./EventHandler');\nvar OptionsManager = require('./OptionsManager');\nvar Engine = {};\nvar contexts = [];\nvar nextTickQueue = [];\nvar currentFrame = 0;\nvar nextTickFrame = 0;\nvar deferQueue = [];\nvar lastTime = Date.now();\nvar frameTime;\nvar frameTimeLimit;\nvar loopEnabled = true;\nvar eventForwarders = {};\nvar eventHandler = new EventHandler();\nvar options = {\n    containerType: 'div',\n    containerClass: 'famous-container',\n    fpsCap: undefined,\n    runLoop: true,\n    appMode: true\n};\nvar optionsManager = new OptionsManager(options);\nvar MAX_DEFER_FRAME_TIME = 10;\nEngine.step = function step() {\n    currentFrame++;\n    nextTickFrame = currentFrame;\n    var currentTime = Date.now();\n    if (frameTimeLimit && currentTime - lastTime < frameTimeLimit)\n        return;\n    var i = 0;\n    frameTime = currentTime - lastTime;\n    lastTime = currentTime;\n    eventHandler.emit('prerender');\n    var numFunctions = nextTickQueue.length;\n    while (numFunctions--)\n        nextTickQueue.shift()(currentFrame);\n    while (deferQueue.length && Date.now() - currentTime < MAX_DEFER_FRAME_TIME) {\n        deferQueue.shift().call(this);\n    }\n    for (i = 0; i < contexts.length; i++)\n        contexts[i].update();\n    eventHandler.emit('postrender');\n};\nfunction loop() {\n    if (options.runLoop) {\n        Engine.step();\n        window.requestAnimationFrame(loop);\n    } else\n        loopEnabled = false;\n}\nwindow.requestAnimationFrame(loop);\nfunction handleResize(event) {\n    for (var i = 0; i < contexts.length; i++) {\n        contexts[i].emit('resize');\n    }\n    eventHandler.emit('resize');\n}\nwindow.addEventListener('resize', handleResize, false);\nhandleResize();\nfunction initialize() {\n    window.addEventListener('touchmove', function (event) {\n        event.preventDefault();\n    }, true);\n    addRootClasses();\n}\nvar initialized = false;\nfunction addRootClasses() {\n    if (!document.body) {\n        Engine.nextTick(addRootClasses);\n        return;\n    }\n    document.body.classList.add('famous-root');\n    document.documentElement.classList.add('famous-root');\n}\nEngine.pipe = function pipe(target) {\n    if (target.subscribe instanceof Function)\n        return target.subscribe(Engine);\n    else\n        return eventHandler.pipe(target);\n};\nEngine.unpipe = function unpipe(target) {\n    if (target.unsubscribe instanceof Function)\n        return target.unsubscribe(Engine);\n    else\n        return eventHandler.unpipe(target);\n};\nEngine.on = function on(type, handler) {\n    if (!(type in eventForwarders)) {\n        eventForwarders[type] = eventHandler.emit.bind(eventHandler, type);\n        addEngineListener(type, eventForwarders[type]);\n    }\n    return eventHandler.on(type, handler);\n};\nfunction addEngineListener(type, forwarder) {\n    if (!document.body) {\n        Engine.nextTick(addEventListener.bind(this, type, forwarder));\n        return;\n    }\n    document.body.addEventListener(type, forwarder);\n}\nEngine.emit = function emit(type, event) {\n    return eventHandler.emit(type, event);\n};\nEngine.removeListener = function removeListener(type, handler) {\n    return eventHandler.removeListener(type, handler);\n};\nEngine.getFPS = function getFPS() {\n    return 1000 / frameTime;\n};\nEngine.setFPSCap = function setFPSCap(fps) {\n    frameTimeLimit = Math.floor(1000 / fps);\n};\nEngine.getOptions = function getOptions(key) {\n    return optionsManager.getOptions(key);\n};\nEngine.setOptions = function setOptions(options) {\n    return optionsManager.setOptions.apply(optionsManager, arguments);\n};\nEngine.createContext = function createContext(el) {\n    if (!initialized && options.appMode)\n        Engine.nextTick(initialize);\n    var needMountContainer = false;\n    if (!el) {\n        el = document.createElement(options.containerType);\n        el.classList.add(options.containerClass);\n        needMountContainer = true;\n    }\n    var context = new Context(el);\n    Engine.registerContext(context);\n    if (needMountContainer)\n        mount(context, el);\n    return context;\n};\nfunction mount(context, el) {\n    if (!document.body) {\n        Engine.nextTick(mount.bind(this, context, el));\n        return;\n    }\n    document.body.appendChild(el);\n    context.emit('resize');\n}\nEngine.registerContext = function registerContext(context) {\n    contexts.push(context);\n    return context;\n};\nEngine.getContexts = function getContexts() {\n    return contexts;\n};\nEngine.deregisterContext = function deregisterContext(context) {\n    var i = contexts.indexOf(context);\n    if (i >= 0)\n        contexts.splice(i, 1);\n};\nEngine.nextTick = function nextTick(fn) {\n    nextTickQueue.push(fn);\n};\nEngine.defer = function defer(fn) {\n    deferQueue.push(fn);\n};\noptionsManager.on('change', function (data) {\n    if (data.id === 'fpsCap')\n        Engine.setFPSCap(data.value);\n    else if (data.id === 'runLoop') {\n        if (!loopEnabled && data.value) {\n            loopEnabled = true;\n            window.requestAnimationFrame(loop);\n        }\n    }\n});\nmodule.exports = Engine;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/Engine.js\n ** module id = 1\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar RenderNode = require('./RenderNode');\nvar EventHandler = require('./EventHandler');\nvar ElementAllocator = require('./ElementAllocator');\nvar Transform = require('./Transform');\nvar Transitionable = require('../transitions/Transitionable');\nvar _zeroZero = [\n    0,\n    0\n];\nvar usePrefix = !('perspective' in document.documentElement.style);\nfunction _getElementSize() {\n    var element = this.container;\n    return [\n        element.clientWidth,\n        element.clientHeight\n    ];\n}\nvar _setPerspective = usePrefix ? function (element, perspective) {\n    element.style.webkitPerspective = perspective ? perspective.toFixed() + 'px' : '';\n} : function (element, perspective) {\n    element.style.perspective = perspective ? perspective.toFixed() + 'px' : '';\n};\nfunction Context(container) {\n    this.container = container;\n    this._allocator = new ElementAllocator(container);\n    this._node = new RenderNode();\n    this._eventOutput = new EventHandler();\n    this._size = _getElementSize.call(this);\n    this._perspectiveState = new Transitionable(0);\n    this._perspective = undefined;\n    this._nodeContext = {\n        allocator: this._allocator,\n        transform: Transform.identity,\n        opacity: 1,\n        origin: _zeroZero,\n        align: _zeroZero,\n        size: this._size\n    };\n    this._eventOutput.on('resize', function () {\n        this.setSize(_getElementSize.call(this));\n    }.bind(this));\n}\nContext.prototype.getAllocator = function getAllocator() {\n    return this._allocator;\n};\nContext.prototype.add = function add(obj) {\n    return this._node.add(obj);\n};\nContext.prototype.migrate = function migrate(container) {\n    if (container === this.container)\n        return;\n    this.container = container;\n    this._allocator.migrate(container);\n};\nContext.prototype.getSize = function getSize() {\n    return this._size;\n};\nContext.prototype.setSize = function setSize(size) {\n    if (!size)\n        size = _getElementSize.call(this);\n    this._size[0] = size[0];\n    this._size[1] = size[1];\n};\nContext.prototype.update = function update(contextParameters) {\n    if (contextParameters) {\n        if (contextParameters.transform)\n            this._nodeContext.transform = contextParameters.transform;\n        if (contextParameters.opacity)\n            this._nodeContext.opacity = contextParameters.opacity;\n        if (contextParameters.origin)\n            this._nodeContext.origin = contextParameters.origin;\n        if (contextParameters.align)\n            this._nodeContext.align = contextParameters.align;\n        if (contextParameters.size)\n            this._nodeContext.size = contextParameters.size;\n    }\n    var perspective = this._perspectiveState.get();\n    if (perspective !== this._perspective) {\n        _setPerspective(this.container, perspective);\n        this._perspective = perspective;\n    }\n    this._node.commit(this._nodeContext);\n};\nContext.prototype.getPerspective = function getPerspective() {\n    return this._perspectiveState.get();\n};\nContext.prototype.setPerspective = function setPerspective(perspective, transition, callback) {\n    return this._perspectiveState.set(perspective, transition, callback);\n};\nContext.prototype.emit = function emit(type, event) {\n    return this._eventOutput.emit(type, event);\n};\nContext.prototype.on = function on(type, handler) {\n    return this._eventOutput.on(type, handler);\n};\nContext.prototype.removeListener = function removeListener(type, handler) {\n    return this._eventOutput.removeListener(type, handler);\n};\nContext.prototype.pipe = function pipe(target) {\n    return this._eventOutput.pipe(target);\n};\nContext.prototype.unpipe = function unpipe(target) {\n    return this._eventOutput.unpipe(target);\n};\nmodule.exports = Context;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/Context.js\n ** module id = 2\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Entity = require('./Entity');\nvar SpecParser = require('./SpecParser');\nfunction RenderNode(object) {\n    this._object = null;\n    this._child = null;\n    this._hasMultipleChildren = false;\n    this._isRenderable = false;\n    this._isModifier = false;\n    this._resultCache = {};\n    this._prevResults = {};\n    this._childResult = null;\n    if (object)\n        this.set(object);\n}\nRenderNode.prototype.add = function add(child) {\n    var childNode = child instanceof RenderNode ? child : new RenderNode(child);\n    if (this._child instanceof Array)\n        this._child.push(childNode);\n    else if (this._child) {\n        this._child = [\n            this._child,\n            childNode\n        ];\n        this._hasMultipleChildren = true;\n        this._childResult = [];\n    } else\n        this._child = childNode;\n    return childNode;\n};\nRenderNode.prototype.get = function get() {\n    return this._object || (this._hasMultipleChildren ? null : this._child ? this._child.get() : null);\n};\nRenderNode.prototype.set = function set(child) {\n    this._childResult = null;\n    this._hasMultipleChildren = false;\n    this._isRenderable = child.render ? true : false;\n    this._isModifier = child.modify ? true : false;\n    this._object = child;\n    this._child = null;\n    if (child instanceof RenderNode)\n        return child;\n    else\n        return this;\n};\nRenderNode.prototype.getSize = function getSize() {\n    var result = null;\n    var target = this.get();\n    if (target && target.getSize)\n        result = target.getSize();\n    if (!result && this._child && this._child.getSize)\n        result = this._child.getSize();\n    return result;\n};\nfunction _applyCommit(spec, context, cacheStorage) {\n    var result = SpecParser.parse(spec, context);\n    var keys = Object.keys(result);\n    for (var i = 0; i < keys.length; i++) {\n        var id = keys[i];\n        var childNode = Entity.get(id);\n        var commitParams = result[id];\n        commitParams.allocator = context.allocator;\n        var commitResult = childNode.commit(commitParams);\n        if (commitResult)\n            _applyCommit(commitResult, context, cacheStorage);\n        else\n            cacheStorage[id] = commitParams;\n    }\n}\nRenderNode.prototype.commit = function commit(context) {\n    var prevKeys = Object.keys(this._prevResults);\n    for (var i = 0; i < prevKeys.length; i++) {\n        var id = prevKeys[i];\n        if (this._resultCache[id] === undefined) {\n            var object = Entity.get(id);\n            if (object.cleanup)\n                object.cleanup(context.allocator);\n        }\n    }\n    this._prevResults = this._resultCache;\n    this._resultCache = {};\n    _applyCommit(this.render(), context, this._resultCache);\n};\nRenderNode.prototype.render = function render() {\n    if (this._isRenderable)\n        return this._object.render();\n    var result = null;\n    if (this._hasMultipleChildren) {\n        result = this._childResult;\n        var children = this._child;\n        for (var i = 0; i < children.length; i++) {\n            result[i] = children[i].render();\n        }\n    } else if (this._child)\n        result = this._child.render();\n    return this._isModifier ? this._object.modify(result) : result;\n};\nmodule.exports = RenderNode;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/RenderNode.js\n ** module id = 3\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar entities = [];\nfunction get(id) {\n    return entities[id];\n}\nfunction set(id, entity) {\n    entities[id] = entity;\n}\nfunction register(entity) {\n    var id = entities.length;\n    set(id, entity);\n    return id;\n}\nfunction unregister(id) {\n    set(id, null);\n}\nmodule.exports = {\n    register: register,\n    unregister: unregister,\n    get: get,\n    set: set\n};\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/Entity.js\n ** module id = 4\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Transform = require('./Transform');\nfunction SpecParser() {\n    this.result = {};\n}\nSpecParser._instance = new SpecParser();\nSpecParser.parse = function parse(spec, context) {\n    return SpecParser._instance.parse(spec, context);\n};\nSpecParser.prototype.parse = function parse(spec, context) {\n    this.reset();\n    this._parseSpec(spec, context, Transform.identity);\n    return this.result;\n};\nSpecParser.prototype.reset = function reset() {\n    this.result = {};\n};\nfunction _vecInContext(v, m) {\n    return [\n        v[0] * m[0] + v[1] * m[4] + v[2] * m[8],\n        v[0] * m[1] + v[1] * m[5] + v[2] * m[9],\n        v[0] * m[2] + v[1] * m[6] + v[2] * m[10]\n    ];\n}\nvar _zeroZero = [\n    0,\n    0\n];\nSpecParser.prototype._parseSpec = function _parseSpec(spec, parentContext, sizeContext) {\n    var id;\n    var target;\n    var transform;\n    var opacity;\n    var origin;\n    var align;\n    var size;\n    if (typeof spec === 'number') {\n        id = spec;\n        transform = parentContext.transform;\n        align = parentContext.align || _zeroZero;\n        if (parentContext.size && align && (align[0] || align[1])) {\n            var alignAdjust = [\n                align[0] * parentContext.size[0],\n                align[1] * parentContext.size[1],\n                0\n            ];\n            transform = Transform.thenMove(transform, _vecInContext(alignAdjust, sizeContext));\n        }\n        this.result[id] = {\n            transform: transform,\n            opacity: parentContext.opacity,\n            origin: parentContext.origin || _zeroZero,\n            align: parentContext.align || _zeroZero,\n            size: parentContext.size\n        };\n    } else if (!spec) {\n        return;\n    } else if (spec instanceof Array) {\n        for (var i = 0; i < spec.length; i++) {\n            this._parseSpec(spec[i], parentContext, sizeContext);\n        }\n    } else {\n        target = spec.target;\n        transform = parentContext.transform;\n        opacity = parentContext.opacity;\n        origin = parentContext.origin;\n        align = parentContext.align;\n        size = parentContext.size;\n        var nextSizeContext = sizeContext;\n        if (spec.opacity !== undefined)\n            opacity = parentContext.opacity * spec.opacity;\n        if (spec.transform)\n            transform = Transform.multiply(parentContext.transform, spec.transform);\n        if (spec.origin) {\n            origin = spec.origin;\n            nextSizeContext = parentContext.transform;\n        }\n        if (spec.align)\n            align = spec.align;\n        if (spec.size || spec.proportions) {\n            var parentSize = size;\n            size = [\n                size[0],\n                size[1]\n            ];\n            if (spec.size) {\n                if (spec.size[0] !== undefined)\n                    size[0] = spec.size[0];\n                if (spec.size[1] !== undefined)\n                    size[1] = spec.size[1];\n            }\n            if (spec.proportions) {\n                if (spec.proportions[0] !== undefined)\n                    size[0] = size[0] * spec.proportions[0];\n                if (spec.proportions[1] !== undefined)\n                    size[1] = size[1] * spec.proportions[1];\n            }\n            if (parentSize) {\n                if (align && (align[0] || align[1]))\n                    transform = Transform.thenMove(transform, _vecInContext([\n                        align[0] * parentSize[0],\n                        align[1] * parentSize[1],\n                        0\n                    ], sizeContext));\n                if (origin && (origin[0] || origin[1]))\n                    transform = Transform.moveThen([\n                        -origin[0] * size[0],\n                        -origin[1] * size[1],\n                        0\n                    ], transform);\n            }\n            nextSizeContext = parentContext.transform;\n            origin = null;\n            align = null;\n        }\n        this._parseSpec(target, {\n            transform: transform,\n            opacity: opacity,\n            origin: origin,\n            align: align,\n            size: size\n        }, nextSizeContext);\n    }\n};\nmodule.exports = SpecParser;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/SpecParser.js\n ** module id = 5\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Transform = {};\nTransform.precision = 0.000001;\nTransform.identity = [\n    1,\n    0,\n    0,\n    0,\n    0,\n    1,\n    0,\n    0,\n    0,\n    0,\n    1,\n    0,\n    0,\n    0,\n    0,\n    1\n];\nTransform.multiply4x4 = function multiply4x4(a, b) {\n    return [\n        a[0] * b[0] + a[4] * b[1] + a[8] * b[2] + a[12] * b[3],\n        a[1] * b[0] + a[5] * b[1] + a[9] * b[2] + a[13] * b[3],\n        a[2] * b[0] + a[6] * b[1] + a[10] * b[2] + a[14] * b[3],\n        a[3] * b[0] + a[7] * b[1] + a[11] * b[2] + a[15] * b[3],\n        a[0] * b[4] + a[4] * b[5] + a[8] * b[6] + a[12] * b[7],\n        a[1] * b[4] + a[5] * b[5] + a[9] * b[6] + a[13] * b[7],\n        a[2] * b[4] + a[6] * b[5] + a[10] * b[6] + a[14] * b[7],\n        a[3] * b[4] + a[7] * b[5] + a[11] * b[6] + a[15] * b[7],\n        a[0] * b[8] + a[4] * b[9] + a[8] * b[10] + a[12] * b[11],\n        a[1] * b[8] + a[5] * b[9] + a[9] * b[10] + a[13] * b[11],\n        a[2] * b[8] + a[6] * b[9] + a[10] * b[10] + a[14] * b[11],\n        a[3] * b[8] + a[7] * b[9] + a[11] * b[10] + a[15] * b[11],\n        a[0] * b[12] + a[4] * b[13] + a[8] * b[14] + a[12] * b[15],\n        a[1] * b[12] + a[5] * b[13] + a[9] * b[14] + a[13] * b[15],\n        a[2] * b[12] + a[6] * b[13] + a[10] * b[14] + a[14] * b[15],\n        a[3] * b[12] + a[7] * b[13] + a[11] * b[14] + a[15] * b[15]\n    ];\n};\nTransform.multiply = function multiply(a, b) {\n    return [\n        a[0] * b[0] + a[4] * b[1] + a[8] * b[2],\n        a[1] * b[0] + a[5] * b[1] + a[9] * b[2],\n        a[2] * b[0] + a[6] * b[1] + a[10] * b[2],\n        0,\n        a[0] * b[4] + a[4] * b[5] + a[8] * b[6],\n        a[1] * b[4] + a[5] * b[5] + a[9] * b[6],\n        a[2] * b[4] + a[6] * b[5] + a[10] * b[6],\n        0,\n        a[0] * b[8] + a[4] * b[9] + a[8] * b[10],\n        a[1] * b[8] + a[5] * b[9] + a[9] * b[10],\n        a[2] * b[8] + a[6] * b[9] + a[10] * b[10],\n        0,\n        a[0] * b[12] + a[4] * b[13] + a[8] * b[14] + a[12],\n        a[1] * b[12] + a[5] * b[13] + a[9] * b[14] + a[13],\n        a[2] * b[12] + a[6] * b[13] + a[10] * b[14] + a[14],\n        1\n    ];\n};\nTransform.thenMove = function thenMove(m, t) {\n    if (!t[2])\n        t[2] = 0;\n    return [\n        m[0],\n        m[1],\n        m[2],\n        0,\n        m[4],\n        m[5],\n        m[6],\n        0,\n        m[8],\n        m[9],\n        m[10],\n        0,\n        m[12] + t[0],\n        m[13] + t[1],\n        m[14] + t[2],\n        1\n    ];\n};\nTransform.moveThen = function moveThen(v, m) {\n    if (!v[2])\n        v[2] = 0;\n    var t0 = v[0] * m[0] + v[1] * m[4] + v[2] * m[8];\n    var t1 = v[0] * m[1] + v[1] * m[5] + v[2] * m[9];\n    var t2 = v[0] * m[2] + v[1] * m[6] + v[2] * m[10];\n    return Transform.thenMove(m, [\n        t0,\n        t1,\n        t2\n    ]);\n};\nTransform.translate = function translate(x, y, z) {\n    if (z === undefined)\n        z = 0;\n    return [\n        1,\n        0,\n        0,\n        0,\n        0,\n        1,\n        0,\n        0,\n        0,\n        0,\n        1,\n        0,\n        x,\n        y,\n        z,\n        1\n    ];\n};\nTransform.thenScale = function thenScale(m, s) {\n    return [\n        s[0] * m[0],\n        s[1] * m[1],\n        s[2] * m[2],\n        0,\n        s[0] * m[4],\n        s[1] * m[5],\n        s[2] * m[6],\n        0,\n        s[0] * m[8],\n        s[1] * m[9],\n        s[2] * m[10],\n        0,\n        s[0] * m[12],\n        s[1] * m[13],\n        s[2] * m[14],\n        1\n    ];\n};\nTransform.scale = function scale(x, y, z) {\n    if (z === undefined)\n        z = 1;\n    if (y === undefined)\n        y = x;\n    return [\n        x,\n        0,\n        0,\n        0,\n        0,\n        y,\n        0,\n        0,\n        0,\n        0,\n        z,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n};\nTransform.rotateX = function rotateX(theta) {\n    var cosTheta = Math.cos(theta);\n    var sinTheta = Math.sin(theta);\n    return [\n        1,\n        0,\n        0,\n        0,\n        0,\n        cosTheta,\n        sinTheta,\n        0,\n        0,\n        -sinTheta,\n        cosTheta,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n};\nTransform.rotateY = function rotateY(theta) {\n    var cosTheta = Math.cos(theta);\n    var sinTheta = Math.sin(theta);\n    return [\n        cosTheta,\n        0,\n        -sinTheta,\n        0,\n        0,\n        1,\n        0,\n        0,\n        sinTheta,\n        0,\n        cosTheta,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n};\nTransform.rotateZ = function rotateZ(theta) {\n    var cosTheta = Math.cos(theta);\n    var sinTheta = Math.sin(theta);\n    return [\n        cosTheta,\n        sinTheta,\n        0,\n        0,\n        -sinTheta,\n        cosTheta,\n        0,\n        0,\n        0,\n        0,\n        1,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n};\nTransform.rotate = function rotate(phi, theta, psi) {\n    var cosPhi = Math.cos(phi);\n    var sinPhi = Math.sin(phi);\n    var cosTheta = Math.cos(theta);\n    var sinTheta = Math.sin(theta);\n    var cosPsi = Math.cos(psi);\n    var sinPsi = Math.sin(psi);\n    var result = [\n        cosTheta * cosPsi,\n        cosPhi * sinPsi + sinPhi * sinTheta * cosPsi,\n        sinPhi * sinPsi - cosPhi * sinTheta * cosPsi,\n        0,\n        -cosTheta * sinPsi,\n        cosPhi * cosPsi - sinPhi * sinTheta * sinPsi,\n        sinPhi * cosPsi + cosPhi * sinTheta * sinPsi,\n        0,\n        sinTheta,\n        -sinPhi * cosTheta,\n        cosPhi * cosTheta,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n    return result;\n};\nTransform.rotateAxis = function rotateAxis(v, theta) {\n    var sinTheta = Math.sin(theta);\n    var cosTheta = Math.cos(theta);\n    var verTheta = 1 - cosTheta;\n    var xxV = v[0] * v[0] * verTheta;\n    var xyV = v[0] * v[1] * verTheta;\n    var xzV = v[0] * v[2] * verTheta;\n    var yyV = v[1] * v[1] * verTheta;\n    var yzV = v[1] * v[2] * verTheta;\n    var zzV = v[2] * v[2] * verTheta;\n    var xs = v[0] * sinTheta;\n    var ys = v[1] * sinTheta;\n    var zs = v[2] * sinTheta;\n    var result = [\n        xxV + cosTheta,\n        xyV + zs,\n        xzV - ys,\n        0,\n        xyV - zs,\n        yyV + cosTheta,\n        yzV + xs,\n        0,\n        xzV + ys,\n        yzV - xs,\n        zzV + cosTheta,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n    return result;\n};\nTransform.aboutOrigin = function aboutOrigin(v, m) {\n    var t0 = v[0] - (v[0] * m[0] + v[1] * m[4] + v[2] * m[8]);\n    var t1 = v[1] - (v[0] * m[1] + v[1] * m[5] + v[2] * m[9]);\n    var t2 = v[2] - (v[0] * m[2] + v[1] * m[6] + v[2] * m[10]);\n    return Transform.thenMove(m, [\n        t0,\n        t1,\n        t2\n    ]);\n};\nTransform.skew = function skew(phi, theta, psi) {\n    return [\n        1,\n        Math.tan(theta),\n        0,\n        0,\n        Math.tan(psi),\n        1,\n        0,\n        0,\n        0,\n        Math.tan(phi),\n        1,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n};\nTransform.skewX = function skewX(angle) {\n    return [\n        1,\n        0,\n        0,\n        0,\n        Math.tan(angle),\n        1,\n        0,\n        0,\n        0,\n        0,\n        1,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n};\nTransform.skewY = function skewY(angle) {\n    return [\n        1,\n        Math.tan(angle),\n        0,\n        0,\n        0,\n        1,\n        0,\n        0,\n        0,\n        0,\n        1,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n};\nTransform.perspective = function perspective(focusZ) {\n    return [\n        1,\n        0,\n        0,\n        0,\n        0,\n        1,\n        0,\n        0,\n        0,\n        0,\n        1,\n        -1 / focusZ,\n        0,\n        0,\n        0,\n        1\n    ];\n};\nTransform.getTranslate = function getTranslate(m) {\n    return [\n        m[12],\n        m[13],\n        m[14]\n    ];\n};\nTransform.inverse = function inverse(m) {\n    var c0 = m[5] * m[10] - m[6] * m[9];\n    var c1 = m[4] * m[10] - m[6] * m[8];\n    var c2 = m[4] * m[9] - m[5] * m[8];\n    var c4 = m[1] * m[10] - m[2] * m[9];\n    var c5 = m[0] * m[10] - m[2] * m[8];\n    var c6 = m[0] * m[9] - m[1] * m[8];\n    var c8 = m[1] * m[6] - m[2] * m[5];\n    var c9 = m[0] * m[6] - m[2] * m[4];\n    var c10 = m[0] * m[5] - m[1] * m[4];\n    var detM = m[0] * c0 - m[1] * c1 + m[2] * c2;\n    var invD = 1 / detM;\n    var result = [\n        invD * c0,\n        -invD * c4,\n        invD * c8,\n        0,\n        -invD * c1,\n        invD * c5,\n        -invD * c9,\n        0,\n        invD * c2,\n        -invD * c6,\n        invD * c10,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n    result[12] = -m[12] * result[0] - m[13] * result[4] - m[14] * result[8];\n    result[13] = -m[12] * result[1] - m[13] * result[5] - m[14] * result[9];\n    result[14] = -m[12] * result[2] - m[13] * result[6] - m[14] * result[10];\n    return result;\n};\nTransform.transpose = function transpose(m) {\n    return [\n        m[0],\n        m[4],\n        m[8],\n        m[12],\n        m[1],\n        m[5],\n        m[9],\n        m[13],\n        m[2],\n        m[6],\n        m[10],\n        m[14],\n        m[3],\n        m[7],\n        m[11],\n        m[15]\n    ];\n};\nfunction _normSquared(v) {\n    return v.length === 2 ? v[0] * v[0] + v[1] * v[1] : v[0] * v[0] + v[1] * v[1] + v[2] * v[2];\n}\nfunction _norm(v) {\n    return Math.sqrt(_normSquared(v));\n}\nfunction _sign(n) {\n    return n < 0 ? -1 : 1;\n}\nTransform.interpret = function interpret(M) {\n    var x = [\n        M[0],\n        M[1],\n        M[2]\n    ];\n    var sgn = _sign(x[0]);\n    var xNorm = _norm(x);\n    var v = [\n        x[0] + sgn * xNorm,\n        x[1],\n        x[2]\n    ];\n    var mult = 2 / _normSquared(v);\n    if (mult >= Infinity) {\n        return {\n            translate: Transform.getTranslate(M),\n            rotate: [\n                0,\n                0,\n                0\n            ],\n            scale: [\n                0,\n                0,\n                0\n            ],\n            skew: [\n                0,\n                0,\n                0\n            ]\n        };\n    }\n    var Q1 = [\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n    Q1[0] = 1 - mult * v[0] * v[0];\n    Q1[5] = 1 - mult * v[1] * v[1];\n    Q1[10] = 1 - mult * v[2] * v[2];\n    Q1[1] = -mult * v[0] * v[1];\n    Q1[2] = -mult * v[0] * v[2];\n    Q1[6] = -mult * v[1] * v[2];\n    Q1[4] = Q1[1];\n    Q1[8] = Q1[2];\n    Q1[9] = Q1[6];\n    var MQ1 = Transform.multiply(Q1, M);\n    var x2 = [\n        MQ1[5],\n        MQ1[6]\n    ];\n    var sgn2 = _sign(x2[0]);\n    var x2Norm = _norm(x2);\n    var v2 = [\n        x2[0] + sgn2 * x2Norm,\n        x2[1]\n    ];\n    var mult2 = 2 / _normSquared(v2);\n    var Q2 = [\n        1,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        0,\n        1\n    ];\n    Q2[5] = 1 - mult2 * v2[0] * v2[0];\n    Q2[10] = 1 - mult2 * v2[1] * v2[1];\n    Q2[6] = -mult2 * v2[0] * v2[1];\n    Q2[9] = Q2[6];\n    var Q = Transform.multiply(Q2, Q1);\n    var R = Transform.multiply(Q, M);\n    var remover = Transform.scale(R[0] < 0 ? -1 : 1, R[5] < 0 ? -1 : 1, R[10] < 0 ? -1 : 1);\n    R = Transform.multiply(R, remover);\n    Q = Transform.multiply(remover, Q);\n    var result = {};\n    result.translate = Transform.getTranslate(M);\n    result.rotate = [\n        Math.atan2(-Q[6], Q[10]),\n        Math.asin(Q[2]),\n        Math.atan2(-Q[1], Q[0])\n    ];\n    if (!result.rotate[0]) {\n        result.rotate[0] = 0;\n        result.rotate[2] = Math.atan2(Q[4], Q[5]);\n    }\n    result.scale = [\n        R[0],\n        R[5],\n        R[10]\n    ];\n    result.skew = [\n        Math.atan2(R[9], result.scale[2]),\n        Math.atan2(R[8], result.scale[2]),\n        Math.atan2(R[4], result.scale[0])\n    ];\n    if (Math.abs(result.rotate[0]) + Math.abs(result.rotate[2]) > 1.5 * Math.PI) {\n        result.rotate[1] = Math.PI - result.rotate[1];\n        if (result.rotate[1] > Math.PI)\n            result.rotate[1] -= 2 * Math.PI;\n        if (result.rotate[1] < -Math.PI)\n            result.rotate[1] += 2 * Math.PI;\n        if (result.rotate[0] < 0)\n            result.rotate[0] += Math.PI;\n        else\n            result.rotate[0] -= Math.PI;\n        if (result.rotate[2] < 0)\n            result.rotate[2] += Math.PI;\n        else\n            result.rotate[2] -= Math.PI;\n    }\n    return result;\n};\nTransform.average = function average(M1, M2, t) {\n    t = t === undefined ? 0.5 : t;\n    var specM1 = Transform.interpret(M1);\n    var specM2 = Transform.interpret(M2);\n    var specAvg = {\n        translate: [\n            0,\n            0,\n            0\n        ],\n        rotate: [\n            0,\n            0,\n            0\n        ],\n        scale: [\n            0,\n            0,\n            0\n        ],\n        skew: [\n            0,\n            0,\n            0\n        ]\n    };\n    for (var i = 0; i < 3; i++) {\n        specAvg.translate[i] = (1 - t) * specM1.translate[i] + t * specM2.translate[i];\n        specAvg.rotate[i] = (1 - t) * specM1.rotate[i] + t * specM2.rotate[i];\n        specAvg.scale[i] = (1 - t) * specM1.scale[i] + t * specM2.scale[i];\n        specAvg.skew[i] = (1 - t) * specM1.skew[i] + t * specM2.skew[i];\n    }\n    return Transform.build(specAvg);\n};\nTransform.build = function build(spec) {\n    var scaleMatrix = Transform.scale(spec.scale[0], spec.scale[1], spec.scale[2]);\n    var skewMatrix = Transform.skew(spec.skew[0], spec.skew[1], spec.skew[2]);\n    var rotateMatrix = Transform.rotate(spec.rotate[0], spec.rotate[1], spec.rotate[2]);\n    return Transform.thenMove(Transform.multiply(Transform.multiply(rotateMatrix, skewMatrix), scaleMatrix), spec.translate);\n};\nTransform.equals = function equals(a, b) {\n    return !Transform.notEquals(a, b);\n};\nTransform.notEquals = function notEquals(a, b) {\n    if (a === b)\n        return false;\n    return !(a && b) || a[12] !== b[12] || a[13] !== b[13] || a[14] !== b[14] || a[0] !== b[0] || a[1] !== b[1] || a[2] !== b[2] || a[4] !== b[4] || a[5] !== b[5] || a[6] !== b[6] || a[8] !== b[8] || a[9] !== b[9] || a[10] !== b[10];\n};\nTransform.normalizeRotation = function normalizeRotation(rotation) {\n    var result = rotation.slice(0);\n    if (result[0] === Math.PI * 0.5 || result[0] === -Math.PI * 0.5) {\n        result[0] = -result[0];\n        result[1] = Math.PI - result[1];\n        result[2] -= Math.PI;\n    }\n    if (result[0] > Math.PI * 0.5) {\n        result[0] = result[0] - Math.PI;\n        result[1] = Math.PI - result[1];\n        result[2] -= Math.PI;\n    }\n    if (result[0] < -Math.PI * 0.5) {\n        result[0] = result[0] + Math.PI;\n        result[1] = -Math.PI - result[1];\n        result[2] -= Math.PI;\n    }\n    while (result[1] < -Math.PI)\n        result[1] += 2 * Math.PI;\n    while (result[1] >= Math.PI)\n        result[1] -= 2 * Math.PI;\n    while (result[2] < -Math.PI)\n        result[2] += 2 * Math.PI;\n    while (result[2] >= Math.PI)\n        result[2] -= 2 * Math.PI;\n    return result;\n};\nTransform.inFront = [\n    1,\n    0,\n    0,\n    0,\n    0,\n    1,\n    0,\n    0,\n    0,\n    0,\n    1,\n    0,\n    0,\n    0,\n    0.001,\n    1\n];\nTransform.behind = [\n    1,\n    0,\n    0,\n    0,\n    0,\n    1,\n    0,\n    0,\n    0,\n    0,\n    1,\n    0,\n    0,\n    0,\n    -0.001,\n    1\n];\nmodule.exports = Transform;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/Transform.js\n ** module id = 6\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar EventEmitter = require('./EventEmitter');\nfunction EventHandler() {\n    EventEmitter.apply(this, arguments);\n    this.downstream = [];\n    this.downstreamFn = [];\n    this.upstream = [];\n    this.upstreamListeners = {};\n}\nEventHandler.prototype = Object.create(EventEmitter.prototype);\nEventHandler.prototype.constructor = EventHandler;\nEventHandler.setInputHandler = function setInputHandler(object, handler) {\n    object.trigger = handler.trigger.bind(handler);\n    if (handler.subscribe && handler.unsubscribe) {\n        object.subscribe = handler.subscribe.bind(handler);\n        object.unsubscribe = handler.unsubscribe.bind(handler);\n    }\n};\nEventHandler.setOutputHandler = function setOutputHandler(object, handler) {\n    if (handler instanceof EventHandler)\n        handler.bindThis(object);\n    object.pipe = handler.pipe.bind(handler);\n    object.unpipe = handler.unpipe.bind(handler);\n    object.on = handler.on.bind(handler);\n    object.addListener = object.on;\n    object.removeListener = handler.removeListener.bind(handler);\n};\nEventHandler.prototype.emit = function emit(type, event) {\n    EventEmitter.prototype.emit.apply(this, arguments);\n    var i = 0;\n    for (i = 0; i < this.downstream.length; i++) {\n        if (this.downstream[i].trigger)\n            this.downstream[i].trigger(type, event);\n    }\n    for (i = 0; i < this.downstreamFn.length; i++) {\n        this.downstreamFn[i](type, event);\n    }\n    return this;\n};\nEventHandler.prototype.trigger = EventHandler.prototype.emit;\nEventHandler.prototype.pipe = function pipe(target) {\n    if (target.subscribe instanceof Function)\n        return target.subscribe(this);\n    var downstreamCtx = target instanceof Function ? this.downstreamFn : this.downstream;\n    var index = downstreamCtx.indexOf(target);\n    if (index < 0)\n        downstreamCtx.push(target);\n    if (target instanceof Function)\n        target('pipe', null);\n    else if (target.trigger)\n        target.trigger('pipe', null);\n    return target;\n};\nEventHandler.prototype.unpipe = function unpipe(target) {\n    if (target.unsubscribe instanceof Function)\n        return target.unsubscribe(this);\n    var downstreamCtx = target instanceof Function ? this.downstreamFn : this.downstream;\n    var index = downstreamCtx.indexOf(target);\n    if (index >= 0) {\n        downstreamCtx.splice(index, 1);\n        if (target instanceof Function)\n            target('unpipe', null);\n        else if (target.trigger)\n            target.trigger('unpipe', null);\n        return target;\n    } else\n        return false;\n};\nEventHandler.prototype.on = function on(type, handler) {\n    EventEmitter.prototype.on.apply(this, arguments);\n    if (!(type in this.upstreamListeners)) {\n        var upstreamListener = this.trigger.bind(this, type);\n        this.upstreamListeners[type] = upstreamListener;\n        for (var i = 0; i < this.upstream.length; i++) {\n            this.upstream[i].on(type, upstreamListener);\n        }\n    }\n    return this;\n};\nEventHandler.prototype.addListener = EventHandler.prototype.on;\nEventHandler.prototype.subscribe = function subscribe(source) {\n    var index = this.upstream.indexOf(source);\n    if (index < 0) {\n        this.upstream.push(source);\n        for (var type in this.upstreamListeners) {\n            source.on(type, this.upstreamListeners[type]);\n        }\n    }\n    return this;\n};\nEventHandler.prototype.unsubscribe = function unsubscribe(source) {\n    var index = this.upstream.indexOf(source);\n    if (index >= 0) {\n        this.upstream.splice(index, 1);\n        for (var type in this.upstreamListeners) {\n            source.removeListener(type, this.upstreamListeners[type]);\n        }\n    }\n    return this;\n};\nmodule.exports = EventHandler;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/EventHandler.js\n ** module id = 7\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nfunction EventEmitter() {\n    this.listeners = {};\n    this._owner = this;\n}\nEventEmitter.prototype.emit = function emit(type, event) {\n    var handlers = this.listeners[type];\n    if (handlers) {\n        for (var i = 0; i < handlers.length; i++) {\n            handlers[i].call(this._owner, event);\n        }\n    }\n    return this;\n};\nEventEmitter.prototype.on = function on(type, handler) {\n    if (!(type in this.listeners))\n        this.listeners[type] = [];\n    var index = this.listeners[type].indexOf(handler);\n    if (index < 0)\n        this.listeners[type].push(handler);\n    return this;\n};\nEventEmitter.prototype.addListener = EventEmitter.prototype.on;\nEventEmitter.prototype.removeListener = function removeListener(type, handler) {\n    var listener = this.listeners[type];\n    if (listener !== undefined) {\n        var index = listener.indexOf(handler);\n        if (index >= 0)\n            listener.splice(index, 1);\n    }\n    return this;\n};\nEventEmitter.prototype.bindThis = function bindThis(owner) {\n    this._owner = owner;\n};\nmodule.exports = EventEmitter;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/EventEmitter.js\n ** module id = 8\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nfunction ElementAllocator(container) {\n    if (!container)\n        container = document.createDocumentFragment();\n    this.container = container;\n    this.detachedNodes = {};\n    this.nodeCount = 0;\n}\nElementAllocator.prototype.migrate = function migrate(container) {\n    var oldContainer = this.container;\n    if (container === oldContainer)\n        return;\n    if (oldContainer instanceof DocumentFragment) {\n        container.appendChild(oldContainer);\n    } else {\n        while (oldContainer.hasChildNodes()) {\n            container.appendChild(oldContainer.firstChild);\n        }\n    }\n    this.container = container;\n};\nElementAllocator.prototype.allocate = function allocate(type) {\n    type = type.toLowerCase();\n    if (!(type in this.detachedNodes))\n        this.detachedNodes[type] = [];\n    var nodeStore = this.detachedNodes[type];\n    var result;\n    if (nodeStore.length > 0) {\n        result = nodeStore.pop();\n    } else {\n        result = document.createElement(type);\n        this.container.appendChild(result);\n    }\n    this.nodeCount++;\n    return result;\n};\nElementAllocator.prototype.deallocate = function deallocate(element) {\n    var nodeType = element.nodeName.toLowerCase();\n    var nodeStore = this.detachedNodes[nodeType];\n    nodeStore.push(element);\n    this.nodeCount--;\n};\nElementAllocator.prototype.getNodeCount = function getNodeCount() {\n    return this.nodeCount;\n};\nmodule.exports = ElementAllocator;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/ElementAllocator.js\n ** module id = 9\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar MultipleTransition = require('./MultipleTransition');\nvar TweenTransition = require('./TweenTransition');\nfunction Transitionable(start) {\n    this.currentAction = null;\n    this.actionQueue = [];\n    this.callbackQueue = [];\n    this.state = 0;\n    this.velocity = undefined;\n    this._callback = undefined;\n    this._engineInstance = null;\n    this._currentMethod = null;\n    this.set(start);\n}\nvar transitionMethods = {};\nTransitionable.register = function register(methods) {\n    var success = true;\n    for (var method in methods) {\n        if (!Transitionable.registerMethod(method, methods[method]))\n            success = false;\n    }\n    return success;\n};\nTransitionable.registerMethod = function registerMethod(name, engineClass) {\n    if (!(name in transitionMethods)) {\n        transitionMethods[name] = engineClass;\n        return true;\n    } else\n        return false;\n};\nTransitionable.unregisterMethod = function unregisterMethod(name) {\n    if (name in transitionMethods) {\n        delete transitionMethods[name];\n        return true;\n    } else\n        return false;\n};\nfunction _loadNext() {\n    if (this._callback) {\n        var callback = this._callback;\n        this._callback = undefined;\n        callback();\n    }\n    if (this.actionQueue.length <= 0) {\n        this.set(this.get());\n        return;\n    }\n    this.currentAction = this.actionQueue.shift();\n    this._callback = this.callbackQueue.shift();\n    var method = null;\n    var endValue = this.currentAction[0];\n    var transition = this.currentAction[1];\n    if (transition instanceof Object && transition.method) {\n        method = transition.method;\n        if (typeof method === 'string')\n            method = transitionMethods[method];\n    } else {\n        method = TweenTransition;\n    }\n    if (this._currentMethod !== method) {\n        if (!(endValue instanceof Object) || method.SUPPORTS_MULTIPLE === true || endValue.length <= method.SUPPORTS_MULTIPLE) {\n            this._engineInstance = new method();\n        } else {\n            this._engineInstance = new MultipleTransition(method);\n        }\n        this._currentMethod = method;\n    }\n    this._engineInstance.reset(this.state, this.velocity);\n    if (this.velocity !== undefined)\n        transition.velocity = this.velocity;\n    this._engineInstance.set(endValue, transition, _loadNext.bind(this));\n}\nTransitionable.prototype.set = function set(endState, transition, callback) {\n    if (!transition) {\n        this.reset(endState);\n        if (callback)\n            callback();\n        return this;\n    }\n    var action = [\n        endState,\n        transition\n    ];\n    this.actionQueue.push(action);\n    this.callbackQueue.push(callback);\n    if (!this.currentAction)\n        _loadNext.call(this);\n    return this;\n};\nTransitionable.prototype.reset = function reset(startState, startVelocity) {\n    this._currentMethod = null;\n    this._engineInstance = null;\n    this._callback = undefined;\n    this.state = startState;\n    this.velocity = startVelocity;\n    this.currentAction = null;\n    this.actionQueue = [];\n    this.callbackQueue = [];\n};\nTransitionable.prototype.delay = function delay(duration, callback) {\n    var endValue;\n    if (this.actionQueue.length)\n        endValue = this.actionQueue[this.actionQueue.length - 1][0];\n    else if (this.currentAction)\n        endValue = this.currentAction[0];\n    else\n        endValue = this.get();\n    return this.set(endValue, {\n        duration: duration,\n        curve: function () {\n            return 0;\n        }\n    }, callback);\n};\nTransitionable.prototype.get = function get(timestamp) {\n    if (this._engineInstance) {\n        if (this._engineInstance.getVelocity)\n            this.velocity = this._engineInstance.getVelocity();\n        this.state = this._engineInstance.get(timestamp);\n    }\n    return this.state;\n};\nTransitionable.prototype.isActive = function isActive() {\n    return !!this.currentAction;\n};\nTransitionable.prototype.halt = function halt() {\n    return this.set(this.get());\n};\nmodule.exports = Transitionable;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/transitions/Transitionable.js\n ** module id = 10\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Utility = require('../utilities/Utility');\nfunction MultipleTransition(method) {\n    this.method = method;\n    this._instances = [];\n    this.state = [];\n}\nMultipleTransition.SUPPORTS_MULTIPLE = true;\nMultipleTransition.prototype.get = function get() {\n    for (var i = 0; i < this._instances.length; i++) {\n        this.state[i] = this._instances[i].get();\n    }\n    return this.state;\n};\nMultipleTransition.prototype.set = function set(endState, transition, callback) {\n    var _allCallback = Utility.after(endState.length, callback);\n    for (var i = 0; i < endState.length; i++) {\n        if (!this._instances[i])\n            this._instances[i] = new this.method();\n        this._instances[i].set(endState[i], transition, _allCallback);\n    }\n};\nMultipleTransition.prototype.reset = function reset(startState) {\n    for (var i = 0; i < startState.length; i++) {\n        if (!this._instances[i])\n            this._instances[i] = new this.method();\n        this._instances[i].reset(startState[i]);\n    }\n};\nmodule.exports = MultipleTransition;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/transitions/MultipleTransition.js\n ** module id = 11\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Utility = {};\nUtility.Direction = {\n    X: 0,\n    Y: 1,\n    Z: 2\n};\nUtility.after = function after(count, callback) {\n    var counter = count;\n    return function () {\n        counter--;\n        if (counter === 0)\n            callback.apply(this, arguments);\n    };\n};\nUtility.loadURL = function loadURL(url, callback) {\n    var xhr = new XMLHttpRequest();\n    xhr.onreadystatechange = function onreadystatechange() {\n        if (this.readyState === 4) {\n            if (callback)\n                callback(this.responseText);\n        }\n    };\n    xhr.open('GET', url);\n    xhr.send();\n};\nUtility.createDocumentFragmentFromHTML = function createDocumentFragmentFromHTML(html) {\n    var element = document.createElement('div');\n    element.innerHTML = html;\n    var result = document.createDocumentFragment();\n    while (element.hasChildNodes())\n        result.appendChild(element.firstChild);\n    return result;\n};\nUtility.clone = function clone(b) {\n    var a;\n    if (typeof b === 'object') {\n        a = b instanceof Array ? [] : {};\n        for (var key in b) {\n            if (typeof b[key] === 'object' && b[key] !== null) {\n                if (b[key] instanceof Array) {\n                    a[key] = new Array(b[key].length);\n                    for (var i = 0; i < b[key].length; i++) {\n                        a[key][i] = Utility.clone(b[key][i]);\n                    }\n                } else {\n                    a[key] = Utility.clone(b[key]);\n                }\n            } else {\n                a[key] = b[key];\n            }\n        }\n    } else {\n        a = b;\n    }\n    return a;\n};\nmodule.exports = Utility;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/utilities/Utility.js\n ** module id = 12\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nfunction TweenTransition(options) {\n    this.options = Object.create(TweenTransition.DEFAULT_OPTIONS);\n    if (options)\n        this.setOptions(options);\n    this._startTime = 0;\n    this._startValue = 0;\n    this._updateTime = 0;\n    this._endValue = 0;\n    this._curve = undefined;\n    this._duration = 0;\n    this._active = false;\n    this._callback = undefined;\n    this.state = 0;\n    this.velocity = undefined;\n}\nTweenTransition.Curves = {\n    linear: function (t) {\n        return t;\n    },\n    easeIn: function (t) {\n        return t * t;\n    },\n    easeOut: function (t) {\n        return t * (2 - t);\n    },\n    easeInOut: function (t) {\n        if (t <= 0.5)\n            return 2 * t * t;\n        else\n            return -2 * t * t + 4 * t - 1;\n    },\n    easeOutBounce: function (t) {\n        return t * (3 - 2 * t);\n    },\n    spring: function (t) {\n        return (1 - t) * Math.sin(6 * Math.PI * t) + t;\n    }\n};\nTweenTransition.SUPPORTS_MULTIPLE = true;\nTweenTransition.DEFAULT_OPTIONS = {\n    curve: TweenTransition.Curves.linear,\n    duration: 500,\n    speed: 0\n};\nvar registeredCurves = {};\nTweenTransition.registerCurve = function registerCurve(curveName, curve) {\n    if (!registeredCurves[curveName]) {\n        registeredCurves[curveName] = curve;\n        return true;\n    } else {\n        return false;\n    }\n};\nTweenTransition.unregisterCurve = function unregisterCurve(curveName) {\n    if (registeredCurves[curveName]) {\n        delete registeredCurves[curveName];\n        return true;\n    } else {\n        return false;\n    }\n};\nTweenTransition.getCurve = function getCurve(curveName) {\n    var curve = registeredCurves[curveName];\n    if (curve !== undefined)\n        return curve;\n    else\n        throw new Error('curve not registered');\n};\nTweenTransition.getCurves = function getCurves() {\n    return registeredCurves;\n};\nfunction _interpolate(a, b, t) {\n    return (1 - t) * a + t * b;\n}\nfunction _clone(obj) {\n    if (obj instanceof Object) {\n        if (obj instanceof Array)\n            return obj.slice(0);\n        else\n            return Object.create(obj);\n    } else\n        return obj;\n}\nfunction _normalize(transition, defaultTransition) {\n    var result = { curve: defaultTransition.curve };\n    if (defaultTransition.duration)\n        result.duration = defaultTransition.duration;\n    if (defaultTransition.speed)\n        result.speed = defaultTransition.speed;\n    if (transition instanceof Object) {\n        if (transition.duration !== undefined)\n            result.duration = transition.duration;\n        if (transition.curve)\n            result.curve = transition.curve;\n        if (transition.speed)\n            result.speed = transition.speed;\n    }\n    if (typeof result.curve === 'string')\n        result.curve = TweenTransition.getCurve(result.curve);\n    return result;\n}\nTweenTransition.prototype.setOptions = function setOptions(options) {\n    if (options.curve !== undefined)\n        this.options.curve = options.curve;\n    if (options.duration !== undefined)\n        this.options.duration = options.duration;\n    if (options.speed !== undefined)\n        this.options.speed = options.speed;\n};\nTweenTransition.prototype.set = function set(endValue, transition, callback) {\n    if (!transition) {\n        this.reset(endValue);\n        if (callback)\n            callback();\n        return;\n    }\n    this._startValue = _clone(this.get());\n    transition = _normalize(transition, this.options);\n    if (transition.speed) {\n        var startValue = this._startValue;\n        if (startValue instanceof Object) {\n            var variance = 0;\n            for (var i in startValue)\n                variance += (endValue[i] - startValue[i]) * (endValue[i] - startValue[i]);\n            transition.duration = Math.sqrt(variance) / transition.speed;\n        } else {\n            transition.duration = Math.abs(endValue - startValue) / transition.speed;\n        }\n    }\n    this._startTime = Date.now();\n    this._endValue = _clone(endValue);\n    this._startVelocity = _clone(transition.velocity);\n    this._duration = transition.duration;\n    this._curve = transition.curve;\n    this._active = true;\n    this._callback = callback;\n};\nTweenTransition.prototype.reset = function reset(startValue, startVelocity) {\n    if (this._callback) {\n        var callback = this._callback;\n        this._callback = undefined;\n        callback();\n    }\n    this.state = _clone(startValue);\n    this.velocity = _clone(startVelocity);\n    this._startTime = 0;\n    this._duration = 0;\n    this._updateTime = 0;\n    this._startValue = this.state;\n    this._startVelocity = this.velocity;\n    this._endValue = this.state;\n    this._active = false;\n};\nTweenTransition.prototype.getVelocity = function getVelocity() {\n    return this.velocity;\n};\nTweenTransition.prototype.get = function get(timestamp) {\n    this.update(timestamp);\n    return this.state;\n};\nfunction _calculateVelocity(current, start, curve, duration, t) {\n    var velocity;\n    var eps = 1e-7;\n    var speed = (curve(t) - curve(t - eps)) / eps;\n    if (current instanceof Array) {\n        velocity = [];\n        for (var i = 0; i < current.length; i++) {\n            if (typeof current[i] === 'number')\n                velocity[i] = speed * (current[i] - start[i]) / duration;\n            else\n                velocity[i] = 0;\n        }\n    } else\n        velocity = speed * (current - start) / duration;\n    return velocity;\n}\nfunction _calculateState(start, end, t) {\n    var state;\n    if (start instanceof Array) {\n        state = [];\n        for (var i = 0; i < start.length; i++) {\n            if (typeof start[i] === 'number')\n                state[i] = _interpolate(start[i], end[i], t);\n            else\n                state[i] = start[i];\n        }\n    } else\n        state = _interpolate(start, end, t);\n    return state;\n}\nTweenTransition.prototype.update = function update(timestamp) {\n    if (!this._active) {\n        if (this._callback) {\n            var callback = this._callback;\n            this._callback = undefined;\n            callback();\n        }\n        return;\n    }\n    if (!timestamp)\n        timestamp = Date.now();\n    if (this._updateTime >= timestamp)\n        return;\n    this._updateTime = timestamp;\n    var timeSinceStart = timestamp - this._startTime;\n    if (timeSinceStart >= this._duration) {\n        this.state = this._endValue;\n        this.velocity = _calculateVelocity(this.state, this._startValue, this._curve, this._duration, 1);\n        this._active = false;\n    } else if (timeSinceStart < 0) {\n        this.state = this._startValue;\n        this.velocity = this._startVelocity;\n    } else {\n        var t = timeSinceStart / this._duration;\n        this.state = _calculateState(this._startValue, this._endValue, this._curve(t));\n        this.velocity = _calculateVelocity(this.state, this._startValue, this._curve, this._duration, t);\n    }\n};\nTweenTransition.prototype.isActive = function isActive() {\n    return this._active;\n};\nTweenTransition.prototype.halt = function halt() {\n    this.reset(this.get());\n};\nTweenTransition.registerCurve('linear', TweenTransition.Curves.linear);\nTweenTransition.registerCurve('easeIn', TweenTransition.Curves.easeIn);\nTweenTransition.registerCurve('easeOut', TweenTransition.Curves.easeOut);\nTweenTransition.registerCurve('easeInOut', TweenTransition.Curves.easeInOut);\nTweenTransition.registerCurve('easeOutBounce', TweenTransition.Curves.easeOutBounce);\nTweenTransition.registerCurve('spring', TweenTransition.Curves.spring);\nTweenTransition.customCurve = function customCurve(v1, v2) {\n    v1 = v1 || 0;\n    v2 = v2 || 0;\n    return function (t) {\n        return v1 * t + (-2 * v1 - v2 + 3) * t * t + (v1 + v2 - 2) * t * t * t;\n    };\n};\nmodule.exports = TweenTransition;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/transitions/TweenTransition.js\n ** module id = 13\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar EventHandler = require('./EventHandler');\nfunction OptionsManager(value) {\n    this._value = value;\n    this.eventOutput = null;\n}\nOptionsManager.patch = function patchObject(source, data) {\n    var manager = new OptionsManager(source);\n    for (var i = 1; i < arguments.length; i++)\n        manager.patch(arguments[i]);\n    return source;\n};\nfunction _createEventOutput() {\n    this.eventOutput = new EventHandler();\n    this.eventOutput.bindThis(this);\n    EventHandler.setOutputHandler(this, this.eventOutput);\n}\nOptionsManager.prototype.patch = function patch() {\n    var myState = this._value;\n    for (var i = 0; i < arguments.length; i++) {\n        var data = arguments[i];\n        for (var k in data) {\n            if (k in myState && (data[k] && data[k].constructor === Object) && (myState[k] && myState[k].constructor === Object)) {\n                if (!myState.hasOwnProperty(k))\n                    myState[k] = Object.create(myState[k]);\n                this.key(k).patch(data[k]);\n                if (this.eventOutput)\n                    this.eventOutput.emit('change', {\n                        id: k,\n                        value: this.key(k).value()\n                    });\n            } else\n                this.set(k, data[k]);\n        }\n    }\n    return this;\n};\nOptionsManager.prototype.setOptions = OptionsManager.prototype.patch;\nOptionsManager.prototype.key = function key(identifier) {\n    var result = new OptionsManager(this._value[identifier]);\n    if (!(result._value instanceof Object) || result._value instanceof Array)\n        result._value = {};\n    return result;\n};\nOptionsManager.prototype.get = function get(key) {\n    return key ? this._value[key] : this._value;\n};\nOptionsManager.prototype.getOptions = OptionsManager.prototype.get;\nOptionsManager.prototype.set = function set(key, value) {\n    var originalValue = this.get(key);\n    this._value[key] = value;\n    if (this.eventOutput && value !== originalValue)\n        this.eventOutput.emit('change', {\n            id: key,\n            value: value\n        });\n    return this;\n};\nOptionsManager.prototype.on = function on() {\n    _createEventOutput.call(this);\n    return this.on.apply(this, arguments);\n};\nOptionsManager.prototype.removeListener = function removeListener() {\n    _createEventOutput.call(this);\n    return this.removeListener.apply(this, arguments);\n};\nOptionsManager.prototype.pipe = function pipe() {\n    _createEventOutput.call(this);\n    return this.pipe.apply(this, arguments);\n};\nOptionsManager.prototype.unpipe = function unpipe() {\n    _createEventOutput.call(this);\n    return this.unpipe.apply(this, arguments);\n};\nmodule.exports = OptionsManager;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/OptionsManager.js\n ** module id = 14\n ** module chunks = 0\n **/","require('./classList.js');\nrequire('./functionPrototypeBind.js');\nrequire('./requestAnimationFrame.js');\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-polyfills/index.js\n ** module id = 15\n ** module chunks = 0\n **/","\n/*\n * classList.js: Cross-browser full element.classList implementation.\n * 2011-06-15\n *\n * By Eli Grey, http://eligrey.com\n * Public Domain.\n * NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK.\n */\n\n/*global self, document, DOMException */\n\n/*! @source http://purl.eligrey.com/github/classList.js/blob/master/classList.js*/\n\nif (typeof document !== \"undefined\" && !(\"classList\" in document.createElement(\"a\"))) {\n\n(function (view) {\n\n\"use strict\";\n\nvar\n      classListProp = \"classList\"\n    , protoProp = \"prototype\"\n    , elemCtrProto = (view.HTMLElement || view.Element)[protoProp]\n    , objCtr = Object\n    , strTrim = String[protoProp].trim || function () {\n        return this.replace(/^\\s+|\\s+$/g, \"\");\n    }\n    , arrIndexOf = Array[protoProp].indexOf || function (item) {\n        var\n              i = 0\n            , len = this.length\n        ;\n        for (; i < len; i++) {\n            if (i in this && this[i] === item) {\n                return i;\n            }\n        }\n        return -1;\n    }\n    // Vendors: please allow content code to instantiate DOMExceptions\n    , DOMEx = function (type, message) {\n        this.name = type;\n        this.code = DOMException[type];\n        this.message = message;\n    }\n    , checkTokenAndGetIndex = function (classList, token) {\n        if (token === \"\") {\n            throw new DOMEx(\n                  \"SYNTAX_ERR\"\n                , \"An invalid or illegal string was specified\"\n            );\n        }\n        if (/\\s/.test(token)) {\n            throw new DOMEx(\n                  \"INVALID_CHARACTER_ERR\"\n                , \"String contains an invalid character\"\n            );\n        }\n        return arrIndexOf.call(classList, token);\n    }\n    , ClassList = function (elem) {\n        var\n              trimmedClasses = strTrim.call(elem.className)\n            , classes = trimmedClasses ? trimmedClasses.split(/\\s+/) : []\n            , i = 0\n            , len = classes.length\n        ;\n        for (; i < len; i++) {\n            this.push(classes[i]);\n        }\n        this._updateClassName = function () {\n            elem.className = this.toString();\n        };\n    }\n    , classListProto = ClassList[protoProp] = []\n    , classListGetter = function () {\n        return new ClassList(this);\n    }\n;\n// Most DOMException implementations don't allow calling DOMException's toString()\n// on non-DOMExceptions. Error's toString() is sufficient here.\nDOMEx[protoProp] = Error[protoProp];\nclassListProto.item = function (i) {\n    return this[i] || null;\n};\nclassListProto.contains = function (token) {\n    token += \"\";\n    return checkTokenAndGetIndex(this, token) !== -1;\n};\nclassListProto.add = function (token) {\n    token += \"\";\n    if (checkTokenAndGetIndex(this, token) === -1) {\n        this.push(token);\n        this._updateClassName();\n    }\n};\nclassListProto.remove = function (token) {\n    token += \"\";\n    var index = checkTokenAndGetIndex(this, token);\n    if (index !== -1) {\n        this.splice(index, 1);\n        this._updateClassName();\n    }\n};\nclassListProto.toggle = function (token) {\n    token += \"\";\n    if (checkTokenAndGetIndex(this, token) === -1) {\n        this.add(token);\n    } else {\n        this.remove(token);\n    }\n};\nclassListProto.toString = function () {\n    return this.join(\" \");\n};\n\nif (objCtr.defineProperty) {\n    var classListPropDesc = {\n          get: classListGetter\n        , enumerable: true\n        , configurable: true\n    };\n    try {\n        objCtr.defineProperty(elemCtrProto, classListProp, classListPropDesc);\n    } catch (ex) { // IE 8 doesn't support enumerable:true\n        if (ex.number === -0x7FF5EC54) {\n            classListPropDesc.enumerable = false;\n            objCtr.defineProperty(elemCtrProto, classListProp, classListPropDesc);\n        }\n    }\n} else if (objCtr[protoProp].__defineGetter__) {\n    elemCtrProto.__defineGetter__(classListProp, classListGetter);\n}\n\n}(self));\n\n}\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-polyfills/classList.js\n ** module id = 16\n ** module chunks = 0\n **/","if (!Function.prototype.bind) {\n    Function.prototype.bind = function (oThis) {\n        if (typeof this !== \"function\") {\n            // closest thing possible to the ECMAScript 5 internal IsCallable function\n            throw new TypeError(\"Function.prototype.bind - what is trying to be bound is not callable\");\n        }\n\n        var aArgs = Array.prototype.slice.call(arguments, 1),\n        fToBind = this,\n        fNOP = function () {},\n        fBound = function () {\n            return fToBind.apply(this instanceof fNOP && oThis\n                ? this\n                : oThis,\n                aArgs.concat(Array.prototype.slice.call(arguments)));\n        };\n\n        fNOP.prototype = this.prototype;\n        fBound.prototype = new fNOP();\n\n        return fBound;\n    };\n}\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-polyfills/functionPrototypeBind.js\n ** module id = 17\n ** module chunks = 0\n **/","// adds requestAnimationFrame functionality\n// Source: http://strd6.com/2011/05/better-window-requestanimationframe-shim/\n\nwindow.requestAnimationFrame || (window.requestAnimationFrame =\n  window.webkitRequestAnimationFrame ||\n  window.mozRequestAnimationFrame    ||\n  window.oRequestAnimationFrame      ||\n  window.msRequestAnimationFrame     ||\n  function(callback, element) {\n    return window.setTimeout(function() {\n      callback(+new Date());\n  }, 1000 / 60);\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-polyfills/requestAnimationFrame.js\n ** module id = 18\n ** module chunks = 0\n **/","// style-loader: Adds some css to the DOM by adding a <style> tag\nvar dispose = require(\"!/Users/hein/repos/autolayout/visualformat-editor/node_modules/style-loader/addStyle.js\")\n\t// The css code:\n\t(require(\"!!/Users/hein/repos/autolayout/visualformat-editor/node_modules/css-loader/index.js!/Users/hein/repos/autolayout/visualformat-editor/node_modules/famous/core/famous.css\"));\n// Hot Module Replacement\nif(module.hot) {\n\tmodule.hot.accept();\n\tmodule.hot.dispose(dispose);\n}\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/famous.css\n ** module id = 19\n ** module chunks = 0\n **/","/*\r\n\tMIT License http://www.opensource.org/licenses/mit-license.php\r\n\tAuthor Tobias Koppers @sokra\r\n*/\r\nmodule.exports = function addStyle(cssCode) {\r\n\tif(typeof DEBUG !== \"undefined\" && DEBUG) {\r\n\t\tif(typeof document !== \"object\") throw new Error(\"The style-loader cannot be used in a non-browser environment\");\r\n\t}\r\n\tvar styleElement = document.createElement(\"style\");\r\n\tstyleElement.type = \"text/css\";\r\n\tvar head = document.getElementsByTagName(\"head\")[0];\r\n\thead.appendChild(styleElement);\r\n\tif (styleElement.styleSheet) {\r\n\t\tstyleElement.styleSheet.cssText = cssCode;\r\n\t} else {\r\n\t\tstyleElement.appendChild(document.createTextNode(cssCode));\r\n\t}\r\n\treturn function() {\r\n\t\thead.removeChild(styleElement);\r\n\t};\r\n}\r\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/style-loader/addStyle.js\n ** module id = 20\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * Owner: mark@famo.us\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\n\n.famous-root {\n    width: 100%;\n    height: 100%;\n    margin: 0px;\n    padding: 0px;\n    opacity: .999999; /* ios8 hotfix */\n    overflow: hidden;\n    -webkit-transform-style: preserve-3d;\n    transform-style: preserve-3d;\n}\n\n.famous-container, .famous-group {\n    position: absolute;\n    top: 0px;\n    left: 0px;\n    bottom: 0px;\n    right: 0px;\n    overflow: visible;\n    -webkit-transform-style: preserve-3d;\n    transform-style: preserve-3d;\n    -webkit-backface-visibility: visible;\n    backface-visibility: visible;\n    pointer-events: none;\n}\n\n.famous-group {\n    width: 0px;\n    height: 0px;\n    margin: 0px;\n    padding: 0px;\n}\n\n.famous-surface {\n    position: absolute;\n    -webkit-transform-origin: center center;\n    transform-origin: center center;\n    -webkit-backface-visibility: hidden;\n    backface-visibility: hidden;\n    -webkit-transform-style: preserve-3d;\n    transform-style: preserve-3d;\n    -webkit-box-sizing: border-box;\n    -moz-box-sizing: border-box;\n    box-sizing: border-box;\n    -webkit-tap-highlight-color: transparent;\n    pointer-events: auto;\n}\n\n.famous-container-group {\n    position: relative;\n    width: 100%;\n    height: 100%;\n}\n\n\n\n/** WEBPACK FOOTER **\n ** ../~/famous/core/famous.css\n **/","// style-loader: Adds some css to the DOM by adding a <style> tag\nvar dispose = require(\"!/Users/hein/repos/autolayout/visualformat-editor/node_modules/style-loader/addStyle.js\")\n\t// The css code:\n\t(require(\"!!/Users/hein/repos/autolayout/visualformat-editor/node_modules/css-loader/index.js!/Users/hein/repos/autolayout/visualformat-editor/node_modules/famous-flex/src/widgets/styles.css\"));\n// Hot Module Replacement\nif(module.hot) {\n\tmodule.hot.accept();\n\tmodule.hot.dispose(dispose);\n}\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/widgets/styles.css\n ** module id = 22\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2015\n */\n\n/* datepicker */\n.ff-datepicker.item {\n  text-align: center;\n}\n.ff-datepicker.item > div {\n  /* align content vertically */\n  position: relative;\n  top: 50%;\n  -webkit-transform: translateY(-50%);\n  -ms-transform: translateY(-50%);\n  -moz-transform: translateY(-50%);\n  -o-transform: translateY(-50%);\n  transform: translateY(-50%);\n}\n.ff-datepicker.top, .ff-datepicker.middle, .ff-datepicker.bottom {\n  pointer-events: none;\n}\n\n\n/* tabbar common */\n.ff-tabbar.item {\n  text-align: center;\n  white-space: nowrap;\n  color: #333333;\n  cursor: pointer;\n}\n.ff-tabbar.item > div {\n  /* align content vertically */\n  position: relative;\n  top: 50%;\n  -webkit-transform: translateY(-50%);\n  -ms-transform: translateY(-50%);\n  -moz-transform: translateY(-50%);\n  -o-transform: translateY(-50%);\n  transform: translateY(-50%);\n}\n.ff-tabbar.selectedItemOverlay {\n  border-bottom: 6px solid #1185c3;\n}\n\n\n\n/** WEBPACK FOOTER **\n ** ../~/famous-flex/src/widgets/styles.css\n **/","// style-loader: Adds some css to the DOM by adding a <style> tag\nvar dispose = require(\"!/Users/hein/repos/autolayout/visualformat-editor/node_modules/style-loader/addStyle.js\")\n\t// The css code:\n\t(require(\"!!/Users/hein/repos/autolayout/visualformat-editor/node_modules/css-loader/index.js!/Users/hein/repos/autolayout/visualformat-editor/src/styles.css\"));\n// Hot Module Replacement\nif(module.hot) {\n\tmodule.hot.accept();\n\tmodule.hot.dispose(dispose);\n}\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ./styles.css\n ** module id = 24\n ** module chunks = 0\n **/","@font-face {\n  font-family: 'Montserrat';\n  src: url('./fonts/montserrat/Montserrat-Hairline.otf');\n  font-weight: 100;\n}\n\n@font-face {\n  font-family: 'Montserrat';\n  src: url('./fonts/montserrat/Montserrat-Light.otf');\n  font-weight: 200;\n}\n\n@font-face {\n  font-family: 'DancingScriptOT';\n  src: url('./fonts/dancing-script-ot/DancingScript-Regular.otf');\n}\n\nbody {\n  color: #555555;\n  font-family: 'Montserrat';\n  font-weight: 200;\n  font-size: 15px;\n}\ntextarea, input {\n  font-family: 'droid sans mono', monospace, 'courier new', courier, sans-serif;\n  font-size: 17px;\n  border: 1px solid #DDDDDD;\n  -moz-tab-size: 2;\n  -o-tab-size: 2;\n  tab-size: 2;\n  resize: none;\n}\n.CodeMirror {\n  position: absolute !important;\n  width: 100% !important;\n  height: 100% !important;\n}\ninput {\n  text-align: center;\n}\n.banner {\n  font-weight: 100;\n  font-size: 60px;\n  text-align: center;\n  color: black;\n  z-index: 10;\n}\n.banner > iframe {\n  position: absolute;\n  left: 10px;\n  top: 10px;\n}\n.banner .subTitle {\n  font-family: DancingScriptOT;\n  font-weight: bold;\n  font-size: 26px;\n  color: orange;\n}\n.ff-tabbar.selectedItemOverlay {\n  border-bottom: 3px solid orange;\n}\n.ff-tabbar.item > div {\n  text-overflow: ellipsis;\n  white-space: nowrap;\n  overflow: hidden;\n}\n.ff-tabbar.item.selected {\n  color: orange;\n  font-weight: bold;\n}\n.setting.text {\n  text-align: right;\n}\n\n.constraints, .log, .raw {\n  overflow: scroll;\n  font-size: 17px;\n}\n.log {\n  padding: 5px;\n}\n\n.va {\n  /* align vertical */\n  display: block;\n  position: relative;\n  top: 50%;\n  -webkit-transform: translateY(-50%);\n  -moz-transform: translateY(-50%);\n  -ms-transform: translateY(-50%);\n  -o-transform: translateY(-50%);\n  transform: translateY(-50%);\n}\n\n.subView {\n  border: 1px solid #DDDDDD;\n  border-radius: 5px;\n  text-align: center;\n}\n.subView.circle {\n  border-radius: 50%;\n}\n\n\n\n/** WEBPACK FOOTER **\n ** ./styles.css\n **/","module.exports = __webpack_public_path__ + \"fonts/montserrat/Montserrat-Hairline.otf\"\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ./fonts/montserrat/Montserrat-Hairline.otf\n ** module id = 26\n ** module chunks = 0\n **/","module.exports = __webpack_public_path__ + \"fonts/montserrat/Montserrat-Light.otf\"\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ./fonts/montserrat/Montserrat-Light.otf\n ** module id = 27\n ** module chunks = 0\n **/","module.exports = __webpack_public_path__ + \"fonts/dancing-script-ot/DancingScript-Regular.otf\"\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ./fonts/dancing-script-ot/DancingScript-Regular.otf\n ** module id = 28\n ** module chunks = 0\n **/","module.exports = __webpack_public_path__ + \"index.html\"\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ./index.html\n ** module id = 29\n ** module chunks = 0\n **/","// style-loader: Adds some css to the DOM by adding a <style> tag\nvar dispose = require(\"!/Users/hein/repos/autolayout/visualformat-editor/node_modules/style-loader/addStyle.js\")\n\t// The css code:\n\t(require(\"!!/Users/hein/repos/autolayout/visualformat-editor/node_modules/css-loader/index.js!/Users/hein/repos/autolayout/visualformat-editor/node_modules/codemirror/lib/codemirror.css\"));\n// Hot Module Replacement\nif(module.hot) {\n\tmodule.hot.accept();\n\tmodule.hot.dispose(dispose);\n}\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/codemirror/lib/codemirror.css\n ** module id = 30\n ** module chunks = 0\n **/","/* BASICS */\n\n.CodeMirror {\n  /* Set height, width, borders, and global font properties here */\n  font-family: monospace;\n  height: 300px;\n  color: black;\n}\n\n/* PADDING */\n\n.CodeMirror-lines {\n  padding: 4px 0; /* Vertical padding around content */\n}\n.CodeMirror pre {\n  padding: 0 4px; /* Horizontal padding of content */\n}\n\n.CodeMirror-scrollbar-filler, .CodeMirror-gutter-filler {\n  background-color: white; /* The little square between H and V scrollbars */\n}\n\n/* GUTTER */\n\n.CodeMirror-gutters {\n  border-right: 1px solid #ddd;\n  background-color: #f7f7f7;\n  white-space: nowrap;\n}\n.CodeMirror-linenumbers {}\n.CodeMirror-linenumber {\n  padding: 0 3px 0 5px;\n  min-width: 20px;\n  text-align: right;\n  color: #999;\n  white-space: nowrap;\n}\n\n.CodeMirror-guttermarker { color: black; }\n.CodeMirror-guttermarker-subtle { color: #999; }\n\n/* CURSOR */\n\n.CodeMirror div.CodeMirror-cursor {\n  border-left: 1px solid black;\n}\n/* Shown when moving in bi-directional text */\n.CodeMirror div.CodeMirror-secondarycursor {\n  border-left: 1px solid silver;\n}\n.CodeMirror.cm-fat-cursor div.CodeMirror-cursor {\n  width: auto;\n  border: 0;\n  background: #7e7;\n}\n.CodeMirror.cm-fat-cursor div.CodeMirror-cursors {\n  z-index: 1;\n}\n\n.cm-animate-fat-cursor {\n  width: auto;\n  border: 0;\n  -webkit-animation: blink 1.06s steps(1) infinite;\n  -moz-animation: blink 1.06s steps(1) infinite;\n  animation: blink 1.06s steps(1) infinite;\n}\n@-moz-keyframes blink {\n  0% { background: #7e7; }\n  50% { background: none; }\n  100% { background: #7e7; }\n}\n@-webkit-keyframes blink {\n  0% { background: #7e7; }\n  50% { background: none; }\n  100% { background: #7e7; }\n}\n@keyframes blink {\n  0% { background: #7e7; }\n  50% { background: none; }\n  100% { background: #7e7; }\n}\n\n/* Can style cursor different in overwrite (non-insert) mode */\ndiv.CodeMirror-overwrite div.CodeMirror-cursor {}\n\n.cm-tab { display: inline-block; text-decoration: inherit; }\n\n.CodeMirror-ruler {\n  border-left: 1px solid #ccc;\n  position: absolute;\n}\n\n/* DEFAULT THEME */\n\n.cm-s-default .cm-keyword {color: #708;}\n.cm-s-default .cm-atom {color: #219;}\n.cm-s-default .cm-number {color: #164;}\n.cm-s-default .cm-def {color: #00f;}\n.cm-s-default .cm-variable,\n.cm-s-default .cm-punctuation,\n.cm-s-default .cm-property,\n.cm-s-default .cm-operator {}\n.cm-s-default .cm-variable-2 {color: #05a;}\n.cm-s-default .cm-variable-3 {color: #085;}\n.cm-s-default .cm-comment {color: #a50;}\n.cm-s-default .cm-string {color: #a11;}\n.cm-s-default .cm-string-2 {color: #f50;}\n.cm-s-default .cm-meta {color: #555;}\n.cm-s-default .cm-qualifier {color: #555;}\n.cm-s-default .cm-builtin {color: #30a;}\n.cm-s-default .cm-bracket {color: #997;}\n.cm-s-default .cm-tag {color: #170;}\n.cm-s-default .cm-attribute {color: #00c;}\n.cm-s-default .cm-header {color: blue;}\n.cm-s-default .cm-quote {color: #090;}\n.cm-s-default .cm-hr {color: #999;}\n.cm-s-default .cm-link {color: #00c;}\n\n.cm-negative {color: #d44;}\n.cm-positive {color: #292;}\n.cm-header, .cm-strong {font-weight: bold;}\n.cm-em {font-style: italic;}\n.cm-link {text-decoration: underline;}\n.cm-strikethrough {text-decoration: line-through;}\n\n.cm-s-default .cm-error {color: #f00;}\n.cm-invalidchar {color: #f00;}\n\n.CodeMirror-composing { border-bottom: 2px solid; }\n\n/* Default styles for common addons */\n\ndiv.CodeMirror span.CodeMirror-matchingbracket {color: #0f0;}\ndiv.CodeMirror span.CodeMirror-nonmatchingbracket {color: #f22;}\n.CodeMirror-matchingtag { background: rgba(255, 150, 0, .3); }\n.CodeMirror-activeline-background {background: #e8f2ff;}\n\n/* STOP */\n\n/* The rest of this file contains styles related to the mechanics of\n   the editor. You probably shouldn't touch them. */\n\n.CodeMirror {\n  position: relative;\n  overflow: hidden;\n  background: white;\n}\n\n.CodeMirror-scroll {\n  overflow: scroll !important; /* Things will break if this is overridden */\n  /* 30px is the magic margin used to hide the element's real scrollbars */\n  /* See overflow: hidden in .CodeMirror */\n  margin-bottom: -30px; margin-right: -30px;\n  padding-bottom: 30px;\n  height: 100%;\n  outline: none; /* Prevent dragging from highlighting the element */\n  position: relative;\n}\n.CodeMirror-sizer {\n  position: relative;\n  border-right: 30px solid transparent;\n}\n\n/* The fake, visible scrollbars. Used to force redraw during scrolling\n   before actuall scrolling happens, thus preventing shaking and\n   flickering artifacts. */\n.CodeMirror-vscrollbar, .CodeMirror-hscrollbar, .CodeMirror-scrollbar-filler, .CodeMirror-gutter-filler {\n  position: absolute;\n  z-index: 6;\n  display: none;\n}\n.CodeMirror-vscrollbar {\n  right: 0; top: 0;\n  overflow-x: hidden;\n  overflow-y: scroll;\n}\n.CodeMirror-hscrollbar {\n  bottom: 0; left: 0;\n  overflow-y: hidden;\n  overflow-x: scroll;\n}\n.CodeMirror-scrollbar-filler {\n  right: 0; bottom: 0;\n}\n.CodeMirror-gutter-filler {\n  left: 0; bottom: 0;\n}\n\n.CodeMirror-gutters {\n  position: absolute; left: 0; top: 0;\n  z-index: 3;\n}\n.CodeMirror-gutter {\n  white-space: normal;\n  height: 100%;\n  display: inline-block;\n  margin-bottom: -30px;\n  /* Hack to make IE7 behave */\n  *zoom:1;\n  *display:inline;\n}\n.CodeMirror-gutter-wrapper {\n  position: absolute;\n  z-index: 4;\n  height: 100%;\n}\n.CodeMirror-gutter-elt {\n  position: absolute;\n  cursor: default;\n  z-index: 4;\n}\n.CodeMirror-gutter-wrapper {\n  -webkit-user-select: none;\n  -moz-user-select: none;\n  user-select: none;\n}\n\n.CodeMirror-lines {\n  cursor: text;\n  min-height: 1px; /* prevents collapsing before first draw */\n}\n.CodeMirror pre {\n  /* Reset some styles that the rest of the page might have set */\n  -moz-border-radius: 0; -webkit-border-radius: 0; border-radius: 0;\n  border-width: 0;\n  background: transparent;\n  font-family: inherit;\n  font-size: inherit;\n  margin: 0;\n  white-space: pre;\n  word-wrap: normal;\n  line-height: inherit;\n  color: inherit;\n  z-index: 2;\n  position: relative;\n  overflow: visible;\n  -webkit-tap-highlight-color: transparent;\n}\n.CodeMirror-wrap pre {\n  word-wrap: break-word;\n  white-space: pre-wrap;\n  word-break: normal;\n}\n\n.CodeMirror-linebackground {\n  position: absolute;\n  left: 0; right: 0; top: 0; bottom: 0;\n  z-index: 0;\n}\n\n.CodeMirror-linewidget {\n  position: relative;\n  z-index: 2;\n  overflow: auto;\n}\n\n.CodeMirror-widget {}\n\n.CodeMirror-code {\n  outline: none;\n}\n\n/* Force content-box sizing for the elements where we expect it */\n.CodeMirror-scroll,\n.CodeMirror-sizer,\n.CodeMirror-gutter,\n.CodeMirror-gutters,\n.CodeMirror-linenumber {\n  -moz-box-sizing: content-box;\n  box-sizing: content-box;\n}\n\n.CodeMirror-measure {\n  position: absolute;\n  width: 100%;\n  height: 0;\n  overflow: hidden;\n  visibility: hidden;\n}\n.CodeMirror-measure pre { position: static; }\n\n.CodeMirror div.CodeMirror-cursor {\n  position: absolute;\n  border-right: none;\n  width: 0;\n}\n\ndiv.CodeMirror-cursors {\n  visibility: hidden;\n  position: relative;\n  z-index: 3;\n}\n.CodeMirror-focused div.CodeMirror-cursors {\n  visibility: visible;\n}\n\n.CodeMirror-selected { background: #d9d9d9; }\n.CodeMirror-focused .CodeMirror-selected { background: #d7d4f0; }\n.CodeMirror-crosshair { cursor: crosshair; }\n.CodeMirror ::selection { background: #d7d4f0; }\n.CodeMirror ::-moz-selection { background: #d7d4f0; }\n\n.cm-searching {\n  background: #ffa;\n  background: rgba(255, 255, 0, .4);\n}\n\n/* IE7 hack to prevent it from returning funny offsetTops on the spans */\n.CodeMirror span { *vertical-align: text-bottom; }\n\n/* Used to force a border model for a node */\n.cm-force-border { padding-right: .1px; }\n\n@media print {\n  /* Hide the cursor when printing */\n  .CodeMirror div.CodeMirror-cursors {\n    visibility: hidden;\n  }\n}\n\n/* See issue #2901 */\n.cm-tab-wrap-hack:after { content: ''; }\n\n/* Help users use markselection to safely style text background */\nspan.CodeMirror-selectedtext { background: none; }\n\n\n\n/** WEBPACK FOOTER **\n ** ../~/codemirror/lib/codemirror.css\n **/","// style-loader: Adds some css to the DOM by adding a <style> tag\nvar dispose = require(\"!/Users/hein/repos/autolayout/visualformat-editor/node_modules/style-loader/addStyle.js\")\n\t// The css code:\n\t(require(\"!!/Users/hein/repos/autolayout/visualformat-editor/node_modules/css-loader/index.js!/Users/hein/repos/autolayout/visualformat-editor/src/mode/vfl/vfl.css\"));\n// Hot Module Replacement\nif(module.hot) {\n\tmodule.hot.accept();\n\tmodule.hot.dispose(dispose);\n}\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ./mode/vfl/vfl.css\n ** module id = 32\n ** module chunks = 0\n **/",".cm-s-vfl span.cm-def {color: #D8D8D8;}\n.cm-s-vfl span.cm-atom {color: #62a35c;}\n.cm-s-vfl span.cm-meta {color: #a71d5d;}\n.cm-s-vfl span.cm-number {color: #0086b3;}\n.cm-s-vfl span.cm-bracket {color: #193691;}\n.cm-s-vfl span.cm-keyword {color: #193691; font-weight: bold;}\n.cm-s-vfl span.cm-variable {color: #f09e53;}\n.cm-s-vfl span.cm-operator {color: #795da3;}\n.cm-s-vfl span.cm-comment {color: #999999;}\n\n\n\n/** WEBPACK FOOTER **\n ** ./mode/vfl/vfl.css\n **/",";(function () {\n\t'use strict';\n\n\t/**\n\t * @preserve FastClick: polyfill to remove click delays on browsers with touch UIs.\n\t *\n\t * @codingstandard ftlabs-jsv2\n\t * @copyright The Financial Times Limited [All Rights Reserved]\n\t * @license MIT License (see LICENSE.txt)\n\t */\n\n\t/*jslint browser:true, node:true*/\n\t/*global define, Event, Node*/\n\n\n\t/**\n\t * Instantiate fast-clicking listeners on the specified layer.\n\t *\n\t * @constructor\n\t * @param {Element} layer The layer to listen on\n\t * @param {Object} [options={}] The options to override the defaults\n\t */\n\tfunction FastClick(layer, options) {\n\t\tvar oldOnClick;\n\n\t\toptions = options || {};\n\n\t\t/**\n\t\t * Whether a click is currently being tracked.\n\t\t *\n\t\t * @type boolean\n\t\t */\n\t\tthis.trackingClick = false;\n\n\n\t\t/**\n\t\t * Timestamp for when click tracking started.\n\t\t *\n\t\t * @type number\n\t\t */\n\t\tthis.trackingClickStart = 0;\n\n\n\t\t/**\n\t\t * The element being tracked for a click.\n\t\t *\n\t\t * @type EventTarget\n\t\t */\n\t\tthis.targetElement = null;\n\n\n\t\t/**\n\t\t * X-coordinate of touch start event.\n\t\t *\n\t\t * @type number\n\t\t */\n\t\tthis.touchStartX = 0;\n\n\n\t\t/**\n\t\t * Y-coordinate of touch start event.\n\t\t *\n\t\t * @type number\n\t\t */\n\t\tthis.touchStartY = 0;\n\n\n\t\t/**\n\t\t * ID of the last touch, retrieved from Touch.identifier.\n\t\t *\n\t\t * @type number\n\t\t */\n\t\tthis.lastTouchIdentifier = 0;\n\n\n\t\t/**\n\t\t * Touchmove boundary, beyond which a click will be cancelled.\n\t\t *\n\t\t * @type number\n\t\t */\n\t\tthis.touchBoundary = options.touchBoundary || 10;\n\n\n\t\t/**\n\t\t * The FastClick layer.\n\t\t *\n\t\t * @type Element\n\t\t */\n\t\tthis.layer = layer;\n\n\t\t/**\n\t\t * The minimum time between tap(touchstart and touchend) events\n\t\t *\n\t\t * @type number\n\t\t */\n\t\tthis.tapDelay = options.tapDelay || 200;\n\n\t\t/**\n\t\t * The maximum time for a tap\n\t\t *\n\t\t * @type number\n\t\t */\n\t\tthis.tapTimeout = options.tapTimeout || 700;\n\n\t\tif (FastClick.notNeeded(layer)) {\n\t\t\treturn;\n\t\t}\n\n\t\t// Some old versions of Android don't have Function.prototype.bind\n\t\tfunction bind(method, context) {\n\t\t\treturn function() { return method.apply(context, arguments); };\n\t\t}\n\n\n\t\tvar methods = ['onMouse', 'onClick', 'onTouchStart', 'onTouchMove', 'onTouchEnd', 'onTouchCancel'];\n\t\tvar context = this;\n\t\tfor (var i = 0, l = methods.length; i < l; i++) {\n\t\t\tcontext[methods[i]] = bind(context[methods[i]], context);\n\t\t}\n\n\t\t// Set up event handlers as required\n\t\tif (deviceIsAndroid) {\n\t\t\tlayer.addEventListener('mouseover', this.onMouse, true);\n\t\t\tlayer.addEventListener('mousedown', this.onMouse, true);\n\t\t\tlayer.addEventListener('mouseup', this.onMouse, true);\n\t\t}\n\n\t\tlayer.addEventListener('click', this.onClick, true);\n\t\tlayer.addEventListener('touchstart', this.onTouchStart, false);\n\t\tlayer.addEventListener('touchmove', this.onTouchMove, false);\n\t\tlayer.addEventListener('touchend', this.onTouchEnd, false);\n\t\tlayer.addEventListener('touchcancel', this.onTouchCancel, false);\n\n\t\t// Hack is required for browsers that don't support Event#stopImmediatePropagation (e.g. Android 2)\n\t\t// which is how FastClick normally stops click events bubbling to callbacks registered on the FastClick\n\t\t// layer when they are cancelled.\n\t\tif (!Event.prototype.stopImmediatePropagation) {\n\t\t\tlayer.removeEventListener = function(type, callback, capture) {\n\t\t\t\tvar rmv = Node.prototype.removeEventListener;\n\t\t\t\tif (type === 'click') {\n\t\t\t\t\trmv.call(layer, type, callback.hijacked || callback, capture);\n\t\t\t\t} else {\n\t\t\t\t\trmv.call(layer, type, callback, capture);\n\t\t\t\t}\n\t\t\t};\n\n\t\t\tlayer.addEventListener = function(type, callback, capture) {\n\t\t\t\tvar adv = Node.prototype.addEventListener;\n\t\t\t\tif (type === 'click') {\n\t\t\t\t\tadv.call(layer, type, callback.hijacked || (callback.hijacked = function(event) {\n\t\t\t\t\t\tif (!event.propagationStopped) {\n\t\t\t\t\t\t\tcallback(event);\n\t\t\t\t\t\t}\n\t\t\t\t\t}), capture);\n\t\t\t\t} else {\n\t\t\t\t\tadv.call(layer, type, callback, capture);\n\t\t\t\t}\n\t\t\t};\n\t\t}\n\n\t\t// If a handler is already declared in the element's onclick attribute, it will be fired before\n\t\t// FastClick's onClick handler. Fix this by pulling out the user-defined handler function and\n\t\t// adding it as listener.\n\t\tif (typeof layer.onclick === 'function') {\n\n\t\t\t// Android browser on at least 3.2 requires a new reference to the function in layer.onclick\n\t\t\t// - the old one won't work if passed to addEventListener directly.\n\t\t\toldOnClick = layer.onclick;\n\t\t\tlayer.addEventListener('click', function(event) {\n\t\t\t\toldOnClick(event);\n\t\t\t}, false);\n\t\t\tlayer.onclick = null;\n\t\t}\n\t}\n\n\t/**\n\t* Windows Phone 8.1 fakes user agent string to look like Android and iPhone.\n\t*\n\t* @type boolean\n\t*/\n\tvar deviceIsWindowsPhone = navigator.userAgent.indexOf(\"Windows Phone\") >= 0;\n\n\t/**\n\t * Android requires exceptions.\n\t *\n\t * @type boolean\n\t */\n\tvar deviceIsAndroid = navigator.userAgent.indexOf('Android') > 0 && !deviceIsWindowsPhone;\n\n\n\t/**\n\t * iOS requires exceptions.\n\t *\n\t * @type boolean\n\t */\n\tvar deviceIsIOS = /iP(ad|hone|od)/.test(navigator.userAgent) && !deviceIsWindowsPhone;\n\n\n\t/**\n\t * iOS 4 requires an exception for select elements.\n\t *\n\t * @type boolean\n\t */\n\tvar deviceIsIOS4 = deviceIsIOS && (/OS 4_\\d(_\\d)?/).test(navigator.userAgent);\n\n\n\t/**\n\t * iOS 6.0-7.* requires the target element to be manually derived\n\t *\n\t * @type boolean\n\t */\n\tvar deviceIsIOSWithBadTarget = deviceIsIOS && (/OS [6-7]_\\d/).test(navigator.userAgent);\n\n\t/**\n\t * BlackBerry requires exceptions.\n\t *\n\t * @type boolean\n\t */\n\tvar deviceIsBlackBerry10 = navigator.userAgent.indexOf('BB10') > 0;\n\n\t/**\n\t * Determine whether a given element requires a native click.\n\t *\n\t * @param {EventTarget|Element} target Target DOM element\n\t * @returns {boolean} Returns true if the element needs a native click\n\t */\n\tFastClick.prototype.needsClick = function(target) {\n\t\tswitch (target.nodeName.toLowerCase()) {\n\n\t\t// Don't send a synthetic click to disabled inputs (issue #62)\n\t\tcase 'button':\n\t\tcase 'select':\n\t\tcase 'textarea':\n\t\t\tif (target.disabled) {\n\t\t\t\treturn true;\n\t\t\t}\n\n\t\t\tbreak;\n\t\tcase 'input':\n\n\t\t\t// File inputs need real clicks on iOS 6 due to a browser bug (issue #68)\n\t\t\tif ((deviceIsIOS && target.type === 'file') || target.disabled) {\n\t\t\t\treturn true;\n\t\t\t}\n\n\t\t\tbreak;\n\t\tcase 'label':\n\t\tcase 'iframe': // iOS8 homescreen apps can prevent events bubbling into frames\n\t\tcase 'video':\n\t\t\treturn true;\n\t\t}\n\n\t\treturn (/\\bneedsclick\\b/).test(target.className);\n\t};\n\n\n\t/**\n\t * Determine whether a given element requires a call to focus to simulate click into element.\n\t *\n\t * @param {EventTarget|Element} target Target DOM element\n\t * @returns {boolean} Returns true if the element requires a call to focus to simulate native click.\n\t */\n\tFastClick.prototype.needsFocus = function(target) {\n\t\tswitch (target.nodeName.toLowerCase()) {\n\t\tcase 'textarea':\n\t\t\treturn true;\n\t\tcase 'select':\n\t\t\treturn !deviceIsAndroid;\n\t\tcase 'input':\n\t\t\tswitch (target.type) {\n\t\t\tcase 'button':\n\t\t\tcase 'checkbox':\n\t\t\tcase 'file':\n\t\t\tcase 'image':\n\t\t\tcase 'radio':\n\t\t\tcase 'submit':\n\t\t\t\treturn false;\n\t\t\t}\n\n\t\t\t// No point in attempting to focus disabled inputs\n\t\t\treturn !target.disabled && !target.readOnly;\n\t\tdefault:\n\t\t\treturn (/\\bneedsfocus\\b/).test(target.className);\n\t\t}\n\t};\n\n\n\t/**\n\t * Send a click event to the specified element.\n\t *\n\t * @param {EventTarget|Element} targetElement\n\t * @param {Event} event\n\t */\n\tFastClick.prototype.sendClick = function(targetElement, event) {\n\t\tvar clickEvent, touch;\n\n\t\t// On some Android devices activeElement needs to be blurred otherwise the synthetic click will have no effect (#24)\n\t\tif (document.activeElement && document.activeElement !== targetElement) {\n\t\t\tdocument.activeElement.blur();\n\t\t}\n\n\t\ttouch = event.changedTouches[0];\n\n\t\t// Synthesise a click event, with an extra attribute so it can be tracked\n\t\tclickEvent = document.createEvent('MouseEvents');\n\t\tclickEvent.initMouseEvent(this.determineEventType(targetElement), true, true, window, 1, touch.screenX, touch.screenY, touch.clientX, touch.clientY, false, false, false, false, 0, null);\n\t\tclickEvent.forwardedTouchEvent = true;\n\t\ttargetElement.dispatchEvent(clickEvent);\n\t};\n\n\tFastClick.prototype.determineEventType = function(targetElement) {\n\n\t\t//Issue #159: Android Chrome Select Box does not open with a synthetic click event\n\t\tif (deviceIsAndroid && targetElement.tagName.toLowerCase() === 'select') {\n\t\t\treturn 'mousedown';\n\t\t}\n\n\t\treturn 'click';\n\t};\n\n\n\t/**\n\t * @param {EventTarget|Element} targetElement\n\t */\n\tFastClick.prototype.focus = function(targetElement) {\n\t\tvar length;\n\n\t\t// Issue #160: on iOS 7, some input elements (e.g. date datetime month) throw a vague TypeError on setSelectionRange. These elements don't have an integer value for the selectionStart and selectionEnd properties, but unfortunately that can't be used for detection because accessing the properties also throws a TypeError. Just check the type instead. Filed as Apple bug #15122724.\n\t\tif (deviceIsIOS && targetElement.setSelectionRange && targetElement.type.indexOf('date') !== 0 && targetElement.type !== 'time' && targetElement.type !== 'month') {\n\t\t\tlength = targetElement.value.length;\n\t\t\ttargetElement.setSelectionRange(length, length);\n\t\t} else {\n\t\t\ttargetElement.focus();\n\t\t}\n\t};\n\n\n\t/**\n\t * Check whether the given target element is a child of a scrollable layer and if so, set a flag on it.\n\t *\n\t * @param {EventTarget|Element} targetElement\n\t */\n\tFastClick.prototype.updateScrollParent = function(targetElement) {\n\t\tvar scrollParent, parentElement;\n\n\t\tscrollParent = targetElement.fastClickScrollParent;\n\n\t\t// Attempt to discover whether the target element is contained within a scrollable layer. Re-check if the\n\t\t// target element was moved to another parent.\n\t\tif (!scrollParent || !scrollParent.contains(targetElement)) {\n\t\t\tparentElement = targetElement;\n\t\t\tdo {\n\t\t\t\tif (parentElement.scrollHeight > parentElement.offsetHeight) {\n\t\t\t\t\tscrollParent = parentElement;\n\t\t\t\t\ttargetElement.fastClickScrollParent = parentElement;\n\t\t\t\t\tbreak;\n\t\t\t\t}\n\n\t\t\t\tparentElement = parentElement.parentElement;\n\t\t\t} while (parentElement);\n\t\t}\n\n\t\t// Always update the scroll top tracker if possible.\n\t\tif (scrollParent) {\n\t\t\tscrollParent.fastClickLastScrollTop = scrollParent.scrollTop;\n\t\t}\n\t};\n\n\n\t/**\n\t * @param {EventTarget} targetElement\n\t * @returns {Element|EventTarget}\n\t */\n\tFastClick.prototype.getTargetElementFromEventTarget = function(eventTarget) {\n\n\t\t// On some older browsers (notably Safari on iOS 4.1 - see issue #56) the event target may be a text node.\n\t\tif (eventTarget.nodeType === Node.TEXT_NODE) {\n\t\t\treturn eventTarget.parentNode;\n\t\t}\n\n\t\treturn eventTarget;\n\t};\n\n\n\t/**\n\t * On touch start, record the position and scroll offset.\n\t *\n\t * @param {Event} event\n\t * @returns {boolean}\n\t */\n\tFastClick.prototype.onTouchStart = function(event) {\n\t\tvar targetElement, touch, selection;\n\n\t\t// Ignore multiple touches, otherwise pinch-to-zoom is prevented if both fingers are on the FastClick element (issue #111).\n\t\tif (event.targetTouches.length > 1) {\n\t\t\treturn true;\n\t\t}\n\n\t\ttargetElement = this.getTargetElementFromEventTarget(event.target);\n\t\ttouch = event.targetTouches[0];\n\n\t\tif (deviceIsIOS) {\n\n\t\t\t// Only trusted events will deselect text on iOS (issue #49)\n\t\t\tselection = window.getSelection();\n\t\t\tif (selection.rangeCount && !selection.isCollapsed) {\n\t\t\t\treturn true;\n\t\t\t}\n\n\t\t\tif (!deviceIsIOS4) {\n\n\t\t\t\t// Weird things happen on iOS when an alert or confirm dialog is opened from a click event callback (issue #23):\n\t\t\t\t// when the user next taps anywhere else on the page, new touchstart and touchend events are dispatched\n\t\t\t\t// with the same identifier as the touch event that previously triggered the click that triggered the alert.\n\t\t\t\t// Sadly, there is an issue on iOS 4 that causes some normal touch events to have the same identifier as an\n\t\t\t\t// immediately preceeding touch event (issue #52), so this fix is unavailable on that platform.\n\t\t\t\t// Issue 120: touch.identifier is 0 when Chrome dev tools 'Emulate touch events' is set with an iOS device UA string,\n\t\t\t\t// which causes all touch events to be ignored. As this block only applies to iOS, and iOS identifiers are always long,\n\t\t\t\t// random integers, it's safe to to continue if the identifier is 0 here.\n\t\t\t\tif (touch.identifier && touch.identifier === this.lastTouchIdentifier) {\n\t\t\t\t\tevent.preventDefault();\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\n\t\t\t\tthis.lastTouchIdentifier = touch.identifier;\n\n\t\t\t\t// If the target element is a child of a scrollable layer (using -webkit-overflow-scrolling: touch) and:\n\t\t\t\t// 1) the user does a fling scroll on the scrollable layer\n\t\t\t\t// 2) the user stops the fling scroll with another tap\n\t\t\t\t// then the event.target of the last 'touchend' event will be the element that was under the user's finger\n\t\t\t\t// when the fling scroll was started, causing FastClick to send a click event to that layer - unless a check\n\t\t\t\t// is made to ensure that a parent layer was not scrolled before sending a synthetic click (issue #42).\n\t\t\t\tthis.updateScrollParent(targetElement);\n\t\t\t}\n\t\t}\n\n\t\tthis.trackingClick = true;\n\t\tthis.trackingClickStart = event.timeStamp;\n\t\tthis.targetElement = targetElement;\n\n\t\tthis.touchStartX = touch.pageX;\n\t\tthis.touchStartY = touch.pageY;\n\n\t\t// Prevent phantom clicks on fast double-tap (issue #36)\n\t\tif ((event.timeStamp - this.lastClickTime) < this.tapDelay) {\n\t\t\tevent.preventDefault();\n\t\t}\n\n\t\treturn true;\n\t};\n\n\n\t/**\n\t * Based on a touchmove event object, check whether the touch has moved past a boundary since it started.\n\t *\n\t * @param {Event} event\n\t * @returns {boolean}\n\t */\n\tFastClick.prototype.touchHasMoved = function(event) {\n\t\tvar touch = event.changedTouches[0], boundary = this.touchBoundary;\n\n\t\tif (Math.abs(touch.pageX - this.touchStartX) > boundary || Math.abs(touch.pageY - this.touchStartY) > boundary) {\n\t\t\treturn true;\n\t\t}\n\n\t\treturn false;\n\t};\n\n\n\t/**\n\t * Update the last position.\n\t *\n\t * @param {Event} event\n\t * @returns {boolean}\n\t */\n\tFastClick.prototype.onTouchMove = function(event) {\n\t\tif (!this.trackingClick) {\n\t\t\treturn true;\n\t\t}\n\n\t\t// If the touch has moved, cancel the click tracking\n\t\tif (this.targetElement !== this.getTargetElementFromEventTarget(event.target) || this.touchHasMoved(event)) {\n\t\t\tthis.trackingClick = false;\n\t\t\tthis.targetElement = null;\n\t\t}\n\n\t\treturn true;\n\t};\n\n\n\t/**\n\t * Attempt to find the labelled control for the given label element.\n\t *\n\t * @param {EventTarget|HTMLLabelElement} labelElement\n\t * @returns {Element|null}\n\t */\n\tFastClick.prototype.findControl = function(labelElement) {\n\n\t\t// Fast path for newer browsers supporting the HTML5 control attribute\n\t\tif (labelElement.control !== undefined) {\n\t\t\treturn labelElement.control;\n\t\t}\n\n\t\t// All browsers under test that support touch events also support the HTML5 htmlFor attribute\n\t\tif (labelElement.htmlFor) {\n\t\t\treturn document.getElementById(labelElement.htmlFor);\n\t\t}\n\n\t\t// If no for attribute exists, attempt to retrieve the first labellable descendant element\n\t\t// the list of which is defined here: http://www.w3.org/TR/html5/forms.html#category-label\n\t\treturn labelElement.querySelector('button, input:not([type=hidden]), keygen, meter, output, progress, select, textarea');\n\t};\n\n\n\t/**\n\t * On touch end, determine whether to send a click event at once.\n\t *\n\t * @param {Event} event\n\t * @returns {boolean}\n\t */\n\tFastClick.prototype.onTouchEnd = function(event) {\n\t\tvar forElement, trackingClickStart, targetTagName, scrollParent, touch, targetElement = this.targetElement;\n\n\t\tif (!this.trackingClick) {\n\t\t\treturn true;\n\t\t}\n\n\t\t// Prevent phantom clicks on fast double-tap (issue #36)\n\t\tif ((event.timeStamp - this.lastClickTime) < this.tapDelay) {\n\t\t\tthis.cancelNextClick = true;\n\t\t\treturn true;\n\t\t}\n\n\t\tif ((event.timeStamp - this.trackingClickStart) > this.tapTimeout) {\n\t\t\treturn true;\n\t\t}\n\n\t\t// Reset to prevent wrong click cancel on input (issue #156).\n\t\tthis.cancelNextClick = false;\n\n\t\tthis.lastClickTime = event.timeStamp;\n\n\t\ttrackingClickStart = this.trackingClickStart;\n\t\tthis.trackingClick = false;\n\t\tthis.trackingClickStart = 0;\n\n\t\t// On some iOS devices, the targetElement supplied with the event is invalid if the layer\n\t\t// is performing a transition or scroll, and has to be re-detected manually. Note that\n\t\t// for this to function correctly, it must be called *after* the event target is checked!\n\t\t// See issue #57; also filed as rdar://13048589 .\n\t\tif (deviceIsIOSWithBadTarget) {\n\t\t\ttouch = event.changedTouches[0];\n\n\t\t\t// In certain cases arguments of elementFromPoint can be negative, so prevent setting targetElement to null\n\t\t\ttargetElement = document.elementFromPoint(touch.pageX - window.pageXOffset, touch.pageY - window.pageYOffset) || targetElement;\n\t\t\ttargetElement.fastClickScrollParent = this.targetElement.fastClickScrollParent;\n\t\t}\n\n\t\ttargetTagName = targetElement.tagName.toLowerCase();\n\t\tif (targetTagName === 'label') {\n\t\t\tforElement = this.findControl(targetElement);\n\t\t\tif (forElement) {\n\t\t\t\tthis.focus(targetElement);\n\t\t\t\tif (deviceIsAndroid) {\n\t\t\t\t\treturn false;\n\t\t\t\t}\n\n\t\t\t\ttargetElement = forElement;\n\t\t\t}\n\t\t} else if (this.needsFocus(targetElement)) {\n\n\t\t\t// Case 1: If the touch started a while ago (best guess is 100ms based on tests for issue #36) then focus will be triggered anyway. Return early and unset the target element reference so that the subsequent click will be allowed through.\n\t\t\t// Case 2: Without this exception for input elements tapped when the document is contained in an iframe, then any inputted text won't be visible even though the value attribute is updated as the user types (issue #37).\n\t\t\tif ((event.timeStamp - trackingClickStart) > 100 || (deviceIsIOS && window.top !== window && targetTagName === 'input')) {\n\t\t\t\tthis.targetElement = null;\n\t\t\t\treturn false;\n\t\t\t}\n\n\t\t\tthis.focus(targetElement);\n\t\t\tthis.sendClick(targetElement, event);\n\n\t\t\t// Select elements need the event to go through on iOS 4, otherwise the selector menu won't open.\n\t\t\t// Also this breaks opening selects when VoiceOver is active on iOS6, iOS7 (and possibly others)\n\t\t\tif (!deviceIsIOS || targetTagName !== 'select') {\n\t\t\t\tthis.targetElement = null;\n\t\t\t\tevent.preventDefault();\n\t\t\t}\n\n\t\t\treturn false;\n\t\t}\n\n\t\tif (deviceIsIOS && !deviceIsIOS4) {\n\n\t\t\t// Don't send a synthetic click event if the target element is contained within a parent layer that was scrolled\n\t\t\t// and this tap is being used to stop the scrolling (usually initiated by a fling - issue #42).\n\t\t\tscrollParent = targetElement.fastClickScrollParent;\n\t\t\tif (scrollParent && scrollParent.fastClickLastScrollTop !== scrollParent.scrollTop) {\n\t\t\t\treturn true;\n\t\t\t}\n\t\t}\n\n\t\t// Prevent the actual click from going though - unless the target node is marked as requiring\n\t\t// real clicks or if it is in the whitelist in which case only non-programmatic clicks are permitted.\n\t\tif (!this.needsClick(targetElement)) {\n\t\t\tevent.preventDefault();\n\t\t\tthis.sendClick(targetElement, event);\n\t\t}\n\n\t\treturn false;\n\t};\n\n\n\t/**\n\t * On touch cancel, stop tracking the click.\n\t *\n\t * @returns {void}\n\t */\n\tFastClick.prototype.onTouchCancel = function() {\n\t\tthis.trackingClick = false;\n\t\tthis.targetElement = null;\n\t};\n\n\n\t/**\n\t * Determine mouse events which should be permitted.\n\t *\n\t * @param {Event} event\n\t * @returns {boolean}\n\t */\n\tFastClick.prototype.onMouse = function(event) {\n\n\t\t// If a target element was never set (because a touch event was never fired) allow the event\n\t\tif (!this.targetElement) {\n\t\t\treturn true;\n\t\t}\n\n\t\tif (event.forwardedTouchEvent) {\n\t\t\treturn true;\n\t\t}\n\n\t\t// Programmatically generated events targeting a specific element should be permitted\n\t\tif (!event.cancelable) {\n\t\t\treturn true;\n\t\t}\n\n\t\t// Derive and check the target element to see whether the mouse event needs to be permitted;\n\t\t// unless explicitly enabled, prevent non-touch click events from triggering actions,\n\t\t// to prevent ghost/doubleclicks.\n\t\tif (!this.needsClick(this.targetElement) || this.cancelNextClick) {\n\n\t\t\t// Prevent any user-added listeners declared on FastClick element from being fired.\n\t\t\tif (event.stopImmediatePropagation) {\n\t\t\t\tevent.stopImmediatePropagation();\n\t\t\t} else {\n\n\t\t\t\t// Part of the hack for browsers that don't support Event#stopImmediatePropagation (e.g. Android 2)\n\t\t\t\tevent.propagationStopped = true;\n\t\t\t}\n\n\t\t\t// Cancel the event\n\t\t\tevent.stopPropagation();\n\t\t\tevent.preventDefault();\n\n\t\t\treturn false;\n\t\t}\n\n\t\t// If the mouse event is permitted, return true for the action to go through.\n\t\treturn true;\n\t};\n\n\n\t/**\n\t * On actual clicks, determine whether this is a touch-generated click, a click action occurring\n\t * naturally after a delay after a touch (which needs to be cancelled to avoid duplication), or\n\t * an actual click which should be permitted.\n\t *\n\t * @param {Event} event\n\t * @returns {boolean}\n\t */\n\tFastClick.prototype.onClick = function(event) {\n\t\tvar permitted;\n\n\t\t// It's possible for another FastClick-like library delivered with third-party code to fire a click event before FastClick does (issue #44). In that case, set the click-tracking flag back to false and return early. This will cause onTouchEnd to return early.\n\t\tif (this.trackingClick) {\n\t\t\tthis.targetElement = null;\n\t\t\tthis.trackingClick = false;\n\t\t\treturn true;\n\t\t}\n\n\t\t// Very odd behaviour on iOS (issue #18): if a submit element is present inside a form and the user hits enter in the iOS simulator or clicks the Go button on the pop-up OS keyboard the a kind of 'fake' click event will be triggered with the submit-type input element as the target.\n\t\tif (event.target.type === 'submit' && event.detail === 0) {\n\t\t\treturn true;\n\t\t}\n\n\t\tpermitted = this.onMouse(event);\n\n\t\t// Only unset targetElement if the click is not permitted. This will ensure that the check for !targetElement in onMouse fails and the browser's click doesn't go through.\n\t\tif (!permitted) {\n\t\t\tthis.targetElement = null;\n\t\t}\n\n\t\t// If clicks are permitted, return true for the action to go through.\n\t\treturn permitted;\n\t};\n\n\n\t/**\n\t * Remove all FastClick's event listeners.\n\t *\n\t * @returns {void}\n\t */\n\tFastClick.prototype.destroy = function() {\n\t\tvar layer = this.layer;\n\n\t\tif (deviceIsAndroid) {\n\t\t\tlayer.removeEventListener('mouseover', this.onMouse, true);\n\t\t\tlayer.removeEventListener('mousedown', this.onMouse, true);\n\t\t\tlayer.removeEventListener('mouseup', this.onMouse, true);\n\t\t}\n\n\t\tlayer.removeEventListener('click', this.onClick, true);\n\t\tlayer.removeEventListener('touchstart', this.onTouchStart, false);\n\t\tlayer.removeEventListener('touchmove', this.onTouchMove, false);\n\t\tlayer.removeEventListener('touchend', this.onTouchEnd, false);\n\t\tlayer.removeEventListener('touchcancel', this.onTouchCancel, false);\n\t};\n\n\n\t/**\n\t * Check whether FastClick is needed.\n\t *\n\t * @param {Element} layer The layer to listen on\n\t */\n\tFastClick.notNeeded = function(layer) {\n\t\tvar metaViewport;\n\t\tvar chromeVersion;\n\t\tvar blackberryVersion;\n\t\tvar firefoxVersion;\n\n\t\t// Devices that don't support touch don't need FastClick\n\t\tif (typeof window.ontouchstart === 'undefined') {\n\t\t\treturn true;\n\t\t}\n\n\t\t// Chrome version - zero for other browsers\n\t\tchromeVersion = +(/Chrome\\/([0-9]+)/.exec(navigator.userAgent) || [,0])[1];\n\n\t\tif (chromeVersion) {\n\n\t\t\tif (deviceIsAndroid) {\n\t\t\t\tmetaViewport = document.querySelector('meta[name=viewport]');\n\n\t\t\t\tif (metaViewport) {\n\t\t\t\t\t// Chrome on Android with user-scalable=\"no\" doesn't need FastClick (issue #89)\n\t\t\t\t\tif (metaViewport.content.indexOf('user-scalable=no') !== -1) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t\t// Chrome 32 and above with width=device-width or less don't need FastClick\n\t\t\t\t\tif (chromeVersion > 31 && document.documentElement.scrollWidth <= window.outerWidth) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t}\n\n\t\t\t// Chrome desktop doesn't need FastClick (issue #15)\n\t\t\t} else {\n\t\t\t\treturn true;\n\t\t\t}\n\t\t}\n\n\t\tif (deviceIsBlackBerry10) {\n\t\t\tblackberryVersion = navigator.userAgent.match(/Version\\/([0-9]*)\\.([0-9]*)/);\n\n\t\t\t// BlackBerry 10.3+ does not require Fastclick library.\n\t\t\t// https://github.com/ftlabs/fastclick/issues/251\n\t\t\tif (blackberryVersion[1] >= 10 && blackberryVersion[2] >= 3) {\n\t\t\t\tmetaViewport = document.querySelector('meta[name=viewport]');\n\n\t\t\t\tif (metaViewport) {\n\t\t\t\t\t// user-scalable=no eliminates click delay.\n\t\t\t\t\tif (metaViewport.content.indexOf('user-scalable=no') !== -1) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t\t// width=device-width (or less than device-width) eliminates click delay.\n\t\t\t\t\tif (document.documentElement.scrollWidth <= window.outerWidth) {\n\t\t\t\t\t\treturn true;\n\t\t\t\t\t}\n\t\t\t\t}\n\t\t\t}\n\t\t}\n\n\t\t// IE10 with -ms-touch-action: none or manipulation, which disables double-tap-to-zoom (issue #97)\n\t\tif (layer.style.msTouchAction === 'none' || layer.style.touchAction === 'manipulation') {\n\t\t\treturn true;\n\t\t}\n\n\t\t// Firefox version - zero for other browsers\n\t\tfirefoxVersion = +(/Firefox\\/([0-9]+)/.exec(navigator.userAgent) || [,0])[1];\n\n\t\tif (firefoxVersion >= 27) {\n\t\t\t// Firefox 27+ does not have tap delay if the content is not zoomable - https://bugzilla.mozilla.org/show_bug.cgi?id=922896\n\n\t\t\tmetaViewport = document.querySelector('meta[name=viewport]');\n\t\t\tif (metaViewport && (metaViewport.content.indexOf('user-scalable=no') !== -1 || document.documentElement.scrollWidth <= window.outerWidth)) {\n\t\t\t\treturn true;\n\t\t\t}\n\t\t}\n\n\t\t// IE11: prefixed -ms-touch-action is no longer supported and it's recomended to use non-prefixed version\n\t\t// http://msdn.microsoft.com/en-us/library/windows/apps/Hh767313.aspx\n\t\tif (layer.style.touchAction === 'none' || layer.style.touchAction === 'manipulation') {\n\t\t\treturn true;\n\t\t}\n\n\t\treturn false;\n\t};\n\n\n\t/**\n\t * Factory method for creating a FastClick object\n\t *\n\t * @param {Element} layer The layer to listen on\n\t * @param {Object} [options={}] The options to override the defaults\n\t */\n\tFastClick.attach = function(layer, options) {\n\t\treturn new FastClick(layer, options);\n\t};\n\n\n\tif (typeof define === 'function' && typeof define.amd === 'object' && define.amd) {\n\n\t\t// AMD. Register as an anonymous module.\n\t\tdefine(function() {\n\t\t\treturn FastClick;\n\t\t});\n\t} else if (typeof module !== 'undefined' && module.exports) {\n\t\tmodule.exports = FastClick.attach;\n\t\tmodule.exports.FastClick = FastClick;\n\t} else {\n\t\twindow.FastClick = FastClick;\n\t}\n}());\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/fastclick/lib/fastclick.js\n ** module id = 34\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2014 - 2015\n */\n\n/*global console*/\n/*eslint no-console: 0*/\n\n/**\n * LayoutController lays out renderables according to a layout-\n * function and a data-source.\n *\n * Events:\n *\n * |event      |description|\n * |-----------|-----------|\n * |layoutstart|Emitted before the layout function is executed.|\n * |layoutend  |Emitted after the layout function has been executed.|\n * |reflow     |Emitted after one or more renderables have been changed.|\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var Utility = require('famous/utilities/Utility');\n    var Entity = require('famous/core/Entity');\n    var ViewSequence = require('famous/core/ViewSequence');\n    var OptionsManager = require('famous/core/OptionsManager');\n    var EventHandler = require('famous/core/EventHandler');\n    var LayoutUtility = require('./LayoutUtility');\n    var LayoutNodeManager = require('./LayoutNodeManager');\n    var LayoutNode = require('./LayoutNode');\n    var FlowLayoutNode = require('./FlowLayoutNode');\n    var Transform = require('famous/core/Transform');\n    require('./helpers/LayoutDockHelper');\n\n    /**\n     * @class\n     * @param {Object} options Options.\n     * @param {Function|Object} [options.layout] Layout function or layout-literal.\n     * @param {Object} [options.layoutOptions] Options to pass in to the layout-function.\n     * @param {Array|ViewSequence|Object} [options.dataSource] Array, ViewSequence or Object with key/value pairs.\n     * @param {Utility.Direction} [options.direction] Direction to layout into (e.g. Utility.Direction.Y) (when omitted the default direction of the layout is used)\n     * @param {Bool} [options.flow] Enables flow animations when the layout changes (default: `false`).\n     * @param {Object} [options.flowOptions] Options used by nodes when reflowing.\n     * @param {Bool} [options.flowOptions.reflowOnResize] Smoothly reflows renderables on resize (only used when flow = true) (default: `true`).\n     * @param {Object} [options.flowOptions.spring] Spring options used by nodes when reflowing (default: `{dampingRatio: 0.8, period: 300}`).\n     * @param {Object} [options.flowOptions.properties] Properties which should be enabled or disabled for flowing.\n     * @param {Spec} [options.flowOptions.insertSpec] Size, transform, opacity... to use when inserting new renderables into the scene (default: `{}`).\n     * @param {Spec} [options.flowOptions.removeSpec] Size, transform, opacity... to use when removing renderables from the scene (default: `{}`).\n     * @param {Bool} [options.alwaysLayout] When set to true, always calls the layout function on every render-cycle (default: `false`).\n     * @param {Bool} [options.autoPipeEvents] When set to true, automatically calls .pipe on all renderables when inserted (default: `false`).\n     * @param {Object} [options.preallocateNodes] Optimisation option to improve initial scrolling/animation performance by pre-allocating nodes, e.g.: `{count: 50, spec: {size:[0, 0], transform: Transform.identity}}`.\n     * @alias module:LayoutController\n     */\n    function LayoutController(options, nodeManager) {\n\n        // Commit\n        this.id = Entity.register(this);\n        this._isDirty = true;\n        this._contextSizeCache = [0, 0];\n        this._commitOutput = {};\n\n        // Create an object to we can capture the famo.us cleanup call on\n        // LayoutController.\n        this._cleanupRegistration = {\n          commit: function() {\n              return undefined;\n          },\n          cleanup: function(context) {\n              this.cleanup(context);\n          }.bind(this)\n        };\n        this._cleanupRegistration.target = Entity.register(this._cleanupRegistration);\n        this._cleanupRegistration.render = function() {\n          return this.target;\n        }.bind(this._cleanupRegistration);\n\n        // Setup input event handler\n        this._eventInput = new EventHandler();\n        EventHandler.setInputHandler(this, this._eventInput);\n\n        // Setup event handlers\n        this._eventOutput = new EventHandler();\n        EventHandler.setOutputHandler(this, this._eventOutput);\n\n        // Data-source\n        //this._dataSource = undefined;\n        //this._nodesById = undefined;\n        //this._viewSequence = undefined;\n\n        // Layout\n        this._layout = {\n            //function: undefined,\n            //literal: undefined,\n            //capabilities: undefined,\n            options: Object.create({})\n        };\n        //this._direction = undefined;\n        this._layout.optionsManager = new OptionsManager(this._layout.options);\n        this._layout.optionsManager.on('change', function() {\n            this._isDirty = true;\n        }.bind(this));\n\n        // Create options\n        this.options = Object.create(LayoutController.DEFAULT_OPTIONS);\n        this._optionsManager = new OptionsManager(this.options);\n\n        // Create node manager that manages (Flow)LayoutNode instances\n        if (nodeManager) {\n            this._nodes = nodeManager;\n        }\n        else if (options && options.flow) {\n            this._nodes = new LayoutNodeManager(FlowLayoutNode, _initFlowLayoutNode.bind(this));\n        }\n        else {\n            this._nodes = new LayoutNodeManager(LayoutNode);\n        }\n\n        // Set options\n        this.setDirection(undefined);\n        if (options) {\n            this.setOptions(options);\n        }\n    }\n\n    LayoutController.DEFAULT_OPTIONS = {\n        flow: false,\n        flowOptions: {\n            reflowOnResize: true,\n            properties: {\n                opacity: true,\n                align: true,\n                origin: true,\n                size: true,\n                translate: true,\n                skew: true,\n                rotate: true,\n                scale: true\n            },\n            spring: {\n                dampingRatio: 0.8,\n                period: 300\n            }\n            /*insertSpec: {\n                opacity: undefined,\n                size: undefined,\n                transform: undefined,\n                origin: undefined,\n                align: undefined\n            },\n            removeSpec: {\n                opacity: undefined,\n                size: undefined,\n                transform: undefined,\n                origin: undefined,\n                align: undefined\n            }*/\n        }\n    };\n\n    /**\n     * Called whenever a layout-node is created/re-used. Initializes\n     * the node with the `insertSpec` if it has been defined.\n     */\n    function _initFlowLayoutNode(node, spec) {\n        if (!spec && this.options.flowOptions.insertSpec) {\n            node.setSpec(this.options.flowOptions.insertSpec);\n        }\n    }\n\n    /**\n     * Patches the LayoutController instance's options with the passed-in ones.\n     *\n     * @param {Options} options An object of configurable options for the LayoutController instance.\n     * @param {Function|Object} [options.layout] Layout function or layout-literal.\n     * @param {Object} [options.layoutOptions] Options to pass in to the layout-function.\n     * @param {Array|ViewSequence|Object} [options.dataSource] Array, ViewSequence or Object with key/value pairs.\n     * @param {Utility.Direction} [options.direction] Direction to layout into (e.g. Utility.Direction.Y) (when omitted the default direction of the layout is used)\n     * @param {Object} [options.flowOptions] Options used by nodes when reflowing.\n     * @param {Bool} [options.flowOptions.reflowOnResize] Smoothly reflows renderables on resize (only used when flow = true) (default: `true`).\n     * @param {Object} [options.flowOptions.spring] Spring options used by nodes when reflowing (default: `{dampingRatio: 0.8, period: 300}`).\n     * @param {Object} [options.flowOptions.properties] Properties which should be enabled or disabled for flowing.\n     * @param {Spec} [options.flowOptions.insertSpec] Size, transform, opacity... to use when inserting new renderables into the scene (default: `{}`).\n     * @param {Spec} [options.flowOptions.removeSpec] Size, transform, opacity... to use when removing renderables from the scene (default: `{}`).\n     * @param {Bool} [options.alwaysLayout] When set to true, always calls the layout function on every render-cycle (default: `false`).\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.setOptions = function(options) {\n        if ((options.alignment !== undefined) && (options.alignment !== this.options.alignment)) {\n            this._isDirty = true;\n        }\n        this._optionsManager.setOptions(options);\n        if (options.nodeSpring) {\n            console.warn('nodeSpring options have been moved inside `flowOptions`. Use `flowOptions.spring` instead.');\n            this._optionsManager.setOptions({\n                flowOptions: {\n                    spring: options.nodeSpring\n                }\n            });\n            this._nodes.setNodeOptions(this.options.flowOptions);\n        }\n        if (options.reflowOnResize !== undefined) {\n            console.warn('reflowOnResize options have been moved inside `flowOptions`. Use `flowOptions.reflowOnResize` instead.');\n            this._optionsManager.setOptions({\n                flowOptions: {\n                    reflowOnResize: options.reflowOnResize\n                }\n            });\n            this._nodes.setNodeOptions(this.options.flowOptions);\n        }\n        if (options.insertSpec) {\n            console.warn('insertSpec options have been moved inside `flowOptions`. Use `flowOptions.insertSpec` instead.');\n            this._optionsManager.setOptions({\n                flowOptions: {\n                    insertSpec: options.insertSpec\n                }\n            });\n            this._nodes.setNodeOptions(this.options.flowOptions);\n        }\n        if (options.removeSpec) {\n            console.warn('removeSpec options have been moved inside `flowOptions`. Use `flowOptions.removeSpec` instead.');\n            this._optionsManager.setOptions({\n                flowOptions: {\n                    removeSpec: options.removeSpec\n                }\n            });\n            this._nodes.setNodeOptions(this.options.flowOptions);\n        }\n        if (options.dataSource) {\n            this.setDataSource(options.dataSource);\n        }\n        if (options.layout) {\n            this.setLayout(options.layout, options.layoutOptions);\n        }\n        else if (options.layoutOptions) {\n            this.setLayoutOptions(options.layoutOptions);\n        }\n        if (options.direction !== undefined) {\n            this.setDirection(options.direction);\n        }\n        if (options.flowOptions && this.options.flow) {\n            this._nodes.setNodeOptions(this.options.flowOptions);\n        }\n        if (options.preallocateNodes) {\n            this._nodes.preallocateNodes(options.preallocateNodes.count || 0, options.preallocateNodes.spec);\n        }\n        return this;\n    };\n\n    /**\n     * Helper function to enumerate all the renderables in the datasource\n     */\n    function _forEachRenderable(callback) {\n        var dataSource = this._dataSource;\n        if (dataSource instanceof Array) {\n            for (var i = 0, j = dataSource.length; i < j; i++) {\n                callback(dataSource[i]);\n            }\n        }\n        else if (dataSource instanceof ViewSequence) {\n            var renderable;\n            while (dataSource) {\n                renderable = dataSource.get();\n                if (!renderable) {\n                    break;\n                }\n                callback(renderable);\n                dataSource = dataSource.getNext();\n            }\n        }\n        else {\n            for (var key in dataSource) {\n                callback(dataSource[key]);\n            }\n        }\n    }\n\n    /**\n     * Sets the collection of renderables which are layed out according to\n     * the layout-function.\n     *\n     * The data-source can be either an Array, ViewSequence or Object\n     * with key/value pairs.\n     *\n     * @param {Array|Object|ViewSequence} dataSource Array, ViewSequence or Object.\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.setDataSource = function(dataSource) {\n        this._dataSource = dataSource;\n        this._initialViewSequence = undefined;\n        this._nodesById = undefined;\n        if (dataSource instanceof Array) {\n            this._viewSequence = new ViewSequence(dataSource);\n            this._initialViewSequence = this._viewSequence;\n        }\n        else if ((dataSource instanceof ViewSequence) || dataSource.getNext) {\n            this._viewSequence = dataSource;\n            this._initialViewSequence = dataSource;\n        }\n        else if (dataSource instanceof Object){\n            this._nodesById = dataSource;\n        }\n        if (this.options.autoPipeEvents) {\n            if (this._dataSource.pipe) {\n                this._dataSource.pipe(this);\n                this._dataSource.pipe(this._eventOutput);\n            }\n            else {\n                _forEachRenderable.call(this, function(renderable) {\n                    if (renderable && renderable.pipe) {\n                        renderable.pipe(this);\n                        renderable.pipe(this._eventOutput);\n                    }\n                }.bind(this));\n            }\n        }\n        this._isDirty = true;\n        return this;\n    };\n\n    /**\n     * Get the data-source.\n     *\n     * @return {Array|ViewSequence|Object} data-source\n     */\n    LayoutController.prototype.getDataSource = function() {\n        return this._dataSource;\n    };\n\n    /**\n     * Set the new layout.\n     *\n     * @param {Function|Object} layout Layout function or layout-literal\n     * @param {Object} [options] Options to pass in to the layout-function\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.setLayout = function(layout, options) {\n\n        // Set new layout funtion\n        if (layout instanceof Function) {\n            this._layout._function = layout;\n            this._layout.capabilities = layout.Capabilities;\n            this._layout.literal = undefined;\n\n        // If the layout is an object, treat it as a layout-literal\n        }\n        else if (layout instanceof Object) {\n            this._layout.literal = layout;\n            this._layout.capabilities = undefined; // todo - derive from literal somehow?\n            var helperName = Object.keys(layout)[0];\n            var Helper = LayoutUtility.getRegisteredHelper(helperName);\n            this._layout._function = Helper ? function(context, options2) {\n                var helper = new Helper(context, options2);\n                helper.parse(layout[helperName]);\n            } : undefined;\n        }\n        else {\n            this._layout._function = undefined;\n            this._layout.capabilities = undefined;\n            this._layout.literal = undefined;\n        }\n\n        // Update options\n        if (options) {\n            this.setLayoutOptions(options);\n        }\n\n        // Update direction\n        this.setDirection(this._configuredDirection);\n        this._isDirty = true;\n        return this;\n    };\n\n    /**\n     * Get the current layout.\n     *\n     * @return {Function|Object} Layout function or layout literal\n     */\n    LayoutController.prototype.getLayout = function() {\n        return this._layout.literal || this._layout._function;\n    };\n\n    /**\n     * Set the options for the current layout. Use this function after\n     * `setLayout` to update one or more options for the layout-function.\n     *\n     * @param {Object} [options] Options to pass in to the layout-function\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.setLayoutOptions = function(options) {\n        this._layout.optionsManager.setOptions(options);\n        return this;\n    };\n\n    /**\n     * Get the current layout options.\n     *\n     * @return {Object} Layout options\n     */\n    LayoutController.prototype.getLayoutOptions = function() {\n        return this._layout.options;\n    };\n\n    /**\n     * Calculates the actual in-use direction based on the given direction\n     * and supported capabilities of the layout-function.\n     */\n    function _getActualDirection(direction) {\n\n        // When the direction is configured in the capabilities, look it up there\n        if (this._layout.capabilities && this._layout.capabilities.direction) {\n\n            // Multiple directions are supported\n            if (Array.isArray(this._layout.capabilities.direction)) {\n                for (var i = 0; i < this._layout.capabilities.direction.length; i++) {\n                    if (this._layout.capabilities.direction[i] === direction) {\n                        return direction;\n                    }\n                }\n                return this._layout.capabilities.direction[0];\n            }\n\n            // Only one direction is supported, we must use that\n            else {\n                return this._layout.capabilities.direction;\n            }\n        }\n\n        // Use Y-direction as a fallback\n        return (direction === undefined) ? Utility.Direction.Y : direction;\n    }\n\n    /**\n     * Set the direction of the layout. When no direction is set, the default\n     * direction of the layout function is used.\n     *\n     * @param {Utility.Direction} direction Direction (e.g. Utility.Direction.X)\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.setDirection = function(direction) {\n        this._configuredDirection = direction;\n        var newDirection = _getActualDirection.call(this, direction);\n        if (newDirection !== this._direction) {\n            this._direction = newDirection;\n            this._isDirty = true;\n        }\n    };\n\n    /**\n     * Get the direction (e.g. Utility.Direction.Y). By default, this function\n     * returns the direction that was configured by setting `setDirection`. When\n     * the direction has not been set, `undefined` is returned.\n     *\n     * When no direction has been set, the first direction is used that is specified\n     * in the capabilities of the layout-function. To obtain the actual in-use direction,\n     * use `getDirection(true)`. This method returns the actual in-use direction and\n     * never returns undefined.\n     *\n     * @param {Boolean} [actual] Set to true to obtain the actual in-use direction\n     * @return {Utility.Direction} Direction or undefined\n     */\n    LayoutController.prototype.getDirection = function(actual) {\n        return actual ? this._direction : this._configuredDirection;\n    };\n\n    /**\n     * Get the spec (size, transform, etc..) for the given renderable or\n     * Id.\n     *\n     * @param {Renderable|String} node Renderabe or Id to look for\n     * @param {Bool} [normalize] When set to `true` normalizes the origin/align into the transform translation (default: `false`).\n     * @param {Bool} [endState] When set to `true` returns the flowing end-state spec rather than the current spec.\n     * @return {Spec} spec or undefined\n     */\n    LayoutController.prototype.getSpec = function(node, normalize, endState) {\n        if (!node) {\n            return undefined;\n        }\n        if ((node instanceof String) || (typeof node === 'string')) {\n            if (!this._nodesById) {\n               return undefined;\n            }\n            node = this._nodesById[node];\n            if (!node) {\n                return undefined;\n            }\n\n            // If the result was an array, return that instead\n            if (node instanceof Array) {\n                return node;\n            }\n        }\n        if (this._specs) {\n            for (var i = 0; i < this._specs.length; i++) {\n                var spec = this._specs[i];\n                if (spec.renderNode === node) {\n                    if (endState && spec.endState) {\n                        spec = spec.endState;\n                    }\n                    // normalize align & origin into transform\n                    if (normalize && spec.transform && spec.size && (spec.align || spec.origin)) {\n                        var transform = spec.transform;\n                        if (spec.align && (spec.align[0] || spec.align[1])) {\n                            transform = Transform.thenMove(transform, [spec.align[0] * this._contextSizeCache[0], spec.align[1] * this._contextSizeCache[1], 0]);\n                        }\n                        if (spec.origin && (spec.origin[0] || spec.origin[1])) {\n                            transform = Transform.moveThen([-spec.origin[0] * spec.size[0], -spec.origin[1] * spec.size[1], 0], transform);\n                        }\n                        return {\n                            opacity: spec.opacity,\n                            size: spec.size,\n                            transform: transform\n                        };\n                    }\n                    return spec;\n                }\n            }\n        }\n        return undefined;\n    };\n\n    /**\n     * Forces a reflow of the layout the next render cycle.\n     *\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.reflowLayout = function() {\n        this._isDirty = true;\n        return this;\n    };\n\n    /**\n     * Resets the current flow state, so that all renderables\n     * are immediately displayed in their end-state.\n     *\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.resetFlowState = function() {\n        if (this.options.flow) {\n            this._resetFlowState = true;\n        }\n        return this;\n    };\n\n    /**\n     * Inserts a renderable into the data-source.\n     *\n     * The optional argument `insertSpec` is only used `flow` mode is enabled.\n     * When specified, the renderable is inserted using an animation starting with\n     * size, origin, opacity, transform, etc... as specified in `insertSpec'.\n     *\n     * @param {Number|String} indexOrId Index (0 = before first, -1 at end), within dataSource array or id (String)\n     * @param {Object} renderable Renderable to add to the data-source\n     * @param {Spec} [insertSpec] Size, transform, etc.. to start with when inserting\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.insert = function(indexOrId, renderable, insertSpec) {\n\n        // Add the renderable in case of an id (String)\n        if ((indexOrId instanceof String) || (typeof indexOrId === 'string')) {\n\n            // Create data-source if neccesary\n            if (this._dataSource === undefined) {\n                this._dataSource = {};\n                this._nodesById = this._dataSource;\n            }\n\n            // Insert renderable\n            if (this._nodesById[indexOrId] === renderable) {\n                return this;\n            }\n            this._nodesById[indexOrId] = renderable;\n        }\n\n        // Add the renderable using an index\n        else {\n\n            // Create data-source if neccesary\n            if (this._dataSource === undefined) {\n                this._dataSource = [];\n                this._viewSequence = new ViewSequence(this._dataSource);\n                this._initialViewSequence = this._viewSequence;\n            }\n\n            // Insert into array\n            var dataSource = this._viewSequence || this._dataSource;\n            var array = _getDataSourceArray.call(this);\n            if (array && (indexOrId === array.length)) {\n                indexOrId = -1;\n            }\n            if (indexOrId === -1) {\n                dataSource.push(renderable);\n            }\n            else if (indexOrId === 0) {\n                if (dataSource === this._viewSequence) {\n                    dataSource.splice(0, 0, renderable);\n                    if (this._viewSequence.getIndex() === 0) {\n                        var nextViewSequence = this._viewSequence.getNext();\n                        if (nextViewSequence && nextViewSequence.get()) {\n                            this._viewSequence = nextViewSequence;\n                        }\n                    }\n                }\n                else {\n                    dataSource.splice(0, 0, renderable);\n                }\n            }\n            else {\n                dataSource.splice(indexOrId, 0, renderable);\n            }\n        }\n\n        // When a custom insert-spec was specified, store that in the layout-node\n        if (insertSpec) {\n            this._nodes.insertNode(this._nodes.createNode(renderable, insertSpec));\n        }\n\n        // Auto pipe events\n        if (this.options.autoPipeEvents && renderable && renderable.pipe) {\n            renderable.pipe(this);\n            renderable.pipe(this._eventOutput);\n        }\n\n        // Force a reflow\n        this._isDirty = true;\n\n        return this;\n    };\n\n    /**\n     * Adds a renderable to the end of a sequential data-source.\n     *\n     * The optional argument `insertSpec` is only used `flow` mode is enabled.\n     * When specified, the renderable is inserted using an animation starting with\n     * size, origin, opacity, transform, etc... as specified in `insertSpec'.\n     *\n     * @param {Object} renderable Renderable to add to the data-source\n     * @param {Spec} [insertSpec] Size, transform, etc.. to start with when inserting\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.push = function(renderable, insertSpec) {\n        return this.insert(-1, renderable, insertSpec);\n    };\n\n    /**\n     * Helper function for finding the view-sequence node at the given position.\n     */\n    function _getViewSequenceAtIndex(index, startViewSequence) {\n        var viewSequence = startViewSequence || this._viewSequence;\n        var i = viewSequence ? viewSequence.getIndex() : index;\n        if (index > i) {\n            while (viewSequence) {\n                viewSequence = viewSequence.getNext();\n                if (!viewSequence) {\n                    return undefined;\n                }\n                i = viewSequence.getIndex();\n                if (i === index) {\n                    return viewSequence;\n                }\n                else if (index < i) {\n                    return undefined;\n                }\n            }\n        }\n        else if (index < i) {\n            while (viewSequence) {\n                viewSequence = viewSequence.getPrevious();\n                if (!viewSequence) {\n                    return undefined;\n                }\n                i = viewSequence.getIndex();\n                if (i === index) {\n                    return viewSequence;\n                }\n                else if (index > i) {\n                    return undefined;\n                }\n            }\n        }\n        return viewSequence;\n    }\n\n    /**\n     * Helper that return the underlying array datasource if available.\n     */\n    function _getDataSourceArray() {\n      if (Array.isArray(this._dataSource)) {\n        return this._dataSource;\n      }\n      else if (this._viewSequence || this._viewSequence._) {\n        return this._viewSequence._.array;\n      }\n      return undefined;\n    }\n\n    /**\n     * Get the renderable at the given index or Id.\n     *\n     * @param {Number|String} indexOrId Index within dataSource array or id (String)\n     * @return {Renderable} renderable or `undefined`\n     */\n    LayoutController.prototype.get = function(indexOrId) {\n      if (this._nodesById || (indexOrId instanceof String) || (typeof indexOrId === 'string')) {\n        return this._nodesById ? this._nodesById[indexOrId] : undefined;\n      }\n      var viewSequence = _getViewSequenceAtIndex.call(this, indexOrId);\n      return viewSequence ? viewSequence.get() : undefined;\n    };\n\n    /**\n     * Swaps two renderables at the given positions.\n     *\n     * This method is only supported for dataSources of type Array or ViewSequence.\n     *\n     * @param {Number} index Index of the renderable to swap\n     * @param {Number} index2 Index of the renderable to swap with\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.swap = function(index, index2) {\n        var array = _getDataSourceArray.call(this);\n        if (!array) {\n            throw '.swap is only supported for dataSources of type Array or ViewSequence';\n        }\n        if (index === index2) {\n          return this;\n        }\n        if ((index < 0) || (index >= array.length)) {\n          throw 'Invalid index (' + index + ') specified to .swap';\n        }\n        if ((index2 < 0) || (index2 >= array.length)) {\n          throw 'Invalid second index (' + index2 + ') specified to .swap';\n        }\n        var renderNode = array[index];\n        array[index] = array[index2];\n        array[index2] = renderNode;\n        this._isDirty = true;\n        return this;\n    };\n\n    /**\n     * Replaces a renderable at the given index or id.\n     *\n     * @param {Number|String} indexOrId Index within dataSource array or id (String)\n     * @param {Renderable} renderable renderable to replace with\n     * @param {Bool} [noAnimation] When set to `true`, replaces the renderable without any flowing animation.\n     * @return {Renderable} old renderable that has been replaced\n     */\n    LayoutController.prototype.replace = function(indexOrId, renderable, noAnimation) {\n        var oldRenderable;\n        if (this._nodesById || (indexOrId instanceof String) || (typeof indexOrId === 'string')) {\n            oldRenderable = this._nodesById[indexOrId];\n            if (oldRenderable !== renderable) {\n                if (noAnimation && oldRenderable) {\n                    var node = this._nodes.getNodeByRenderNode(oldRenderable);\n                    if (node) {\n                        node.setRenderNode(renderable);\n                    }\n                }\n                this._nodesById[indexOrId] = renderable;\n                this._isDirty = true;\n            }\n            return oldRenderable;\n        }\n        var array = _getDataSourceArray.call(this);\n        if (!array) {\n          return undefined;\n        }\n        if ((indexOrId < 0) || (indexOrId >= array.length)) {\n          throw 'Invalid index (' + indexOrId + ') specified to .replace';\n        }\n        oldRenderable = array[indexOrId];\n        if (oldRenderable !== renderable) {\n          array[indexOrId] = renderable;\n          this._isDirty = true;\n        }\n        return oldRenderable;\n    };\n\n    /**\n     * Moves a renderable to a new index.\n     *\n     * This method is only supported for dataSources of type Array or ViewSequence.\n     *\n     * @param {Number} index Index of the renderable to move.\n     * @param {Number} newIndex New index of the renderable.\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.move = function(index, newIndex) {\n        var array = _getDataSourceArray.call(this);\n        if (!array) {\n            throw '.move is only supported for dataSources of type Array or ViewSequence';\n        }\n        if ((index < 0) || (index >= array.length)) {\n          throw 'Invalid index (' + index + ') specified to .move';\n        }\n        if ((newIndex < 0) || (newIndex >= array.length)) {\n          throw 'Invalid newIndex (' + newIndex + ') specified to .move';\n        }\n        var item = array.splice(index, 1)[0];\n        array.splice(newIndex, 0, item);\n        this._isDirty = true;\n        return this;\n    };\n\n    /**\n     * Removes a renderable from the data-source.\n     *\n     * The optional argument `removeSpec` is only used `flow` mode is enabled.\n     * When specified, the renderable is removed using an animation ending at\n     * the size, origin, opacity, transform, etc... as specified in `removeSpec'.\n     *\n     * @param {Number|String|Renderable} indexOrId Index, id (String) or renderable to remove.\n     * @param {Spec} [removeSpec] Size, transform, etc.. to end with when removing\n     * @return {Renderable} renderable that has been removed\n     */\n    LayoutController.prototype.remove = function(indexOrId, removeSpec) {\n        var renderNode;\n\n        // Remove the renderable in case of an id (String)\n        if (this._nodesById || (indexOrId instanceof String) || (typeof indexOrId === 'string')) {\n\n            // Find and remove renderable from data-source\n            if ((indexOrId instanceof String) || (typeof indexOrId === 'string')) {\n                renderNode = this._nodesById[indexOrId];\n                if (renderNode) {\n                    delete this._nodesById[indexOrId];\n                }\n            }\n            else {\n                for (var key in this._nodesById) {\n                    if (this._nodesById[key] === indexOrId) {\n                        delete this._nodesById[key];\n                        renderNode = indexOrId;\n                        break;\n                    }\n                }\n            }\n        }\n\n        // Remove the renderable using an index\n        else if ((indexOrId instanceof Number) || (typeof indexOrId === 'number')) {\n            var array = _getDataSourceArray.call(this);\n            if (!array || (indexOrId < 0) || (indexOrId >= array.length)) {\n                throw 'Invalid index (' + indexOrId + ') specified to .remove (or dataSource doesn\\'t support remove)';\n            }\n            renderNode = array[indexOrId];\n            this._dataSource.splice(indexOrId, 1);\n        }\n\n        // Remove by renderable\n        else {\n            indexOrId = this._dataSource.indexOf(indexOrId);\n            if (indexOrId >= 0) {\n                this._dataSource.splice(indexOrId, 1);\n                renderNode = indexOrId;\n            }\n        }\n\n        // When a node is removed from the view-sequence, the current this._viewSequence\n        // node may not be part of the valid view-sequence anymore. This seems to be a bug\n        // in the famo.us ViewSequence implementation/concept. The following check was added\n        // to ensure that always a valid viewSequence node is selected into the ScrollView.\n        if (this._viewSequence && renderNode) {\n            var viewSequence = _getViewSequenceAtIndex.call(this, this._viewSequence.getIndex(), this._initialViewSequence);\n            viewSequence = viewSequence || _getViewSequenceAtIndex.call(this, this._viewSequence.getIndex() - 1, this._initialViewSequence);\n            viewSequence = viewSequence || this._dataSource;\n            this._viewSequence = viewSequence;\n        }\n\n        // When a custom remove-spec was specified, store that in the layout-node\n        if (renderNode && removeSpec) {\n            var node = this._nodes.getNodeByRenderNode(renderNode);\n            if (node) {\n                node.remove(removeSpec || this.options.flowOptions.removeSpec);\n            }\n        }\n\n        // Force a reflow\n        if (renderNode) {\n            this._isDirty = true;\n        }\n\n        return renderNode;\n    };\n\n    /**\n     * Removes all renderables from the data-source.\n     *\n     * The optional argument `removeSpec` is only used when `flow` mode is enabled.\n     * When specified, the renderables are removed using an animation ending at\n     * the size, origin, opacity, transform, etc... as specified in `removeSpec'.\n     *\n     * @param {Spec} [removeSpec] Size, transform, etc.. to end with when removing\n     * @return {LayoutController} this\n     */\n    LayoutController.prototype.removeAll = function(removeSpec) {\n        if (this._nodesById) {\n            var dirty = false;\n            for (var key in this._nodesById) {\n                delete this._nodesById[key];\n                dirty = true;\n            }\n            if (dirty) {\n                this._isDirty = true;\n            }\n        }\n        else if (this._dataSource){\n            this.setDataSource([]);\n        }\n        if (removeSpec) {\n            var node = this._nodes.getStartEnumNode();\n            while (node) {\n                node.remove(removeSpec || this.options.flowOptions.removeSpec);\n                node = node._next;\n            }\n        }\n        return this;\n    };\n\n    /**\n     * Return size of contained element or `undefined` when size is not defined.\n     *\n     * @return {Array.Number} [width, height]\n     */\n    LayoutController.prototype.getSize = function() {\n        return this._size || this.options.size;\n    };\n\n    /**\n     * Generate a render spec from the contents of this component.\n     *\n     * @private\n     * @method render\n     * @return {Object} Render spec for this component\n     */\n    LayoutController.prototype.render = function render() {\n        return this.id;\n    };\n\n    /**\n     * Apply changes from this component to the corresponding document element.\n     * This includes changes to classes, styles, size, content, opacity, origin,\n     * and matrix transforms.\n     *\n     * @private\n     * @method commit\n     * @param {Context} context commit context\n     */\n    LayoutController.prototype.commit = function commit(context) {\n        var transform = context.transform;\n        var origin = context.origin;\n        var size = context.size;\n        var opacity = context.opacity;\n\n        // Reset the flow-state when requested\n        if (this._resetFlowState) {\n            this._resetFlowState = false;\n            this._isDirty = true;\n            this._nodes.removeAll();\n        }\n\n        // When the size or layout function has changed, reflow the layout\n        if (size[0] !== this._contextSizeCache[0] ||\n            size[1] !== this._contextSizeCache[1] ||\n            this._isDirty ||\n            this._nodes._trueSizeRequested ||\n            this.options.alwaysLayout){\n\n            // Emit start event\n            var eventData = {\n                target: this,\n                oldSize: this._contextSizeCache,\n                size: size,\n                dirty: this._isDirty,\n                trueSizeRequested: this._nodes._trueSizeRequested\n            };\n            this._eventOutput.emit('layoutstart', eventData);\n\n            // When the layout has changed, and we are not just scrolling,\n            // disable the locked state of the layout-nodes so that they\n            // can freely transition between the old and new state.\n            if (this.options.flow) {\n                var lock = false;\n                if (!this.options.flowOptions.reflowOnResize) {\n                    if (!this._isDirty &&\n                        ((size[0] !== this._contextSizeCache[0]) ||\n                         (size[1] !== this._contextSizeCache[1]))) {\n                        lock = undefined;\n                    }\n                    else {\n                      lock = true;\n                    }\n                }\n                if (lock !== undefined) {\n                    var node = this._nodes.getStartEnumNode();\n                    while (node) {\n                        node.releaseLock(lock);\n                        node = node._next;\n                    }\n                }\n            }\n\n            // Update state\n            this._contextSizeCache[0] = size[0];\n            this._contextSizeCache[1] = size[1];\n            this._isDirty = false;\n\n            // Prepare for layout\n            var scrollEnd;\n            if (this.options.size && (this.options.size[this._direction] === true)) {\n                scrollEnd = 1000000; // calculate scroll-length\n            }\n            var layoutContext = this._nodes.prepareForLayout(\n                this._viewSequence,     // first node to layout\n                this._nodesById, {      // so we can do fast id lookups\n                    size: size,\n                    direction: this._direction,\n                    scrollEnd: scrollEnd\n                }\n            );\n\n            // Layout objects\n            if (this._layout._function) {\n                this._layout._function(\n                    layoutContext,          // context which the layout-function can use\n                    this._layout.options    // additional layout-options\n                );\n            }\n\n            // Mark non-invalidated nodes for removal\n            this._nodes.removeNonInvalidatedNodes(this.options.flowOptions.removeSpec);\n\n            // Cleanup any nodes in case of a VirtualViewSequence\n            this._nodes.removeVirtualViewSequenceNodes();\n\n            // Calculate scroll-length and use that as the true-size (height)\n            if (scrollEnd) {\n                scrollEnd = 0;\n                node = this._nodes.getStartEnumNode();\n                while (node) {\n                    if (node._invalidated && node.scrollLength) {\n                        scrollEnd += node.scrollLength;\n                    }\n                    node = node._next;\n                }\n                this._size = this._size || [0, 0];\n                this._size[0] = this.options.size[0];\n                this._size[1] = this.options.size[1];\n                this._size[this._direction] = scrollEnd;\n            }\n\n            // Update output and optionally emit event\n            var result = this._nodes.buildSpecAndDestroyUnrenderedNodes();\n            this._specs = result.specs;\n            this._commitOutput.target = result.specs;\n            this._eventOutput.emit('layoutend', eventData);\n            this._eventOutput.emit('reflow', {\n                target: this\n            });\n        }\n        else if (this.options.flow) {\n\n            // Update output and optionally emit event\n            result = this._nodes.buildSpecAndDestroyUnrenderedNodes();\n            this._specs = result.specs;\n            this._commitOutput.target = result.specs;\n            if (result.modified) {\n                this._eventOutput.emit('reflow', {\n                    target: this\n                });\n            }\n        }\n\n        // Render child-nodes every commit\n        var target = this._commitOutput.target;\n        for (var i = 0, j = target.length; i < j; i++) {\n            if (target[i].renderNode) {\n                target[i].target = target[i].renderNode.render();\n            }\n        }\n\n        // Add our cleanup-registration id also to the list, so that the\n        // cleanup function is called by famo.us when the LayoutController is\n        // removed from the render-tree.\n        if (!target.length || (target[target.length-1] !== this._cleanupRegistration)) {\n            target.push(this._cleanupRegistration);\n        }\n\n        // Translate dependent on origin\n        if (origin && ((origin[0] !== 0) || (origin[1] !== 0))) {\n            transform = Transform.moveThen([-size[0]*origin[0], -size[1]*origin[1], 0], transform);\n        }\n        this._commitOutput.size = size;\n        this._commitOutput.opacity = opacity;\n        this._commitOutput.transform = transform;\n        return this._commitOutput;\n    };\n\n    /**\n     * Called whenever the layout-controller is removed from the render-tree.\n     *\n     * @private\n     * @param {Context} context cleanup context\n     */\n    LayoutController.prototype.cleanup = function(context) {\n        if (this.options.flow) {\n            this._resetFlowState = true;\n        }\n    };\n\n    module.exports = LayoutController;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/LayoutController.js\n ** module id = 35\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nfunction ViewSequence(options) {\n    if (!options)\n        options = [];\n    if (options instanceof Array)\n        options = { array: options };\n    this._ = null;\n    this.index = options.index || 0;\n    if (options.array)\n        this._ = new this.constructor.Backing(options.array);\n    else if (options._)\n        this._ = options._;\n    if (this.index === this._.firstIndex)\n        this._.firstNode = this;\n    if (this.index === this._.firstIndex + this._.array.length - 1)\n        this._.lastNode = this;\n    if (options.loop !== undefined)\n        this._.loop = options.loop;\n    if (options.trackSize !== undefined)\n        this._.trackSize = options.trackSize;\n    this._previousNode = null;\n    this._nextNode = null;\n}\nViewSequence.Backing = function Backing(array) {\n    this.array = array;\n    this.firstIndex = 0;\n    this.loop = false;\n    this.firstNode = null;\n    this.lastNode = null;\n    this.cumulativeSizes = [[\n            0,\n            0\n        ]];\n    this.sizeDirty = true;\n    this.trackSize = false;\n};\nViewSequence.Backing.prototype.getValue = function getValue(i) {\n    var _i = i - this.firstIndex;\n    if (_i < 0 || _i >= this.array.length)\n        return null;\n    return this.array[_i];\n};\nViewSequence.Backing.prototype.setValue = function setValue(i, value) {\n    this.array[i - this.firstIndex] = value;\n};\nViewSequence.Backing.prototype.getSize = function getSize(index) {\n    return this.cumulativeSizes[index];\n};\nViewSequence.Backing.prototype.calculateSize = function calculateSize(index) {\n    index = index || this.array.length;\n    var size = [\n        0,\n        0\n    ];\n    for (var i = 0; i < index; i++) {\n        var nodeSize = this.array[i].getSize();\n        if (!nodeSize)\n            return undefined;\n        if (size[0] !== undefined) {\n            if (nodeSize[0] === undefined)\n                size[0] = undefined;\n            else\n                size[0] += nodeSize[0];\n        }\n        if (size[1] !== undefined) {\n            if (nodeSize[1] === undefined)\n                size[1] = undefined;\n            else\n                size[1] += nodeSize[1];\n        }\n        this.cumulativeSizes[i + 1] = size.slice();\n    }\n    this.sizeDirty = false;\n    return size;\n};\nViewSequence.Backing.prototype.reindex = function reindex(start, removeCount, insertCount) {\n    if (!this.array[0])\n        return;\n    var i = 0;\n    var index = this.firstIndex;\n    var indexShiftAmount = insertCount - removeCount;\n    var node = this.firstNode;\n    while (index < start - 1) {\n        node = node.getNext();\n        index++;\n    }\n    var spliceStartNode = node;\n    for (i = 0; i < removeCount; i++) {\n        node = node.getNext();\n        if (node)\n            node._previousNode = spliceStartNode;\n    }\n    var spliceResumeNode = node ? node.getNext() : null;\n    spliceStartNode._nextNode = null;\n    node = spliceStartNode;\n    for (i = 0; i < insertCount; i++)\n        node = node.getNext();\n    index += insertCount;\n    if (node !== spliceResumeNode) {\n        node._nextNode = spliceResumeNode;\n        if (spliceResumeNode)\n            spliceResumeNode._previousNode = node;\n    }\n    if (spliceResumeNode) {\n        node = spliceResumeNode;\n        index++;\n        while (node && index < this.array.length + this.firstIndex) {\n            if (node._nextNode)\n                node.index += indexShiftAmount;\n            else\n                node.index = index;\n            node = node.getNext();\n            index++;\n        }\n    }\n    if (this.trackSize)\n        this.sizeDirty = true;\n};\nViewSequence.prototype.getPrevious = function getPrevious() {\n    var len = this._.array.length;\n    if (!len) {\n        this._previousNode = null;\n    } else if (this.index === this._.firstIndex) {\n        if (this._.loop) {\n            this._previousNode = this._.lastNode || new this.constructor({\n                _: this._,\n                index: this._.firstIndex + len - 1\n            });\n            this._previousNode._nextNode = this;\n        } else {\n            this._previousNode = null;\n        }\n    } else if (!this._previousNode) {\n        this._previousNode = new this.constructor({\n            _: this._,\n            index: this.index - 1\n        });\n        this._previousNode._nextNode = this;\n    }\n    return this._previousNode;\n};\nViewSequence.prototype.getNext = function getNext() {\n    var len = this._.array.length;\n    if (!len) {\n        this._nextNode = null;\n    } else if (this.index === this._.firstIndex + len - 1) {\n        if (this._.loop) {\n            this._nextNode = this._.firstNode || new this.constructor({\n                _: this._,\n                index: this._.firstIndex\n            });\n            this._nextNode._previousNode = this;\n        } else {\n            this._nextNode = null;\n        }\n    } else if (!this._nextNode) {\n        this._nextNode = new this.constructor({\n            _: this._,\n            index: this.index + 1\n        });\n        this._nextNode._previousNode = this;\n    }\n    return this._nextNode;\n};\nViewSequence.prototype.indexOf = function indexOf(item) {\n    return this._.array.indexOf(item);\n};\nViewSequence.prototype.getIndex = function getIndex() {\n    return this.index;\n};\nViewSequence.prototype.toString = function toString() {\n    return '' + this.index;\n};\nViewSequence.prototype.unshift = function unshift(value) {\n    this._.array.unshift.apply(this._.array, arguments);\n    this._.firstIndex -= arguments.length;\n    if (this._.trackSize)\n        this._.sizeDirty = true;\n};\nViewSequence.prototype.push = function push(value) {\n    this._.array.push.apply(this._.array, arguments);\n    if (this._.trackSize)\n        this._.sizeDirty = true;\n};\nViewSequence.prototype.splice = function splice(index, howMany) {\n    var values = Array.prototype.slice.call(arguments, 2);\n    this._.array.splice.apply(this._.array, [\n        index - this._.firstIndex,\n        howMany\n    ].concat(values));\n    this._.reindex(index, howMany, values.length);\n};\nViewSequence.prototype.swap = function swap(other) {\n    var otherValue = other.get();\n    var myValue = this.get();\n    this._.setValue(this.index, otherValue);\n    this._.setValue(other.index, myValue);\n    var myPrevious = this._previousNode;\n    var myNext = this._nextNode;\n    var myIndex = this.index;\n    var otherPrevious = other._previousNode;\n    var otherNext = other._nextNode;\n    var otherIndex = other.index;\n    this.index = otherIndex;\n    this._previousNode = otherPrevious === this ? other : otherPrevious;\n    if (this._previousNode)\n        this._previousNode._nextNode = this;\n    this._nextNode = otherNext === this ? other : otherNext;\n    if (this._nextNode)\n        this._nextNode._previousNode = this;\n    other.index = myIndex;\n    other._previousNode = myPrevious === other ? this : myPrevious;\n    if (other._previousNode)\n        other._previousNode._nextNode = other;\n    other._nextNode = myNext === other ? this : myNext;\n    if (other._nextNode)\n        other._nextNode._previousNode = other;\n    if (this.index === this._.firstIndex)\n        this._.firstNode = this;\n    else if (this.index === this._.firstIndex + this._.array.length - 1)\n        this._.lastNode = this;\n    if (other.index === this._.firstIndex)\n        this._.firstNode = other;\n    else if (other.index === this._.firstIndex + this._.array.length - 1)\n        this._.lastNode = other;\n    if (this._.trackSize)\n        this._.sizeDirty = true;\n};\nViewSequence.prototype.get = function get() {\n    return this._.getValue(this.index);\n};\nViewSequence.prototype.getSize = function getSize() {\n    var target = this.get();\n    return target ? target.getSize() : null;\n};\nViewSequence.prototype.render = function render() {\n    if (this._.trackSize && this._.sizeDirty)\n        this._.calculateSize();\n    var target = this.get();\n    return target ? target.render.apply(target, arguments) : null;\n};\nmodule.exports = ViewSequence;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/ViewSequence.js\n ** module id = 36\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2014\n */\n\n/*global console*/\n/*eslint no-console:0*/\n\n/**\n * Utility class for famous-flex.\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var Utility = require('famous/utilities/Utility');\n\n    /**\n     * @class\n     * @alias module:LayoutUtility\n     */\n    function LayoutUtility() {\n    }\n    LayoutUtility.registeredHelpers = {};\n\n    var Capabilities = {\n        SEQUENCE: 1,\n        DIRECTION_X: 2,\n        DIRECTION_Y: 4,\n        SCROLLING: 8\n    };\n    LayoutUtility.Capabilities = Capabilities;\n\n    /**\n     *  Normalizes the margins argument.\n     *\n     *  @param {Array.Number} margins\n     */\n    LayoutUtility.normalizeMargins = function(margins) {\n        if (!margins) {\n            return [0, 0, 0, 0];\n        }\n        else if (!Array.isArray(margins)) {\n            return [margins, margins, margins, margins];\n        }\n        else if (margins.length === 0) {\n            return [0, 0, 0, 0];\n        }\n        else if (margins.length === 1) {\n            return [margins[0], margins[0], margins[0], margins[0]];\n        }\n        else if (margins.length === 2) {\n            return [margins[0], margins[1], margins[0], margins[1]];\n        }\n        else {\n            return margins;\n        }\n    };\n\n    /**\n     * Makes a (shallow) copy of a spec.\n     *\n     * @param {Spec} spec Spec to clone\n     * @return {Spec} cloned spec\n     */\n    LayoutUtility.cloneSpec = function(spec) {\n        var clone = {};\n        if (spec.opacity !== undefined) {\n            clone.opacity = spec.opacity;\n        }\n        if (spec.size !== undefined) {\n            clone.size = spec.size.slice(0);\n        }\n        if (spec.transform !== undefined) {\n            clone.transform = spec.transform.slice(0);\n        }\n        if (spec.origin !== undefined) {\n            clone.origin = spec.origin.slice(0);\n        }\n        if (spec.align !== undefined) {\n            clone.align = spec.align.slice(0);\n        }\n        return clone;\n    };\n\n    /**\n     * Compares two arrays for equality.\n     */\n    function _isEqualArray(a, b) {\n        if (a === b) {\n            return true;\n        }\n        if ((a === undefined) || (b === undefined)) {\n            return false;\n        }\n        var i = a.length;\n        if (i !== b.length){\n            return false;\n        }\n        while (i--) {\n            if (a[i] !== b[i]) {\n                return false;\n            }\n        }\n        return true;\n    }\n\n    /**\n     * Compares two specs for equality.\n     *\n     * @param {Spec} spec1 Spec to compare\n     * @param {Spec} spec2 Spec to compare\n     * @return {Boolean} true/false\n     */\n    LayoutUtility.isEqualSpec = function(spec1, spec2) {\n        if (spec1.opacity !== spec2.opacity) {\n            return false;\n        }\n        if (!_isEqualArray(spec1.size, spec2.size)) {\n            return false;\n        }\n        if (!_isEqualArray(spec1.transform, spec2.transform)) {\n            return false;\n        }\n        if (!_isEqualArray(spec1.origin, spec2.origin)) {\n            return false;\n        }\n        if (!_isEqualArray(spec1.align, spec2.align)) {\n            return false;\n        }\n        return true;\n    };\n\n    /**\n     * Helper function that returns a string containing the differences\n     * between two specs.\n     *\n     * @param {Spec} spec1 Spec to compare\n     * @param {Spec} spec2 Spec to compare\n     * @return {String} text\n     */\n    LayoutUtility.getSpecDiffText = function(spec1, spec2) {\n        var result = 'spec diff:';\n        if (spec1.opacity !== spec2.opacity) {\n            result += '\\nopacity: ' + spec1.opacity + ' != ' + spec2.opacity;\n        }\n        if (!_isEqualArray(spec1.size, spec2.size)) {\n            result += '\\nsize: ' + JSON.stringify(spec1.size) + ' != ' + JSON.stringify(spec2.size);\n        }\n        if (!_isEqualArray(spec1.transform, spec2.transform)) {\n            result += '\\ntransform: ' + JSON.stringify(spec1.transform) + ' != ' + JSON.stringify(spec2.transform);\n        }\n        if (!_isEqualArray(spec1.origin, spec2.origin)) {\n            result += '\\norigin: ' + JSON.stringify(spec1.origin) + ' != ' + JSON.stringify(spec2.origin);\n        }\n        if (!_isEqualArray(spec1.align, spec2.align)) {\n            result += '\\nalign: ' + JSON.stringify(spec1.align) + ' != ' + JSON.stringify(spec2.align);\n        }\n        return result;\n    };\n\n    /**\n     * Helper function to call whenever a critical error has occurred.\n     *\n     * @param {String} message error-message\n     */\n    LayoutUtility.error = function(message) {\n        console.log('ERROR: ' + message);\n        throw message;\n    };\n\n    /**\n     * Helper function to call whenever a warning error has occurred.\n     *\n     * @param {String} message warning-message\n     */\n    LayoutUtility.warning = function(message) {\n        console.log('WARNING: ' + message);\n    };\n\n    /**\n     * Helper function to log 1 or more arguments. All the arguments\n     * are concatenated to produce a single string which is logged.\n     *\n     * @param {String|Array|Object} args arguments to stringify and concatenate\n     */\n    LayoutUtility.log = function(args) {\n        var message = '';\n        for (var i = 0; i < arguments.length; i++) {\n            var arg = arguments[i];\n            if ((arg instanceof Object) || (arg instanceof Array)) {\n                message += JSON.stringify(arg);\n            }\n            else {\n                message += arg;\n            }\n        }\n        console.log(message);\n    };\n\n    /**\n     * Combines two sets of options into a single set.\n     *\n     * @param {Object} options1 base set of options\n     * @param {Object} options2 set of options to merge into `options1`\n     * @param {Bool} [forceClone] ensures that a clone is returned rather that one of the original options objects\n     * @return {Object} Combined options\n     */\n    LayoutUtility.combineOptions = function(options1, options2, forceClone) {\n        if (options1 && !options2 && !forceClone) {\n            return options1;\n        }\n        else if (!options1 && options2 && !forceClone) {\n            return options2;\n        }\n        var options = Utility.clone(options1 || {});\n        if (options2) {\n            for (var key in options2) {\n                options[key] = options2[key];\n            }\n        }\n        return options;\n    };\n\n    /**\n     * Registers a layout-helper so it can be used as a layout-literal for\n     * a layout-controller. The LayoutHelper instance must support the `parse`\n     * function, which is fed the layout-literal content.\n     *\n     * **Example:**\n     *\n     * ```javascript\n     * Layout.registerHelper('dock', LayoutDockHelper);\n     *\n     * var layoutController = new LayoutController({\n     *   layout: { dock: [,\n     *     ['top', 'header', 50],\n     *     ['bottom', 'footer', 50],\n     *     ['fill', 'content'],\n     *   ]},\n     *   dataSource: {\n     *     header: new Surface({content: 'Header'}),\n     *     footer: new Surface({content: 'Footer'}),\n     *     content: new Surface({content: 'Content'}),\n     *   }\n     * })\n     * ```\n     *\n     * @param {String} name name of the helper (e.g. 'dock')\n     * @param {Function} Helper Helper to register (e.g. LayoutDockHelper)\n     */\n    LayoutUtility.registerHelper = function(name, Helper) {\n        if (!Helper.prototype.parse) {\n            LayoutUtility.error('The layout-helper for name \"' + name + '\" is required to support the \"parse\" method');\n        }\n        if (this.registeredHelpers[name] !== undefined) {\n            LayoutUtility.warning('A layout-helper with the name \"' + name + '\" is already registered and will be overwritten');\n        }\n        this.registeredHelpers[name] = Helper;\n    };\n\n    /**\n     * Unregisters a layout-helper.\n     *\n     * @param {String} name name of the layout-helper\n     */\n    LayoutUtility.unregisterHelper = function(name) {\n        delete this.registeredHelpers[name];\n    };\n\n    /**\n     * Gets a registered layout-helper by its name.\n     *\n     * @param {String} name name of the layout-helper\n     * @return {Function} layout-helper or undefined\n     */\n    LayoutUtility.getRegisteredHelper = function(name) {\n        return this.registeredHelpers[name];\n    };\n\n    // Layout function\n    module.exports = LayoutUtility;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/LayoutUtility.js\n ** module id = 37\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2014/2015\n */\n\n/**\n * LayoutNodeManager is a private class used internally by LayoutController, ScrollController\n * and ScrollView. It manages the layout-nodes that are rendered and exposes the layout-context\n * which is passed along to the layout-function.\n *\n * LayoutNodeManager keeps track of every rendered node through an ordered double-linked\n * list. The first time the layout-function is called, the linked list is created.\n * After that, the linked list is updated to reflect the output of the layout-function.\n * When the layout is unchanged, then the linked-list exactly matches the order of the\n * accessed nodes in the layout-function, and no layout-nodes need to be created or\n * re-ordered.\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var LayoutContext = require('./LayoutContext');\n    var LayoutUtility = require('./LayoutUtility');\n    var Surface = require('famous/core/Surface');\n    var RenderNode = require('famous/core/RenderNode');\n\n    var MAX_POOL_SIZE = 100;\n\n    /**\n     * @class\n     * @param {LayoutNode} LayoutNode Layout-nodes to create\n     * @param {Function} initLayoutNodeFn function to use when initializing new nodes\n     * @alias module:LayoutNodeManager\n     */\n    function LayoutNodeManager(LayoutNode, initLayoutNodeFn) {\n        this.LayoutNode = LayoutNode;\n        this._initLayoutNodeFn = initLayoutNodeFn;\n        this._layoutCount = 0;\n        this._context = new LayoutContext({\n            next: _contextNext.bind(this),\n            prev: _contextPrev.bind(this),\n            get: _contextGet.bind(this),\n            set: _contextSet.bind(this),\n            resolveSize: _contextResolveSize.bind(this),\n            size: [0, 0]\n            //,cycle: 0\n        });\n        this._contextState = {\n            // enumation state for the context\n            //nextSequence: undefined,\n            //prevSequence: undefined,\n            //next: undefined\n            //prev: undefined\n            //start: undefined\n        };\n        this._pool = {\n            layoutNodes: {\n                size: 0\n                //first: undefined\n            },\n            resolveSize: [0, 0]\n        };\n        //this._first = undefined; // first item in the linked list\n        //this._nodesById = undefined;\n        //this._trueSizeRequested = false;\n    }\n\n    /**\n     * Prepares the manager for a new layout iteration, after which it returns the\n     * context which can be used by the layout-function.\n     *\n     * @param {ViewSequence} viewSequence first node to layout\n     * @param {Object} [nodesById] dictionary to use when looking up nodes by id\n     * @return {LayoutContext} context which can be passed to the layout-function\n     */\n    LayoutNodeManager.prototype.prepareForLayout = function(viewSequence, nodesById, contextData) {\n\n        // Reset all nodes\n        var node = this._first;\n        while (node) {\n            node.reset();\n            node = node._next;\n        }\n\n        // Prepare data\n        var context = this._context;\n        this._layoutCount++;\n        this._nodesById = nodesById;\n        this._trueSizeRequested = false;\n        this._reevalTrueSize =\n            contextData.reevalTrueSize ||\n            !context.size ||\n            (context.size[0] !== contextData.size[0]) ||\n            (context.size[1] !== contextData.size[1]);\n\n        // Prepare context for enumation\n        var contextState = this._contextState;\n        contextState.startSequence = viewSequence;\n        contextState.nextSequence = viewSequence;\n        contextState.prevSequence = viewSequence;\n        contextState.start = undefined;\n        contextState.nextGetIndex = 0;\n        contextState.prevGetIndex = 0;\n        contextState.nextSetIndex = 0;\n        contextState.prevSetIndex = 0;\n        contextState.addCount = 0;\n        contextState.removeCount = 0;\n        contextState.lastRenderNode = undefined;\n\n        // Prepare content\n        context.size[0] = contextData.size[0];\n        context.size[1] = contextData.size[1];\n        context.direction = contextData.direction;\n        context.reverse = contextData.reverse;\n        context.alignment = contextData.reverse ? 1 : 0;\n        context.scrollOffset = contextData.scrollOffset || 0;\n        context.scrollStart = contextData.scrollStart || 0;\n        context.scrollEnd = contextData.scrollEnd || context.size[context.direction];\n        //context.cycle++;\n        return context;\n    };\n\n    /**\n     * When the layout-function no longer lays-out the node, then it is not longer\n     * being invalidated. In this case the destination is set to the removeSpec\n     * after which the node is animated towards the remove-spec.\n     *\n     * @param {Spec} [removeSpec] spec towards which the no longer layed-out nodes are animated\n     */\n    LayoutNodeManager.prototype.removeNonInvalidatedNodes = function(removeSpec) {\n        var node = this._first;\n        while (node) {\n\n            // If a node existed, but it is no longer being layed out,\n            // then set it to the '_removing' state.\n            if (!node._invalidated && !node._removing) {\n                node.remove(removeSpec);\n            }\n\n            // Move to next node\n            node = node._next;\n        }\n    };\n\n    /**\n     * Cleans up any unaccessed virtual nodes that have been created by a VirtualViewSequence.\n     */\n    LayoutNodeManager.prototype.removeVirtualViewSequenceNodes = function() {\n        if (this._contextState.startSequence && this._contextState.startSequence.cleanup) {\n            this._contextState.startSequence.cleanup();\n        }\n    };\n\n    /**\n     * Builds the render-spec and destroy any layout-nodes that no longer\n     * return a render-spec.\n     *\n     * @return {Array.Spec} array of Specs\n     */\n    LayoutNodeManager.prototype.buildSpecAndDestroyUnrenderedNodes = function(translate) {\n        var specs = [];\n        var result = {\n            specs: specs,\n            modified: false\n        };\n        var node = this._first;\n        while (node) {\n            var modified = node._specModified;\n            var spec = node.getSpec();\n            if (spec.removed) {\n\n                // Destroy node\n                var destroyNode = node;\n                node = node._next;\n                _destroyNode.call(this, destroyNode);\n\n                // Mark as modified\n                result.modified = true;\n            }\n            else {\n\n                // Update stats\n                if (modified) {\n                    if (spec.transform && translate) {\n                        spec.transform[12] += translate[0];\n                        spec.transform[13] += translate[1];\n                        spec.transform[14] += translate[2];\n                        spec.transform[12] = Math.round(spec.transform[12] * 100000) / 100000;\n                        spec.transform[13] = Math.round(spec.transform[13] * 100000) / 100000;\n                        if (spec.endState) {\n                            spec.endState.transform[12] += translate[0];\n                            spec.endState.transform[13] += translate[1];\n                            spec.endState.transform[14] += translate[2];\n                            spec.endState.transform[12] = Math.round(spec.endState.transform[12] * 100000) / 100000;\n                            spec.endState.transform[13] = Math.round(spec.endState.transform[13] * 100000) / 100000;\n                        }\n                    }\n                    result.modified = true;\n                }\n\n                // Set meta data\n                spec.usesTrueSize = node.usesTrueSize;\n                spec.trueSizeRequested = node.trueSizeRequested;\n\n                // Add node to result output\n                specs.push(spec);\n                node = node._next;\n            }\n        }\n        this._contextState.addCount = 0;\n        this._contextState.removeCount = 0;\n        return result;\n    };\n\n    /**\n     * Get the layout-node by its renderable.\n     *\n     * @param {Object} renderable renderable\n     * @return {LayoutNode} layout-node or undefined\n     */\n    LayoutNodeManager.prototype.getNodeByRenderNode = function(renderable) {\n        var node = this._first;\n        while (node) {\n            if (node.renderNode === renderable) {\n                return node;\n            }\n            node = node._next;\n        }\n        return undefined;\n    };\n\n    /**\n     * Inserts a layout-node into the linked-list.\n     *\n     * @param {LayoutNode} node layout-node to insert\n     */\n    LayoutNodeManager.prototype.insertNode = function(node) {\n        node._next = this._first;\n        if (this._first) {\n            this._first._prev = node;\n        }\n        this._first = node;\n    };\n\n    /**\n     * Sets the options for all nodes.\n     *\n     * @param {Object} options node options\n     */\n    LayoutNodeManager.prototype.setNodeOptions = function(options) {\n        this._nodeOptions = options;\n        var node = this._first;\n        while (node) {\n            node.setOptions(options);\n            node = node._next;\n        }\n        node = this._pool.layoutNodes.first;\n        while (node) {\n            node.setOptions(options);\n            node = node._next;\n        }\n    };\n\n    /**\n     * Pre-allocate layout-nodes ahead of using them.\n     *\n     * @param {Number} count number of nodes to pre-allocate with the given spec\n     * @param {Spec} [spec] render-spec (defined the node properties which to pre-allocate)\n     */\n    LayoutNodeManager.prototype.preallocateNodes = function(count, spec) {\n        var nodes = [];\n        for (var i = 0; i < count; i++) {\n            nodes.push(this.createNode(undefined, spec));\n        }\n        for (i = 0; i < count; i++) {\n            _destroyNode.call(this, nodes[i]);\n        }\n    };\n\n    /**\n     * Creates a layout-node\n     *\n     * @param {Object} renderNode render-node for whom to create a layout-node for\n     * @return {LayoutNode} layout-node\n     */\n    LayoutNodeManager.prototype.createNode = function(renderNode, spec) {\n        var node;\n        if (this._pool.layoutNodes.first) {\n            node = this._pool.layoutNodes.first;\n            this._pool.layoutNodes.first = node._next;\n            this._pool.layoutNodes.size--;\n            node.constructor.apply(node, arguments);\n        }\n        else {\n            node = new this.LayoutNode(renderNode, spec);\n            if (this._nodeOptions) {\n                node.setOptions(this._nodeOptions);\n            }\n        }\n        node._prev = undefined;\n        node._next = undefined;\n        node._viewSequence = undefined;\n        node._layoutCount = 0;\n        if (this._initLayoutNodeFn) {\n            this._initLayoutNodeFn.call(this, node, spec);\n        }\n        return node;\n    };\n\n    /**\n     * Removes all nodes.\n     */\n    LayoutNodeManager.prototype.removeAll = function() {\n        var node = this._first;\n        while (node) {\n          var next = node._next;\n          _destroyNode.call(this, node);\n          node = next;\n        }\n        this._first = undefined;\n    };\n\n    /**\n     * Destroys a layout-node\n     */\n    function _destroyNode(node) {\n\n        // Remove node from linked-list\n        if (node._next) {\n            node._next._prev = node._prev;\n        }\n        if (node._prev) {\n            node._prev._next = node._next;\n        }\n        else {\n            this._first = node._next;\n        }\n\n        // Destroy the node\n        node.destroy();\n\n        // Add node to pool\n        if (this._pool.layoutNodes.size < MAX_POOL_SIZE) {\n            this._pool.layoutNodes.size++;\n            node._prev = undefined;\n            node._next = this._pool.layoutNodes.first;\n            this._pool.layoutNodes.first = node;\n        }\n    }\n\n    /**\n     * Gets start layout-node for enumeration.\n     *\n     * @param {Bool} [next] undefined = all, true = all next, false = all previous\n     * @return {LayoutNode} layout-node or undefined\n     */\n    LayoutNodeManager.prototype.getStartEnumNode = function(next) {\n        if (next === undefined) {\n            return this._first;\n        }\n        else if (next === true) {\n            return (this._contextState.start && this._contextState.startPrev) ? this._contextState.start._next : this._contextState.start;\n        }\n        else if (next === false) {\n            return (this._contextState.start && !this._contextState.startPrev) ? this._contextState.start._prev : this._contextState.start;\n        }\n    };\n\n    /**\n     * Checks the integrity of the linked-list.\n     */\n    /*function _checkIntegrity() {\n        var node = this._first;\n        var count = 0;\n        var prevNode;\n        while (node) {\n            if (!node._prev && (node !== this._first)) {\n                throw 'No prev but not first';\n            }\n            if (node._prev !== prevNode) {\n                throw 'Bork';\n            }\n            prevNode = node;\n            node = node._next;\n            count++;\n        }\n    }\n\n    function _checkContextStateIntegrity() {\n        var node = this._contextState.start;\n        while (node) {\n            if (node === this._contextState.next) {\n                break;\n            }\n            if (!node._invalidated) {\n                throw 'WTF';\n            }\n            node = node._next;\n        }\n        node = this._contextState.start;\n        while (node) {\n            if (node === this._contextState.prev) {\n                break;\n            }\n            if (!node._invalidated) {\n                throw 'WTF';\n            }\n            node = node._prev;\n        }\n    }*/\n\n    /**\n     * Creates or gets a layout node.\n     */\n    function _contextGetCreateAndOrderNodes(renderNode, prev) {\n\n        // The first time this function is called, the current\n        // prev/next position is obtained.\n        var node;\n        var state = this._contextState;\n        if (!state.start) {\n            node = this._first;\n            while (node) {\n                if (node.renderNode === renderNode) {\n                    break;\n                }\n                node = node._next;\n            }\n            if (!node) {\n                node = this.createNode(renderNode);\n                node._next = this._first;\n                if (this._first) {\n                    this._first._prev = node;\n                }\n                this._first = node;\n            }\n            state.start = node;\n            state.startPrev = prev;\n            state.prev = node;\n            state.next = node;\n            return node;\n        }\n\n        // Check whether node already exist at the correct position\n        // in the linked-list. If so, return that node immediately\n        // and advance the prev/next pointer for the next/prev\n        // lookup operation.\n        if (prev) {\n            if (state.prev._prev && (state.prev._prev.renderNode === renderNode)) {\n                state.prev = state.prev._prev;\n                return state.prev;\n            }\n        }\n        else {\n            if (state.next._next && (state.next._next.renderNode === renderNode)) {\n                state.next = state.next._next;\n                return state.next;\n            }\n        }\n\n        // Lookup the node anywhere in the list..\n        node = this._first;\n        while (node) {\n            if (node.renderNode === renderNode) {\n                break;\n            }\n            node = node._next;\n        }\n\n        // Create new node if neccessary\n        if (!node) {\n            node = this.createNode(renderNode);\n        }\n\n        // Node existed, remove from linked-list\n        else {\n            if (node._next) {\n                node._next._prev = node._prev;\n            }\n            if (node._prev) {\n                node._prev._next = node._next;\n            }\n            else {\n                this._first = node._next;\n            }\n            node._next = undefined;\n            node._prev = undefined;\n        }\n\n        // Insert node into the linked list\n        if (prev) {\n            if (state.prev._prev) {\n                node._prev = state.prev._prev;\n                state.prev._prev._next = node;\n            }\n            else {\n                this._first = node;\n            }\n            state.prev._prev = node;\n            node._next = state.prev;\n            state.prev = node;\n        }\n        else {\n            if (state.next._next) {\n                node._next = state.next._next;\n                state.next._next._prev = node;\n            }\n            state.next._next = node;\n            node._prev = state.next;\n            state.next = node;\n        }\n\n        return node;\n    }\n\n    /**\n     * Get the next render-node\n     */\n    function _contextNext() {\n\n        // Get the next node from the sequence\n        if (!this._contextState.nextSequence) {\n            return undefined;\n        }\n        if (this._context.reverse) {\n            this._contextState.nextSequence = this._contextState.nextSequence.getNext();\n            if (!this._contextState.nextSequence) {\n                return undefined;\n            }\n        }\n        var renderNode = this._contextState.nextSequence.get();\n        if (!renderNode) {\n            this._contextState.nextSequence = undefined;\n            return undefined;\n        }\n        var nextSequence = this._contextState.nextSequence;\n        if (!this._context.reverse) {\n            this._contextState.nextSequence = this._contextState.nextSequence.getNext();\n        }\n        if (this._contextState.lastRenderNode === renderNode) {\n          throw 'ViewSequence is corrupted, should never contain the same renderNode twice, index: ' + nextSequence.getIndex();\n        }\n        this._contextState.lastRenderNode = renderNode;\n        return {\n            renderNode: renderNode,\n            viewSequence: nextSequence,\n            next: true,\n            index: ++this._contextState.nextGetIndex\n        };\n    }\n\n    /**\n     * Get the previous render-node\n     */\n    function _contextPrev() {\n\n        // Get the previous node from the sequence\n        if (!this._contextState.prevSequence) {\n            return undefined;\n        }\n        if (!this._context.reverse) {\n            this._contextState.prevSequence = this._contextState.prevSequence.getPrevious();\n            if (!this._contextState.prevSequence) {\n                return undefined;\n            }\n        }\n        var renderNode = this._contextState.prevSequence.get();\n        if (!renderNode) {\n            this._contextState.prevSequence = undefined;\n            return undefined;\n        }\n        var prevSequence = this._contextState.prevSequence;\n        if (this._context.reverse) {\n            this._contextState.prevSequence = this._contextState.prevSequence.getPrevious();\n        }\n        if (this._contextState.lastRenderNode === renderNode) {\n          throw 'ViewSequence is corrupted, should never contain the same renderNode twice, index: ' + prevSequence.getIndex();\n        }\n        this._contextState.lastRenderNode = renderNode;\n        return {\n            renderNode: renderNode,\n            viewSequence: prevSequence,\n            prev: true,\n            index: --this._contextState.prevGetIndex\n        };\n    }\n\n    /**\n     * Resolve id into a context-node.\n     */\n     function _contextGet(contextNodeOrId) {\n        if (this._nodesById && ((contextNodeOrId instanceof String) || (typeof contextNodeOrId === 'string'))) {\n            var renderNode = this._nodesById[contextNodeOrId];\n            if (!renderNode) {\n                return undefined;\n            }\n\n            // Return array\n            if (renderNode instanceof Array) {\n                var result = [];\n                for (var i = 0, j = renderNode.length; i < j; i++) {\n                    result.push({\n                        renderNode: renderNode[i],\n                        arrayElement: true\n                    });\n                }\n                return result;\n            }\n\n            // Create context node\n            return {\n                renderNode: renderNode,\n                byId: true\n            };\n        }\n        else {\n            return contextNodeOrId;\n        }\n    }\n\n    /**\n     * Set the node content\n     */\n    function _contextSet(contextNodeOrId, set) {\n        var contextNode = this._nodesById ? _contextGet.call(this, contextNodeOrId) : contextNodeOrId;\n        if (contextNode) {\n            var node = contextNode.node;\n            if (!node) {\n                if (contextNode.next) {\n                     if (contextNode.index < this._contextState.nextSetIndex) {\n                        LayoutUtility.error('Nodes must be layed out in the same order as they were requested!');\n                     }\n                     this._contextState.nextSetIndex = contextNode.index;\n                }\n                else if (contextNode.prev) {\n                     if (contextNode.index > this._contextState.prevSetIndex) {\n                        LayoutUtility.error('Nodes must be layed out in the same order as they were requested!');\n                     }\n                     this._contextState.prevSetIndex = contextNode.index;\n                }\n                node = _contextGetCreateAndOrderNodes.call(this, contextNode.renderNode, contextNode.prev);\n                node._viewSequence = contextNode.viewSequence;\n                node._layoutCount++;\n                if (node._layoutCount === 1) {\n                    this._contextState.addCount++;\n                }\n                contextNode.node = node;\n            }\n            node.usesTrueSize = contextNode.usesTrueSize;\n            node.trueSizeRequested = contextNode.trueSizeRequested;\n            node.set(set, this._context.size);\n            contextNode.set = set;\n        }\n        return set;\n    }\n\n    /**\n     * Helper function that recursively discovers the configured size for a\n     * given renderNode.\n     */\n    function _resolveConfigSize(renderNode) {\n        if (renderNode instanceof RenderNode) {\n            var result = null;\n            var target = renderNode.get();\n            if (target) {\n                result = _resolveConfigSize(target);\n                if (result) {\n                    return result;\n                }\n            }\n            if (renderNode._child) {\n                return _resolveConfigSize(renderNode._child);\n            }\n        }\n        else if (renderNode instanceof Surface) {\n            return renderNode.size ? {\n                renderNode: renderNode,\n                size: renderNode.size\n            } : undefined;\n        }\n        else if (renderNode.options && renderNode.options.size) {\n            return {\n                renderNode: renderNode,\n                size: renderNode.options.size\n            };\n        }\n        return undefined;\n    }\n\n    /**\n     * Resolve the size of the layout-node from the renderable itsself.\n     */\n    function _contextResolveSize(contextNodeOrId, parentSize) {\n        var contextNode = this._nodesById ? _contextGet.call(this, contextNodeOrId) : contextNodeOrId;\n        var resolveSize = this._pool.resolveSize;\n        if (!contextNode) {\n            resolveSize[0] = 0;\n            resolveSize[1] = 0;\n            return resolveSize;\n        }\n\n        // Get in use size\n        var renderNode = contextNode.renderNode;\n        var size = renderNode.getSize();\n        if (!size) {\n            return parentSize;\n        }\n\n        // Check if true-size is used and it must be reavaluated.\n        // This particular piece of code specifically handles true-size Surfaces in famo.us.\n        // It contains portions that ensure that the true-size of a Surface is re-evaluated\n        // and also workaround code that backs up the size of a Surface, so that when the surface\n        // is re-added to the DOM (e.g. when scrolling) it doesn't temporarily have a size of 0.\n        var configSize = _resolveConfigSize(renderNode);\n        if (configSize && ((configSize.size[0] === true) || (configSize.size[1] === true))) {\n            contextNode.usesTrueSize = true;\n            if (configSize.renderNode instanceof Surface) {\n                var backupSize = configSize.renderNode._backupSize;\n                if (configSize.renderNode._contentDirty || configSize.renderNode._trueSizeCheck) {\n                  this._trueSizeRequested = true;\n                  contextNode.trueSizeRequested = true;\n                }\n                if (configSize.renderNode._trueSizeCheck) {\n\n                    // Fix for true-size renderables. When true-size is used, the size\n                    // is incorrect for one render-cycle due to the fact that Surface.commit\n                    // updates the content after asking the DOM for the offsetHeight/offsetWidth.\n                    // The code below backs the size up, and re-uses that when this scenario\n                    // occurs.\n                    if (backupSize && (configSize.size !== size)) {\n                        var newWidth = (configSize.size[0] === true) ? Math.max(backupSize[0], size[0]) : size[0];\n                        var newHeight = (configSize.size[1] === true) ? Math.max(backupSize[1], size[1]) : size[1];\n                        backupSize[0] = newWidth;\n                        backupSize[1] = newHeight;\n                        size = backupSize;\n                        configSize.renderNode._backupSize = undefined;\n                        backupSize = undefined;\n                    }\n                }\n                if (this._reevalTrueSize || (backupSize && ((backupSize[0] !== size[0]) || (backupSize[1] !== size[1])))) {\n                    configSize.renderNode._trueSizeCheck = true; // force request of true-size from DOM\n                    configSize.renderNode._sizeDirty = true;\n                    this._trueSizeRequested = true;\n                }\n\n                // Backup the size of the node\n                if (!backupSize) {\n                    configSize.renderNode._backupSize = [0, 0];\n                    backupSize = configSize.renderNode._backupSize;\n                }\n                backupSize[0] = size[0];\n                backupSize[1] = size[1];\n            }\n\n            // Ensure re-layout when a child layout-controller is using true-size and it\n            // has ben changed.\n            else if (configSize.renderNode._nodes) {\n                if (this._reevalTrueSize || configSize.renderNode._nodes._trueSizeRequested) {\n                    contextNode.trueSizeRequested = true;\n                    this._trueSizeRequested = true;\n                }\n            }\n        }\n\n        // Resolve 'undefined' to parent-size and true to 0\n        if ((size[0] === undefined) || (size[0] === true) || (size[1] === undefined) || (size[1] === true)) {\n            resolveSize[0] = size[0];\n            resolveSize[1] = size[1];\n            size = resolveSize;\n            if (size[0] === undefined) {\n                size[0] = parentSize[0];\n            }\n            else if (size[0] === true) {\n                size[0] = 0;\n                this._trueSizeRequested = true;\n                contextNode.trueSizeRequested = true;\n            }\n            if (size[1] === undefined) {\n                size[1] = parentSize[1];\n            }\n            else if (size[1] === true) {\n                size[1] = 0;\n                this._trueSizeRequested = true;\n                contextNode.trueSizeRequested = true;\n            }\n        }\n        return size;\n    }\n\n    module.exports = LayoutNodeManager;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/LayoutNodeManager.js\n ** module id = 38\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2014\n */\n\n/**\n * LayoutContext is the interface for a layout-function to access\n * renderables in the data-source and set their size, position, tranformation, etc...\n *\n * The `next`, `prev` and `get` functions return an opaque object which represents\n * the renderable that is to be layed out. To access the actual renderable, use the\n * `.renderNode` property of this opaque object.\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    /**\n     * @class\n     * @alias module:LayoutContext\n     */\n    function LayoutContext(methods) {\n        for (var n in methods) {\n            this[n] = methods[n];\n        }\n    }\n\n    /**\n     * {Property} Size in which to layout the renderables.\n     */\n    LayoutContext.prototype.size = undefined;\n\n    /**\n     * {Property} Direction in which to layout the renderables (0 = X, 1 = Y).\n     */\n    LayoutContext.prototype.direction = undefined;\n\n    /**\n     * {Property} {Number} Scrolling offset at which to start laying out next/prev renderables.\n     */\n    LayoutContext.prototype.scrollOffset = undefined;\n\n    /**\n     * {Property} {Number} Top/left boundary to which to layout renderables (default: 0).\n     */\n    LayoutContext.prototype.scrollStart = undefined;\n\n    /**\n     * {Property} {Number} Bottom/right boundary to which to continue laying out renderables.\n     */\n    LayoutContext.prototype.scrollEnd = undefined;\n\n    /**\n     * Get the context-node for the next renderable in the data-source. When\n     * the end of the data-source is reached, `undefined` is returned.\n     * Use this function to enumerate the contents of a data-source that is\n     * either an Array or a ViewSequence.\n     *\n     * **Example:**\n     *\n     * ```javascript\n     * function MyLayoutFunction(context, options) {\n     *   var height = 0;\n     *   var node = context.next(); // get first next node\n     *   while (node) {\n     *     context.set(node, {\n     *       size: [context.size[0], 100],\n     *       translate: [0, height, 0]\n     *     });\n     *     height += 100;\n     *     node = context.next(); // get next node\n     *   }\n     * }\n     * ```\n     *\n     * @return {Object} context-node or undefined\n     */\n    LayoutContext.prototype.next = function() {\n        // dummy implementation, override in constructor\n    };\n\n    /**\n     * Get the context-node for the previous renderable in the data-source. When\n     * the start of the data-source is reached, `undefined` is returned.\n     * Use this function to enumerate the contents of a data-source that is\n     * either an Array or a ViewSequence.\n     *\n     * **Example:**\n     *\n     * ```javascript\n     * function MyLayoutFunction(context, options) {\n     *   var height = 0;\n     *   var node = context.prev(); // get first previous\n     *   while (node) {\n     *     height -= 100;\n     *     context.set(node, {\n     *       size: [context.size[0], 100],\n     *       translate: [0, height, 0]\n     *     });\n     *     node = context.prev(); // get prev node\n     *   }\n     * }\n     * ```\n     *\n     * @return {Object} context-node or undefined\n     */\n    LayoutContext.prototype.prev = function() {\n        // dummy implementation, override in constructor\n    };\n\n    /**\n     * Get the context-node for a renderable with a specific id. This function\n     * should be used to access data-sources which are key-value collections.\n     * When a data-source is an Array or a ViewSequence, use `next()`.\n     * In many cases it is not neccesary to use `get()`, instead you can pass\n     * the id of the renderable straight to the `set` function.\n     *\n     * **Example:**\n     *\n     * ```javascript\n     * var layoutController = new LayoutController({\n     *   layout: function (context, options) {\n     *     var size = context.size;\n     *     var left = context.get('left');\n     *     context.set(left, { size: [100, size[1]] });\n     *\n     *     var right = context.get('right');\n     *     context.set(right, {\n     *       size: [100, size[1]],\n     *       translate: [size[1] - 100, 0, 0]\n     *     });\n     *\n     *     var middle = context.get('middle');\n     *     context.set(middle, {\n     *       size: [size[0] - 200, size[1]],\n     *       translate: [100, 0, 0]\n     *     });\n     *   },\n     *   dataSource: {\n     *     left: new Surface({content: 'left'}),\n     *     right: new Surface({content: 'right'}),\n     *     middle: new Surface({content: 'middle'})\n     *   }\n     * });\n     * ```\n     *\n     * **Arrays:**\n     *\n     * A value at a specific id in the datasource can also be an array. To access the\n     * context-nodes in the array use `get()` to get the array and the elements in the\n     * array:\n     *\n     * ```javascript\n     * var layoutController = new LayoutController({\n     *   layout: function (context, options) {\n     *     var size = context.size;\n     *     var left = 0;\n     *\n     *     // Position title\n     *     context.set('title', { size: [100, size[1]] });\n     *     left += 100;\n     *\n     *     // Position left-items (array)\n     *     var leftItems = context.get('leftItems');\n     *     for (var i = 0; i < leftItems.length; i++) {\n     *       var leftItem = context.get(leftItems[i]);\n     *       context.set(leftItem, {\n     *         size: [100, size[1]],\n     *         translate: [left, 0, 0]\n     *       });\n     *       left += 100;\n     *     }\n     *   },\n     *   dataSource: {\n     *     title: new Surface({content: 'title'}),\n     *     leftItems: [\n     *       new Surface({content: 'item1'}),\n     *       new Surface({content: 'item2'})\n     *     ]\n     *   }\n     * });\n     * ```\n     *\n     * @param {Object|String} node context-node or node-id\n     * @return {Object} context-node or undefined\n     */\n    LayoutContext.prototype.get = function(node) {\n        // dummy implementation, override in constructor\n    };\n\n    /**\n     * Set the size, origin, align, translation, scale, rotate, skew & opacity for a context-node.\n     *\n     * **Overview of all supported properties:**\n     *\n     * ```javascript\n     * function MyLayoutFunction(context, options) {\n     *   context.set('mynode', {\n     *     size: [100, 20],\n     *     origin: [0.5, 0.5],\n     *     align: [0.5, 0.5],\n     *     translate: [50, 10, 0],\n     *     scale: [1, 1, 1],\n     *     skew: [0, 0, 0],\n     *     rotate: [Math.PI, 0, 0],\n     *     opacity: 1\n     *   })\n     * }\n     * ```\n     *\n     * @param {Object|String} node context-node or node-id\n     * @param {Object} set properties: size, origin, align, translate, scale, rotate, skew & opacity\n     */\n    LayoutContext.prototype.set = function(node, set) {\n        // dummy implementation, override in constructor\n    };\n\n    /**\n     * Resolve the size of a context-node by accessing the `getSize` function\n     * of the renderable.\n     *\n     * **Example:**\n     *\n     * ```javascript\n     * var layoutController = new LayoutController({\n     *   layout: function (context, options) {\n     *     var centerSize = context.resolveSize('center');\n     *     context.set('center', {origin: [0.5, 0.5]});\n     *     context.set('centerRight', {\n     *       origin: [0.5, 0.5],\n     *       translate: [centerSize[0] / 2, 0, 0]\n     *     });\n     *   },\n     *   dataSource: {\n     *     center: new Surface({content: 'center'}),\n     *     centerRight: new Surface({content: 'centerRight'}),\n     *   }\n     * });\n     * ```\n     *\n     * **When the size of the renderable is calculated by the DOM (`true` size)**\n     *\n     * When the layout-function performs its layout for the first time, it is\n     * possible that the renderable has not yet been rendered and its size\n     * is unknown. In this case, the LayoutController will cause a second\n     * reflow of the layout the next render-cycle, ensuring that the renderables\n     * are layed out as expected.\n     *\n     * @param {Object|String} node context-node, node-id or array-element\n     * @return {Size} size of the node\n     */\n    LayoutContext.prototype.resolveSize = function(node) {\n        // dummy implementation, override in constructor\n    };\n\n    module.exports = LayoutContext;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/LayoutContext.js\n ** module id = 39\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar ElementOutput = require('./ElementOutput');\nfunction Surface(options) {\n    ElementOutput.call(this);\n    this.options = {};\n    this.properties = {};\n    this.attributes = {};\n    this.content = '';\n    this.classList = [];\n    this.size = null;\n    this._classesDirty = true;\n    this._stylesDirty = true;\n    this._attributesDirty = true;\n    this._sizeDirty = true;\n    this._contentDirty = true;\n    this._trueSizeCheck = true;\n    this._dirtyClasses = [];\n    if (options)\n        this.setOptions(options);\n    this._currentTarget = null;\n}\nSurface.prototype = Object.create(ElementOutput.prototype);\nSurface.prototype.constructor = Surface;\nSurface.prototype.elementType = 'div';\nSurface.prototype.elementClass = 'famous-surface';\nSurface.prototype.setAttributes = function setAttributes(attributes) {\n    for (var n in attributes) {\n        if (n === 'style')\n            throw new Error('Cannot set styles via \"setAttributes\" as it will break Famo.us.  Use \"setProperties\" instead.');\n        this.attributes[n] = attributes[n];\n    }\n    this._attributesDirty = true;\n};\nSurface.prototype.getAttributes = function getAttributes() {\n    return this.attributes;\n};\nSurface.prototype.setProperties = function setProperties(properties) {\n    for (var n in properties) {\n        this.properties[n] = properties[n];\n    }\n    this._stylesDirty = true;\n    return this;\n};\nSurface.prototype.getProperties = function getProperties() {\n    return this.properties;\n};\nSurface.prototype.addClass = function addClass(className) {\n    if (this.classList.indexOf(className) < 0) {\n        this.classList.push(className);\n        this._classesDirty = true;\n    }\n    return this;\n};\nSurface.prototype.removeClass = function removeClass(className) {\n    var i = this.classList.indexOf(className);\n    if (i >= 0) {\n        this._dirtyClasses.push(this.classList.splice(i, 1)[0]);\n        this._classesDirty = true;\n    }\n    return this;\n};\nSurface.prototype.toggleClass = function toggleClass(className) {\n    var i = this.classList.indexOf(className);\n    if (i >= 0) {\n        this.removeClass(className);\n    } else {\n        this.addClass(className);\n    }\n    return this;\n};\nSurface.prototype.setClasses = function setClasses(classList) {\n    var i = 0;\n    var removal = [];\n    for (i = 0; i < this.classList.length; i++) {\n        if (classList.indexOf(this.classList[i]) < 0)\n            removal.push(this.classList[i]);\n    }\n    for (i = 0; i < removal.length; i++)\n        this.removeClass(removal[i]);\n    for (i = 0; i < classList.length; i++)\n        this.addClass(classList[i]);\n    return this;\n};\nSurface.prototype.getClassList = function getClassList() {\n    return this.classList;\n};\nSurface.prototype.setContent = function setContent(content) {\n    if (this.content !== content) {\n        this.content = content;\n        this._contentDirty = true;\n    }\n    return this;\n};\nSurface.prototype.getContent = function getContent() {\n    return this.content;\n};\nSurface.prototype.setOptions = function setOptions(options) {\n    if (options.size)\n        this.setSize(options.size);\n    if (options.classes)\n        this.setClasses(options.classes);\n    if (options.properties)\n        this.setProperties(options.properties);\n    if (options.attributes)\n        this.setAttributes(options.attributes);\n    if (options.content)\n        this.setContent(options.content);\n    return this;\n};\nfunction _cleanupClasses(target) {\n    for (var i = 0; i < this._dirtyClasses.length; i++)\n        target.classList.remove(this._dirtyClasses[i]);\n    this._dirtyClasses = [];\n}\nfunction _applyStyles(target) {\n    for (var n in this.properties) {\n        target.style[n] = this.properties[n];\n    }\n}\nfunction _cleanupStyles(target) {\n    for (var n in this.properties) {\n        target.style[n] = '';\n    }\n}\nfunction _applyAttributes(target) {\n    for (var n in this.attributes) {\n        target.setAttribute(n, this.attributes[n]);\n    }\n}\nfunction _cleanupAttributes(target) {\n    for (var n in this.attributes) {\n        target.removeAttribute(n);\n    }\n}\nfunction _xyNotEquals(a, b) {\n    return a && b ? a[0] !== b[0] || a[1] !== b[1] : a !== b;\n}\nSurface.prototype.setup = function setup(allocator) {\n    var target = allocator.allocate(this.elementType);\n    if (this.elementClass) {\n        if (this.elementClass instanceof Array) {\n            for (var i = 0; i < this.elementClass.length; i++) {\n                target.classList.add(this.elementClass[i]);\n            }\n        } else {\n            target.classList.add(this.elementClass);\n        }\n    }\n    target.style.display = '';\n    this.attach(target);\n    this._opacity = null;\n    this._currentTarget = target;\n    this._stylesDirty = true;\n    this._classesDirty = true;\n    this._attributesDirty = true;\n    this._sizeDirty = true;\n    this._contentDirty = true;\n    this._originDirty = true;\n    this._transformDirty = true;\n};\nSurface.prototype.commit = function commit(context) {\n    if (!this._currentTarget)\n        this.setup(context.allocator);\n    var target = this._currentTarget;\n    var size = context.size;\n    if (this._classesDirty) {\n        _cleanupClasses.call(this, target);\n        var classList = this.getClassList();\n        for (var i = 0; i < classList.length; i++)\n            target.classList.add(classList[i]);\n        this._classesDirty = false;\n        this._trueSizeCheck = true;\n    }\n    if (this._stylesDirty) {\n        _applyStyles.call(this, target);\n        this._stylesDirty = false;\n        this._trueSizeCheck = true;\n    }\n    if (this._attributesDirty) {\n        _applyAttributes.call(this, target);\n        this._attributesDirty = false;\n        this._trueSizeCheck = true;\n    }\n    if (this.size) {\n        var origSize = context.size;\n        size = [\n            this.size[0],\n            this.size[1]\n        ];\n        if (size[0] === undefined)\n            size[0] = origSize[0];\n        if (size[1] === undefined)\n            size[1] = origSize[1];\n        if (size[0] === true || size[1] === true) {\n            if (size[0] === true) {\n                if (this._trueSizeCheck || this._size[0] === 0) {\n                    var width = target.offsetWidth;\n                    if (this._size && this._size[0] !== width) {\n                        this._size[0] = width;\n                        this._sizeDirty = true;\n                    }\n                    size[0] = width;\n                } else {\n                    if (this._size)\n                        size[0] = this._size[0];\n                }\n            }\n            if (size[1] === true) {\n                if (this._trueSizeCheck || this._size[1] === 0) {\n                    var height = target.offsetHeight;\n                    if (this._size && this._size[1] !== height) {\n                        this._size[1] = height;\n                        this._sizeDirty = true;\n                    }\n                    size[1] = height;\n                } else {\n                    if (this._size)\n                        size[1] = this._size[1];\n                }\n            }\n            this._trueSizeCheck = false;\n        }\n    }\n    if (_xyNotEquals(this._size, size)) {\n        if (!this._size)\n            this._size = [\n                0,\n                0\n            ];\n        this._size[0] = size[0];\n        this._size[1] = size[1];\n        this._sizeDirty = true;\n    }\n    if (this._sizeDirty) {\n        if (this._size) {\n            target.style.width = this.size && this.size[0] === true ? '' : this._size[0] + 'px';\n            target.style.height = this.size && this.size[1] === true ? '' : this._size[1] + 'px';\n        }\n        this._eventOutput.emit('resize');\n    }\n    if (this._contentDirty) {\n        this.deploy(target);\n        this._eventOutput.emit('deploy');\n        this._contentDirty = false;\n        this._trueSizeCheck = true;\n    }\n    ElementOutput.prototype.commit.call(this, context);\n};\nSurface.prototype.cleanup = function cleanup(allocator) {\n    var i = 0;\n    var target = this._currentTarget;\n    this._eventOutput.emit('recall');\n    this.recall(target);\n    target.style.display = 'none';\n    target.style.opacity = '';\n    target.style.width = '';\n    target.style.height = '';\n    _cleanupStyles.call(this, target);\n    _cleanupAttributes.call(this, target);\n    var classList = this.getClassList();\n    _cleanupClasses.call(this, target);\n    for (i = 0; i < classList.length; i++)\n        target.classList.remove(classList[i]);\n    if (this.elementClass) {\n        if (this.elementClass instanceof Array) {\n            for (i = 0; i < this.elementClass.length; i++) {\n                target.classList.remove(this.elementClass[i]);\n            }\n        } else {\n            target.classList.remove(this.elementClass);\n        }\n    }\n    this.detach(target);\n    this._currentTarget = null;\n    allocator.deallocate(target);\n};\nSurface.prototype.deploy = function deploy(target) {\n    var content = this.getContent();\n    if (content instanceof Node) {\n        while (target.hasChildNodes())\n            target.removeChild(target.firstChild);\n        target.appendChild(content);\n    } else\n        target.innerHTML = content;\n};\nSurface.prototype.recall = function recall(target) {\n    var df = document.createDocumentFragment();\n    while (target.hasChildNodes())\n        df.appendChild(target.firstChild);\n    this.setContent(df);\n};\nSurface.prototype.getSize = function getSize() {\n    return this._size ? this._size : this.size;\n};\nSurface.prototype.setSize = function setSize(size) {\n    this.size = size ? [\n        size[0],\n        size[1]\n    ] : null;\n    this._sizeDirty = true;\n    return this;\n};\nmodule.exports = Surface;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/Surface.js\n ** module id = 40\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Entity = require('./Entity');\nvar EventHandler = require('./EventHandler');\nvar Transform = require('./Transform');\nvar usePrefix = !('transform' in document.documentElement.style);\nvar devicePixelRatio = window.devicePixelRatio || 1;\nfunction ElementOutput(element) {\n    this._matrix = null;\n    this._opacity = 1;\n    this._origin = null;\n    this._size = null;\n    this._eventOutput = new EventHandler();\n    this._eventOutput.bindThis(this);\n    this.eventForwarder = function eventForwarder(event) {\n        this._eventOutput.emit(event.type, event);\n    }.bind(this);\n    this.id = Entity.register(this);\n    this._element = null;\n    this._sizeDirty = false;\n    this._originDirty = false;\n    this._transformDirty = false;\n    this._invisible = false;\n    if (element)\n        this.attach(element);\n}\nElementOutput.prototype.on = function on(type, fn) {\n    if (this._element)\n        this._element.addEventListener(type, this.eventForwarder);\n    this._eventOutput.on(type, fn);\n};\nElementOutput.prototype.removeListener = function removeListener(type, fn) {\n    this._eventOutput.removeListener(type, fn);\n};\nElementOutput.prototype.emit = function emit(type, event) {\n    if (event && !event.origin)\n        event.origin = this;\n    var handled = this._eventOutput.emit(type, event);\n    if (handled && event && event.stopPropagation)\n        event.stopPropagation();\n    return handled;\n};\nElementOutput.prototype.pipe = function pipe(target) {\n    return this._eventOutput.pipe(target);\n};\nElementOutput.prototype.unpipe = function unpipe(target) {\n    return this._eventOutput.unpipe(target);\n};\nElementOutput.prototype.render = function render() {\n    return this.id;\n};\nfunction _addEventListeners(target) {\n    for (var i in this._eventOutput.listeners) {\n        target.addEventListener(i, this.eventForwarder);\n    }\n}\nfunction _removeEventListeners(target) {\n    for (var i in this._eventOutput.listeners) {\n        target.removeEventListener(i, this.eventForwarder);\n    }\n}\nfunction _formatCSSTransform(m) {\n    m[12] = Math.round(m[12] * devicePixelRatio) / devicePixelRatio;\n    m[13] = Math.round(m[13] * devicePixelRatio) / devicePixelRatio;\n    var result = 'matrix3d(';\n    for (var i = 0; i < 15; i++) {\n        result += m[i] < 0.000001 && m[i] > -0.000001 ? '0,' : m[i] + ',';\n    }\n    result += m[15] + ')';\n    return result;\n}\nvar _setMatrix;\nif (usePrefix) {\n    _setMatrix = function (element, matrix) {\n        element.style.webkitTransform = _formatCSSTransform(matrix);\n    };\n} else {\n    _setMatrix = function (element, matrix) {\n        element.style.transform = _formatCSSTransform(matrix);\n    };\n}\nfunction _formatCSSOrigin(origin) {\n    return 100 * origin[0] + '% ' + 100 * origin[1] + '%';\n}\nvar _setOrigin = usePrefix ? function (element, origin) {\n    element.style.webkitTransformOrigin = _formatCSSOrigin(origin);\n} : function (element, origin) {\n    element.style.transformOrigin = _formatCSSOrigin(origin);\n};\nvar _setInvisible = usePrefix ? function (element) {\n    element.style.webkitTransform = 'scale3d(0.0001,0.0001,0.0001)';\n    element.style.opacity = 0;\n} : function (element) {\n    element.style.transform = 'scale3d(0.0001,0.0001,0.0001)';\n    element.style.opacity = 0;\n};\nfunction _xyNotEquals(a, b) {\n    return a && b ? a[0] !== b[0] || a[1] !== b[1] : a !== b;\n}\nElementOutput.prototype.commit = function commit(context) {\n    var target = this._element;\n    if (!target)\n        return;\n    var matrix = context.transform;\n    var opacity = context.opacity;\n    var origin = context.origin;\n    var size = context.size;\n    if (!matrix && this._matrix) {\n        this._matrix = null;\n        this._opacity = 0;\n        _setInvisible(target);\n        return;\n    }\n    if (_xyNotEquals(this._origin, origin))\n        this._originDirty = true;\n    if (Transform.notEquals(this._matrix, matrix))\n        this._transformDirty = true;\n    if (this._invisible) {\n        this._invisible = false;\n        this._element.style.display = '';\n    }\n    if (this._opacity !== opacity) {\n        this._opacity = opacity;\n        target.style.opacity = opacity >= 1 ? '0.999999' : opacity;\n    }\n    if (this._transformDirty || this._originDirty || this._sizeDirty) {\n        if (this._sizeDirty)\n            this._sizeDirty = false;\n        if (this._originDirty) {\n            if (origin) {\n                if (!this._origin)\n                    this._origin = [\n                        0,\n                        0\n                    ];\n                this._origin[0] = origin[0];\n                this._origin[1] = origin[1];\n            } else\n                this._origin = null;\n            _setOrigin(target, this._origin);\n            this._originDirty = false;\n        }\n        if (!matrix)\n            matrix = Transform.identity;\n        this._matrix = matrix;\n        var aaMatrix = this._size ? Transform.thenMove(matrix, [\n            -this._size[0] * origin[0],\n            -this._size[1] * origin[1],\n            0\n        ]) : matrix;\n        _setMatrix(target, aaMatrix);\n        this._transformDirty = false;\n    }\n};\nElementOutput.prototype.cleanup = function cleanup() {\n    if (this._element) {\n        this._invisible = true;\n        this._element.style.display = 'none';\n    }\n};\nElementOutput.prototype.attach = function attach(target) {\n    this._element = target;\n    _addEventListeners.call(this, target);\n};\nElementOutput.prototype.detach = function detach() {\n    var target = this._element;\n    if (target) {\n        _removeEventListeners.call(this, target);\n        if (this._invisible) {\n            this._invisible = false;\n            this._element.style.display = '';\n        }\n    }\n    this._element = null;\n    return target;\n};\nmodule.exports = ElementOutput;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/ElementOutput.js\n ** module id = 41\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2014\n */\n\n/**\n * Internal LayoutNode class used by `LayoutController`.\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var Transform = require('famous/core/Transform');\n    var LayoutUtility = require('./LayoutUtility');\n\n    /**\n     * @class\n     * @param {Object} renderNode Render-node which this layout-node represents\n     * @alias module:LayoutNode\n     */\n    function LayoutNode(renderNode, spec) {\n        this.renderNode = renderNode;\n        this._spec = spec ? LayoutUtility.cloneSpec(spec) : {};\n        this._spec.renderNode = renderNode; // also store in spec\n        this._specModified = true;\n        this._invalidated = false;\n        this._removing = false;\n        //this.scrollLength = undefined;\n        //this.trueSizeRequested = false;\n    }\n\n    /**\n     * Called to update the underlying render-node\n     */\n    LayoutNode.prototype.setRenderNode = function(renderNode) {\n        this.renderNode = renderNode;\n        this._spec.renderNode = renderNode;\n    };\n\n    /**\n     * Called to update the options for the node\n     */\n    LayoutNode.prototype.setOptions = function(options) {\n        // override to implement\n    };\n\n    /**\n     * Called when the node is destroyed\n     */\n    LayoutNode.prototype.destroy = function() {\n        this.renderNode = undefined;\n        this._spec.renderNode = undefined;\n        this._viewSequence = undefined;\n    };\n\n    /**\n     * Reset the end-state. This function is called on all layout-nodes prior to\n     * calling the layout-function. So that the layout-function starts with a clean slate.\n     */\n    LayoutNode.prototype.reset = function() {\n        this._invalidated = false;\n        this.trueSizeRequested = false;\n    };\n\n    /**\n     * Set the spec of the node\n     *\n     * @param {Object} spec\n     */\n    LayoutNode.prototype.setSpec = function(spec) {\n        this._specModified = true;\n        if (spec.align) {\n            if (!spec.align) {\n                this._spec.align = [0, 0];\n            }\n            this._spec.align[0] = spec.align[0];\n            this._spec.align[1] = spec.align[1];\n        }\n        else {\n            this._spec.align = undefined;\n        }\n        if (spec.origin) {\n            if (!spec.origin) {\n                this._spec.origin = [0, 0];\n            }\n            this._spec.origin[0] = spec.origin[0];\n            this._spec.origin[1] = spec.origin[1];\n        }\n        else {\n            this._spec.origin = undefined;\n        }\n        if (spec.size) {\n            if (!spec.size) {\n                this._spec.size = [0, 0];\n            }\n            this._spec.size[0] = spec.size[0];\n            this._spec.size[1] = spec.size[1];\n        }\n        else {\n            this._spec.size = undefined;\n        }\n        if (spec.transform) {\n            if (!spec.transform) {\n                this._spec.transform = spec.transform.slice(0);\n            }\n            else {\n                for (var i = 0; i < 16; i++) {\n                    this._spec.transform[i] = spec.transform[i];\n                }\n            }\n        }\n        else {\n            this._spec.transform = undefined;\n        }\n        this._spec.opacity = spec.opacity;\n    };\n\n    /**\n     * Set the content of the node\n     *\n     * @param {Object} set\n     */\n    LayoutNode.prototype.set = function(set, size) {\n        this._invalidated = true;\n        this._specModified = true;\n        this._removing = false;\n        var spec = this._spec;\n        spec.opacity = set.opacity;\n        if (set.size) {\n            if (!spec.size) {\n                spec.size = [0, 0];\n            }\n            spec.size[0] = set.size[0];\n            spec.size[1] = set.size[1];\n        }\n        else {\n            spec.size = undefined;\n        }\n        if (set.origin) {\n            if (!spec.origin) {\n                spec.origin = [0, 0];\n            }\n            spec.origin[0] = set.origin[0];\n            spec.origin[1] = set.origin[1];\n        }\n        else {\n            spec.origin = undefined;\n        }\n        if (set.align) {\n            if (!spec.align) {\n                spec.align = [0, 0];\n            }\n            spec.align[0] = set.align[0];\n            spec.align[1] = set.align[1];\n        }\n        else {\n            spec.align = undefined;\n        }\n\n        if (set.skew || set.rotate || set.scale) {\n            this._spec.transform = Transform.build({\n                translate: set.translate || [0, 0, 0],\n                skew: set.skew || [0, 0, 0],\n                scale: set.scale || [1, 1, 1],\n                rotate: set.rotate || [0, 0, 0]\n            });\n        }\n        else if (set.translate) {\n            this._spec.transform = Transform.translate(set.translate[0], set.translate[1], set.translate[2]);\n        }\n        else {\n            this._spec.transform = undefined;\n        }\n        this.scrollLength = set.scrollLength;\n    };\n\n    /**\n     * Creates the render-spec\n     */\n    LayoutNode.prototype.getSpec = function() {\n        this._specModified = false;\n        this._spec.removed = !this._invalidated;\n        return this._spec;\n    };\n\n    /**\n     * Marks the node for removal\n     */\n    LayoutNode.prototype.remove = function(removeSpec) {\n        this._removing = true;\n    };\n\n    module.exports = LayoutNode;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/LayoutNode.js\n ** module id = 42\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2014 - 2015\n */\n\n/**\n * Internal LayoutNode class used by `LayoutNodeManager`.\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var OptionsManager = require('famous/core/OptionsManager');\n    var Transform = require('famous/core/Transform');\n    var Vector = require('famous/math/Vector');\n    var Particle = require('famous/physics/bodies/Particle');\n    var Spring = require('famous/physics/forces/Spring');\n    var PhysicsEngine = require('famous/physics/PhysicsEngine');\n    var LayoutNode = require('./LayoutNode');\n    var Transitionable = require('famous/transitions/Transitionable');\n\n    /**\n     * @class\n     * @extends LayoutNode\n     * @param {Object} renderNode Render-node which this layout-node represents\n     * @param {Spec} spec Initial state\n     * @param {Object} physicsEngines physics-engines to use\n     * @alias module:FlowLayoutNode\n     */\n    function FlowLayoutNode(renderNode, spec) {\n        LayoutNode.apply(this, arguments);\n\n        if (!this.options) {\n            this.options = Object.create(this.constructor.DEFAULT_OPTIONS);\n            this._optionsManager = new OptionsManager(this.options);\n        }\n\n        if (!this._pe) {\n            this._pe = new PhysicsEngine();\n            this._pe.sleep();\n        }\n\n        if (!this._properties) {\n            this._properties = {};\n        }\n        else {\n            for (var propName in this._properties) {\n                this._properties[propName].init = false;\n            }\n        }\n\n        if (!this._lockTransitionable) {\n            this._lockTransitionable = new Transitionable(1);\n        }\n        else {\n            this._lockTransitionable.halt();\n            this._lockTransitionable.reset(1);\n        }\n\n        this._specModified = true;\n        this._initial = true;\n        this._spec.endState = {};\n        if (spec) {\n            this.setSpec(spec);\n        }\n    }\n    FlowLayoutNode.prototype = Object.create(LayoutNode.prototype);\n    FlowLayoutNode.prototype.constructor = FlowLayoutNode;\n\n    FlowLayoutNode.DEFAULT_OPTIONS = {\n        spring: {\n            dampingRatio: 0.8,\n            period: 300\n        },\n        properties: {\n            opacity: true,\n            align: true,\n            origin: true,\n            size: true,\n            translate: true,\n            skew: true,\n            rotate: true,\n            scale: true\n        },\n        particleRounding: 0.001\n    };\n\n    /**\n     * Defaults\n     */\n    var DEFAULT = {\n        opacity: 1,\n        opacity2D: [1, 0],\n        size: [0, 0],\n        origin: [0, 0],\n        align: [0, 0],\n        scale: [1, 1, 1],\n        translate: [0, 0, 0],\n        rotate: [0, 0, 0],\n        skew: [0, 0, 0]\n    };\n\n    /**\n     * Verifies that the integrity of the layout-node is oke.\n     */\n    /*function _verifyIntegrity() {\n        var i;\n        for (var propName in this._properties) {\n            var prop = this._properties[propName];\n            if (prop.particle) {\n                if (isNaN(prop.particle.getEnergy())) {\n                    throw 'invalid particle energy: ' + propName;\n                }\n                var value = prop.particle.getPosition();\n                for (i = 0; i < value.length; i++) {\n                    if (isNaN(value[i])) {\n                       throw 'invalid particle value: ' + propName + '(' + i + ')';\n                    }\n                }\n                value = prop.endState.get();\n                for (i = 0; i < value.length; i++) {\n                    if (isNaN(value[i])) {\n                       throw 'invalid endState value: ' + propName + '(' + i + ')';\n                    }\n                }\n            }\n        }\n    }*/\n\n    /**\n     * Sets the configuration options\n     */\n    FlowLayoutNode.prototype.setOptions = function(options) {\n        this._optionsManager.setOptions(options);\n        var wasSleeping = this._pe.isSleeping();\n        for (var propName in this._properties) {\n            var prop = this._properties[propName];\n            if (options.spring && prop.force) {\n                prop.force.setOptions(this.options.spring);\n            }\n            if (options.properties && (options.properties[propName] !== undefined)) {\n                if (this.options.properties[propName].length) {\n                    prop.enabled = this.options.properties[propName];\n                }\n                else {\n                    prop.enabled = [\n                        this.options.properties[propName],\n                        this.options.properties[propName],\n                        this.options.properties[propName]\n                    ];\n                }\n            }\n        }\n        if (wasSleeping) {\n            this._pe.sleep();\n        }\n        return this;\n    };\n\n    /**\n     * Set the properties from a spec.\n     */\n    FlowLayoutNode.prototype.setSpec = function(spec) {\n        var set;\n        if (spec.transform) {\n            set = Transform.interpret(spec.transform);\n        }\n        if (!set) {\n            set = {};\n        }\n        set.opacity = spec.opacity;\n        set.size = spec.size;\n        set.align = spec.align;\n        set.origin = spec.origin;\n\n        var oldRemoving = this._removing;\n        var oldInvalidated = this._invalidated;\n        this.set(set);\n        this._removing = oldRemoving;\n        this._invalidated = oldInvalidated;\n    };\n\n    /**\n     * Reset the end-state. This function is called on all layout-nodes prior to\n     * calling the layout-function. So that the layout-function starts with a clean slate.\n     */\n    FlowLayoutNode.prototype.reset = function() {\n        if (this._invalidated) {\n            for (var propName in this._properties) {\n                this._properties[propName].invalidated = false;\n            }\n            this._invalidated = false;\n        }\n        this.trueSizeRequested = false;\n        this.usesTrueSize = false;\n    };\n\n    /**\n     * Markes the node for removal.\n     */\n    FlowLayoutNode.prototype.remove = function(removeSpec) {\n\n        // Transition to the remove-spec state\n        this._removing = true;\n        if (removeSpec) {\n            this.setSpec(removeSpec);\n        }\n        else {\n            this._pe.sleep();\n            this._specModified = false;\n        }\n\n        // Mark for removal\n        this._invalidated = false;\n    };\n\n    /**\n     * Temporarily releases the flowing-lock that is applied to the node.\n     * E.g., when changing position, resizing, the lock should be released so that\n     * the renderables can smoothly transition to their new positions.\n     */\n    FlowLayoutNode.prototype.releaseLock = function(enable) {\n        this._lockTransitionable.halt();\n        this._lockTransitionable.reset(0);\n        if (enable) {\n          this._lockTransitionable.set(1, {\n              duration: this.options.spring.period || 1000\n          });\n        }\n    };\n\n    /**\n     * Helper function for getting the property value.\n     */\n    function _getRoundedValue3D(prop, def, precision, lockValue) {\n        if (!prop || !prop.init) {\n            return def;\n        }\n        return [\n            prop.enabled[0] ? (Math.round((prop.curState.x + ((prop.endState.x - prop.curState.x) * lockValue)) / precision) * precision) : prop.endState.x,\n            prop.enabled[1] ? (Math.round((prop.curState.y + ((prop.endState.y - prop.curState.y) * lockValue)) / precision) * precision) : prop.endState.y,\n            prop.enabled[2] ? (Math.round((prop.curState.z + ((prop.endState.z - prop.curState.z) * lockValue)) / precision) * precision) : prop.endState.z\n        ];\n    }\n\n    /**\n     * Creates the render-spec\n     */\n    FlowLayoutNode.prototype.getSpec = function() {\n\n        // When the end state was reached, return the previous spec\n        var endStateReached = this._pe.isSleeping();\n        if (!this._specModified && endStateReached) {\n            this._spec.removed = !this._invalidated;\n            return this._spec;\n        }\n        this._initial = false;\n        this._specModified = !endStateReached;\n        this._spec.removed = false;\n\n        // Step physics engine when not sleeping\n        if (!endStateReached) {\n            this._pe.step();\n        }\n\n        // Build fresh spec\n        var spec = this._spec;\n        var precision = this.options.particleRounding;\n        var lockValue = this._lockTransitionable.get();\n\n        // opacity\n        var prop = this._properties.opacity;\n        if (prop && prop.init) {\n            spec.opacity = prop.enabled[0] ? (Math.round(Math.max(0, Math.min(1, prop.curState.x)) / precision) * precision) : prop.endState.x;\n            spec.endState.opacity = prop.endState.x;\n        }\n        else {\n            spec.opacity = undefined;\n            spec.endState.opacity = undefined;\n        }\n\n        // size\n        prop = this._properties.size;\n        if (prop && prop.init) {\n            spec.size = spec.size || [0, 0];\n            spec.size[0] = prop.enabled[0] ? (Math.round((prop.curState.x + ((prop.endState.x - prop.curState.x) * lockValue)) / 0.1) * 0.1) : prop.endState.x;\n            spec.size[1] = prop.enabled[1] ? (Math.round((prop.curState.y + ((prop.endState.y - prop.curState.y) * lockValue)) / 0.1) * 0.1) : prop.endState.y;\n            spec.endState.size = spec.endState.size || [0, 0];\n            spec.endState.size[0] = prop.endState.x;\n            spec.endState.size[1] = prop.endState.y;\n        }\n        else {\n            spec.size = undefined;\n            spec.endState.size = undefined;\n        }\n\n        // align\n        prop = this._properties.align;\n        if (prop && prop.init) {\n            spec.align = spec.align || [0, 0];\n            spec.align[0] = prop.enabled[0] ? (Math.round((prop.curState.x + ((prop.endState.x - prop.curState.x) * lockValue)) / 0.1) * 0.1) : prop.endState.x;\n            spec.align[1] = prop.enabled[1] ? (Math.round((prop.curState.y + ((prop.endState.y - prop.curState.y) * lockValue)) / 0.1) * 0.1) : prop.endState.y;\n            spec.endState.align = spec.endState.align || [0, 0];\n            spec.endState.align[0] = prop.endState.x;\n            spec.endState.align[1] = prop.endState.y;\n        }\n        else {\n            spec.align = undefined;\n            spec.endState.align = undefined;\n        }\n\n        // origin\n        prop = this._properties.origin;\n        if (prop && prop.init) {\n            spec.origin = spec.origin || [0, 0];\n            spec.origin[0] = prop.enabled[0] ? (Math.round((prop.curState.x + ((prop.endState.x - prop.curState.x) * lockValue)) / 0.1) * 0.1) : prop.endState.x;\n            spec.origin[1] = prop.enabled[1] ? (Math.round((prop.curState.y + ((prop.endState.y - prop.curState.y) * lockValue)) / 0.1) * 0.1) : prop.endState.y;\n            spec.endState.origin = spec.endState.origin || [0, 0];\n            spec.endState.origin[0] = prop.endState.x;\n            spec.endState.origin[1] = prop.endState.y;\n        }\n        else {\n            spec.origin = undefined;\n            spec.endState.origin = undefined;\n        }\n\n        // translate\n        var translate = this._properties.translate;\n        var translateX;\n        var translateY;\n        var translateZ;\n        if (translate && translate.init) {\n            translateX = translate.enabled[0] ? (Math.round((translate.curState.x + ((translate.endState.x - translate.curState.x) * lockValue)) / precision) * precision) : translate.endState.x;\n            translateY = translate.enabled[1] ? (Math.round((translate.curState.y + ((translate.endState.y - translate.curState.y) * lockValue)) / precision) * precision) : translate.endState.y;\n            translateZ = translate.enabled[2] ? (Math.round((translate.curState.z + ((translate.endState.z - translate.curState.z) * lockValue)) / precision) * precision) : translate.endState.z;\n        }\n        else {\n            translateX = 0;\n            translateY = 0;\n            translateZ = 0;\n        }\n\n        // scale, skew, scale\n        var scale = this._properties.scale;\n        var skew = this._properties.skew;\n        var rotate = this._properties.rotate;\n        if (scale || skew || rotate) {\n            spec.transform = Transform.build({\n                translate: [translateX, translateY, translateZ],\n                skew: _getRoundedValue3D.call(this, skew, DEFAULT.skew, this.options.particleRounding, lockValue),\n                scale: _getRoundedValue3D.call(this, scale, DEFAULT.scale, this.options.particleRounding, lockValue),\n                rotate: _getRoundedValue3D.call(this, rotate, DEFAULT.rotate, this.options.particleRounding, lockValue)\n            });\n            spec.endState.transform = Transform.build({\n                translate: translate ? [translate.endState.x, translate.endState.y, translate.endState.z] : DEFAULT.translate,\n                scale: scale ? [scale.endState.x, scale.endState.y, scale.endState.z] : DEFAULT.scale,\n                skew: skew ? [skew.endState.x, skew.endState.y, skew.endState.z] : DEFAULT.skew,\n                rotate: rotate ? [rotate.endState.x, rotate.endState.y, rotate.endState.z] : DEFAULT.rotate\n            });\n        }\n        else if (translate) {\n            if (!spec.transform) {\n                spec.transform = Transform.translate(translateX, translateY, translateZ);\n            }\n            else {\n                spec.transform[12] = translateX;\n                spec.transform[13] = translateY;\n                spec.transform[14] = translateZ;\n            }\n            if (!spec.endState.transform) {\n                spec.endState.transform = Transform.translate(translate.endState.x, translate.endState.y, translate.endState.z);\n            }\n            else {\n                spec.endState.transform[12] = translate.endState.x;\n                spec.endState.transform[13] = translate.endState.y;\n                spec.endState.transform[14] = translate.endState.z;\n            }\n        }\n        else {\n            spec.transform = undefined;\n            spec.endState.transform = undefined;\n        }\n        return this._spec;\n    };\n\n    /**\n     * Helper function to set the property of a node (e.g. opacity, translate, etc..)\n     */\n    function _setPropertyValue(prop, propName, endState, defaultValue, immediate, isTranslate) {\n\n        // Get property\n        prop = prop || this._properties[propName];\n\n        // Update the property\n        if (prop && prop.init) {\n            prop.invalidated = true;\n            var value = defaultValue;\n            if (endState !== undefined) {\n                value = endState;\n            }\n            else if (this._removing) {\n                value = prop.particle.getPosition();\n            }\n            //if (isTranslate && (this._lockDirection !== undefined) && (this._lockTransitionable.get() === 1)) {\n            //    immediate = true; // this is a bit dirty, it should check !_lockDirection for non changes as well before setting immediate to true\n            //}\n            // set new end state (the quick way)\n            prop.endState.x = value[0];\n            prop.endState.y = (value.length > 1) ? value[1] : 0;\n            prop.endState.z = (value.length > 2) ? value[2] : 0;\n            if (immediate) {\n                // set current state (the quick way)\n                prop.curState.x = prop.endState.x;\n                prop.curState.y = prop.endState.y;\n                prop.curState.z = prop.endState.z;\n                // reset velocity (the quick way)\n                prop.velocity.x = 0;\n                prop.velocity.y = 0;\n                prop.velocity.z = 0;\n            }\n            else if ((prop.endState.x !== prop.curState.x) ||\n                     (prop.endState.y !== prop.curState.y) ||\n                     (prop.endState.z !== prop.curState.z)) {\n                this._pe.wake();\n            }\n            return;\n        }\n        else {\n\n            // Create property if neccesary\n            var wasSleeping = this._pe.isSleeping();\n            if (!prop) {\n                prop = {\n                    particle: new Particle({\n                        position: (this._initial || immediate) ? endState : defaultValue\n                    }),\n                    endState: new Vector(endState)\n                };\n                prop.curState = prop.particle.position;\n                prop.velocity = prop.particle.velocity;\n                prop.force = new Spring(this.options.spring);\n                prop.force.setOptions({\n                    anchor: prop.endState\n                });\n                this._pe.addBody(prop.particle);\n                prop.forceId = this._pe.attach(prop.force, prop.particle);\n                this._properties[propName] = prop;\n            }\n            else {\n                prop.particle.setPosition((this._initial || immediate) ? endState : defaultValue);\n                prop.endState.set(endState);\n            }\n            if (!this._initial && !immediate) {\n                this._pe.wake();\n            }\n            else if (wasSleeping) {\n                this._pe.sleep(); // nothing has changed, put back to sleep\n            }\n            if (this.options.properties[propName] && this.options.properties[propName].length) {\n                prop.enabled = this.options.properties[propName];\n            }\n            else {\n                prop.enabled = [\n                  this.options.properties[propName],\n                  this.options.properties[propName],\n                  this.options.properties[propName]\n                ];\n            }\n            prop.init = true;\n            prop.invalidated = true;\n        }\n    }\n\n    /**\n     * Get value if not equals.\n     */\n    function _getIfNE2D(a1, a2) {\n        return ((a1[0] === a2[0]) && (a1[1] === a2[1])) ? undefined : a1;\n    }\n    function _getIfNE3D(a1, a2) {\n        return ((a1[0] === a2[0]) && (a1[1] === a2[1]) && (a1[2] === a2[2])) ? undefined : a1;\n    }\n\n    /**\n     * context.set(..)\n     */\n    FlowLayoutNode.prototype.set = function(set, defaultSize) {\n        if (defaultSize) {\n            this._removing = false;\n        }\n        this._invalidated = true;\n        this.scrollLength = set.scrollLength;\n        this._specModified = true;\n\n        // opacity\n        var prop = this._properties.opacity;\n        var value = (set.opacity === DEFAULT.opacity) ? undefined : set.opacity;\n        if ((value !== undefined) || (prop && prop.init)) {\n            _setPropertyValue.call(this, prop, 'opacity', (value === undefined) ? undefined : [value, 0], DEFAULT.opacity2D);\n        }\n\n        // set align\n        prop = this._properties.align;\n        value = set.align ? _getIfNE2D(set.align, DEFAULT.align) : undefined;\n        if (value || (prop && prop.init)) {\n            _setPropertyValue.call(this, prop, 'align', value, DEFAULT.align);\n        }\n\n        // set orgin\n        prop = this._properties.origin;\n        value = set.origin ? _getIfNE2D(set.origin, DEFAULT.origin) : undefined;\n        if (value || (prop && prop.init)) {\n            _setPropertyValue.call(this, prop, 'origin', value, DEFAULT.origin);\n        }\n\n        // set size\n        prop = this._properties.size;\n        value = set.size || defaultSize;\n        if (value || (prop && prop.init)) {\n            _setPropertyValue.call(this, prop, 'size', value, defaultSize, this.usesTrueSize);\n        }\n\n        // set translate\n        prop = this._properties.translate;\n        value = set.translate;\n        if (value || (prop && prop.init)) {\n            _setPropertyValue.call(this, prop, 'translate', value, DEFAULT.translate, undefined, true);\n        }\n\n        // set scale\n        prop = this._properties.scale;\n        value = set.scale ? _getIfNE3D(set.scale, DEFAULT.scale) : undefined;\n        if (value || (prop && prop.init)) {\n            _setPropertyValue.call(this, prop, 'scale', value, DEFAULT.scale);\n        }\n\n        // set rotate\n        prop = this._properties.rotate;\n        value = set.rotate ? _getIfNE3D(set.rotate, DEFAULT.rotate) : undefined;\n        if (value || (prop && prop.init)) {\n            _setPropertyValue.call(this, prop, 'rotate', value, DEFAULT.rotate);\n        }\n\n        // set skew\n        prop = this._properties.skew;\n        value = set.skew ? _getIfNE3D(set.skew, DEFAULT.skew) : undefined;\n        if (value || (prop && prop.init)) {\n            _setPropertyValue.call(this, prop, 'skew', value, DEFAULT.skew);\n        }\n    };\n\n    module.exports = FlowLayoutNode;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/FlowLayoutNode.js\n ** module id = 43\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Force = require('./Force');\nvar Vector = require('../../math/Vector');\nfunction Spring(options) {\n    Force.call(this);\n    this.options = Object.create(this.constructor.DEFAULT_OPTIONS);\n    if (options)\n        this.setOptions(options);\n    this.disp = new Vector(0, 0, 0);\n    _init.call(this);\n}\nSpring.prototype = Object.create(Force.prototype);\nSpring.prototype.constructor = Spring;\nvar pi = Math.PI;\nvar MIN_PERIOD = 150;\nSpring.FORCE_FUNCTIONS = {\n    FENE: function (dist, rMax) {\n        var rMaxSmall = rMax * 0.99;\n        var r = Math.max(Math.min(dist, rMaxSmall), -rMaxSmall);\n        return r / (1 - r * r / (rMax * rMax));\n    },\n    HOOK: function (dist) {\n        return dist;\n    }\n};\nSpring.DEFAULT_OPTIONS = {\n    period: 300,\n    dampingRatio: 0.1,\n    length: 0,\n    maxLength: Infinity,\n    anchor: undefined,\n    forceFunction: Spring.FORCE_FUNCTIONS.HOOK\n};\nfunction _calcStiffness() {\n    var options = this.options;\n    options.stiffness = Math.pow(2 * pi / options.period, 2);\n}\nfunction _calcDamping() {\n    var options = this.options;\n    options.damping = 4 * pi * options.dampingRatio / options.period;\n}\nfunction _init() {\n    _calcStiffness.call(this);\n    _calcDamping.call(this);\n}\nSpring.prototype.setOptions = function setOptions(options) {\n    if (options.anchor !== undefined) {\n        if (options.anchor.position instanceof Vector)\n            this.options.anchor = options.anchor.position;\n        if (options.anchor instanceof Vector)\n            this.options.anchor = options.anchor;\n        if (options.anchor instanceof Array)\n            this.options.anchor = new Vector(options.anchor);\n    }\n    if (options.period !== undefined) {\n        if (options.period < MIN_PERIOD) {\n            options.period = MIN_PERIOD;\n            console.warn('The period of a SpringTransition is capped at ' + MIN_PERIOD + ' ms. Use a SnapTransition for faster transitions');\n        }\n        this.options.period = options.period;\n    }\n    if (options.dampingRatio !== undefined)\n        this.options.dampingRatio = options.dampingRatio;\n    if (options.length !== undefined)\n        this.options.length = options.length;\n    if (options.forceFunction !== undefined)\n        this.options.forceFunction = options.forceFunction;\n    if (options.maxLength !== undefined)\n        this.options.maxLength = options.maxLength;\n    _init.call(this);\n    Force.prototype.setOptions.call(this, options);\n};\nSpring.prototype.applyForce = function applyForce(targets, source) {\n    var force = this.force;\n    var disp = this.disp;\n    var options = this.options;\n    var stiffness = options.stiffness;\n    var damping = options.damping;\n    var restLength = options.length;\n    var maxLength = options.maxLength;\n    var anchor = options.anchor || source.position;\n    var forceFunction = options.forceFunction;\n    var i;\n    var target;\n    var p2;\n    var v2;\n    var dist;\n    var m;\n    for (i = 0; i < targets.length; i++) {\n        target = targets[i];\n        p2 = target.position;\n        v2 = target.velocity;\n        anchor.sub(p2).put(disp);\n        dist = disp.norm() - restLength;\n        if (dist === 0)\n            return;\n        m = target.mass;\n        stiffness *= m;\n        damping *= m;\n        disp.normalize(stiffness * forceFunction(dist, maxLength)).put(force);\n        if (damping)\n            if (source)\n                force.add(v2.sub(source.velocity).mult(-damping)).put(force);\n            else\n                force.add(v2.mult(-damping)).put(force);\n        target.applyForce(force);\n        if (source)\n            source.applyForce(force.mult(-1));\n    }\n};\nSpring.prototype.getEnergy = function getEnergy(targets, source) {\n    var options = this.options;\n    var restLength = options.length;\n    var anchor = source ? source.position : options.anchor;\n    var strength = options.stiffness;\n    var energy = 0;\n    for (var i = 0; i < targets.length; i++) {\n        var target = targets[i];\n        var dist = anchor.sub(target.position).norm() - restLength;\n        energy += 0.5 * strength * dist * dist;\n    }\n    return energy;\n};\nmodule.exports = Spring;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/physics/forces/Spring.js\n ** module id = 44\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Vector = require('../../math/Vector');\nvar EventHandler = require('../../core/EventHandler');\nfunction Force(force) {\n    this.force = new Vector(force);\n    this._eventOutput = new EventHandler();\n    EventHandler.setOutputHandler(this, this._eventOutput);\n}\nForce.prototype.setOptions = function setOptions(options) {\n    this._eventOutput.emit('change', options);\n};\nForce.prototype.applyForce = function applyForce(targets) {\n    var length = targets.length;\n    while (length--) {\n        targets[length].applyForce(this.force);\n    }\n};\nForce.prototype.getEnergy = function getEnergy() {\n    return 0;\n};\nmodule.exports = Force;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/physics/forces/Force.js\n ** module id = 45\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nfunction Vector(x, y, z) {\n    if (arguments.length === 1 && x !== undefined)\n        this.set(x);\n    else {\n        this.x = x || 0;\n        this.y = y || 0;\n        this.z = z || 0;\n    }\n    return this;\n}\nvar _register = new Vector(0, 0, 0);\nVector.prototype.add = function add(v) {\n    return _setXYZ.call(_register, this.x + v.x, this.y + v.y, this.z + v.z);\n};\nVector.prototype.sub = function sub(v) {\n    return _setXYZ.call(_register, this.x - v.x, this.y - v.y, this.z - v.z);\n};\nVector.prototype.mult = function mult(r) {\n    return _setXYZ.call(_register, r * this.x, r * this.y, r * this.z);\n};\nVector.prototype.div = function div(r) {\n    return this.mult(1 / r);\n};\nVector.prototype.cross = function cross(v) {\n    var x = this.x;\n    var y = this.y;\n    var z = this.z;\n    var vx = v.x;\n    var vy = v.y;\n    var vz = v.z;\n    return _setXYZ.call(_register, z * vy - y * vz, x * vz - z * vx, y * vx - x * vy);\n};\nVector.prototype.equals = function equals(v) {\n    return v.x === this.x && v.y === this.y && v.z === this.z;\n};\nVector.prototype.rotateX = function rotateX(theta) {\n    var x = this.x;\n    var y = this.y;\n    var z = this.z;\n    var cosTheta = Math.cos(theta);\n    var sinTheta = Math.sin(theta);\n    return _setXYZ.call(_register, x, y * cosTheta - z * sinTheta, y * sinTheta + z * cosTheta);\n};\nVector.prototype.rotateY = function rotateY(theta) {\n    var x = this.x;\n    var y = this.y;\n    var z = this.z;\n    var cosTheta = Math.cos(theta);\n    var sinTheta = Math.sin(theta);\n    return _setXYZ.call(_register, z * sinTheta + x * cosTheta, y, z * cosTheta - x * sinTheta);\n};\nVector.prototype.rotateZ = function rotateZ(theta) {\n    var x = this.x;\n    var y = this.y;\n    var z = this.z;\n    var cosTheta = Math.cos(theta);\n    var sinTheta = Math.sin(theta);\n    return _setXYZ.call(_register, x * cosTheta - y * sinTheta, x * sinTheta + y * cosTheta, z);\n};\nVector.prototype.dot = function dot(v) {\n    return this.x * v.x + this.y * v.y + this.z * v.z;\n};\nVector.prototype.normSquared = function normSquared() {\n    return this.dot(this);\n};\nVector.prototype.norm = function norm() {\n    return Math.sqrt(this.normSquared());\n};\nVector.prototype.normalize = function normalize(length) {\n    if (arguments.length === 0)\n        length = 1;\n    var norm = this.norm();\n    if (norm > 1e-7)\n        return _setFromVector.call(_register, this.mult(length / norm));\n    else\n        return _setXYZ.call(_register, length, 0, 0);\n};\nVector.prototype.clone = function clone() {\n    return new Vector(this);\n};\nVector.prototype.isZero = function isZero() {\n    return !(this.x || this.y || this.z);\n};\nfunction _setXYZ(x, y, z) {\n    this.x = x;\n    this.y = y;\n    this.z = z;\n    return this;\n}\nfunction _setFromArray(v) {\n    return _setXYZ.call(this, v[0], v[1], v[2] || 0);\n}\nfunction _setFromVector(v) {\n    return _setXYZ.call(this, v.x, v.y, v.z);\n}\nfunction _setFromNumber(x) {\n    return _setXYZ.call(this, x, 0, 0);\n}\nVector.prototype.set = function set(v) {\n    if (v instanceof Array)\n        return _setFromArray.call(this, v);\n    if (typeof v === 'number')\n        return _setFromNumber.call(this, v);\n    return _setFromVector.call(this, v);\n};\nVector.prototype.setXYZ = function (x, y, z) {\n    return _setXYZ.apply(this, arguments);\n};\nVector.prototype.set1D = function (x) {\n    return _setFromNumber.call(this, x);\n};\nVector.prototype.put = function put(v) {\n    if (this === _register)\n        _setFromVector.call(v, _register);\n    else\n        _setFromVector.call(v, this);\n};\nVector.prototype.clear = function clear() {\n    return _setXYZ.call(this, 0, 0, 0);\n};\nVector.prototype.cap = function cap(cap) {\n    if (cap === Infinity)\n        return _setFromVector.call(_register, this);\n    var norm = this.norm();\n    if (norm > cap)\n        return _setFromVector.call(_register, this.mult(cap / norm));\n    else\n        return _setFromVector.call(_register, this);\n};\nVector.prototype.project = function project(n) {\n    return n.mult(this.dot(n));\n};\nVector.prototype.reflectAcross = function reflectAcross(n) {\n    n.normalize().put(n);\n    return _setFromVector(_register, this.sub(this.project(n).mult(2)));\n};\nVector.prototype.get = function get() {\n    return [\n        this.x,\n        this.y,\n        this.z\n    ];\n};\nVector.prototype.get1D = function () {\n    return this.x;\n};\nmodule.exports = Vector;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/math/Vector.js\n ** module id = 46\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Vector = require('../../math/Vector');\nvar Transform = require('../../core/Transform');\nvar EventHandler = require('../../core/EventHandler');\nvar Integrator = require('../integrators/SymplecticEuler');\nfunction Particle(options) {\n    options = options || {};\n    var defaults = Particle.DEFAULT_OPTIONS;\n    this.position = new Vector();\n    this.velocity = new Vector();\n    this.force = new Vector();\n    this._engine = null;\n    this._isSleeping = true;\n    this._eventOutput = null;\n    this.mass = options.mass !== undefined ? options.mass : defaults.mass;\n    this.inverseMass = 1 / this.mass;\n    this.setPosition(options.position || defaults.position);\n    this.setVelocity(options.velocity || defaults.velocity);\n    this.force.set(options.force || [\n        0,\n        0,\n        0\n    ]);\n    this.transform = Transform.identity.slice();\n    this._spec = {\n        size: [\n            true,\n            true\n        ],\n        target: {\n            transform: this.transform,\n            origin: [\n                0.5,\n                0.5\n            ],\n            target: null\n        }\n    };\n}\nParticle.DEFAULT_OPTIONS = {\n    position: [\n        0,\n        0,\n        0\n    ],\n    velocity: [\n        0,\n        0,\n        0\n    ],\n    mass: 1\n};\nvar _events = {\n    start: 'start',\n    update: 'update',\n    end: 'end'\n};\nvar now = Date.now;\nParticle.prototype.isBody = false;\nParticle.prototype.isActive = function isActive() {\n    return !this._isSleeping;\n};\nParticle.prototype.sleep = function sleep() {\n    if (this._isSleeping)\n        return;\n    this.emit(_events.end, this);\n    this._isSleeping = true;\n};\nParticle.prototype.wake = function wake() {\n    if (!this._isSleeping)\n        return;\n    this.emit(_events.start, this);\n    this._isSleeping = false;\n    this._prevTime = now();\n    if (this._engine)\n        this._engine.wake();\n};\nParticle.prototype.setPosition = function setPosition(position) {\n    this.position.set(position);\n};\nParticle.prototype.setPosition1D = function setPosition1D(x) {\n    this.position.x = x;\n};\nParticle.prototype.getPosition = function getPosition() {\n    this._engine.step();\n    return this.position.get();\n};\nParticle.prototype.getPosition1D = function getPosition1D() {\n    this._engine.step();\n    return this.position.x;\n};\nParticle.prototype.setVelocity = function setVelocity(velocity) {\n    this.velocity.set(velocity);\n    if (!(velocity[0] === 0 && velocity[1] === 0 && velocity[2] === 0))\n        this.wake();\n};\nParticle.prototype.setVelocity1D = function setVelocity1D(x) {\n    this.velocity.x = x;\n    if (x !== 0)\n        this.wake();\n};\nParticle.prototype.getVelocity = function getVelocity() {\n    return this.velocity.get();\n};\nParticle.prototype.setForce = function setForce(force) {\n    this.force.set(force);\n    this.wake();\n};\nParticle.prototype.getVelocity1D = function getVelocity1D() {\n    return this.velocity.x;\n};\nParticle.prototype.setMass = function setMass(mass) {\n    this.mass = mass;\n    this.inverseMass = 1 / mass;\n};\nParticle.prototype.getMass = function getMass() {\n    return this.mass;\n};\nParticle.prototype.reset = function reset(position, velocity) {\n    this.setPosition(position || [\n        0,\n        0,\n        0\n    ]);\n    this.setVelocity(velocity || [\n        0,\n        0,\n        0\n    ]);\n};\nParticle.prototype.applyForce = function applyForce(force) {\n    if (force.isZero())\n        return;\n    this.force.add(force).put(this.force);\n    this.wake();\n};\nParticle.prototype.applyImpulse = function applyImpulse(impulse) {\n    if (impulse.isZero())\n        return;\n    var velocity = this.velocity;\n    velocity.add(impulse.mult(this.inverseMass)).put(velocity);\n};\nParticle.prototype.integrateVelocity = function integrateVelocity(dt) {\n    Integrator.integrateVelocity(this, dt);\n};\nParticle.prototype.integratePosition = function integratePosition(dt) {\n    Integrator.integratePosition(this, dt);\n};\nParticle.prototype._integrate = function _integrate(dt) {\n    this.integrateVelocity(dt);\n    this.integratePosition(dt);\n};\nParticle.prototype.getEnergy = function getEnergy() {\n    return 0.5 * this.mass * this.velocity.normSquared();\n};\nParticle.prototype.getTransform = function getTransform() {\n    this._engine.step();\n    var position = this.position;\n    var transform = this.transform;\n    transform[12] = position.x;\n    transform[13] = position.y;\n    transform[14] = position.z;\n    return transform;\n};\nParticle.prototype.modify = function modify(target) {\n    var _spec = this._spec.target;\n    _spec.transform = this.getTransform();\n    _spec.target = target;\n    return this._spec;\n};\nfunction _createEventOutput() {\n    this._eventOutput = new EventHandler();\n    this._eventOutput.bindThis(this);\n    EventHandler.setOutputHandler(this, this._eventOutput);\n}\nParticle.prototype.emit = function emit(type, data) {\n    if (!this._eventOutput)\n        return;\n    this._eventOutput.emit(type, data);\n};\nParticle.prototype.on = function on() {\n    _createEventOutput.call(this);\n    return this.on.apply(this, arguments);\n};\nParticle.prototype.removeListener = function removeListener() {\n    _createEventOutput.call(this);\n    return this.removeListener.apply(this, arguments);\n};\nParticle.prototype.pipe = function pipe() {\n    _createEventOutput.call(this);\n    return this.pipe.apply(this, arguments);\n};\nParticle.prototype.unpipe = function unpipe() {\n    _createEventOutput.call(this);\n    return this.unpipe.apply(this, arguments);\n};\nmodule.exports = Particle;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/physics/bodies/Particle.js\n ** module id = 47\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar SymplecticEuler = {};\nSymplecticEuler.integrateVelocity = function integrateVelocity(body, dt) {\n    var v = body.velocity;\n    var w = body.inverseMass;\n    var f = body.force;\n    if (f.isZero())\n        return;\n    v.add(f.mult(dt * w)).put(v);\n    f.clear();\n};\nSymplecticEuler.integratePosition = function integratePosition(body, dt) {\n    var p = body.position;\n    var v = body.velocity;\n    p.add(v.mult(dt)).put(p);\n};\nSymplecticEuler.integrateAngularMomentum = function integrateAngularMomentum(body, dt) {\n    var L = body.angularMomentum;\n    var t = body.torque;\n    if (t.isZero())\n        return;\n    L.add(t.mult(dt)).put(L);\n    t.clear();\n};\nSymplecticEuler.integrateOrientation = function integrateOrientation(body, dt) {\n    var q = body.orientation;\n    var w = body.angularVelocity;\n    if (w.isZero())\n        return;\n    q.add(q.multiply(w).scalarMultiply(0.5 * dt)).put(q);\n};\nmodule.exports = SymplecticEuler;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/physics/integrators/SymplecticEuler.js\n ** module id = 48\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar EventHandler = require('../core/EventHandler');\nfunction PhysicsEngine(options) {\n    this.options = Object.create(PhysicsEngine.DEFAULT_OPTIONS);\n    if (options)\n        this.setOptions(options);\n    this._particles = [];\n    this._bodies = [];\n    this._agentData = {};\n    this._forces = [];\n    this._constraints = [];\n    this._buffer = 0;\n    this._prevTime = now();\n    this._isSleeping = false;\n    this._eventHandler = null;\n    this._currAgentId = 0;\n    this._hasBodies = false;\n    this._eventHandler = null;\n}\nvar TIMESTEP = 17;\nvar MIN_TIME_STEP = 1000 / 120;\nvar MAX_TIME_STEP = 17;\nvar now = Date.now;\nvar _events = {\n    start: 'start',\n    update: 'update',\n    end: 'end'\n};\nPhysicsEngine.DEFAULT_OPTIONS = {\n    constraintSteps: 1,\n    sleepTolerance: 1e-7,\n    velocityCap: undefined,\n    angularVelocityCap: undefined\n};\nPhysicsEngine.prototype.setOptions = function setOptions(opts) {\n    for (var key in opts)\n        if (this.options[key])\n            this.options[key] = opts[key];\n};\nPhysicsEngine.prototype.addBody = function addBody(body) {\n    body._engine = this;\n    if (body.isBody) {\n        this._bodies.push(body);\n        this._hasBodies = true;\n    } else\n        this._particles.push(body);\n    body.on('start', this.wake.bind(this));\n    return body;\n};\nPhysicsEngine.prototype.removeBody = function removeBody(body) {\n    var array = body.isBody ? this._bodies : this._particles;\n    var index = array.indexOf(body);\n    if (index > -1) {\n        for (var agentKey in this._agentData) {\n            if (this._agentData.hasOwnProperty(agentKey)) {\n                this.detachFrom(this._agentData[agentKey].id, body);\n            }\n        }\n        array.splice(index, 1);\n    }\n    if (this.getBodies().length === 0)\n        this._hasBodies = false;\n};\nfunction _mapAgentArray(agent) {\n    if (agent.applyForce)\n        return this._forces;\n    if (agent.applyConstraint)\n        return this._constraints;\n}\nfunction _attachOne(agent, targets, source) {\n    if (targets === undefined)\n        targets = this.getParticlesAndBodies();\n    if (!(targets instanceof Array))\n        targets = [targets];\n    agent.on('change', this.wake.bind(this));\n    this._agentData[this._currAgentId] = {\n        agent: agent,\n        id: this._currAgentId,\n        targets: targets,\n        source: source\n    };\n    _mapAgentArray.call(this, agent).push(this._currAgentId);\n    return this._currAgentId++;\n}\nPhysicsEngine.prototype.attach = function attach(agents, targets, source) {\n    this.wake();\n    if (agents instanceof Array) {\n        var agentIDs = [];\n        for (var i = 0; i < agents.length; i++)\n            agentIDs[i] = _attachOne.call(this, agents[i], targets, source);\n        return agentIDs;\n    } else\n        return _attachOne.call(this, agents, targets, source);\n};\nPhysicsEngine.prototype.attachTo = function attachTo(agentID, target) {\n    _getAgentData.call(this, agentID).targets.push(target);\n};\nPhysicsEngine.prototype.detach = function detach(id) {\n    var agent = this.getAgent(id);\n    var agentArray = _mapAgentArray.call(this, agent);\n    var index = agentArray.indexOf(id);\n    agentArray.splice(index, 1);\n    delete this._agentData[id];\n};\nPhysicsEngine.prototype.detachFrom = function detachFrom(id, target) {\n    var boundAgent = _getAgentData.call(this, id);\n    if (boundAgent.source === target)\n        this.detach(id);\n    else {\n        var targets = boundAgent.targets;\n        var index = targets.indexOf(target);\n        if (index > -1)\n            targets.splice(index, 1);\n    }\n};\nPhysicsEngine.prototype.detachAll = function detachAll() {\n    this._agentData = {};\n    this._forces = [];\n    this._constraints = [];\n    this._currAgentId = 0;\n};\nfunction _getAgentData(id) {\n    return this._agentData[id];\n}\nPhysicsEngine.prototype.getAgent = function getAgent(id) {\n    return _getAgentData.call(this, id).agent;\n};\nPhysicsEngine.prototype.getParticles = function getParticles() {\n    return this._particles;\n};\nPhysicsEngine.prototype.getBodies = function getBodies() {\n    return this._bodies;\n};\nPhysicsEngine.prototype.getParticlesAndBodies = function getParticlesAndBodies() {\n    return this.getParticles().concat(this.getBodies());\n};\nPhysicsEngine.prototype.forEachParticle = function forEachParticle(fn, dt) {\n    var particles = this.getParticles();\n    for (var index = 0, len = particles.length; index < len; index++)\n        fn.call(this, particles[index], dt);\n};\nPhysicsEngine.prototype.forEachBody = function forEachBody(fn, dt) {\n    if (!this._hasBodies)\n        return;\n    var bodies = this.getBodies();\n    for (var index = 0, len = bodies.length; index < len; index++)\n        fn.call(this, bodies[index], dt);\n};\nPhysicsEngine.prototype.forEach = function forEach(fn, dt) {\n    this.forEachParticle(fn, dt);\n    this.forEachBody(fn, dt);\n};\nfunction _updateForce(index) {\n    var boundAgent = _getAgentData.call(this, this._forces[index]);\n    boundAgent.agent.applyForce(boundAgent.targets, boundAgent.source);\n}\nfunction _updateForces() {\n    for (var index = this._forces.length - 1; index > -1; index--)\n        _updateForce.call(this, index);\n}\nfunction _updateConstraint(index, dt) {\n    var boundAgent = this._agentData[this._constraints[index]];\n    return boundAgent.agent.applyConstraint(boundAgent.targets, boundAgent.source, dt);\n}\nfunction _updateConstraints(dt) {\n    var iteration = 0;\n    while (iteration < this.options.constraintSteps) {\n        for (var index = this._constraints.length - 1; index > -1; index--)\n            _updateConstraint.call(this, index, dt);\n        iteration++;\n    }\n}\nfunction _updateVelocities(body, dt) {\n    body.integrateVelocity(dt);\n    if (this.options.velocityCap)\n        body.velocity.cap(this.options.velocityCap).put(body.velocity);\n}\nfunction _updateAngularVelocities(body, dt) {\n    body.integrateAngularMomentum(dt);\n    body.updateAngularVelocity();\n    if (this.options.angularVelocityCap)\n        body.angularVelocity.cap(this.options.angularVelocityCap).put(body.angularVelocity);\n}\nfunction _updateOrientations(body, dt) {\n    body.integrateOrientation(dt);\n}\nfunction _updatePositions(body, dt) {\n    body.integratePosition(dt);\n    body.emit(_events.update, body);\n}\nfunction _integrate(dt) {\n    _updateForces.call(this, dt);\n    this.forEach(_updateVelocities, dt);\n    this.forEachBody(_updateAngularVelocities, dt);\n    _updateConstraints.call(this, dt);\n    this.forEachBody(_updateOrientations, dt);\n    this.forEach(_updatePositions, dt);\n}\nfunction _getParticlesEnergy() {\n    var energy = 0;\n    var particleEnergy = 0;\n    this.forEach(function (particle) {\n        particleEnergy = particle.getEnergy();\n        energy += particleEnergy;\n    });\n    return energy;\n}\nfunction _getAgentsEnergy() {\n    var energy = 0;\n    for (var id in this._agentData)\n        energy += this.getAgentEnergy(id);\n    return energy;\n}\nPhysicsEngine.prototype.getAgentEnergy = function (agentId) {\n    var agentData = _getAgentData.call(this, agentId);\n    return agentData.agent.getEnergy(agentData.targets, agentData.source);\n};\nPhysicsEngine.prototype.getEnergy = function getEnergy() {\n    return _getParticlesEnergy.call(this) + _getAgentsEnergy.call(this);\n};\nPhysicsEngine.prototype.step = function step() {\n    if (this.isSleeping())\n        return;\n    var currTime = now();\n    var dtFrame = currTime - this._prevTime;\n    this._prevTime = currTime;\n    if (dtFrame < MIN_TIME_STEP)\n        return;\n    if (dtFrame > MAX_TIME_STEP)\n        dtFrame = MAX_TIME_STEP;\n    _integrate.call(this, TIMESTEP);\n    this.emit(_events.update, this);\n    if (this.getEnergy() < this.options.sleepTolerance)\n        this.sleep();\n};\nPhysicsEngine.prototype.isSleeping = function isSleeping() {\n    return this._isSleeping;\n};\nPhysicsEngine.prototype.isActive = function isSleeping() {\n    return !this._isSleeping;\n};\nPhysicsEngine.prototype.sleep = function sleep() {\n    if (this._isSleeping)\n        return;\n    this.forEach(function (body) {\n        body.sleep();\n    });\n    this.emit(_events.end, this);\n    this._isSleeping = true;\n};\nPhysicsEngine.prototype.wake = function wake() {\n    if (!this._isSleeping)\n        return;\n    this._prevTime = now();\n    this.emit(_events.start, this);\n    this._isSleeping = false;\n};\nPhysicsEngine.prototype.emit = function emit(type, data) {\n    if (this._eventHandler === null)\n        return;\n    this._eventHandler.emit(type, data);\n};\nPhysicsEngine.prototype.on = function on(event, fn) {\n    if (this._eventHandler === null)\n        this._eventHandler = new EventHandler();\n    this._eventHandler.on(event, fn);\n};\nmodule.exports = PhysicsEngine;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/physics/PhysicsEngine.js\n ** module id = 49\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2014 - 2015\n */\n\n/**\n * LayoutDockHelper helps positioning nodes using docking principles.\n *\n * **Example:**\n *\n * ```javascript\n * var LayoutDockHelper = require('famous-flex/helpers/LayoutDockHelper');\n *\n * function HeaderFooterLayout(context, options) {\n *   var dock = new LayoutDockHelper(context);\n *   dock.top('header', options.headerSize);\n *   dock.bottom('footer', options.footerSize);\n *   dock.fill('content');\n * };\n * ```\n *\n * You can also use layout-literals to create layouts using docking semantics:\n *\n * ```javascript\n * var layoutController = new LayoutController({\n *   layout: {dock: [\n *     ['top', 'header', 40],\n *     ['bottom', 'footer', 40, 1], // z-index +1\n *     ['fill', 'content']\n *   ]},\n *   dataSource: {\n *     header: new Surface({content: 'header'}),\n *     footer: new Surface({content: 'footer'}),\n *     content: new Surface({content: 'content'}),\n *   }\n * });\n * ```\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var LayoutUtility = require('../LayoutUtility');\n\n    /**\n     * @class\n     * @param {LayoutContext} context layout-context\n     * @param {Object} [options] additional options\n     * @param {Object} [options.margins] margins to start out with (default: 0px)\n     * @param {Number} [options.translateZ] z-index to use when translating objects (default: 0)\n     * @alias module:LayoutDockHelper\n     */\n    function LayoutDockHelper(context, options) {\n        var size = context.size;\n        this._size = size;\n        this._context = context;\n        this._options = options;\n        this._data = {\n            z: (options && options.translateZ) ? options.translateZ : 0\n        };\n        if (options && options.margins) {\n            var margins = LayoutUtility.normalizeMargins(options.margins);\n            this._data.left = margins[3];\n            this._data.top = margins[0];\n            this._data.right = size[0] - margins[1];\n            this._data.bottom = size[1] - margins[2];\n        }\n        else {\n            this._data.left = 0;\n            this._data.top = 0;\n            this._data.right = size[0];\n            this._data.bottom = size[1];\n        }\n    }\n\n    /**\n     * Parses the layout-rules based on a JSON data object.\n     * The object should be an array with the following syntax:\n     * `[[rule, node, value, z], [rule, node, value, z], ...]`\n     *\n     * **Example:**\n     *\n     * ```JSON\n     * [\n     *   ['top', 'header', 50],\n     *   ['bottom', 'footer', 50, 10], // z-index: 10\n     *   ['margins', [10, 5]], // marginate remaining space: 10px top/bottom, 5px left/right\n     *   ['fill', 'content']\n     * ]\n     * ```\n     *\n     * @param {Object} data JSON object\n     */\n    LayoutDockHelper.prototype.parse = function(data) {\n        for (var i = 0; i < data.length; i++) {\n            var rule = data[i];\n            var value = (rule.length >= 3) ? rule[2] : undefined;\n            if (rule[0] === 'top') {\n                this.top(rule[1], value, (rule.length >=4) ? rule[3] : undefined);\n            }\n            else if (rule[0] === 'left') {\n                this.left(rule[1], value, (rule.length >=4) ? rule[3] : undefined);\n            }\n            else if (rule[0] === 'right') {\n                this.right(rule[1], value, (rule.length >=4) ? rule[3] : undefined);\n            }\n            else if (rule[0] === 'bottom') {\n                this.bottom(rule[1], value, (rule.length >=4) ? rule[3] : undefined);\n            }\n            else if (rule[0] === 'fill') {\n                this.fill(rule[1], (rule.length >=3) ? rule[2] : undefined);\n            }\n            else if (rule[0] === 'margins') {\n                this.margins(rule[1]);\n            }\n        }\n    };\n\n    /**\n     * Dock the node to the top.\n     *\n     * @param {LayoutNode|String} [node] layout-node to dock, when omitted the `height` argument argument is used for padding\n     * @param {Number} [height] height of the layout-node, when omitted the height of the node is used\n     * @param {Number} [z] z-index to use for the node\n     * @return {LayoutDockHelper} this\n     */\n    LayoutDockHelper.prototype.top = function(node, height, z) {\n        if (height instanceof Array) {\n            height = height[1];\n        }\n        if (height === undefined) {\n            var size = this._context.resolveSize(node, [this._data.right - this._data.left, this._data.bottom - this._data.top]);\n            height = size[1];\n        }\n        this._context.set(node, {\n            size: [this._data.right - this._data.left, height],\n            origin: [0, 0],\n            align: [0, 0],\n            translate: [this._data.left, this._data.top, (z === undefined) ? this._data.z : z]\n        });\n        this._data.top += height;\n        return this;\n    };\n\n    /**\n     * Dock the node to the left\n     *\n     * @param {LayoutNode|String} [node] layout-node to dock, when omitted the `width` argument argument is used for padding\n     * @param {Number} [width] width of the layout-node, when omitted the width of the node is used\n     * @param {Number} [z] z-index to use for the node\n     * @return {LayoutDockHelper} this\n     */\n    LayoutDockHelper.prototype.left = function(node, width, z) {\n        if (width instanceof Array) {\n            width = width[0];\n        }\n        if (width === undefined) {\n            var size = this._context.resolveSize(node, [this._data.right - this._data.left, this._data.bottom - this._data.top]);\n            width = size[0];\n        }\n        this._context.set(node, {\n            size: [width, this._data.bottom - this._data.top],\n            origin: [0, 0],\n            align: [0, 0],\n            translate: [this._data.left, this._data.top, (z === undefined) ? this._data.z : z]\n        });\n        this._data.left += width;\n        return this;\n    };\n\n    /**\n     * Dock the node to the bottom\n     *\n     * @param {LayoutNode|String} [node] layout-node to dock, when omitted the `height` argument argument is used for padding\n     * @param {Number} [height] height of the layout-node, when omitted the height of the node is used\n     * @param {Number} [z] z-index to use for the node\n     * @return {LayoutDockHelper} this\n     */\n    LayoutDockHelper.prototype.bottom = function(node, height, z) {\n        if (height instanceof Array) {\n            height = height[1];\n        }\n        if (height === undefined) {\n            var size = this._context.resolveSize(node, [this._data.right - this._data.left, this._data.bottom - this._data.top]);\n            height = size[1];\n        }\n        this._context.set(node, {\n            size: [this._data.right - this._data.left, height],\n            origin: [0, 1],\n            align: [0, 1],\n            translate: [this._data.left, -(this._size[1] - this._data.bottom), (z === undefined) ? this._data.z : z]\n        });\n        this._data.bottom -= height;\n        return this;\n    };\n\n    /**\n     * Dock the node to the right.\n     *\n     * @param {LayoutNode|String} [node] layout-node to dock, when omitted the `width` argument argument is used for padding\n     * @param {Number} [width] width of the layout-node, when omitted the width of the node is used\n     * @param {Number} [z] z-index to use for the node\n     * @return {LayoutDockHelper} this\n     */\n    LayoutDockHelper.prototype.right = function(node, width, z) {\n        if (width instanceof Array) {\n            width = width[0];\n        }\n        if (node) {\n            if (width === undefined) {\n                var size = this._context.resolveSize(node, [this._data.right - this._data.left, this._data.bottom - this._data.top]);\n                width = size[0];\n            }\n            this._context.set(node, {\n                size: [width, this._data.bottom - this._data.top],\n                origin: [1, 0],\n                align: [1, 0],\n                translate: [-(this._size[0] - this._data.right), this._data.top, (z === undefined) ? this._data.z : z]\n            });\n        }\n        if (width) {\n            this._data.right -= width;\n        }\n        return this;\n    };\n\n    /**\n     * Fills the node to the remaining content.\n     *\n     * @param {LayoutNode|String} node layout-node to dock\n     * @param {Number} [z] z-index to use for the node\n     * @return {LayoutDockHelper} this\n     */\n    LayoutDockHelper.prototype.fill = function(node, z) {\n        this._context.set(node, {\n            size: [this._data.right - this._data.left, this._data.bottom - this._data.top],\n            translate: [this._data.left, this._data.top, (z === undefined) ? this._data.z : z]\n        });\n        return this;\n    };\n\n    /**\n     * Applies indent margins to the remaining content.\n     *\n     * @param {Number|Array} margins margins shorthand (e.g. '5', [10, 10], [5, 10, 5, 10])\n     * @return {LayoutDockHelper} this\n     */\n    LayoutDockHelper.prototype.margins = function(margins) {\n        margins = LayoutUtility.normalizeMargins(margins);\n        this._data.left += margins[3];\n        this._data.top += margins[0];\n        this._data.right -= margins[1];\n        this._data.bottom -= margins[2];\n        return this;\n    };\n\n    /**\n     * Gets the current left/right/top/bottom/z bounds used by the dock-helper.\n     *\n     * @return {Object} `{left: x, right: x, top: x, bottom: x, z: x}`\n     */\n    LayoutDockHelper.prototype.get = function() {\n        return this._data;\n    };\n\n    // Register the helper\n    LayoutUtility.registerHelper('dock', LayoutDockHelper);\n\n    module.exports = LayoutDockHelper;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/helpers/LayoutDockHelper.js\n ** module id = 50\n ** module chunks = 0\n **/","/**\n* AutoLayout.js is licensed under the MIT license. If a copy of the\n* MIT-license was not distributed with this file, You can obtain one at:\n* http://opensource.org/licenses/mit-license.html.\n*\n* @author: Hein Rutjes (IjzerenHein)\n* @license MIT\n* @copyright Gloey Apps, 2016\n*\n* @library autolayout.js\n* @version 0.6.0\n*/\n/*-----------------------------------------------------------------------------\n| Kiwi (TypeScript version)\n|\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n(function(f){if(typeof exports===\"object\"&&typeof module!==\"undefined\"){module.exports=f()}else if(typeof define===\"function\"&&define.amd){define([],f)}else{var g;if(typeof window!==\"undefined\"){g=window}else if(typeof global!==\"undefined\"){g=global}else if(typeof self!==\"undefined\"){g=self}else{g=this}g.AutoLayout = f()}})(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require==\"function\"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error(\"Cannot find module '\"+o+\"'\");throw f.code=\"MODULE_NOT_FOUND\",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require==\"function\"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(require,module,exports){\n'use strict';\n\nvar _createClass = (function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ('value' in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; })();\n\nfunction _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError('Cannot call a class as a function'); } }\n\nvar kiwi = require('kiwi/ts/bin/kiwi');\n'use strict';\n\n/**\n * Layout attributes.\n * @enum {String}\n */\nvar Attribute = {\n  CONST: 'const',\n  NOTANATTRIBUTE: 'const',\n  VARIABLE: 'var',\n  LEFT: 'left',\n  RIGHT: 'right',\n  TOP: 'top',\n  BOTTOM: 'bottom',\n  WIDTH: 'width',\n  HEIGHT: 'height',\n  CENTERX: 'centerX',\n  CENTERY: 'centerY',\n  /*LEADING: 'leading',\n  TRAILING: 'trailing'*/\n  /** Used by the extended VFL syntax. */\n  ZINDEX: 'zIndex'\n};\n\n/**\n * Relation types.\n * @enum {String}\n */\nvar Relation = {\n  /** Less than or equal */\n  LEQ: 'leq',\n  /** Equal */\n  EQU: 'equ',\n  /** Greater than or equal */\n  GEQ: 'geq'\n};\n\n/**\n * Layout priorities.\n * @enum {String}\n */\nvar Priority = {\n  REQUIRED: 1000,\n  DEFAULTHIGH: 750,\n  DEFAULTLOW: 250\n  //FITTINGSIZELEVEL: 50,\n};\n\nvar parser = (function () {\n  /*\n   * Generated by PEG.js 0.8.0.\n   *\n   * http://pegjs.majda.cz/\n   */\n\n  function peg$subclass(child, parent) {\n    function ctor() {\n      this.constructor = child;\n    }\n    ctor.prototype = parent.prototype;\n    child.prototype = new ctor();\n  }\n\n  function SyntaxError(message, expected, found, offset, line, column) {\n    this.message = message;\n    this.expected = expected;\n    this.found = found;\n    this.offset = offset;\n    this.line = line;\n    this.column = column;\n\n    this.name = \"SyntaxError\";\n  }\n\n  peg$subclass(SyntaxError, Error);\n\n  function parse(input) {\n    var options = arguments.length > 1 ? arguments[1] : {},\n        peg$FAILED = {},\n        peg$startRuleFunctions = { visualFormatString: peg$parsevisualFormatString },\n        peg$startRuleFunction = peg$parsevisualFormatString,\n        peg$c0 = peg$FAILED,\n        peg$c1 = null,\n        peg$c2 = \":\",\n        peg$c3 = { type: \"literal\", value: \":\", description: \"\\\":\\\"\" },\n        peg$c4 = [],\n        peg$c5 = function peg$c5(o, superto, view, views, tosuper) {\n      return {\n        orientation: o ? o[0] : 'horizontal',\n        cascade: (superto || []).concat([view], [].concat.apply([], views), tosuper || [])\n      };\n    },\n        peg$c6 = \"H\",\n        peg$c7 = { type: \"literal\", value: \"H\", description: \"\\\"H\\\"\" },\n        peg$c8 = \"V\",\n        peg$c9 = { type: \"literal\", value: \"V\", description: \"\\\"V\\\"\" },\n        peg$c10 = function peg$c10(orient) {\n      return orient == 'H' ? 'horizontal' : 'vertical';\n    },\n        peg$c11 = \"|\",\n        peg$c12 = { type: \"literal\", value: \"|\", description: \"\\\"|\\\"\" },\n        peg$c13 = function peg$c13() {\n      return { view: null };\n    },\n        peg$c14 = \"[\",\n        peg$c15 = { type: \"literal\", value: \"[\", description: \"\\\"[\\\"\" },\n        peg$c16 = \"]\",\n        peg$c17 = { type: \"literal\", value: \"]\", description: \"\\\"]\\\"\" },\n        peg$c18 = function peg$c18(view, predicates) {\n      return extend(view, predicates ? { constraints: predicates } : {});\n    },\n        peg$c19 = \"-\",\n        peg$c20 = { type: \"literal\", value: \"-\", description: \"\\\"-\\\"\" },\n        peg$c21 = function peg$c21(predicateList) {\n      return predicateList;\n    },\n        peg$c22 = function peg$c22() {\n      return [{ relation: 'equ', constant: 'default', $parserOffset: offset() }];\n    },\n        peg$c23 = \"\",\n        peg$c24 = function peg$c24() {\n      return [{ relation: 'equ', constant: 0, $parserOffset: offset() }];\n    },\n        peg$c25 = function peg$c25(n) {\n      return [{ relation: 'equ', constant: n, $parserOffset: offset() }];\n    },\n        peg$c26 = \"(\",\n        peg$c27 = { type: \"literal\", value: \"(\", description: \"\\\"(\\\"\" },\n        peg$c28 = \",\",\n        peg$c29 = { type: \"literal\", value: \",\", description: \"\\\",\\\"\" },\n        peg$c30 = \")\",\n        peg$c31 = { type: \"literal\", value: \")\", description: \"\\\")\\\"\" },\n        peg$c32 = function peg$c32(p, ps) {\n      return [p].concat(ps.map(function (p) {\n        return p[1];\n      }));\n    },\n        peg$c33 = \"@\",\n        peg$c34 = { type: \"literal\", value: \"@\", description: \"\\\"@\\\"\" },\n        peg$c35 = function peg$c35(r, o, p) {\n      return extend({ relation: 'equ' }, r || {}, o, p ? p[1] : {});\n    },\n        peg$c36 = \"==\",\n        peg$c37 = { type: \"literal\", value: \"==\", description: \"\\\"==\\\"\" },\n        peg$c38 = function peg$c38() {\n      return { relation: 'equ', $parserOffset: offset() };\n    },\n        peg$c39 = \"<=\",\n        peg$c40 = { type: \"literal\", value: \"<=\", description: \"\\\"<=\\\"\" },\n        peg$c41 = function peg$c41() {\n      return { relation: 'leq', $parserOffset: offset() };\n    },\n        peg$c42 = \">=\",\n        peg$c43 = { type: \"literal\", value: \">=\", description: \"\\\">=\\\"\" },\n        peg$c44 = function peg$c44() {\n      return { relation: 'geq', $parserOffset: offset() };\n    },\n        peg$c45 = /^[0-9]/,\n        peg$c46 = { type: \"class\", value: \"[0-9]\", description: \"[0-9]\" },\n        peg$c47 = function peg$c47(digits) {\n      return { priority: parseInt(digits.join(\"\"), 10) };\n    },\n        peg$c48 = function peg$c48(n) {\n      return { constant: n };\n    },\n        peg$c49 = /^[a-zA-Z_]/,\n        peg$c50 = { type: \"class\", value: \"[a-zA-Z_]\", description: \"[a-zA-Z_]\" },\n        peg$c51 = /^[a-zA-Z0-9_]/,\n        peg$c52 = { type: \"class\", value: \"[a-zA-Z0-9_]\", description: \"[a-zA-Z0-9_]\" },\n        peg$c53 = function peg$c53(f, v) {\n      return { view: f + v };\n    },\n        peg$c54 = \".\",\n        peg$c55 = { type: \"literal\", value: \".\", description: \"\\\".\\\"\" },\n        peg$c56 = function peg$c56(digits, decimals) {\n      return parseFloat(digits.concat(\".\").concat(decimals).join(\"\"), 10);\n    },\n        peg$c57 = function peg$c57(digits) {\n      return parseInt(digits.join(\"\"), 10);\n    },\n        peg$currPos = 0,\n        peg$reportedPos = 0,\n        peg$cachedPos = 0,\n        peg$cachedPosDetails = { line: 1, column: 1, seenCR: false },\n        peg$maxFailPos = 0,\n        peg$maxFailExpected = [],\n        peg$silentFails = 0,\n        peg$result;\n\n    if (\"startRule\" in options) {\n      if (!(options.startRule in peg$startRuleFunctions)) {\n        throw new Error(\"Can't start parsing from rule \\\"\" + options.startRule + \"\\\".\");\n      }\n\n      peg$startRuleFunction = peg$startRuleFunctions[options.startRule];\n    }\n\n    function text() {\n      return input.substring(peg$reportedPos, peg$currPos);\n    }\n\n    function offset() {\n      return peg$reportedPos;\n    }\n\n    function line() {\n      return peg$computePosDetails(peg$reportedPos).line;\n    }\n\n    function column() {\n      return peg$computePosDetails(peg$reportedPos).column;\n    }\n\n    function expected(description) {\n      throw peg$buildException(null, [{ type: \"other\", description: description }], peg$reportedPos);\n    }\n\n    function error(message) {\n      throw peg$buildException(message, null, peg$reportedPos);\n    }\n\n    function peg$computePosDetails(pos) {\n      function advance(details, startPos, endPos) {\n        var p, ch;\n\n        for (p = startPos; p < endPos; p++) {\n          ch = input.charAt(p);\n          if (ch === \"\\n\") {\n            if (!details.seenCR) {\n              details.line++;\n            }\n            details.column = 1;\n            details.seenCR = false;\n          } else if (ch === \"\\r\" || ch === '\\u2028' || ch === '\\u2029') {\n            details.line++;\n            details.column = 1;\n            details.seenCR = true;\n          } else {\n            details.column++;\n            details.seenCR = false;\n          }\n        }\n      }\n\n      if (peg$cachedPos !== pos) {\n        if (peg$cachedPos > pos) {\n          peg$cachedPos = 0;\n          peg$cachedPosDetails = { line: 1, column: 1, seenCR: false };\n        }\n        advance(peg$cachedPosDetails, peg$cachedPos, pos);\n        peg$cachedPos = pos;\n      }\n\n      return peg$cachedPosDetails;\n    }\n\n    function peg$fail(expected) {\n      if (peg$currPos < peg$maxFailPos) {\n        return;\n      }\n\n      if (peg$currPos > peg$maxFailPos) {\n        peg$maxFailPos = peg$currPos;\n        peg$maxFailExpected = [];\n      }\n\n      peg$maxFailExpected.push(expected);\n    }\n\n    function peg$buildException(message, expected, pos) {\n      function cleanupExpected(expected) {\n        var i = 1;\n\n        expected.sort(function (a, b) {\n          if (a.description < b.description) {\n            return -1;\n          } else if (a.description > b.description) {\n            return 1;\n          } else {\n            return 0;\n          }\n        });\n\n        while (i < expected.length) {\n          if (expected[i - 1] === expected[i]) {\n            expected.splice(i, 1);\n          } else {\n            i++;\n          }\n        }\n      }\n\n      function buildMessage(expected, found) {\n        function stringEscape(s) {\n          function hex(ch) {\n            return ch.charCodeAt(0).toString(16).toUpperCase();\n          }\n\n          return s.replace(/\\\\/g, '\\\\\\\\').replace(/\"/g, '\\\\\"').replace(/\\x08/g, '\\\\b').replace(/\\t/g, '\\\\t').replace(/\\n/g, '\\\\n').replace(/\\f/g, '\\\\f').replace(/\\r/g, '\\\\r').replace(/[\\x00-\\x07\\x0B\\x0E\\x0F]/g, function (ch) {\n            return '\\\\x0' + hex(ch);\n          }).replace(/[\\x10-\\x1F\\x80-\\xFF]/g, function (ch) {\n            return '\\\\x' + hex(ch);\n          }).replace(/[\\u0180-\\u0FFF]/g, function (ch) {\n            return '\\\\u0' + hex(ch);\n          }).replace(/[\\u1080-\\uFFFF]/g, function (ch) {\n            return '\\\\u' + hex(ch);\n          });\n        }\n\n        var expectedDescs = new Array(expected.length),\n            expectedDesc,\n            foundDesc,\n            i;\n\n        for (i = 0; i < expected.length; i++) {\n          expectedDescs[i] = expected[i].description;\n        }\n\n        expectedDesc = expected.length > 1 ? expectedDescs.slice(0, -1).join(\", \") + \" or \" + expectedDescs[expected.length - 1] : expectedDescs[0];\n\n        foundDesc = found ? \"\\\"\" + stringEscape(found) + \"\\\"\" : \"end of input\";\n\n        return \"Expected \" + expectedDesc + \" but \" + foundDesc + \" found.\";\n      }\n\n      var posDetails = peg$computePosDetails(pos),\n          found = pos < input.length ? input.charAt(pos) : null;\n\n      if (expected !== null) {\n        cleanupExpected(expected);\n      }\n\n      return new SyntaxError(message !== null ? message : buildMessage(expected, found), expected, found, pos, posDetails.line, posDetails.column);\n    }\n\n    function peg$parsevisualFormatString() {\n      var s0, s1, s2, s3, s4, s5, s6, s7;\n\n      s0 = peg$currPos;\n      s1 = peg$currPos;\n      s2 = peg$parseorientation();\n      if (s2 !== peg$FAILED) {\n        if (input.charCodeAt(peg$currPos) === 58) {\n          s3 = peg$c2;\n          peg$currPos++;\n        } else {\n          s3 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c3);\n          }\n        }\n        if (s3 !== peg$FAILED) {\n          s2 = [s2, s3];\n          s1 = s2;\n        } else {\n          peg$currPos = s1;\n          s1 = peg$c0;\n        }\n      } else {\n        peg$currPos = s1;\n        s1 = peg$c0;\n      }\n      if (s1 === peg$FAILED) {\n        s1 = peg$c1;\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$currPos;\n        s3 = peg$parsesuperview();\n        if (s3 !== peg$FAILED) {\n          s4 = peg$parseconnection();\n          if (s4 !== peg$FAILED) {\n            s3 = [s3, s4];\n            s2 = s3;\n          } else {\n            peg$currPos = s2;\n            s2 = peg$c0;\n          }\n        } else {\n          peg$currPos = s2;\n          s2 = peg$c0;\n        }\n        if (s2 === peg$FAILED) {\n          s2 = peg$c1;\n        }\n        if (s2 !== peg$FAILED) {\n          s3 = peg$parseview();\n          if (s3 !== peg$FAILED) {\n            s4 = [];\n            s5 = peg$currPos;\n            s6 = peg$parseconnection();\n            if (s6 !== peg$FAILED) {\n              s7 = peg$parseview();\n              if (s7 !== peg$FAILED) {\n                s6 = [s6, s7];\n                s5 = s6;\n              } else {\n                peg$currPos = s5;\n                s5 = peg$c0;\n              }\n            } else {\n              peg$currPos = s5;\n              s5 = peg$c0;\n            }\n            while (s5 !== peg$FAILED) {\n              s4.push(s5);\n              s5 = peg$currPos;\n              s6 = peg$parseconnection();\n              if (s6 !== peg$FAILED) {\n                s7 = peg$parseview();\n                if (s7 !== peg$FAILED) {\n                  s6 = [s6, s7];\n                  s5 = s6;\n                } else {\n                  peg$currPos = s5;\n                  s5 = peg$c0;\n                }\n              } else {\n                peg$currPos = s5;\n                s5 = peg$c0;\n              }\n            }\n            if (s4 !== peg$FAILED) {\n              s5 = peg$currPos;\n              s6 = peg$parseconnection();\n              if (s6 !== peg$FAILED) {\n                s7 = peg$parsesuperview();\n                if (s7 !== peg$FAILED) {\n                  s6 = [s6, s7];\n                  s5 = s6;\n                } else {\n                  peg$currPos = s5;\n                  s5 = peg$c0;\n                }\n              } else {\n                peg$currPos = s5;\n                s5 = peg$c0;\n              }\n              if (s5 === peg$FAILED) {\n                s5 = peg$c1;\n              }\n              if (s5 !== peg$FAILED) {\n                peg$reportedPos = s0;\n                s1 = peg$c5(s1, s2, s3, s4, s5);\n                s0 = s1;\n              } else {\n                peg$currPos = s0;\n                s0 = peg$c0;\n              }\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseorientation() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 72) {\n        s1 = peg$c6;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c7);\n        }\n      }\n      if (s1 === peg$FAILED) {\n        if (input.charCodeAt(peg$currPos) === 86) {\n          s1 = peg$c8;\n          peg$currPos++;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c9);\n          }\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c10(s1);\n      }\n      s0 = s1;\n\n      return s0;\n    }\n\n    function peg$parsesuperview() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 124) {\n        s1 = peg$c11;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c12);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c13();\n      }\n      s0 = s1;\n\n      return s0;\n    }\n\n    function peg$parseview() {\n      var s0, s1, s2, s3, s4;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 91) {\n        s1 = peg$c14;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c15);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parseviewName();\n        if (s2 !== peg$FAILED) {\n          s3 = peg$parsepredicateListWithParens();\n          if (s3 === peg$FAILED) {\n            s3 = peg$c1;\n          }\n          if (s3 !== peg$FAILED) {\n            if (input.charCodeAt(peg$currPos) === 93) {\n              s4 = peg$c16;\n              peg$currPos++;\n            } else {\n              s4 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c17);\n              }\n            }\n            if (s4 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c18(s2, s3);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseconnection() {\n      var s0, s1, s2, s3;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 45) {\n        s1 = peg$c19;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c20);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parsepredicateList();\n        if (s2 !== peg$FAILED) {\n          if (input.charCodeAt(peg$currPos) === 45) {\n            s3 = peg$c19;\n            peg$currPos++;\n          } else {\n            s3 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c20);\n            }\n          }\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c21(s2);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.charCodeAt(peg$currPos) === 45) {\n          s1 = peg$c19;\n          peg$currPos++;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c20);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c22();\n        }\n        s0 = s1;\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          s1 = peg$c23;\n          if (s1 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c24();\n          }\n          s0 = s1;\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parsepredicateList() {\n      var s0;\n\n      s0 = peg$parsesimplePredicate();\n      if (s0 === peg$FAILED) {\n        s0 = peg$parsepredicateListWithParens();\n      }\n\n      return s0;\n    }\n\n    function peg$parsesimplePredicate() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      s1 = peg$parsenumber();\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c25(s1);\n      }\n      s0 = s1;\n\n      return s0;\n    }\n\n    function peg$parsepredicateListWithParens() {\n      var s0, s1, s2, s3, s4, s5, s6;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 40) {\n        s1 = peg$c26;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c27);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parsepredicate();\n        if (s2 !== peg$FAILED) {\n          s3 = [];\n          s4 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 44) {\n            s5 = peg$c28;\n            peg$currPos++;\n          } else {\n            s5 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c29);\n            }\n          }\n          if (s5 !== peg$FAILED) {\n            s6 = peg$parsepredicate();\n            if (s6 !== peg$FAILED) {\n              s5 = [s5, s6];\n              s4 = s5;\n            } else {\n              peg$currPos = s4;\n              s4 = peg$c0;\n            }\n          } else {\n            peg$currPos = s4;\n            s4 = peg$c0;\n          }\n          while (s4 !== peg$FAILED) {\n            s3.push(s4);\n            s4 = peg$currPos;\n            if (input.charCodeAt(peg$currPos) === 44) {\n              s5 = peg$c28;\n              peg$currPos++;\n            } else {\n              s5 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c29);\n              }\n            }\n            if (s5 !== peg$FAILED) {\n              s6 = peg$parsepredicate();\n              if (s6 !== peg$FAILED) {\n                s5 = [s5, s6];\n                s4 = s5;\n              } else {\n                peg$currPos = s4;\n                s4 = peg$c0;\n              }\n            } else {\n              peg$currPos = s4;\n              s4 = peg$c0;\n            }\n          }\n          if (s3 !== peg$FAILED) {\n            if (input.charCodeAt(peg$currPos) === 41) {\n              s4 = peg$c30;\n              peg$currPos++;\n            } else {\n              s4 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c31);\n              }\n            }\n            if (s4 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c32(s2, s3);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parsepredicate() {\n      var s0, s1, s2, s3, s4, s5;\n\n      s0 = peg$currPos;\n      s1 = peg$parserelation();\n      if (s1 === peg$FAILED) {\n        s1 = peg$c1;\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parseobjectOfPredicate();\n        if (s2 !== peg$FAILED) {\n          s3 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 64) {\n            s4 = peg$c33;\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c34);\n            }\n          }\n          if (s4 !== peg$FAILED) {\n            s5 = peg$parsepriority();\n            if (s5 !== peg$FAILED) {\n              s4 = [s4, s5];\n              s3 = s4;\n            } else {\n              peg$currPos = s3;\n              s3 = peg$c0;\n            }\n          } else {\n            peg$currPos = s3;\n            s3 = peg$c0;\n          }\n          if (s3 === peg$FAILED) {\n            s3 = peg$c1;\n          }\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c35(s1, s2, s3);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parserelation() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      if (input.substr(peg$currPos, 2) === peg$c36) {\n        s1 = peg$c36;\n        peg$currPos += 2;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c37);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c38();\n      }\n      s0 = s1;\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.substr(peg$currPos, 2) === peg$c39) {\n          s1 = peg$c39;\n          peg$currPos += 2;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c40);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c41();\n        }\n        s0 = s1;\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          if (input.substr(peg$currPos, 2) === peg$c42) {\n            s1 = peg$c42;\n            peg$currPos += 2;\n          } else {\n            s1 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c43);\n            }\n          }\n          if (s1 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c44();\n          }\n          s0 = s1;\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parseobjectOfPredicate() {\n      var s0;\n\n      s0 = peg$parseconstant();\n      if (s0 === peg$FAILED) {\n        s0 = peg$parseviewName();\n      }\n\n      return s0;\n    }\n\n    function peg$parsepriority() {\n      var s0, s1, s2;\n\n      s0 = peg$currPos;\n      s1 = [];\n      if (peg$c45.test(input.charAt(peg$currPos))) {\n        s2 = input.charAt(peg$currPos);\n        peg$currPos++;\n      } else {\n        s2 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c46);\n        }\n      }\n      if (s2 !== peg$FAILED) {\n        while (s2 !== peg$FAILED) {\n          s1.push(s2);\n          if (peg$c45.test(input.charAt(peg$currPos))) {\n            s2 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s2 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c46);\n            }\n          }\n        }\n      } else {\n        s1 = peg$c0;\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c47(s1);\n      }\n      s0 = s1;\n\n      return s0;\n    }\n\n    function peg$parseconstant() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      s1 = peg$parsenumber();\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c48(s1);\n      }\n      s0 = s1;\n\n      return s0;\n    }\n\n    function peg$parseviewName() {\n      var s0, s1, s2, s3, s4;\n\n      s0 = peg$currPos;\n      s1 = peg$currPos;\n      s2 = [];\n      if (peg$c49.test(input.charAt(peg$currPos))) {\n        s3 = input.charAt(peg$currPos);\n        peg$currPos++;\n      } else {\n        s3 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c50);\n        }\n      }\n      if (s3 !== peg$FAILED) {\n        while (s3 !== peg$FAILED) {\n          s2.push(s3);\n          if (peg$c49.test(input.charAt(peg$currPos))) {\n            s3 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s3 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c50);\n            }\n          }\n        }\n      } else {\n        s2 = peg$c0;\n      }\n      if (s2 !== peg$FAILED) {\n        s2 = input.substring(s1, peg$currPos);\n      }\n      s1 = s2;\n      if (s1 !== peg$FAILED) {\n        s2 = peg$currPos;\n        s3 = [];\n        if (peg$c51.test(input.charAt(peg$currPos))) {\n          s4 = input.charAt(peg$currPos);\n          peg$currPos++;\n        } else {\n          s4 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c52);\n          }\n        }\n        while (s4 !== peg$FAILED) {\n          s3.push(s4);\n          if (peg$c51.test(input.charAt(peg$currPos))) {\n            s4 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c52);\n            }\n          }\n        }\n        if (s3 !== peg$FAILED) {\n          s3 = input.substring(s2, peg$currPos);\n        }\n        s2 = s3;\n        if (s2 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c53(s1, s2);\n          s0 = s1;\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parsenumber() {\n      var s0, s1, s2, s3, s4;\n\n      s0 = peg$currPos;\n      s1 = [];\n      if (peg$c45.test(input.charAt(peg$currPos))) {\n        s2 = input.charAt(peg$currPos);\n        peg$currPos++;\n      } else {\n        s2 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c46);\n        }\n      }\n      if (s2 !== peg$FAILED) {\n        while (s2 !== peg$FAILED) {\n          s1.push(s2);\n          if (peg$c45.test(input.charAt(peg$currPos))) {\n            s2 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s2 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c46);\n            }\n          }\n        }\n      } else {\n        s1 = peg$c0;\n      }\n      if (s1 !== peg$FAILED) {\n        if (input.charCodeAt(peg$currPos) === 46) {\n          s2 = peg$c54;\n          peg$currPos++;\n        } else {\n          s2 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c55);\n          }\n        }\n        if (s2 !== peg$FAILED) {\n          s3 = [];\n          if (peg$c45.test(input.charAt(peg$currPos))) {\n            s4 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c46);\n            }\n          }\n          if (s4 !== peg$FAILED) {\n            while (s4 !== peg$FAILED) {\n              s3.push(s4);\n              if (peg$c45.test(input.charAt(peg$currPos))) {\n                s4 = input.charAt(peg$currPos);\n                peg$currPos++;\n              } else {\n                s4 = peg$FAILED;\n                if (peg$silentFails === 0) {\n                  peg$fail(peg$c46);\n                }\n              }\n            }\n          } else {\n            s3 = peg$c0;\n          }\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c56(s1, s3);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        s1 = [];\n        if (peg$c45.test(input.charAt(peg$currPos))) {\n          s2 = input.charAt(peg$currPos);\n          peg$currPos++;\n        } else {\n          s2 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c46);\n          }\n        }\n        if (s2 !== peg$FAILED) {\n          while (s2 !== peg$FAILED) {\n            s1.push(s2);\n            if (peg$c45.test(input.charAt(peg$currPos))) {\n              s2 = input.charAt(peg$currPos);\n              peg$currPos++;\n            } else {\n              s2 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c46);\n              }\n            }\n          }\n        } else {\n          s1 = peg$c0;\n        }\n        if (s1 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c57(s1);\n        }\n        s0 = s1;\n      }\n\n      return s0;\n    }\n\n    function extend(dst) {\n      for (var i = 1; i < arguments.length; i++) {\n        for (var k in arguments[i]) {\n          dst[k] = arguments[i][k];\n        }\n      }\n      return dst;\n    }\n\n    peg$result = peg$startRuleFunction();\n\n    if (peg$result !== peg$FAILED && peg$currPos === input.length) {\n      return peg$result;\n    } else {\n      if (peg$result !== peg$FAILED && peg$currPos < input.length) {\n        peg$fail({ type: \"end\", description: \"end of input\" });\n      }\n\n      throw peg$buildException(null, peg$maxFailExpected, peg$maxFailPos);\n    }\n  }\n\n  return {\n    SyntaxError: SyntaxError,\n    parse: parse\n  };\n})();\n\nvar parserExt = (function () {\n  /*\n   * Generated by PEG.js 0.8.0.\n   *\n   * http://pegjs.majda.cz/\n   */\n\n  function peg$subclass(child, parent) {\n    function ctor() {\n      this.constructor = child;\n    }\n    ctor.prototype = parent.prototype;\n    child.prototype = new ctor();\n  }\n\n  function SyntaxError(message, expected, found, offset, line, column) {\n    this.message = message;\n    this.expected = expected;\n    this.found = found;\n    this.offset = offset;\n    this.line = line;\n    this.column = column;\n\n    this.name = \"SyntaxError\";\n  }\n\n  peg$subclass(SyntaxError, Error);\n\n  function parse(input) {\n    var options = arguments.length > 1 ? arguments[1] : {},\n        peg$FAILED = {},\n        peg$startRuleFunctions = { visualFormatStringExt: peg$parsevisualFormatStringExt },\n        peg$startRuleFunction = peg$parsevisualFormatStringExt,\n        peg$c0 = peg$FAILED,\n        peg$c1 = \"C:\",\n        peg$c2 = { type: \"literal\", value: \"C:\", description: \"\\\"C:\\\"\" },\n        peg$c3 = [],\n        peg$c4 = null,\n        peg$c5 = function peg$c5(view, attribute, attributes, comments) {\n      return {\n        type: 'attribute',\n        view: view.view,\n        attributes: [attribute].concat(attributes)\n      };\n    },\n        peg$c6 = function peg$c6(attr, predicates) {\n      return { attr: attr, predicates: predicates };\n    },\n        peg$c7 = \":\",\n        peg$c8 = { type: \"literal\", value: \":\", description: \"\\\":\\\"\" },\n        peg$c9 = function peg$c9(o, superto, view, views, tosuper, comments) {\n      return {\n        type: 'vfl',\n        orientation: o ? o[0] : 'horizontal',\n        cascade: (superto || []).concat(view, [].concat.apply([], views), tosuper || [])\n      };\n    },\n        peg$c10 = \"HV\",\n        peg$c11 = { type: \"literal\", value: \"HV\", description: \"\\\"HV\\\"\" },\n        peg$c12 = function peg$c12() {\n      return 'horzvert';\n    },\n        peg$c13 = \"H\",\n        peg$c14 = { type: \"literal\", value: \"H\", description: \"\\\"H\\\"\" },\n        peg$c15 = function peg$c15() {\n      return 'horizontal';\n    },\n        peg$c16 = \"V\",\n        peg$c17 = { type: \"literal\", value: \"V\", description: \"\\\"V\\\"\" },\n        peg$c18 = function peg$c18() {\n      return 'vertical';\n    },\n        peg$c19 = \"Z\",\n        peg$c20 = { type: \"literal\", value: \"Z\", description: \"\\\"Z\\\"\" },\n        peg$c21 = function peg$c21() {\n      return 'zIndex';\n    },\n        peg$c22 = \" \",\n        peg$c23 = { type: \"literal\", value: \" \", description: \"\\\" \\\"\" },\n        peg$c24 = \"//\",\n        peg$c25 = { type: \"literal\", value: \"//\", description: \"\\\"//\\\"\" },\n        peg$c26 = { type: \"any\", description: \"any character\" },\n        peg$c27 = \"|\",\n        peg$c28 = { type: \"literal\", value: \"|\", description: \"\\\"|\\\"\" },\n        peg$c29 = function peg$c29() {\n      return { view: null };\n    },\n        peg$c30 = \"[\",\n        peg$c31 = { type: \"literal\", value: \"[\", description: \"\\\"[\\\"\" },\n        peg$c32 = \",\",\n        peg$c33 = { type: \"literal\", value: \",\", description: \"\\\",\\\"\" },\n        peg$c34 = \"]\",\n        peg$c35 = { type: \"literal\", value: \"]\", description: \"\\\"]\\\"\" },\n        peg$c36 = function peg$c36(view, views) {\n      return views.length ? [view].concat([].concat.apply([], views)) : view;\n    },\n        peg$c37 = function peg$c37(view, predicates, cascadedViews) {\n      return extend(extend(view, predicates ? { constraints: predicates } : {}), cascadedViews ? {\n        cascade: cascadedViews\n      } : {});\n    },\n        peg$c38 = function peg$c38(views, connection) {\n      return [].concat([].concat.apply([], views), [connection]);\n    },\n        peg$c39 = \"->\",\n        peg$c40 = { type: \"literal\", value: \"->\", description: \"\\\"->\\\"\" },\n        peg$c41 = function peg$c41() {\n      return [{ relation: 'none' }];\n    },\n        peg$c42 = \"-\",\n        peg$c43 = { type: \"literal\", value: \"-\", description: \"\\\"-\\\"\" },\n        peg$c44 = function peg$c44(predicateList) {\n      return predicateList;\n    },\n        peg$c45 = function peg$c45() {\n      return [{ relation: 'equ', constant: 'default' }];\n    },\n        peg$c46 = \"~\",\n        peg$c47 = { type: \"literal\", value: \"~\", description: \"\\\"~\\\"\" },\n        peg$c48 = function peg$c48() {\n      return [{ relation: 'equ', equalSpacing: true }];\n    },\n        peg$c49 = \"\",\n        peg$c50 = function peg$c50() {\n      return [{ relation: 'equ', constant: 0 }];\n    },\n        peg$c51 = function peg$c51(p) {\n      return [{ relation: 'equ', multiplier: p.multiplier }];\n    },\n        peg$c52 = function peg$c52(n) {\n      return [{ relation: 'equ', constant: n }];\n    },\n        peg$c53 = \"(\",\n        peg$c54 = { type: \"literal\", value: \"(\", description: \"\\\"(\\\"\" },\n        peg$c55 = \")\",\n        peg$c56 = { type: \"literal\", value: \")\", description: \"\\\")\\\"\" },\n        peg$c57 = function peg$c57(p, ps) {\n      return [p].concat(ps.map(function (p) {\n        return p[1];\n      }));\n    },\n        peg$c58 = \"@\",\n        peg$c59 = { type: \"literal\", value: \"@\", description: \"\\\"@\\\"\" },\n        peg$c60 = function peg$c60(r, o, p) {\n      return extend({ relation: 'equ' }, r || {}, o, p ? p[1] : {});\n    },\n        peg$c61 = function peg$c61(r, o, p) {\n      return extend({ relation: 'equ', equalSpacing: true }, r || {}, o, p ? p[1] : {});\n    },\n        peg$c62 = \"==\",\n        peg$c63 = { type: \"literal\", value: \"==\", description: \"\\\"==\\\"\" },\n        peg$c64 = function peg$c64() {\n      return { relation: 'equ' };\n    },\n        peg$c65 = \"<=\",\n        peg$c66 = { type: \"literal\", value: \"<=\", description: \"\\\"<=\\\"\" },\n        peg$c67 = function peg$c67() {\n      return { relation: 'leq' };\n    },\n        peg$c68 = \">=\",\n        peg$c69 = { type: \"literal\", value: \">=\", description: \"\\\">=\\\"\" },\n        peg$c70 = function peg$c70() {\n      return { relation: 'geq' };\n    },\n        peg$c71 = /^[0-9]/,\n        peg$c72 = { type: \"class\", value: \"[0-9]\", description: \"[0-9]\" },\n        peg$c73 = function peg$c73(digits) {\n      return { priority: parseInt(digits.join(\"\"), 10) };\n    },\n        peg$c74 = function peg$c74(n) {\n      return { constant: n };\n    },\n        peg$c75 = function peg$c75(n) {\n      return { constant: -n };\n    },\n        peg$c76 = \"+\",\n        peg$c77 = { type: \"literal\", value: \"+\", description: \"\\\"+\\\"\" },\n        peg$c78 = \"%\",\n        peg$c79 = { type: \"literal\", value: \"%\", description: \"\\\"%\\\"\" },\n        peg$c80 = function peg$c80(n) {\n      return { view: null, multiplier: n / 100 };\n    },\n        peg$c81 = function peg$c81(n) {\n      return { view: null, multiplier: n / -100 };\n    },\n        peg$c82 = function peg$c82(vn, a, m, c) {\n      return { view: vn.view, attribute: a ? a : undefined, multiplier: m ? m : 1, constant: c ? c : undefined };\n    },\n        peg$c83 = \".left\",\n        peg$c84 = { type: \"literal\", value: \".left\", description: \"\\\".left\\\"\" },\n        peg$c85 = function peg$c85() {\n      return 'left';\n    },\n        peg$c86 = \".right\",\n        peg$c87 = { type: \"literal\", value: \".right\", description: \"\\\".right\\\"\" },\n        peg$c88 = function peg$c88() {\n      return 'right';\n    },\n        peg$c89 = \".top\",\n        peg$c90 = { type: \"literal\", value: \".top\", description: \"\\\".top\\\"\" },\n        peg$c91 = function peg$c91() {\n      return 'top';\n    },\n        peg$c92 = \".bottom\",\n        peg$c93 = { type: \"literal\", value: \".bottom\", description: \"\\\".bottom\\\"\" },\n        peg$c94 = function peg$c94() {\n      return 'bottom';\n    },\n        peg$c95 = \".width\",\n        peg$c96 = { type: \"literal\", value: \".width\", description: \"\\\".width\\\"\" },\n        peg$c97 = function peg$c97() {\n      return 'width';\n    },\n        peg$c98 = \".height\",\n        peg$c99 = { type: \"literal\", value: \".height\", description: \"\\\".height\\\"\" },\n        peg$c100 = function peg$c100() {\n      return 'height';\n    },\n        peg$c101 = \".centerX\",\n        peg$c102 = { type: \"literal\", value: \".centerX\", description: \"\\\".centerX\\\"\" },\n        peg$c103 = function peg$c103() {\n      return 'centerX';\n    },\n        peg$c104 = \".centerY\",\n        peg$c105 = { type: \"literal\", value: \".centerY\", description: \"\\\".centerY\\\"\" },\n        peg$c106 = function peg$c106() {\n      return 'centerY';\n    },\n        peg$c107 = \"/\",\n        peg$c108 = { type: \"literal\", value: \"/\", description: \"\\\"/\\\"\" },\n        peg$c109 = function peg$c109(n) {\n      return 1 / n;\n    },\n        peg$c110 = \"/+\",\n        peg$c111 = { type: \"literal\", value: \"/+\", description: \"\\\"/+\\\"\" },\n        peg$c112 = \"/-\",\n        peg$c113 = { type: \"literal\", value: \"/-\", description: \"\\\"/-\\\"\" },\n        peg$c114 = function peg$c114(n) {\n      return -1 / n;\n    },\n        peg$c115 = \"*\",\n        peg$c116 = { type: \"literal\", value: \"*\", description: \"\\\"*\\\"\" },\n        peg$c117 = function peg$c117(n) {\n      return n;\n    },\n        peg$c118 = \"*+\",\n        peg$c119 = { type: \"literal\", value: \"*+\", description: \"\\\"*+\\\"\" },\n        peg$c120 = \"*-\",\n        peg$c121 = { type: \"literal\", value: \"*-\", description: \"\\\"*-\\\"\" },\n        peg$c122 = function peg$c122(n) {\n      return -n;\n    },\n        peg$c123 = /^[a-zA-Z_]/,\n        peg$c124 = { type: \"class\", value: \"[a-zA-Z_]\", description: \"[a-zA-Z_]\" },\n        peg$c125 = /^[a-zA-Z0-9_]/,\n        peg$c126 = { type: \"class\", value: \"[a-zA-Z0-9_]\", description: \"[a-zA-Z0-9_]\" },\n        peg$c127 = function peg$c127(f, v, r) {\n      return { view: f + v, range: r, $parserOffset: offset() };\n    },\n        peg$c128 = function peg$c128(f, v) {\n      return { view: f + v, $parserOffset: offset() };\n    },\n        peg$c129 = \"..\",\n        peg$c130 = { type: \"literal\", value: \"..\", description: \"\\\"..\\\"\" },\n        peg$c131 = function peg$c131(d) {\n      return parseInt(d);\n    },\n        peg$c132 = \".\",\n        peg$c133 = { type: \"literal\", value: \".\", description: \"\\\".\\\"\" },\n        peg$c134 = function peg$c134(digits, decimals) {\n      return parseFloat(digits.concat(\".\").concat(decimals).join(\"\"), 10);\n    },\n        peg$c135 = function peg$c135(digits) {\n      return parseInt(digits.join(\"\"), 10);\n    },\n        peg$currPos = 0,\n        peg$reportedPos = 0,\n        peg$cachedPos = 0,\n        peg$cachedPosDetails = { line: 1, column: 1, seenCR: false },\n        peg$maxFailPos = 0,\n        peg$maxFailExpected = [],\n        peg$silentFails = 0,\n        peg$result;\n\n    if (\"startRule\" in options) {\n      if (!(options.startRule in peg$startRuleFunctions)) {\n        throw new Error(\"Can't start parsing from rule \\\"\" + options.startRule + \"\\\".\");\n      }\n\n      peg$startRuleFunction = peg$startRuleFunctions[options.startRule];\n    }\n\n    function text() {\n      return input.substring(peg$reportedPos, peg$currPos);\n    }\n\n    function offset() {\n      return peg$reportedPos;\n    }\n\n    function line() {\n      return peg$computePosDetails(peg$reportedPos).line;\n    }\n\n    function column() {\n      return peg$computePosDetails(peg$reportedPos).column;\n    }\n\n    function expected(description) {\n      throw peg$buildException(null, [{ type: \"other\", description: description }], peg$reportedPos);\n    }\n\n    function error(message) {\n      throw peg$buildException(message, null, peg$reportedPos);\n    }\n\n    function peg$computePosDetails(pos) {\n      function advance(details, startPos, endPos) {\n        var p, ch;\n\n        for (p = startPos; p < endPos; p++) {\n          ch = input.charAt(p);\n          if (ch === \"\\n\") {\n            if (!details.seenCR) {\n              details.line++;\n            }\n            details.column = 1;\n            details.seenCR = false;\n          } else if (ch === \"\\r\" || ch === '\\u2028' || ch === '\\u2029') {\n            details.line++;\n            details.column = 1;\n            details.seenCR = true;\n          } else {\n            details.column++;\n            details.seenCR = false;\n          }\n        }\n      }\n\n      if (peg$cachedPos !== pos) {\n        if (peg$cachedPos > pos) {\n          peg$cachedPos = 0;\n          peg$cachedPosDetails = { line: 1, column: 1, seenCR: false };\n        }\n        advance(peg$cachedPosDetails, peg$cachedPos, pos);\n        peg$cachedPos = pos;\n      }\n\n      return peg$cachedPosDetails;\n    }\n\n    function peg$fail(expected) {\n      if (peg$currPos < peg$maxFailPos) {\n        return;\n      }\n\n      if (peg$currPos > peg$maxFailPos) {\n        peg$maxFailPos = peg$currPos;\n        peg$maxFailExpected = [];\n      }\n\n      peg$maxFailExpected.push(expected);\n    }\n\n    function peg$buildException(message, expected, pos) {\n      function cleanupExpected(expected) {\n        var i = 1;\n\n        expected.sort(function (a, b) {\n          if (a.description < b.description) {\n            return -1;\n          } else if (a.description > b.description) {\n            return 1;\n          } else {\n            return 0;\n          }\n        });\n\n        while (i < expected.length) {\n          if (expected[i - 1] === expected[i]) {\n            expected.splice(i, 1);\n          } else {\n            i++;\n          }\n        }\n      }\n\n      function buildMessage(expected, found) {\n        function stringEscape(s) {\n          function hex(ch) {\n            return ch.charCodeAt(0).toString(16).toUpperCase();\n          }\n\n          return s.replace(/\\\\/g, '\\\\\\\\').replace(/\"/g, '\\\\\"').replace(/\\x08/g, '\\\\b').replace(/\\t/g, '\\\\t').replace(/\\n/g, '\\\\n').replace(/\\f/g, '\\\\f').replace(/\\r/g, '\\\\r').replace(/[\\x00-\\x07\\x0B\\x0E\\x0F]/g, function (ch) {\n            return '\\\\x0' + hex(ch);\n          }).replace(/[\\x10-\\x1F\\x80-\\xFF]/g, function (ch) {\n            return '\\\\x' + hex(ch);\n          }).replace(/[\\u0180-\\u0FFF]/g, function (ch) {\n            return '\\\\u0' + hex(ch);\n          }).replace(/[\\u1080-\\uFFFF]/g, function (ch) {\n            return '\\\\u' + hex(ch);\n          });\n        }\n\n        var expectedDescs = new Array(expected.length),\n            expectedDesc,\n            foundDesc,\n            i;\n\n        for (i = 0; i < expected.length; i++) {\n          expectedDescs[i] = expected[i].description;\n        }\n\n        expectedDesc = expected.length > 1 ? expectedDescs.slice(0, -1).join(\", \") + \" or \" + expectedDescs[expected.length - 1] : expectedDescs[0];\n\n        foundDesc = found ? \"\\\"\" + stringEscape(found) + \"\\\"\" : \"end of input\";\n\n        return \"Expected \" + expectedDesc + \" but \" + foundDesc + \" found.\";\n      }\n\n      var posDetails = peg$computePosDetails(pos),\n          found = pos < input.length ? input.charAt(pos) : null;\n\n      if (expected !== null) {\n        cleanupExpected(expected);\n      }\n\n      return new SyntaxError(message !== null ? message : buildMessage(expected, found), expected, found, pos, posDetails.line, posDetails.column);\n    }\n\n    function peg$parsevisualFormatStringExt() {\n      var s0;\n\n      s0 = peg$parsevisualFormatString();\n      if (s0 === peg$FAILED) {\n        s0 = peg$parsevisualFormatStringConstraintExpression();\n      }\n\n      return s0;\n    }\n\n    function peg$parsevisualFormatStringConstraintExpression() {\n      var s0, s1, s2, s3, s4, s5;\n\n      s0 = peg$currPos;\n      if (input.substr(peg$currPos, 2) === peg$c1) {\n        s1 = peg$c1;\n        peg$currPos += 2;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c2);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parseviewName();\n        if (s2 !== peg$FAILED) {\n          s3 = peg$parseattributePredicate();\n          if (s3 !== peg$FAILED) {\n            s4 = [];\n            s5 = peg$parseattributePredicate();\n            while (s5 !== peg$FAILED) {\n              s4.push(s5);\n              s5 = peg$parseattributePredicate();\n            }\n            if (s4 !== peg$FAILED) {\n              s5 = peg$parsecomments();\n              if (s5 === peg$FAILED) {\n                s5 = peg$c4;\n              }\n              if (s5 !== peg$FAILED) {\n                peg$reportedPos = s0;\n                s1 = peg$c5(s2, s3, s4, s5);\n                s0 = s1;\n              } else {\n                peg$currPos = s0;\n                s0 = peg$c0;\n              }\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseattributePredicate() {\n      var s0, s1, s2;\n\n      s0 = peg$currPos;\n      s1 = peg$parseattribute();\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parsepredicateListWithParens();\n        if (s2 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c6(s1, s2);\n          s0 = s1;\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parsevisualFormatString() {\n      var s0, s1, s2, s3, s4, s5, s6, s7;\n\n      s0 = peg$currPos;\n      s1 = peg$currPos;\n      s2 = peg$parseorientation();\n      if (s2 !== peg$FAILED) {\n        if (input.charCodeAt(peg$currPos) === 58) {\n          s3 = peg$c7;\n          peg$currPos++;\n        } else {\n          s3 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c8);\n          }\n        }\n        if (s3 !== peg$FAILED) {\n          s2 = [s2, s3];\n          s1 = s2;\n        } else {\n          peg$currPos = s1;\n          s1 = peg$c0;\n        }\n      } else {\n        peg$currPos = s1;\n        s1 = peg$c0;\n      }\n      if (s1 === peg$FAILED) {\n        s1 = peg$c4;\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$currPos;\n        s3 = peg$parsesuperview();\n        if (s3 !== peg$FAILED) {\n          s4 = peg$parseconnection();\n          if (s4 !== peg$FAILED) {\n            s3 = [s3, s4];\n            s2 = s3;\n          } else {\n            peg$currPos = s2;\n            s2 = peg$c0;\n          }\n        } else {\n          peg$currPos = s2;\n          s2 = peg$c0;\n        }\n        if (s2 === peg$FAILED) {\n          s2 = peg$c4;\n        }\n        if (s2 !== peg$FAILED) {\n          s3 = peg$parseviewGroup();\n          if (s3 !== peg$FAILED) {\n            s4 = [];\n            s5 = peg$currPos;\n            s6 = peg$parseconnection();\n            if (s6 !== peg$FAILED) {\n              s7 = peg$parseviewGroup();\n              if (s7 !== peg$FAILED) {\n                s6 = [s6, s7];\n                s5 = s6;\n              } else {\n                peg$currPos = s5;\n                s5 = peg$c0;\n              }\n            } else {\n              peg$currPos = s5;\n              s5 = peg$c0;\n            }\n            while (s5 !== peg$FAILED) {\n              s4.push(s5);\n              s5 = peg$currPos;\n              s6 = peg$parseconnection();\n              if (s6 !== peg$FAILED) {\n                s7 = peg$parseviewGroup();\n                if (s7 !== peg$FAILED) {\n                  s6 = [s6, s7];\n                  s5 = s6;\n                } else {\n                  peg$currPos = s5;\n                  s5 = peg$c0;\n                }\n              } else {\n                peg$currPos = s5;\n                s5 = peg$c0;\n              }\n            }\n            if (s4 !== peg$FAILED) {\n              s5 = peg$currPos;\n              s6 = peg$parseconnection();\n              if (s6 !== peg$FAILED) {\n                s7 = peg$parsesuperview();\n                if (s7 !== peg$FAILED) {\n                  s6 = [s6, s7];\n                  s5 = s6;\n                } else {\n                  peg$currPos = s5;\n                  s5 = peg$c0;\n                }\n              } else {\n                peg$currPos = s5;\n                s5 = peg$c0;\n              }\n              if (s5 === peg$FAILED) {\n                s5 = peg$c4;\n              }\n              if (s5 !== peg$FAILED) {\n                s6 = peg$parsecomments();\n                if (s6 === peg$FAILED) {\n                  s6 = peg$c4;\n                }\n                if (s6 !== peg$FAILED) {\n                  peg$reportedPos = s0;\n                  s1 = peg$c9(s1, s2, s3, s4, s5, s6);\n                  s0 = s1;\n                } else {\n                  peg$currPos = s0;\n                  s0 = peg$c0;\n                }\n              } else {\n                peg$currPos = s0;\n                s0 = peg$c0;\n              }\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseorientation() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      if (input.substr(peg$currPos, 2) === peg$c10) {\n        s1 = peg$c10;\n        peg$currPos += 2;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c11);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c12();\n      }\n      s0 = s1;\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.charCodeAt(peg$currPos) === 72) {\n          s1 = peg$c13;\n          peg$currPos++;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c14);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c15();\n        }\n        s0 = s1;\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 86) {\n            s1 = peg$c16;\n            peg$currPos++;\n          } else {\n            s1 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c17);\n            }\n          }\n          if (s1 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c18();\n          }\n          s0 = s1;\n          if (s0 === peg$FAILED) {\n            s0 = peg$currPos;\n            if (input.charCodeAt(peg$currPos) === 90) {\n              s1 = peg$c19;\n              peg$currPos++;\n            } else {\n              s1 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c20);\n              }\n            }\n            if (s1 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c21();\n            }\n            s0 = s1;\n          }\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parsecomments() {\n      var s0, s1, s2, s3, s4;\n\n      s0 = peg$currPos;\n      s1 = [];\n      if (input.charCodeAt(peg$currPos) === 32) {\n        s2 = peg$c22;\n        peg$currPos++;\n      } else {\n        s2 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c23);\n        }\n      }\n      while (s2 !== peg$FAILED) {\n        s1.push(s2);\n        if (input.charCodeAt(peg$currPos) === 32) {\n          s2 = peg$c22;\n          peg$currPos++;\n        } else {\n          s2 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c23);\n          }\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        if (input.substr(peg$currPos, 2) === peg$c24) {\n          s2 = peg$c24;\n          peg$currPos += 2;\n        } else {\n          s2 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c25);\n          }\n        }\n        if (s2 !== peg$FAILED) {\n          s3 = [];\n          if (input.length > peg$currPos) {\n            s4 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c26);\n            }\n          }\n          while (s4 !== peg$FAILED) {\n            s3.push(s4);\n            if (input.length > peg$currPos) {\n              s4 = input.charAt(peg$currPos);\n              peg$currPos++;\n            } else {\n              s4 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c26);\n              }\n            }\n          }\n          if (s3 !== peg$FAILED) {\n            s1 = [s1, s2, s3];\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parsesuperview() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 124) {\n        s1 = peg$c27;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c28);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c29();\n      }\n      s0 = s1;\n\n      return s0;\n    }\n\n    function peg$parseviewGroup() {\n      var s0, s1, s2, s3, s4, s5, s6;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 91) {\n        s1 = peg$c30;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c31);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parseview();\n        if (s2 !== peg$FAILED) {\n          s3 = [];\n          s4 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 44) {\n            s5 = peg$c32;\n            peg$currPos++;\n          } else {\n            s5 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c33);\n            }\n          }\n          if (s5 !== peg$FAILED) {\n            s6 = peg$parseview();\n            if (s6 !== peg$FAILED) {\n              s5 = [s5, s6];\n              s4 = s5;\n            } else {\n              peg$currPos = s4;\n              s4 = peg$c0;\n            }\n          } else {\n            peg$currPos = s4;\n            s4 = peg$c0;\n          }\n          while (s4 !== peg$FAILED) {\n            s3.push(s4);\n            s4 = peg$currPos;\n            if (input.charCodeAt(peg$currPos) === 44) {\n              s5 = peg$c32;\n              peg$currPos++;\n            } else {\n              s5 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c33);\n              }\n            }\n            if (s5 !== peg$FAILED) {\n              s6 = peg$parseview();\n              if (s6 !== peg$FAILED) {\n                s5 = [s5, s6];\n                s4 = s5;\n              } else {\n                peg$currPos = s4;\n                s4 = peg$c0;\n              }\n            } else {\n              peg$currPos = s4;\n              s4 = peg$c0;\n            }\n          }\n          if (s3 !== peg$FAILED) {\n            if (input.charCodeAt(peg$currPos) === 93) {\n              s4 = peg$c34;\n              peg$currPos++;\n            } else {\n              s4 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c35);\n              }\n            }\n            if (s4 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c36(s2, s3);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseview() {\n      var s0, s1, s2, s3;\n\n      s0 = peg$currPos;\n      s1 = peg$parseviewNameRange();\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parsepredicateListWithParens();\n        if (s2 === peg$FAILED) {\n          s2 = peg$c4;\n        }\n        if (s2 !== peg$FAILED) {\n          s3 = peg$parsecascadedViews();\n          if (s3 === peg$FAILED) {\n            s3 = peg$c4;\n          }\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c37(s1, s2, s3);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parsecascadedViews() {\n      var s0, s1, s2, s3, s4, s5;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 58) {\n        s1 = peg$c7;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c8);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = [];\n        s3 = peg$currPos;\n        s4 = peg$parseconnection();\n        if (s4 !== peg$FAILED) {\n          s5 = peg$parseviewGroup();\n          if (s5 !== peg$FAILED) {\n            s4 = [s4, s5];\n            s3 = s4;\n          } else {\n            peg$currPos = s3;\n            s3 = peg$c0;\n          }\n        } else {\n          peg$currPos = s3;\n          s3 = peg$c0;\n        }\n        if (s3 !== peg$FAILED) {\n          while (s3 !== peg$FAILED) {\n            s2.push(s3);\n            s3 = peg$currPos;\n            s4 = peg$parseconnection();\n            if (s4 !== peg$FAILED) {\n              s5 = peg$parseviewGroup();\n              if (s5 !== peg$FAILED) {\n                s4 = [s4, s5];\n                s3 = s4;\n              } else {\n                peg$currPos = s3;\n                s3 = peg$c0;\n              }\n            } else {\n              peg$currPos = s3;\n              s3 = peg$c0;\n            }\n          }\n        } else {\n          s2 = peg$c0;\n        }\n        if (s2 !== peg$FAILED) {\n          s3 = peg$parseconnection();\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c38(s2, s3);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseconnection() {\n      var s0, s1, s2, s3;\n\n      s0 = peg$currPos;\n      if (input.substr(peg$currPos, 2) === peg$c39) {\n        s1 = peg$c39;\n        peg$currPos += 2;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c40);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c41();\n      }\n      s0 = s1;\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.charCodeAt(peg$currPos) === 45) {\n          s1 = peg$c42;\n          peg$currPos++;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c43);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          s2 = peg$parsepredicateList();\n          if (s2 !== peg$FAILED) {\n            if (input.charCodeAt(peg$currPos) === 45) {\n              s3 = peg$c42;\n              peg$currPos++;\n            } else {\n              s3 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c43);\n              }\n            }\n            if (s3 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c44(s2);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 45) {\n            s1 = peg$c42;\n            peg$currPos++;\n          } else {\n            s1 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c43);\n            }\n          }\n          if (s1 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c45();\n          }\n          s0 = s1;\n          if (s0 === peg$FAILED) {\n            s0 = peg$currPos;\n            if (input.charCodeAt(peg$currPos) === 126) {\n              s1 = peg$c46;\n              peg$currPos++;\n            } else {\n              s1 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c47);\n              }\n            }\n            if (s1 !== peg$FAILED) {\n              s2 = peg$parseequalSpacingPredicateList();\n              if (s2 !== peg$FAILED) {\n                if (input.charCodeAt(peg$currPos) === 126) {\n                  s3 = peg$c46;\n                  peg$currPos++;\n                } else {\n                  s3 = peg$FAILED;\n                  if (peg$silentFails === 0) {\n                    peg$fail(peg$c47);\n                  }\n                }\n                if (s3 !== peg$FAILED) {\n                  peg$reportedPos = s0;\n                  s1 = peg$c44(s2);\n                  s0 = s1;\n                } else {\n                  peg$currPos = s0;\n                  s0 = peg$c0;\n                }\n              } else {\n                peg$currPos = s0;\n                s0 = peg$c0;\n              }\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n            if (s0 === peg$FAILED) {\n              s0 = peg$currPos;\n              if (input.charCodeAt(peg$currPos) === 126) {\n                s1 = peg$c46;\n                peg$currPos++;\n              } else {\n                s1 = peg$FAILED;\n                if (peg$silentFails === 0) {\n                  peg$fail(peg$c47);\n                }\n              }\n              if (s1 !== peg$FAILED) {\n                peg$reportedPos = s0;\n                s1 = peg$c48();\n              }\n              s0 = s1;\n              if (s0 === peg$FAILED) {\n                s0 = peg$currPos;\n                s1 = peg$c49;\n                if (s1 !== peg$FAILED) {\n                  peg$reportedPos = s0;\n                  s1 = peg$c50();\n                }\n                s0 = s1;\n              }\n            }\n          }\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parsepredicateList() {\n      var s0;\n\n      s0 = peg$parsesimplePredicate();\n      if (s0 === peg$FAILED) {\n        s0 = peg$parsepredicateListWithParens();\n      }\n\n      return s0;\n    }\n\n    function peg$parsesimplePredicate() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      s1 = peg$parsepercentage();\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c51(s1);\n      }\n      s0 = s1;\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        s1 = peg$parsenumber();\n        if (s1 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c52(s1);\n        }\n        s0 = s1;\n      }\n\n      return s0;\n    }\n\n    function peg$parsepredicateListWithParens() {\n      var s0, s1, s2, s3, s4, s5, s6;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 40) {\n        s1 = peg$c53;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c54);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parsepredicate();\n        if (s2 !== peg$FAILED) {\n          s3 = [];\n          s4 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 44) {\n            s5 = peg$c32;\n            peg$currPos++;\n          } else {\n            s5 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c33);\n            }\n          }\n          if (s5 !== peg$FAILED) {\n            s6 = peg$parsepredicate();\n            if (s6 !== peg$FAILED) {\n              s5 = [s5, s6];\n              s4 = s5;\n            } else {\n              peg$currPos = s4;\n              s4 = peg$c0;\n            }\n          } else {\n            peg$currPos = s4;\n            s4 = peg$c0;\n          }\n          while (s4 !== peg$FAILED) {\n            s3.push(s4);\n            s4 = peg$currPos;\n            if (input.charCodeAt(peg$currPos) === 44) {\n              s5 = peg$c32;\n              peg$currPos++;\n            } else {\n              s5 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c33);\n              }\n            }\n            if (s5 !== peg$FAILED) {\n              s6 = peg$parsepredicate();\n              if (s6 !== peg$FAILED) {\n                s5 = [s5, s6];\n                s4 = s5;\n              } else {\n                peg$currPos = s4;\n                s4 = peg$c0;\n              }\n            } else {\n              peg$currPos = s4;\n              s4 = peg$c0;\n            }\n          }\n          if (s3 !== peg$FAILED) {\n            if (input.charCodeAt(peg$currPos) === 41) {\n              s4 = peg$c55;\n              peg$currPos++;\n            } else {\n              s4 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c56);\n              }\n            }\n            if (s4 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c57(s2, s3);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parsepredicate() {\n      var s0, s1, s2, s3, s4, s5;\n\n      s0 = peg$currPos;\n      s1 = peg$parserelation();\n      if (s1 === peg$FAILED) {\n        s1 = peg$c4;\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parseobjectOfPredicate();\n        if (s2 !== peg$FAILED) {\n          s3 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 64) {\n            s4 = peg$c58;\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c59);\n            }\n          }\n          if (s4 !== peg$FAILED) {\n            s5 = peg$parsepriority();\n            if (s5 !== peg$FAILED) {\n              s4 = [s4, s5];\n              s3 = s4;\n            } else {\n              peg$currPos = s3;\n              s3 = peg$c0;\n            }\n          } else {\n            peg$currPos = s3;\n            s3 = peg$c0;\n          }\n          if (s3 === peg$FAILED) {\n            s3 = peg$c4;\n          }\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c60(s1, s2, s3);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseequalSpacingPredicateList() {\n      var s0, s1, s2, s3, s4, s5, s6;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 40) {\n        s1 = peg$c53;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c54);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parseequalSpacingPredicate();\n        if (s2 !== peg$FAILED) {\n          s3 = [];\n          s4 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 44) {\n            s5 = peg$c32;\n            peg$currPos++;\n          } else {\n            s5 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c33);\n            }\n          }\n          if (s5 !== peg$FAILED) {\n            s6 = peg$parseequalSpacingPredicate();\n            if (s6 !== peg$FAILED) {\n              s5 = [s5, s6];\n              s4 = s5;\n            } else {\n              peg$currPos = s4;\n              s4 = peg$c0;\n            }\n          } else {\n            peg$currPos = s4;\n            s4 = peg$c0;\n          }\n          while (s4 !== peg$FAILED) {\n            s3.push(s4);\n            s4 = peg$currPos;\n            if (input.charCodeAt(peg$currPos) === 44) {\n              s5 = peg$c32;\n              peg$currPos++;\n            } else {\n              s5 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c33);\n              }\n            }\n            if (s5 !== peg$FAILED) {\n              s6 = peg$parseequalSpacingPredicate();\n              if (s6 !== peg$FAILED) {\n                s5 = [s5, s6];\n                s4 = s5;\n              } else {\n                peg$currPos = s4;\n                s4 = peg$c0;\n              }\n            } else {\n              peg$currPos = s4;\n              s4 = peg$c0;\n            }\n          }\n          if (s3 !== peg$FAILED) {\n            if (input.charCodeAt(peg$currPos) === 41) {\n              s4 = peg$c55;\n              peg$currPos++;\n            } else {\n              s4 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c56);\n              }\n            }\n            if (s4 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c57(s2, s3);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseequalSpacingPredicate() {\n      var s0, s1, s2, s3, s4, s5;\n\n      s0 = peg$currPos;\n      s1 = peg$parserelation();\n      if (s1 === peg$FAILED) {\n        s1 = peg$c4;\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parseobjectOfPredicate();\n        if (s2 !== peg$FAILED) {\n          s3 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 64) {\n            s4 = peg$c58;\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c59);\n            }\n          }\n          if (s4 !== peg$FAILED) {\n            s5 = peg$parsepriority();\n            if (s5 !== peg$FAILED) {\n              s4 = [s4, s5];\n              s3 = s4;\n            } else {\n              peg$currPos = s3;\n              s3 = peg$c0;\n            }\n          } else {\n            peg$currPos = s3;\n            s3 = peg$c0;\n          }\n          if (s3 === peg$FAILED) {\n            s3 = peg$c4;\n          }\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c61(s1, s2, s3);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parserelation() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      if (input.substr(peg$currPos, 2) === peg$c62) {\n        s1 = peg$c62;\n        peg$currPos += 2;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c63);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c64();\n      }\n      s0 = s1;\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.substr(peg$currPos, 2) === peg$c65) {\n          s1 = peg$c65;\n          peg$currPos += 2;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c66);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c67();\n        }\n        s0 = s1;\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          if (input.substr(peg$currPos, 2) === peg$c68) {\n            s1 = peg$c68;\n            peg$currPos += 2;\n          } else {\n            s1 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c69);\n            }\n          }\n          if (s1 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c70();\n          }\n          s0 = s1;\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parseobjectOfPredicate() {\n      var s0;\n\n      s0 = peg$parsepercentage();\n      if (s0 === peg$FAILED) {\n        s0 = peg$parseconstant();\n        if (s0 === peg$FAILED) {\n          s0 = peg$parseviewPredicate();\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parsepriority() {\n      var s0, s1, s2;\n\n      s0 = peg$currPos;\n      s1 = [];\n      if (peg$c71.test(input.charAt(peg$currPos))) {\n        s2 = input.charAt(peg$currPos);\n        peg$currPos++;\n      } else {\n        s2 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c72);\n        }\n      }\n      if (s2 !== peg$FAILED) {\n        while (s2 !== peg$FAILED) {\n          s1.push(s2);\n          if (peg$c71.test(input.charAt(peg$currPos))) {\n            s2 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s2 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c72);\n            }\n          }\n        }\n      } else {\n        s1 = peg$c0;\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c73(s1);\n      }\n      s0 = s1;\n\n      return s0;\n    }\n\n    function peg$parseconstant() {\n      var s0, s1, s2;\n\n      s0 = peg$currPos;\n      s1 = peg$parsenumber();\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c74(s1);\n      }\n      s0 = s1;\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.charCodeAt(peg$currPos) === 45) {\n          s1 = peg$c42;\n          peg$currPos++;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c43);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          s2 = peg$parsenumber();\n          if (s2 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c75(s2);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 43) {\n            s1 = peg$c76;\n            peg$currPos++;\n          } else {\n            s1 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c77);\n            }\n          }\n          if (s1 !== peg$FAILED) {\n            s2 = peg$parsenumber();\n            if (s2 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c74(s2);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parsepercentage() {\n      var s0, s1, s2, s3;\n\n      s0 = peg$currPos;\n      s1 = peg$parsenumber();\n      if (s1 !== peg$FAILED) {\n        if (input.charCodeAt(peg$currPos) === 37) {\n          s2 = peg$c78;\n          peg$currPos++;\n        } else {\n          s2 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c79);\n          }\n        }\n        if (s2 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c80(s1);\n          s0 = s1;\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.charCodeAt(peg$currPos) === 45) {\n          s1 = peg$c42;\n          peg$currPos++;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c43);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          s2 = peg$parsenumber();\n          if (s2 !== peg$FAILED) {\n            if (input.charCodeAt(peg$currPos) === 37) {\n              s3 = peg$c78;\n              peg$currPos++;\n            } else {\n              s3 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c79);\n              }\n            }\n            if (s3 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c81(s2);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          if (input.charCodeAt(peg$currPos) === 43) {\n            s1 = peg$c76;\n            peg$currPos++;\n          } else {\n            s1 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c77);\n            }\n          }\n          if (s1 !== peg$FAILED) {\n            s2 = peg$parsenumber();\n            if (s2 !== peg$FAILED) {\n              if (input.charCodeAt(peg$currPos) === 37) {\n                s3 = peg$c78;\n                peg$currPos++;\n              } else {\n                s3 = peg$FAILED;\n                if (peg$silentFails === 0) {\n                  peg$fail(peg$c79);\n                }\n              }\n              if (s3 !== peg$FAILED) {\n                peg$reportedPos = s0;\n                s1 = peg$c80(s2);\n                s0 = s1;\n              } else {\n                peg$currPos = s0;\n                s0 = peg$c0;\n              }\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parseviewPredicate() {\n      var s0, s1, s2, s3, s4;\n\n      s0 = peg$currPos;\n      s1 = peg$parseviewName();\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parseattribute();\n        if (s2 === peg$FAILED) {\n          s2 = peg$c4;\n        }\n        if (s2 !== peg$FAILED) {\n          s3 = peg$parsemultiplier();\n          if (s3 === peg$FAILED) {\n            s3 = peg$c4;\n          }\n          if (s3 !== peg$FAILED) {\n            s4 = peg$parseconstantExpr();\n            if (s4 === peg$FAILED) {\n              s4 = peg$c4;\n            }\n            if (s4 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c82(s1, s2, s3, s4);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parseattribute() {\n      var s0, s1;\n\n      s0 = peg$currPos;\n      if (input.substr(peg$currPos, 5) === peg$c83) {\n        s1 = peg$c83;\n        peg$currPos += 5;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c84);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        peg$reportedPos = s0;\n        s1 = peg$c85();\n      }\n      s0 = s1;\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.substr(peg$currPos, 6) === peg$c86) {\n          s1 = peg$c86;\n          peg$currPos += 6;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c87);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c88();\n        }\n        s0 = s1;\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          if (input.substr(peg$currPos, 4) === peg$c89) {\n            s1 = peg$c89;\n            peg$currPos += 4;\n          } else {\n            s1 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c90);\n            }\n          }\n          if (s1 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c91();\n          }\n          s0 = s1;\n          if (s0 === peg$FAILED) {\n            s0 = peg$currPos;\n            if (input.substr(peg$currPos, 7) === peg$c92) {\n              s1 = peg$c92;\n              peg$currPos += 7;\n            } else {\n              s1 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c93);\n              }\n            }\n            if (s1 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c94();\n            }\n            s0 = s1;\n            if (s0 === peg$FAILED) {\n              s0 = peg$currPos;\n              if (input.substr(peg$currPos, 6) === peg$c95) {\n                s1 = peg$c95;\n                peg$currPos += 6;\n              } else {\n                s1 = peg$FAILED;\n                if (peg$silentFails === 0) {\n                  peg$fail(peg$c96);\n                }\n              }\n              if (s1 !== peg$FAILED) {\n                peg$reportedPos = s0;\n                s1 = peg$c97();\n              }\n              s0 = s1;\n              if (s0 === peg$FAILED) {\n                s0 = peg$currPos;\n                if (input.substr(peg$currPos, 7) === peg$c98) {\n                  s1 = peg$c98;\n                  peg$currPos += 7;\n                } else {\n                  s1 = peg$FAILED;\n                  if (peg$silentFails === 0) {\n                    peg$fail(peg$c99);\n                  }\n                }\n                if (s1 !== peg$FAILED) {\n                  peg$reportedPos = s0;\n                  s1 = peg$c100();\n                }\n                s0 = s1;\n                if (s0 === peg$FAILED) {\n                  s0 = peg$currPos;\n                  if (input.substr(peg$currPos, 8) === peg$c101) {\n                    s1 = peg$c101;\n                    peg$currPos += 8;\n                  } else {\n                    s1 = peg$FAILED;\n                    if (peg$silentFails === 0) {\n                      peg$fail(peg$c102);\n                    }\n                  }\n                  if (s1 !== peg$FAILED) {\n                    peg$reportedPos = s0;\n                    s1 = peg$c103();\n                  }\n                  s0 = s1;\n                  if (s0 === peg$FAILED) {\n                    s0 = peg$currPos;\n                    if (input.substr(peg$currPos, 8) === peg$c104) {\n                      s1 = peg$c104;\n                      peg$currPos += 8;\n                    } else {\n                      s1 = peg$FAILED;\n                      if (peg$silentFails === 0) {\n                        peg$fail(peg$c105);\n                      }\n                    }\n                    if (s1 !== peg$FAILED) {\n                      peg$reportedPos = s0;\n                      s1 = peg$c106();\n                    }\n                    s0 = s1;\n                  }\n                }\n              }\n            }\n          }\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parsemultiplier() {\n      var s0, s1, s2;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 47) {\n        s1 = peg$c107;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c108);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parsenumber();\n        if (s2 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c109(s2);\n          s0 = s1;\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.substr(peg$currPos, 2) === peg$c110) {\n          s1 = peg$c110;\n          peg$currPos += 2;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c111);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          s2 = peg$parsenumber();\n          if (s2 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c109(s2);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n        if (s0 === peg$FAILED) {\n          s0 = peg$currPos;\n          if (input.substr(peg$currPos, 2) === peg$c112) {\n            s1 = peg$c112;\n            peg$currPos += 2;\n          } else {\n            s1 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c113);\n            }\n          }\n          if (s1 !== peg$FAILED) {\n            s2 = peg$parsenumber();\n            if (s2 !== peg$FAILED) {\n              peg$reportedPos = s0;\n              s1 = peg$c114(s2);\n              s0 = s1;\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n          if (s0 === peg$FAILED) {\n            s0 = peg$currPos;\n            if (input.charCodeAt(peg$currPos) === 42) {\n              s1 = peg$c115;\n              peg$currPos++;\n            } else {\n              s1 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c116);\n              }\n            }\n            if (s1 !== peg$FAILED) {\n              s2 = peg$parsenumber();\n              if (s2 !== peg$FAILED) {\n                peg$reportedPos = s0;\n                s1 = peg$c117(s2);\n                s0 = s1;\n              } else {\n                peg$currPos = s0;\n                s0 = peg$c0;\n              }\n            } else {\n              peg$currPos = s0;\n              s0 = peg$c0;\n            }\n            if (s0 === peg$FAILED) {\n              s0 = peg$currPos;\n              if (input.substr(peg$currPos, 2) === peg$c118) {\n                s1 = peg$c118;\n                peg$currPos += 2;\n              } else {\n                s1 = peg$FAILED;\n                if (peg$silentFails === 0) {\n                  peg$fail(peg$c119);\n                }\n              }\n              if (s1 !== peg$FAILED) {\n                s2 = peg$parsenumber();\n                if (s2 !== peg$FAILED) {\n                  peg$reportedPos = s0;\n                  s1 = peg$c117(s2);\n                  s0 = s1;\n                } else {\n                  peg$currPos = s0;\n                  s0 = peg$c0;\n                }\n              } else {\n                peg$currPos = s0;\n                s0 = peg$c0;\n              }\n              if (s0 === peg$FAILED) {\n                s0 = peg$currPos;\n                if (input.substr(peg$currPos, 2) === peg$c120) {\n                  s1 = peg$c120;\n                  peg$currPos += 2;\n                } else {\n                  s1 = peg$FAILED;\n                  if (peg$silentFails === 0) {\n                    peg$fail(peg$c121);\n                  }\n                }\n                if (s1 !== peg$FAILED) {\n                  s2 = peg$parsenumber();\n                  if (s2 !== peg$FAILED) {\n                    peg$reportedPos = s0;\n                    s1 = peg$c122(s2);\n                    s0 = s1;\n                  } else {\n                    peg$currPos = s0;\n                    s0 = peg$c0;\n                  }\n                } else {\n                  peg$currPos = s0;\n                  s0 = peg$c0;\n                }\n              }\n            }\n          }\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parseconstantExpr() {\n      var s0, s1, s2;\n\n      s0 = peg$currPos;\n      if (input.charCodeAt(peg$currPos) === 45) {\n        s1 = peg$c42;\n        peg$currPos++;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c43);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = peg$parsenumber();\n        if (s2 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c122(s2);\n          s0 = s1;\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        if (input.charCodeAt(peg$currPos) === 43) {\n          s1 = peg$c76;\n          peg$currPos++;\n        } else {\n          s1 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c77);\n          }\n        }\n        if (s1 !== peg$FAILED) {\n          s2 = peg$parsenumber();\n          if (s2 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c117(s2);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parseviewNameRange() {\n      var s0, s1, s2, s3, s4;\n\n      s0 = peg$currPos;\n      s1 = peg$currPos;\n      s2 = [];\n      if (peg$c123.test(input.charAt(peg$currPos))) {\n        s3 = input.charAt(peg$currPos);\n        peg$currPos++;\n      } else {\n        s3 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c124);\n        }\n      }\n      if (s3 !== peg$FAILED) {\n        while (s3 !== peg$FAILED) {\n          s2.push(s3);\n          if (peg$c123.test(input.charAt(peg$currPos))) {\n            s3 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s3 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c124);\n            }\n          }\n        }\n      } else {\n        s2 = peg$c0;\n      }\n      if (s2 !== peg$FAILED) {\n        s2 = input.substring(s1, peg$currPos);\n      }\n      s1 = s2;\n      if (s1 !== peg$FAILED) {\n        s2 = peg$currPos;\n        s3 = [];\n        if (peg$c125.test(input.charAt(peg$currPos))) {\n          s4 = input.charAt(peg$currPos);\n          peg$currPos++;\n        } else {\n          s4 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c126);\n          }\n        }\n        while (s4 !== peg$FAILED) {\n          s3.push(s4);\n          if (peg$c125.test(input.charAt(peg$currPos))) {\n            s4 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c126);\n            }\n          }\n        }\n        if (s3 !== peg$FAILED) {\n          s3 = input.substring(s2, peg$currPos);\n        }\n        s2 = s3;\n        if (s2 !== peg$FAILED) {\n          s3 = peg$parserange();\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c127(s1, s2, s3);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        s1 = peg$currPos;\n        s2 = [];\n        if (peg$c123.test(input.charAt(peg$currPos))) {\n          s3 = input.charAt(peg$currPos);\n          peg$currPos++;\n        } else {\n          s3 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c124);\n          }\n        }\n        if (s3 !== peg$FAILED) {\n          while (s3 !== peg$FAILED) {\n            s2.push(s3);\n            if (peg$c123.test(input.charAt(peg$currPos))) {\n              s3 = input.charAt(peg$currPos);\n              peg$currPos++;\n            } else {\n              s3 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c124);\n              }\n            }\n          }\n        } else {\n          s2 = peg$c0;\n        }\n        if (s2 !== peg$FAILED) {\n          s2 = input.substring(s1, peg$currPos);\n        }\n        s1 = s2;\n        if (s1 !== peg$FAILED) {\n          s2 = peg$currPos;\n          s3 = [];\n          if (peg$c125.test(input.charAt(peg$currPos))) {\n            s4 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c126);\n            }\n          }\n          while (s4 !== peg$FAILED) {\n            s3.push(s4);\n            if (peg$c125.test(input.charAt(peg$currPos))) {\n              s4 = input.charAt(peg$currPos);\n              peg$currPos++;\n            } else {\n              s4 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c126);\n              }\n            }\n          }\n          if (s3 !== peg$FAILED) {\n            s3 = input.substring(s2, peg$currPos);\n          }\n          s2 = s3;\n          if (s2 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c128(s1, s2);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      }\n\n      return s0;\n    }\n\n    function peg$parseviewName() {\n      var s0, s1, s2, s3, s4;\n\n      s0 = peg$currPos;\n      s1 = peg$currPos;\n      s2 = [];\n      if (peg$c123.test(input.charAt(peg$currPos))) {\n        s3 = input.charAt(peg$currPos);\n        peg$currPos++;\n      } else {\n        s3 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c124);\n        }\n      }\n      if (s3 !== peg$FAILED) {\n        while (s3 !== peg$FAILED) {\n          s2.push(s3);\n          if (peg$c123.test(input.charAt(peg$currPos))) {\n            s3 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s3 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c124);\n            }\n          }\n        }\n      } else {\n        s2 = peg$c0;\n      }\n      if (s2 !== peg$FAILED) {\n        s2 = input.substring(s1, peg$currPos);\n      }\n      s1 = s2;\n      if (s1 !== peg$FAILED) {\n        s2 = peg$currPos;\n        s3 = [];\n        if (peg$c125.test(input.charAt(peg$currPos))) {\n          s4 = input.charAt(peg$currPos);\n          peg$currPos++;\n        } else {\n          s4 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c126);\n          }\n        }\n        while (s4 !== peg$FAILED) {\n          s3.push(s4);\n          if (peg$c125.test(input.charAt(peg$currPos))) {\n            s4 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c126);\n            }\n          }\n        }\n        if (s3 !== peg$FAILED) {\n          s3 = input.substring(s2, peg$currPos);\n        }\n        s2 = s3;\n        if (s2 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c128(s1, s2);\n          s0 = s1;\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parserange() {\n      var s0, s1, s2, s3;\n\n      s0 = peg$currPos;\n      if (input.substr(peg$currPos, 2) === peg$c129) {\n        s1 = peg$c129;\n        peg$currPos += 2;\n      } else {\n        s1 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c130);\n        }\n      }\n      if (s1 !== peg$FAILED) {\n        s2 = [];\n        if (peg$c71.test(input.charAt(peg$currPos))) {\n          s3 = input.charAt(peg$currPos);\n          peg$currPos++;\n        } else {\n          s3 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c72);\n          }\n        }\n        if (s3 !== peg$FAILED) {\n          while (s3 !== peg$FAILED) {\n            s2.push(s3);\n            if (peg$c71.test(input.charAt(peg$currPos))) {\n              s3 = input.charAt(peg$currPos);\n              peg$currPos++;\n            } else {\n              s3 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c72);\n              }\n            }\n          }\n        } else {\n          s2 = peg$c0;\n        }\n        if (s2 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c131(s2);\n          s0 = s1;\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n\n      return s0;\n    }\n\n    function peg$parsenumber() {\n      var s0, s1, s2, s3, s4;\n\n      s0 = peg$currPos;\n      s1 = [];\n      if (peg$c71.test(input.charAt(peg$currPos))) {\n        s2 = input.charAt(peg$currPos);\n        peg$currPos++;\n      } else {\n        s2 = peg$FAILED;\n        if (peg$silentFails === 0) {\n          peg$fail(peg$c72);\n        }\n      }\n      if (s2 !== peg$FAILED) {\n        while (s2 !== peg$FAILED) {\n          s1.push(s2);\n          if (peg$c71.test(input.charAt(peg$currPos))) {\n            s2 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s2 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c72);\n            }\n          }\n        }\n      } else {\n        s1 = peg$c0;\n      }\n      if (s1 !== peg$FAILED) {\n        if (input.charCodeAt(peg$currPos) === 46) {\n          s2 = peg$c132;\n          peg$currPos++;\n        } else {\n          s2 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c133);\n          }\n        }\n        if (s2 !== peg$FAILED) {\n          s3 = [];\n          if (peg$c71.test(input.charAt(peg$currPos))) {\n            s4 = input.charAt(peg$currPos);\n            peg$currPos++;\n          } else {\n            s4 = peg$FAILED;\n            if (peg$silentFails === 0) {\n              peg$fail(peg$c72);\n            }\n          }\n          if (s4 !== peg$FAILED) {\n            while (s4 !== peg$FAILED) {\n              s3.push(s4);\n              if (peg$c71.test(input.charAt(peg$currPos))) {\n                s4 = input.charAt(peg$currPos);\n                peg$currPos++;\n              } else {\n                s4 = peg$FAILED;\n                if (peg$silentFails === 0) {\n                  peg$fail(peg$c72);\n                }\n              }\n            }\n          } else {\n            s3 = peg$c0;\n          }\n          if (s3 !== peg$FAILED) {\n            peg$reportedPos = s0;\n            s1 = peg$c134(s1, s3);\n            s0 = s1;\n          } else {\n            peg$currPos = s0;\n            s0 = peg$c0;\n          }\n        } else {\n          peg$currPos = s0;\n          s0 = peg$c0;\n        }\n      } else {\n        peg$currPos = s0;\n        s0 = peg$c0;\n      }\n      if (s0 === peg$FAILED) {\n        s0 = peg$currPos;\n        s1 = [];\n        if (peg$c71.test(input.charAt(peg$currPos))) {\n          s2 = input.charAt(peg$currPos);\n          peg$currPos++;\n        } else {\n          s2 = peg$FAILED;\n          if (peg$silentFails === 0) {\n            peg$fail(peg$c72);\n          }\n        }\n        if (s2 !== peg$FAILED) {\n          while (s2 !== peg$FAILED) {\n            s1.push(s2);\n            if (peg$c71.test(input.charAt(peg$currPos))) {\n              s2 = input.charAt(peg$currPos);\n              peg$currPos++;\n            } else {\n              s2 = peg$FAILED;\n              if (peg$silentFails === 0) {\n                peg$fail(peg$c72);\n              }\n            }\n          }\n        } else {\n          s1 = peg$c0;\n        }\n        if (s1 !== peg$FAILED) {\n          peg$reportedPos = s0;\n          s1 = peg$c135(s1);\n        }\n        s0 = s1;\n      }\n\n      return s0;\n    }\n\n    function extend(dst) {\n      for (var i = 1; i < arguments.length; i++) {\n        for (var k in arguments[i]) {\n          dst[k] = arguments[i][k];\n        }\n      }\n      return dst;\n    }\n\n    peg$result = peg$startRuleFunction();\n\n    if (peg$result !== peg$FAILED && peg$currPos === input.length) {\n      return peg$result;\n    } else {\n      if (peg$result !== peg$FAILED && peg$currPos < input.length) {\n        peg$fail({ type: \"end\", description: \"end of input\" });\n      }\n\n      throw peg$buildException(null, peg$maxFailExpected, peg$maxFailPos);\n    }\n  }\n\n  return {\n    SyntaxError: SyntaxError,\n    parse: parse\n  };\n})();\n\nvar Orientation = {\n  HORIZONTAL: 1,\n  VERTICAL: 2,\n  ZINDEX: 4\n};\n\n/**\n * Helper function that inserts equal spacers (~).\n * @private\n */\nfunction _processEqualSpacer(context, stackView) {\n\n  // Determine unique name for the spacer\n  context.equalSpacerIndex = context.equalSpacerIndex || 1;\n  var name = '_~' + context.lineIndex + ':' + context.equalSpacerIndex + '~';\n  if (context.equalSpacerIndex > 1) {\n\n    // Ensure that all spacers have the same width/height\n    context.constraints.push({\n      view1: '_~' + context.lineIndex + ':1~',\n      attr1: context.horizontal ? Attribute.WIDTH : Attribute.HEIGHT,\n      relation: context.relation.relation || Relation.EQU,\n      view2: name,\n      attr2: context.horizontal ? Attribute.WIDTH : Attribute.HEIGHT,\n      priority: context.relation.priority\n    });\n  }\n  context.equalSpacerIndex++;\n\n  // Enforce view/proportional width/height\n  if (context.relation.view || context.relation.multiplier && context.relation.multiplier !== 1) {\n    context.constraints.push({\n      view1: name,\n      attr1: context.horizontal ? Attribute.WIDTH : Attribute.HEIGHT,\n      relation: context.relation.relation || Relation.EQU,\n      view2: context.relation.view,\n      attr2: context.horizontal ? Attribute.WIDTH : Attribute.HEIGHT,\n      priority: context.relation.priority,\n      multiplier: context.relation.multiplier\n    });\n    context.relation.multiplier = undefined;\n  } else if (context.relation.constant) {\n    context.constraints.push({\n      view1: name,\n      attr1: context.horizontal ? Attribute.WIDTH : Attribute.HEIGHT,\n      relation: Relation.EQU,\n      view2: null,\n      attr2: Attribute.CONST,\n      priority: context.relation.priority,\n      constant: context.relation.constant\n    });\n    context.relation.constant = undefined;\n  }\n\n  // Add constraint\n  for (var i = 0; i < context.prevViews.length; i++) {\n    var prevView = context.prevViews[i];\n    switch (context.orientation) {\n      case Orientation.HORIZONTAL:\n        context.prevAttr = prevView !== stackView ? Attribute.RIGHT : Attribute.LEFT;\n        context.curAttr = Attribute.LEFT;\n        break;\n      case Orientation.VERTICAL:\n        context.prevAttr = prevView !== stackView ? Attribute.BOTTOM : Attribute.TOP;\n        context.curAttr = Attribute.TOP;\n        break;\n      case Orientation.ZINDEX:\n        context.prevAttr = Attribute.ZINDEX;\n        context.curAttr = Attribute.ZINDEX;\n        context.relation.constant = prevView !== stackView ? 'default' : 0;\n        break;\n    }\n    context.constraints.push({\n      view1: prevView,\n      attr1: context.prevAttr,\n      relation: context.relation.relation,\n      view2: name,\n      attr2: context.curAttr,\n      priority: context.relation.priority\n    });\n  }\n  context.prevViews = [name];\n}\n\n/**\n * Helper function that inserts proportional spacers (-12%-).\n * @private\n */\nfunction _processProportionalSpacer(context, stackView) {\n  context.proportionalSpacerIndex = context.proportionalSpacerIndex || 1;\n  var name = '_-' + context.lineIndex + ':' + context.proportionalSpacerIndex + '-';\n  context.proportionalSpacerIndex++;\n  context.constraints.push({\n    view1: name,\n    attr1: context.horizontal ? Attribute.WIDTH : Attribute.HEIGHT,\n    relation: context.relation.relation || Relation.EQU,\n    view2: context.relation.view, // or relative to the stackView... food for thought\n    attr2: context.horizontal ? Attribute.WIDTH : Attribute.HEIGHT,\n    priority: context.relation.priority,\n    multiplier: context.relation.multiplier\n  });\n  context.relation.multiplier = undefined;\n\n  // Add constraint\n  for (var i = 0; i < context.prevViews.length; i++) {\n    var prevView = context.prevViews[i];\n    switch (context.orientation) {\n      case Orientation.HORIZONTAL:\n        context.prevAttr = prevView !== stackView ? Attribute.RIGHT : Attribute.LEFT;\n        context.curAttr = Attribute.LEFT;\n        break;\n      case Orientation.VERTICAL:\n        context.prevAttr = prevView !== stackView ? Attribute.BOTTOM : Attribute.TOP;\n        context.curAttr = Attribute.TOP;\n        break;\n      case Orientation.ZINDEX:\n        context.prevAttr = Attribute.ZINDEX;\n        context.curAttr = Attribute.ZINDEX;\n        context.relation.constant = prevView !== stackView ? 'default' : 0;\n        break;\n    }\n    context.constraints.push({\n      view1: prevView,\n      attr1: context.prevAttr,\n      relation: context.relation.relation,\n      view2: name,\n      attr2: context.curAttr,\n      priority: context.relation.priority\n    });\n  }\n  context.prevViews = [name];\n}\n\n/**\n * In case of a stack-view, set constraints for opposite orientations\n * @private\n */\nfunction _processStackView(context, name, subView) {\n  var viewName = undefined;\n  for (var orientation = 1; orientation <= 4; orientation *= 2) {\n    if (subView.orientations & orientation && subView.stack.orientation !== orientation && !(subView.stack.processedOrientations & orientation)) {\n      subView.stack.processedOrientations = subView.stack.processedOrientations | orientation;\n      viewName = viewName || {\n        name: name,\n        type: 'stack'\n      };\n      for (var i = 0, j = subView.stack.subViews.length; i < j; i++) {\n        if (orientation === Orientation.ZINDEX) {\n          context.constraints.push({\n            view1: viewName,\n            attr1: Attribute.ZINDEX,\n            relation: Relation.EQU,\n            view2: subView.stack.subViews[i],\n            attr2: Attribute.ZINDEX\n          });\n        } else {\n          context.constraints.push({\n            view1: viewName,\n            attr1: orientation === Orientation.VERTICAL ? Attribute.HEIGHT : Attribute.WIDTH,\n            relation: Relation.EQU,\n            view2: subView.stack.subViews[i],\n            attr2: orientation === Orientation.VERTICAL ? Attribute.HEIGHT : Attribute.WIDTH\n          });\n          context.constraints.push({\n            view1: viewName,\n            attr1: orientation === Orientation.VERTICAL ? Attribute.TOP : Attribute.LEFT,\n            relation: Relation.EQU,\n            view2: subView.stack.subViews[i],\n            attr2: orientation === Orientation.VERTICAL ? Attribute.TOP : Attribute.LEFT\n          });\n        }\n      }\n    }\n  }\n}\n\n/**\n * Recursive helper function converts a view-name and a range to a series\n * of view-names (e.g. [child1, child2, child3, ...]).\n * @private\n */\nfunction _getRange(name, range) {\n  if (range === true) {\n    range = name.match(/\\.\\.\\d+$/);\n    if (range) {\n      name = name.substring(0, name.length - range[0].length);\n      range = parseInt(range[0].substring(2));\n    }\n  }\n  if (!range) {\n    return [name];\n  }\n  var start = name.match(/\\d+$/);\n  var res = [];\n  var i;\n  if (start) {\n    name = name.substring(0, name.length - start[0].length);\n    for (i = parseInt(start); i <= range; i++) {\n      res.push(name + i);\n    }\n  } else {\n    res.push(name);\n    for (i = 2; i <= range; i++) {\n      res.push(name + i);\n    }\n  }\n  return res;\n}\n\n/**\n * Recursive helper function that processes the cascaded data.\n * @private\n */\nfunction _processCascade(context, cascade, parentItem) {\n  var stackView = parentItem ? parentItem.view : null;\n  var subViews = [];\n  var curViews = [];\n  var subView = undefined;\n  if (stackView) {\n    cascade.push({ view: stackView });\n    curViews.push(stackView);\n  }\n  for (var i = 0; i < cascade.length; i++) {\n    var item = cascade[i];\n    if (!Array.isArray(item) && item.hasOwnProperty('view') || Array.isArray(item) && item[0].view && !item[0].relation) {\n      var items = Array.isArray(item) ? item : [item];\n      for (var z = 0; z < items.length; z++) {\n        item = items[z];\n        var viewRange = item === ',' ? [] : item.view ? _getRange(item.view, item.range) : [null];\n        for (var r = 0; r < viewRange.length; r++) {\n          var curView = viewRange[r];\n          curViews.push(curView);\n\n          //\n          // Add this view to the collection of subViews\n          //\n          if (curView !== stackView) {\n            subViews.push(curView);\n            subView = context.subViews[curView];\n            if (!subView) {\n              subView = { orientations: 0 };\n              context.subViews[curView] = subView;\n            }\n            subView.orientations = subView.orientations | context.orientation;\n            if (subView.stack) {\n              _processStackView(context, curView, subView);\n            }\n          }\n\n          //\n          // Process the relationship between this and the previous views\n          //\n          if (context.prevViews !== undefined && curView !== undefined && context.relation) {\n            if (context.relation.relation !== 'none') {\n              for (var p = 0; p < context.prevViews.length; p++) {\n                var prevView = context.prevViews[p];\n                switch (context.orientation) {\n                  case Orientation.HORIZONTAL:\n                    context.prevAttr = prevView !== stackView ? Attribute.RIGHT : Attribute.LEFT;\n                    context.curAttr = curView !== stackView ? Attribute.LEFT : Attribute.RIGHT;\n                    break;\n                  case Orientation.VERTICAL:\n                    context.prevAttr = prevView !== stackView ? Attribute.BOTTOM : Attribute.TOP;\n                    context.curAttr = curView !== stackView ? Attribute.TOP : Attribute.BOTTOM;\n                    break;\n                  case Orientation.ZINDEX:\n                    context.prevAttr = Attribute.ZINDEX;\n                    context.curAttr = Attribute.ZINDEX;\n                    context.relation.constant = !prevView ? 0 : context.relation.constant || 'default';\n                    break;\n                }\n                context.constraints.push({\n                  view1: prevView,\n                  attr1: context.prevAttr,\n                  relation: context.relation.relation,\n                  view2: curView,\n                  attr2: context.curAttr,\n                  multiplier: context.relation.multiplier,\n                  constant: context.relation.constant === 'default' || !context.relation.constant ? context.relation.constant : -context.relation.constant,\n                  priority: context.relation.priority\n                });\n              }\n            }\n          }\n\n          //\n          // Process view size constraints\n          //\n          var constraints = item.constraints;\n          if (constraints) {\n            for (var n = 0; n < constraints.length; n++) {\n              context.prevAttr = context.horizontal ? Attribute.WIDTH : Attribute.HEIGHT;\n              context.curAttr = constraints[n].view || constraints[n].multiplier ? constraints[n].attribute || context.prevAttr : constraints[n].variable ? Attribute.VARIABLE : Attribute.CONST;\n              context.constraints.push({\n                view1: curView,\n                attr1: context.prevAttr,\n                relation: constraints[n].relation,\n                view2: constraints[n].view,\n                attr2: context.curAttr,\n                multiplier: constraints[n].multiplier,\n                constant: constraints[n].constant,\n                priority: constraints[n].priority\n              });\n            }\n          }\n\n          //\n          // Process cascaded data (child stack-views)\n          //\n          if (item.cascade) {\n            _processCascade(context, item.cascade, item);\n          }\n        }\n      }\n    } else if (item !== ',') {\n      context.prevViews = curViews;\n      curViews = [];\n      context.relation = item[0];\n      if (context.prevViews !== undefined) {\n        if (context.relation.equalSpacing) {\n          _processEqualSpacer(context, stackView);\n        }\n        if (context.relation.multiplier) {\n          _processProportionalSpacer(context, stackView);\n        }\n      }\n    }\n  }\n\n  if (stackView) {\n    subView = context.subViews[stackView];\n    if (!subView) {\n      subView = { orientations: context.orientation };\n      context.subViews[stackView] = subView;\n    } else if (subView.stack) {\n      var err = new Error('A stack named \"' + stackView + '\" has already been created');\n      err.column = parentItem.$parserOffset + 1;\n      throw err;\n    }\n    subView.stack = {\n      orientation: context.orientation,\n      processedOrientations: context.orientation,\n      subViews: subViews\n    };\n    _processStackView(context, stackView, subView);\n  }\n}\n\nvar metaInfoCategories = ['viewport', 'spacing', 'colors', 'shapes', 'widths', 'heights'];\n\n/**\n * VisualFormat\n *\n * @namespace VisualFormat\n */\n\nvar VisualFormat = (function () {\n  function VisualFormat() {\n    _classCallCheck(this, VisualFormat);\n  }\n\n  /**\n   * A SubView is automatically generated when constraints are added to a View.\n   *\n   * @namespace SubView\n   */\n\n  _createClass(VisualFormat, null, [{\n    key: 'parseLine',\n\n    /**\n     * Parses a single line of vfl into an array of constraint definitions.\n     *\n     * When the visual-format could not be succesfully parsed an exception is thrown containing\n     * additional info about the parse error and column position.\n     *\n     * @param {String} visualFormat Visual format string (cannot contain line-endings!).\n     * @param {Object} [options] Configuration options.\n     * @param {Boolean} [options.extended] When set to true uses the extended syntax (default: false).\n     * @param {String} [options.outFormat] Output format (`constraints` or `raw`) (default: `constraints`).\n     * @param {Number} [options.lineIndex] Line-index used when auto generating equal-spacing constraints.\n     * @return {Array} Array of constraint definitions.\n     */\n    value: function parseLine(visualFormat, options) {\n      if (visualFormat.length === 0 || options && options.extended && visualFormat.indexOf('//') === 0) {\n        return [];\n      }\n      var res = options && options.extended ? parserExt.parse(visualFormat) : parser.parse(visualFormat);\n      if (options && options.outFormat === 'raw') {\n        return [res];\n      }\n      var context = {\n        constraints: [],\n        lineIndex: (options ? options.lineIndex : undefined) || 1,\n        subViews: (options ? options.subViews : undefined) || {}\n      };\n      if (res.type === 'attribute') {\n        for (var n = 0; n < res.attributes.length; n++) {\n          var attr = res.attributes[n];\n          for (var m = 0; m < attr.predicates.length; m++) {\n            var predicate = attr.predicates[m];\n            context.constraints.push({\n              view1: res.view,\n              attr1: attr.attr,\n              relation: predicate.relation,\n              view2: predicate.view,\n              attr2: predicate.attribute || attr.attr,\n              multiplier: predicate.multiplier,\n              constant: predicate.constant,\n              priority: predicate.priority\n            });\n          }\n        }\n      } else {\n        switch (res.orientation) {\n          case 'horizontal':\n            context.orientation = Orientation.HORIZONTAL;\n            context.horizontal = true;\n            _processCascade(context, res.cascade, null);\n            break;\n          case 'vertical':\n            context.orientation = Orientation.VERTICAL;\n            _processCascade(context, res.cascade, null);\n            break;\n          case 'horzvert':\n            context.orientation = Orientation.HORIZONTAL;\n            context.horizontal = true;\n            _processCascade(context, res.cascade, null);\n            context = {\n              constraints: context.constraints,\n              lineIndex: context.lineIndex,\n              subViews: context.subViews,\n              orientation: Orientation.VERTICAL\n            };\n            _processCascade(context, res.cascade, null);\n            break;\n          case 'zIndex':\n            context.orientation = Orientation.ZINDEX;\n            _processCascade(context, res.cascade, null);\n            break;\n        }\n      }\n      return context.constraints;\n    }\n\n    /**\n     * Parses one or more visual format strings into an array of constraint definitions.\n     *\n     * When the visual-format could not be succesfully parsed an exception is thrown containing\n     * additional info about the parse error and column position.\n     *\n     * @param {String|Array} visualFormat One or more visual format strings.\n     * @param {Object} [options] Configuration options.\n     * @param {Boolean} [options.extended] When set to true uses the extended syntax (default: false).\n     * @param {Boolean} [options.strict] When set to false trims any leading/trailing spaces and ignores empty lines (default: true).\n     * @param {String} [options.lineSeperator] String that defines the end of a line (default `\\n`).\n     * @param {String} [options.outFormat] Output format (`constraints` or `raw`) (default: `constraints`).\n     * @return {Array} Array of constraint definitions.\n     */\n  }, {\n    key: 'parse',\n    value: function parse(visualFormat, options) {\n      var lineSeperator = options && options.lineSeperator ? options.lineSeperator : '\\n';\n      if (!Array.isArray(visualFormat) && visualFormat.indexOf(lineSeperator) < 0) {\n        try {\n          return this.parseLine(visualFormat, options);\n        } catch (err) {\n          err.source = visualFormat;\n          throw err;\n        }\n      }\n\n      // Decompose visual-format into an array of strings, and within those strings\n      // search for line-endings, and treat each line as a seperate visual-format.\n      visualFormat = Array.isArray(visualFormat) ? visualFormat : [visualFormat];\n      var lines = undefined;\n      var constraints = [];\n      var lineIndex = 0;\n      var line = undefined;\n      var parseOptions = {\n        lineIndex: lineIndex,\n        extended: options && options.extended,\n        strict: options && options.strict !== undefined ? options.strict : true,\n        outFormat: options ? options.outFormat : undefined,\n        subViews: {}\n      };\n      try {\n        for (var i = 0; i < visualFormat.length; i++) {\n          lines = visualFormat[i].split(lineSeperator);\n          for (var j = 0; j < lines.length; j++) {\n            line = lines[j];\n            lineIndex++;\n            parseOptions.lineIndex = lineIndex;\n            if (!parseOptions.strict) {\n              line = line.trim();\n            }\n            if (parseOptions.strict || line.length) {\n              constraints = constraints.concat(this.parseLine(line, parseOptions));\n            }\n          }\n        }\n      } catch (err) {\n        err.source = line;\n        err.line = lineIndex;\n        throw err;\n      }\n      return constraints;\n    }\n\n    /**\n     * Parses meta information from the comments in the VFL.\n     *\n     * Additional meta information can be specified in the comments\n     * for previewing and rendering purposes. For instance, the view-port\n     * aspect-ratio, sub-view widths and colors, can be specified. The\n     * following example renders three colored circles in the visual-format editor:\n     *\n     * ```vfl\n     * //viewport aspect-ratio:3/1 max-height:300\n     * //colors red:#FF0000 green:#00FF00 blue:#0000FF\n     * //shapes red:circle green:circle blue:circle\n     * H:|-[row:[red(green,blue)]-[green]-[blue]]-|\n     * V:|[row]|\n     * ```\n     *\n     * Supported categories and properties:\n     *\n     * |Category|Property|Example|\n     * |--------|--------|-------|\n     * |`viewport`|`aspect-ratio:{width}/{height}`|`//viewport aspect-ratio:16/9`|\n     * ||`width:[{number}/intrinsic]`|`//viewport width:10`|\n     * ||`height:[{number}/intrinsic]`|`//viewport height:intrinsic`|\n     * ||`min-width:{number}`|\n     * ||`max-width:{number}`|\n     * ||`min-height:{number}`|\n     * ||`max-height:{number}`|\n     * |`spacing`|`[{number}/array]`|`//spacing:8` or `//spacing:[10, 20, 5]`|\n     * |`widths`|`{view-name}:[{number}/intrinsic]`|`//widths subview1:100`|\n     * |`heights`|`{view-name}:[{number}/intrinsic]`|`//heights subview1:intrinsic`|\n     * |`colors`|`{view-name}:{color}`|`//colors redview:#FF0000 blueview:#00FF00`|\n     * |`shapes`|`{view-name}:[circle/square]`|`//shapes avatar:circle`|\n     *\n     * @param {String|Array} visualFormat One or more visual format strings.\n     * @param {Object} [options] Configuration options.\n     * @param {String} [options.lineSeperator] String that defines the end of a line (default `\\n`).\n     * @param {String} [options.prefix] When specified, also processes the categories using that prefix (e.g. \"-dev-viewport max-height:10\").\n     * @return {Object} meta-info\n     */\n  }, {\n    key: 'parseMetaInfo',\n    value: function parseMetaInfo(visualFormat, options) {\n      var lineSeperator = options && options.lineSeperator ? options.lineSeperator : '\\n';\n      var prefix = options ? options.prefix : undefined;\n      visualFormat = Array.isArray(visualFormat) ? visualFormat : [visualFormat];\n      var metaInfo = {};\n      var key;\n      for (var k = 0; k < visualFormat.length; k++) {\n        var lines = visualFormat[k].split(lineSeperator);\n        for (var i = 0; i < lines.length; i++) {\n          var line = lines[i];\n          for (var c = 0; c < metaInfoCategories.length; c++) {\n            for (var s = 0; s < (prefix ? 2 : 1); s++) {\n              var category = metaInfoCategories[c];\n              var prefixedCategory = (s === 0 ? '' : prefix) + category;\n              if (line.indexOf('//' + prefixedCategory + ' ') === 0) {\n                var items = line.substring(3 + prefixedCategory.length).split(' ');\n                for (var j = 0; j < items.length; j++) {\n                  metaInfo[category] = metaInfo[category] || {};\n                  var item = items[j].split(':');\n                  var names = _getRange(item[0], true);\n                  for (var r = 0; r < names.length; r++) {\n                    metaInfo[category][names[r]] = item.length > 1 ? item[1] : '';\n                  }\n                }\n              } else if (line.indexOf('//' + prefixedCategory + ':') === 0) {\n                metaInfo[category] = line.substring(3 + prefixedCategory.length);\n              }\n            }\n          }\n        }\n      }\n      if (metaInfo.viewport) {\n        var viewport = metaInfo.viewport;\n        var aspectRatio = viewport['aspect-ratio'];\n        if (aspectRatio) {\n          aspectRatio = aspectRatio.split('/');\n          viewport['aspect-ratio'] = parseInt(aspectRatio[0]) / parseInt(aspectRatio[1]);\n        }\n        if (viewport.height !== undefined) {\n          viewport.height = viewport.height === 'intrinsic' ? true : parseInt(viewport.height);\n        }\n        if (viewport.width !== undefined) {\n          viewport.width = viewport.width === 'intrinsic' ? true : parseInt(viewport.width);\n        }\n        if (viewport['max-height'] !== undefined) {\n          viewport['max-height'] = parseInt(viewport['max-height']);\n        }\n        if (viewport['max-width'] !== undefined) {\n          viewport['max-width'] = parseInt(viewport['max-width']);\n        }\n        if (viewport['min-height'] !== undefined) {\n          viewport['min-height'] = parseInt(viewport['min-height']);\n        }\n        if (viewport['min-width'] !== undefined) {\n          viewport['min-width'] = parseInt(viewport['min-width']);\n        }\n      }\n      if (metaInfo.widths) {\n        for (key in metaInfo.widths) {\n          var width = metaInfo.widths[key] === 'intrinsic' ? true : parseInt(metaInfo.widths[key]);\n          metaInfo.widths[key] = width;\n          if (width === undefined || isNaN(width)) {\n            delete metaInfo.widths[key];\n          }\n        }\n      }\n      if (metaInfo.heights) {\n        for (key in metaInfo.heights) {\n          var height = metaInfo.heights[key] === 'intrinsic' ? true : parseInt(metaInfo.heights[key]);\n          metaInfo.heights[key] = height;\n          if (height === undefined || isNaN(height)) {\n            delete metaInfo.heights[key];\n          }\n        }\n      }\n      if (metaInfo.spacing) {\n        var value = JSON.parse(metaInfo.spacing);\n        metaInfo.spacing = value;\n        if (Array.isArray(value)) {\n          for (var sIdx = 0, len = value.length; sIdx < len; sIdx++) {\n            if (isNaN(value[sIdx])) {\n              delete metaInfo.spacing;\n              break;\n            }\n          }\n        } else if (value === undefined || isNaN(value)) {\n          delete metaInfo.spacing;\n        }\n      }\n      return metaInfo;\n    }\n  }]);\n\n  return VisualFormat;\n})();\n\nvar SubView = (function () {\n  function SubView(options) {\n    _classCallCheck(this, SubView);\n\n    this._name = options.name;\n    this._type = options.type;\n    this._solver = options.solver;\n    this._attr = {};\n    if (!options.name) {\n      if (false) {\n        this._attr[Attribute.LEFT] = new c.Variable();\n        this._solver.addConstraint(new c.StayConstraint(this._attr[Attribute.LEFT], c.Strength.required));\n        this._attr[Attribute.TOP] = new c.Variable();\n        this._solver.addConstraint(new c.StayConstraint(this._attr[Attribute.TOP], c.Strength.required));\n        this._attr[Attribute.ZINDEX] = new c.Variable();\n        this._solver.addConstraint(new c.StayConstraint(this._attr[Attribute.ZINDEX], c.Strength.required));\n      } else {\n        this._attr[Attribute.LEFT] = new kiwi.Variable();\n        this._solver.addConstraint(new kiwi.Constraint(this._attr[Attribute.LEFT], kiwi.Operator.Eq, 0));\n        this._attr[Attribute.TOP] = new kiwi.Variable();\n        this._solver.addConstraint(new kiwi.Constraint(this._attr[Attribute.TOP], kiwi.Operator.Eq, 0));\n        this._attr[Attribute.ZINDEX] = new kiwi.Variable();\n        this._solver.addConstraint(new kiwi.Constraint(this._attr[Attribute.ZINDEX], kiwi.Operator.Eq, 0));\n      }\n    }\n  }\n\n  _createClass(SubView, [{\n    key: 'toJSON',\n    value: function toJSON() {\n      return {\n        name: this.name,\n        left: this.left,\n        top: this.top,\n        width: this.width,\n        height: this.height\n      };\n    }\n  }, {\n    key: 'toString',\n    value: function toString() {\n      JSON.stringify(this.toJSON(), undefined, 2);\n    }\n\n    /**\n     * Name of the sub-view.\n     * @readonly\n     * @type {String}\n     */\n  }, {\n    key: 'getValue',\n\n    /**\n     * Gets the value of one of the attributes.\n     *\n     * @param {String|Attribute} attr Attribute name (e.g. 'right', 'centerY', Attribute.TOP).\n     * @return {Number} value or `undefined`\n     */\n    value: function getValue(attr) {\n      return this._attr[attr] ? this._attr[attr].value() : undefined;\n    }\n\n    /**\n     * @private\n     */\n  }, {\n    key: '_getAttr',\n    value: function _getAttr(attr) {\n      if (this._attr[attr]) {\n        return this._attr[attr];\n      }\n      this._attr[attr] = false ? new c.Variable() : new kiwi.Variable();\n      switch (attr) {\n        case Attribute.RIGHT:\n          this._getAttr(Attribute.LEFT);\n          this._getAttr(Attribute.WIDTH);\n          if (false) {\n            this._solver.addConstraint(new c.Equation(this._attr[attr], c.plus(this._attr[Attribute.LEFT], this._attr[Attribute.WIDTH])));\n          } else {\n            this._solver.addConstraint(new kiwi.Constraint(this._attr[attr], kiwi.Operator.Eq, this._attr[Attribute.LEFT].plus(this._attr[Attribute.WIDTH])));\n          }\n          break;\n        case Attribute.BOTTOM:\n          this._getAttr(Attribute.TOP);\n          this._getAttr(Attribute.HEIGHT);\n          if (false) {\n            this._solver.addConstraint(new c.Equation(this._attr[attr], c.plus(this._attr[Attribute.TOP], this._attr[Attribute.HEIGHT])));\n          } else {\n            this._solver.addConstraint(new kiwi.Constraint(this._attr[attr], kiwi.Operator.Eq, this._attr[Attribute.TOP].plus(this._attr[Attribute.HEIGHT])));\n          }\n          break;\n        case Attribute.CENTERX:\n          this._getAttr(Attribute.LEFT);\n          this._getAttr(Attribute.WIDTH);\n          if (false) {\n            this._solver.addConstraint(new c.Equation(this._attr[attr], c.plus(this._attr[Attribute.LEFT], c.divide(this._attr[Attribute.WIDTH], 2))));\n          } else {\n            this._solver.addConstraint(new kiwi.Constraint(this._attr[attr], kiwi.Operator.Eq, this._attr[Attribute.LEFT].plus(this._attr[Attribute.WIDTH].divide(2))));\n          }\n          break;\n        case Attribute.CENTERY:\n          this._getAttr(Attribute.TOP);\n          this._getAttr(Attribute.HEIGHT);\n          if (false) {\n            this._solver.addConstraint(new c.Equation(this._attr[attr], c.plus(this._attr[Attribute.TOP], c.divide(this._attr[Attribute.HEIGHT], 2))));\n          } else {\n            this._solver.addConstraint(new kiwi.Constraint(this._attr[attr], kiwi.Operator.Eq, this._attr[Attribute.TOP].plus(this._attr[Attribute.HEIGHT].divide(2))));\n          }\n          break;\n      }\n      if (!false) {\n        this._solver.updateVariables();\n      }\n      return this._attr[attr];\n    }\n\n    /**\n     * @private\n     */\n  }, {\n    key: '_getAttrValue',\n    value: function _getAttrValue(attr) {\n      if (false) {\n        return this._getAttr(attr).value;\n      } else {\n        return this._getAttr(attr).value();\n      }\n    }\n  }, {\n    key: 'name',\n    get: function get() {\n      return this._name;\n    }\n\n    /**\n     * Left value (`Attribute.LEFT`).\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'left',\n    get: function get() {\n      return this._getAttrValue(Attribute.LEFT);\n    }\n\n    /**\n     * Right value (`Attribute.RIGHT`).\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'right',\n    get: function get() {\n      return this._getAttrValue(Attribute.RIGHT);\n    }\n\n    /**\n     * Width value (`Attribute.WIDTH`).\n     * @type {Number}\n     */\n  }, {\n    key: 'width',\n    get: function get() {\n      return this._getAttrValue(Attribute.WIDTH);\n    }\n\n    /**\n     * Height value (`Attribute.HEIGHT`).\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'height',\n    get: function get() {\n      return this._getAttrValue(Attribute.HEIGHT);\n    }\n\n    /**\n     * Intrinsic width of the sub-view.\n     *\n     * Use this property to explicitely set the width of the sub-view, e.g.:\n     * ```javascript\n     * var view = new AutoLayout.View(AutoLayout.VisualFormat.parse('|[child1][child2]|'), {\n     *   width: 500\n     * });\n     * view.subViews.child1.intrinsicWidth = 100;\n     * console.log('child2 width: ' + view.subViews.child2.width); // 400\n     * ```\n     *\n     * @type {Number}\n     */\n  }, {\n    key: 'intrinsicWidth',\n    get: function get() {\n      return this._intrinsicWidth;\n    },\n    set: function set(value) {\n      if (value !== undefined && value !== this._intrinsicWidth) {\n        var attr = this._getAttr(Attribute.WIDTH);\n        if (this._intrinsicWidth === undefined) {\n          if (false) {\n            this._solver.addEditVar(attr, new c.Strength('required', this._name ? 998 : 999, 1000, 1000));\n          } else {\n            this._solver.addEditVariable(attr, kiwi.Strength.create(this._name ? 998 : 999, 1000, 1000));\n          }\n        }\n        this._intrinsicWidth = value;\n        this._solver.suggestValue(attr, value);\n        if (false) {\n          this._solver.resolve();\n        } else {\n          this._solver.updateVariables();\n        }\n      }\n    }\n\n    /**\n     * Intrinsic height of the sub-view.\n     *\n     * See `intrinsicWidth`.\n     *\n     * @type {Number}\n     */\n  }, {\n    key: 'intrinsicHeight',\n    get: function get() {\n      return this._intrinsicHeight;\n    },\n    set: function set(value) {\n      if (value !== undefined && value !== this._intrinsicHeight) {\n        var attr = this._getAttr(Attribute.HEIGHT);\n        if (this._intrinsicHeight === undefined) {\n          if (false) {\n            this._solver.addEditVar(attr, new c.Strength('required', this._name ? 998 : 999, 1000, 1000));\n          } else {\n            this._solver.addEditVariable(attr, kiwi.Strength.create(this._name ? 998 : 999, 1000, 1000));\n          }\n        }\n        this._intrinsicHeight = value;\n        this._solver.suggestValue(attr, value);\n        if (false) {\n          this._solver.resolve();\n        } else {\n          this._solver.updateVariables();\n        }\n      }\n    }\n\n    /**\n     * Top value (`Attribute.TOP`).\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'top',\n    get: function get() {\n      return this._getAttrValue(Attribute.TOP);\n    }\n\n    /**\n     * Bottom value (`Attribute.BOTTOM`).\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'bottom',\n    get: function get() {\n      return this._getAttrValue(Attribute.BOTTOM);\n    }\n\n    /**\n     * Horizontal center (`Attribute.CENTERX`).\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'centerX',\n    get: function get() {\n      return this._getAttrValue(Attribute.CENTERX);\n    }\n\n    /**\n     * Vertical center (`Attribute.CENTERY`).\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'centerY',\n    get: function get() {\n      return this._getAttrValue(Attribute.CENTERY);\n    }\n\n    /**\n     * Z-index (`Attribute.ZINDEX`).\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'zIndex',\n    get: function get() {\n      return this._getAttrValue(Attribute.ZINDEX);\n    }\n\n    /**\n     * Returns the type of the sub-view.\n     * @readonly\n     * @type {String}\n     */\n  }, {\n    key: 'type',\n    get: function get() {\n      return this._type;\n    }\n  }]);\n\n  return SubView;\n})();\n\nvar defaultPriorityStrength = false ? new c.Strength('defaultPriority', 0, 1000, 1000) : kiwi.Strength.create(0, 1000, 1000);\n\nfunction _getConst(name, value) {\n  if (false) {\n    var vr = new c.Variable({ value: value });\n    this._solver.addConstraint(new c.StayConstraint(vr, c.Strength.required, 0));\n    return vr;\n  } else {\n    var vr = new kiwi.Variable();\n    this._solver.addConstraint(new kiwi.Constraint(vr, kiwi.Operator.Eq, value));\n    return vr;\n  }\n}\n\nfunction _getSubView(viewName) {\n  if (!viewName) {\n    return this._parentSubView;\n  } else if (viewName.name) {\n    this._subViews[viewName.name] = this._subViews[viewName.name] || new SubView({\n      name: viewName.name,\n      solver: this._solver\n    });\n    this._subViews[viewName.name]._type = this._subViews[viewName.name]._type || viewName.type;\n    return this._subViews[viewName.name];\n  } else {\n    this._subViews[viewName] = this._subViews[viewName] || new SubView({\n      name: viewName,\n      solver: this._solver\n    });\n    return this._subViews[viewName];\n  }\n}\n\nfunction _getSpacing(constraint) {\n  var index = 4;\n  if (!constraint.view1 && constraint.attr1 === 'left') {\n    index = 3;\n  } else if (!constraint.view1 && constraint.attr1 === 'top') {\n    index = 0;\n  } else if (!constraint.view2 && constraint.attr2 === 'right') {\n    index = 1;\n  } else if (!constraint.view2 && constraint.attr2 === 'bottom') {\n    index = 2;\n  } else {\n    switch (constraint.attr1) {\n      case 'left':\n      case 'right':\n      case 'centerX':\n      case 'leading':\n      case 'trailing':\n        index = 4;\n        break;\n      case 'zIndex':\n        index = 6;\n        break;\n      default:\n        index = 5;\n    }\n  }\n  this._spacingVars = this._spacingVars || new Array(7);\n  this._spacingExpr = this._spacingExpr || new Array(7);\n  if (!this._spacingVars[index]) {\n    if (false) {\n      this._spacingVars[index] = new c.Variable();\n      this._solver.addEditVar(this._spacingVars[index]);\n      this._spacingExpr[index] = c.minus(0, this._spacingVars[index]);\n    } else {\n      this._spacingVars[index] = new kiwi.Variable();\n      this._solver.addEditVariable(this._spacingVars[index], kiwi.Strength.create(999, 1000, 1000));\n      this._spacingExpr[index] = this._spacingVars[index].multiply(-1);\n    }\n    this._solver.suggestValue(this._spacingVars[index], this._spacing[index]);\n  }\n  return this._spacingExpr[index];\n}\n\nfunction _addConstraint(constraint) {\n  //this.constraints.push(constraint);\n  var relation = undefined;\n  var multiplier = constraint.multiplier !== undefined ? constraint.multiplier : 1;\n  var constant = constraint.constant !== undefined ? constraint.constant : 0;\n  if (constant === 'default') {\n    constant = _getSpacing.call(this, constraint);\n  }\n  var attr1 = _getSubView.call(this, constraint.view1)._getAttr(constraint.attr1);\n  var attr2 = undefined;\n  if (false) {\n    if (constraint.attr2 === Attribute.CONST) {\n      attr2 = _getConst.call(this, undefined, constraint.constant);\n    } else {\n      attr2 = _getSubView.call(this, constraint.view2)._getAttr(constraint.attr2);\n      if (multiplier !== 1 && constant) {\n        attr2 = c.plus(c.times(attr2, multiplier), constant);\n      } else if (constant) {\n        attr2 = c.plus(attr2, constant);\n      } else if (multiplier !== 1) {\n        attr2 = c.times(attr2, multiplier);\n      }\n    }\n    var strength = constraint.priority !== undefined && constraint.priority < 1000 ? new c.Strength('priority', 0, constraint.priority, 1000) : defaultPriorityStrength;\n    switch (constraint.relation) {\n      case Relation.EQU:\n        relation = new c.Equation(attr1, attr2, strength);\n        break;\n      case Relation.GEQ:\n        relation = new c.Inequality(attr1, c.GEQ, attr2, strength);\n        break;\n      case Relation.LEQ:\n        relation = new c.Inequality(attr1, c.LEQ, attr2, strength);\n        break;\n      default:\n        throw 'Invalid relation specified: ' + constraint.relation;\n    }\n  } else {\n    if (constraint.attr2 === Attribute.CONST) {\n      attr2 = _getConst.call(this, undefined, constraint.constant);\n    } else {\n      attr2 = _getSubView.call(this, constraint.view2)._getAttr(constraint.attr2);\n      if (multiplier !== 1 && constant) {\n        attr2 = attr2.multiply(multiplier).plus(constant);\n      } else if (constant) {\n        attr2 = attr2.plus(constant);\n      } else if (multiplier !== 1) {\n        attr2 = attr2.multiply(multiplier);\n      }\n    }\n    var strength = constraint.priority !== undefined && constraint.priority < 1000 ? kiwi.Strength.create(0, constraint.priority, 1000) : defaultPriorityStrength;\n    switch (constraint.relation) {\n      case Relation.EQU:\n        relation = new kiwi.Constraint(attr1, kiwi.Operator.Eq, attr2, strength);\n        break;\n      case Relation.GEQ:\n        relation = new kiwi.Constraint(attr1, kiwi.Operator.Ge, attr2, strength);\n        break;\n      case Relation.LEQ:\n        relation = new kiwi.Constraint(attr1, kiwi.Operator.Le, attr2, strength);\n        break;\n      default:\n        throw 'Invalid relation specified: ' + constraint.relation;\n    }\n  }\n  this._solver.addConstraint(relation);\n}\n\nfunction _compareSpacing(old, newz) {\n  if (old === newz) {\n    return true;\n  }\n  if (!old || !newz) {\n    return false;\n  }\n  for (var i = 0; i < 7; i++) {\n    if (old[i] !== newz[i]) {\n      return false;\n    }\n  }\n  return true;\n}\n\n/**\n * AutoLayoutJS API reference.\n *\n * ### Index\n *\n * |Entity|Type|Description|\n * |---|---|---|\n * |[AutoLayout](#autolayout)|`namespace`|Top level AutoLayout object.|\n * |[VisualFormat](#autolayoutvisualformat--object)|`namespace`|Parses VFL into constraints.|\n * |[View](#autolayoutview)|`class`|Main entity for adding & evaluating constraints.|\n * |[SubView](#autolayoutsubview--object)|`class`|SubView's are automatically created when constraints are added to views. They give access to the evaluated results.|\n * |[Attribute](#autolayoutattribute--enum)|`enum`|Attribute types that are supported when adding constraints.|\n * |[Relation](#autolayoutrelation--enum)|`enum`|Relationship types that are supported when adding constraints.|\n * |[Priority](#autolayoutpriority--enum)|`enum`|Default priority values for when adding constraints.|\n *\n * ### AutoLayout\n *\n * @module AutoLayout\n */\n\nvar View = (function () {\n\n  /**\n   * @class View\n   * @param {Object} [options] Configuration options.\n   * @param {Number} [options.width] Initial width of the view.\n   * @param {Number} [options.height] Initial height of the view.\n   * @param {Number|Object} [options.spacing] Spacing for the view (default: 8) (see `setSpacing`).\n   * @param {Array} [options.constraints] One or more constraint definitions (see `addConstraints`).\n   */\n\n  function View(options) {\n    _classCallCheck(this, View);\n\n    this._solver = false ? new c.SimplexSolver() : new kiwi.Solver();\n    this._subViews = {};\n    //this._spacing = undefined;\n    this._parentSubView = new SubView({\n      solver: this._solver\n    });\n    this.setSpacing(options && options.spacing !== undefined ? options.spacing : 8);\n    //this.constraints = [];\n    if (options) {\n      if (options.width !== undefined || options.height !== undefined) {\n        this.setSize(options.width, options.height);\n      }\n      if (options.constraints) {\n        this.addConstraints(options.constraints);\n      }\n    }\n  }\n\n  //import DOM from './DOM';\n\n  /**\n   * AutoLayout.\n   *\n   * @namespace AutoLayout\n   * @property {Attribute} Attribute\n   * @property {Relation} Relation\n   * @property {Priority} Priority\n   * @property {VisualFormat} VisualFormat\n   * @property {View} View\n   * @property {SubView} SubView\n   */\n\n  /**\n   * Sets the width and height of the view.\n   *\n   * @param {Number} width Width of the view.\n   * @param {Number} height Height of the view.\n   * @return {View} this\n   */\n\n  _createClass(View, [{\n    key: 'setSize',\n    value: function setSize(width, height /*, depth*/) {\n      this._parentSubView.intrinsicWidth = width;\n      this._parentSubView.intrinsicHeight = height;\n      return this;\n    }\n\n    /**\n     * Width that was set using `setSize`.\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'setSpacing',\n\n    /**\n     * Sets the spacing for the view.\n     *\n     * The spacing can be set for 7 different variables:\n     * `top`, `right`, `bottom`, `left`, `width`, `height` and `zIndex`. The `left`-spacing is\n     * used when a spacer is used between the parent-view and a sub-view (e.g. `|-[subView]`).\n     * The same is true for the `right`, `top` and `bottom` spacers. The `width` and `height` are\n     * used for spacers in between sub-views (e.g. `[view1]-[view2]`).\n     *\n     * Instead of using the full spacing syntax, it is also possible to use shorthand notations:\n     *\n     * |Syntax|Type|Description|\n     * |---|---|---|\n     * |`[top, right, bottom, left, width, height, zIndex]`|Array(7)|Full syntax including z-index **(clockwise order)**.|\n     * |`[top, right, bottom, left, width, height]`|Array(6)|Full horizontal & vertical spacing syntax (no z-index) **(clockwise order)**.|\n     * |`[horizontal, vertical, zIndex]`|Array(3)|Horizontal = left, right, width, vertical = top, bottom, height.|\n     * |`[horizontal, vertical]`|Array(2)|Horizontal = left, right, width, vertical = top, bottom, height, z-index = 1.|\n     * |`spacing`|Number|Horizontal & vertical spacing are all the same, z-index = 1.|\n     *\n     * Examples:\n     * ```javascript\n     * view.setSpacing(10); // horizontal & vertical spacing 10\n     * view.setSpacing([10, 15, 2]); // horizontal spacing 10, vertical spacing 15, z-axis spacing 2\n     * view.setSpacing([10, 20, 10, 20, 5, 5]); // top, right, bottom, left, horizontal, vertical\n     * view.setSpacing([10, 20, 10, 20, 5, 5, 1]); // top, right, bottom, left, horizontal, vertical, z\n     * ```\n     *\n     * @param {Number|Array} spacing\n     * @return {View} this\n     */\n    value: function setSpacing(spacing) {\n      // convert spacing into array: [top, right, bottom, left, horz, vert, z-index]\n      switch (Array.isArray(spacing) ? spacing.length : -1) {\n        case -1:\n          spacing = [spacing, spacing, spacing, spacing, spacing, spacing, 1];break;\n        case 1:\n          spacing = [spacing[0], spacing[0], spacing[0], spacing[0], spacing[0], spacing[0], 1];break;\n        case 2:\n          spacing = [spacing[1], spacing[0], spacing[1], spacing[0], spacing[0], spacing[1], 1];break;\n        case 3:\n          spacing = [spacing[1], spacing[0], spacing[1], spacing[0], spacing[0], spacing[1], spacing[2]];break;\n        case 6:\n          spacing = [spacing[0], spacing[1], spacing[2], spacing[3], spacing[4], spacing[5], 1];break;\n        case 7:\n          break;\n        default:\n          throw 'Invalid spacing syntax';\n      }\n      if (!_compareSpacing(this._spacing, spacing)) {\n        this._spacing = spacing;\n        // update spacing variables\n        if (this._spacingVars) {\n          for (var i = 0; i < this._spacingVars.length; i++) {\n            if (this._spacingVars[i]) {\n              this._solver.suggestValue(this._spacingVars[i], this._spacing[i]);\n            }\n          }\n          if (false) {\n            this._solver.resolve();\n          } else {\n            this._solver.updateVariables();\n          }\n        }\n      }\n      return this;\n    }\n\n    /**\n     * Adds a constraint definition.\n     *\n     * A constraint definition has the following format:\n     *\n     * ```javascript\n     * constraint: {\n     *   view1: {String},\n     *   attr1: {AutoLayout.Attribute},\n     *   relation: {AutoLayout.Relation},\n     *   view2: {String},\n     *   attr2: {AutoLayout.Attribute},\n     *   multiplier: {Number},\n     *   constant: {Number},\n     *   priority: {Number}(0..1000)\n     * }\n     * ```\n     * @param {Object} constraint Constraint definition.\n     * @return {View} this\n     */\n  }, {\n    key: 'addConstraint',\n    value: function addConstraint(constraint) {\n      _addConstraint.call(this, constraint);\n      if (!false) {\n        this._solver.updateVariables();\n      }\n      return this;\n    }\n\n    /**\n     * Adds one or more constraint definitions.\n     *\n     * A constraint definition has the following format:\n     *\n     * ```javascript\n     * constraint: {\n     *   view1: {String},\n     *   attr1: {AutoLayout.Attribute},\n     *   relation: {AutoLayout.Relation},\n     *   view2: {String},\n     *   attr2: {AutoLayout.Attribute},\n     *   multiplier: {Number},\n     *   constant: {Number},\n     *   priority: {Number}(0..1000)\n     * }\n     * ```\n     * @param {Array} constraints One or more constraint definitions.\n     * @return {View} this\n     */\n  }, {\n    key: 'addConstraints',\n    value: function addConstraints(constraints) {\n      for (var j = 0; j < constraints.length; j++) {\n        _addConstraint.call(this, constraints[j]);\n      }\n      if (!false) {\n        this._solver.updateVariables();\n      }\n      return this;\n    }\n\n    /**\n     * Dictionary of `SubView` objects that have been created when adding constraints.\n     * @readonly\n     * @type {Object.SubView}\n     */\n  }, {\n    key: 'width',\n    get: function get() {\n      return this._parentSubView.intrinsicWidth;\n    }\n\n    /**\n     * Height that was set using `setSize`.\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'height',\n    get: function get() {\n      return this._parentSubView.intrinsicHeight;\n    }\n\n    /**\n     * Width that is calculated from the constraints and the `.intrinsicWidth` of\n     * the sub-views.\n     *\n     * When the width has been explicitely set using `setSize`, the fittingWidth\n     * will **always** be the same as the explicitely set width. To calculate the size\n     * based on the content, use:\n     * ```javascript\n     * var view = new AutoLayout.View({\n     *   constraints: VisualFormat.parse('|-[view1]-[view2]-'),\n     *   spacing: 20\n     * });\n     * view.subViews.view1.intrinsicWidth = 100;\n     * view.subViews.view2.intrinsicWidth = 100;\n     * console.log('fittingWidth: ' + view.fittingWidth); // 260\n     * ```\n     *\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'fittingWidth',\n    get: function get() {\n      return this._parentSubView.width;\n    }\n\n    /**\n     * Height that is calculated from the constraints and the `.intrinsicHeight` of\n     * the sub-views.\n     *\n     * See `.fittingWidth`.\n     *\n     * @readonly\n     * @type {Number}\n     */\n  }, {\n    key: 'fittingHeight',\n    get: function get() {\n      return this._parentSubView.height;\n    }\n  }, {\n    key: 'subViews',\n    get: function get() {\n      return this._subViews;\n    }\n\n    /**\n     * Checks whether the constraints incompletely specify the location\n     * of the subViews.\n     * @private\n     */\n    //get hasAmbiguousLayout() {\n    // Todo\n    //}\n  }]);\n\n  return View;\n})();\n\nvar AutoLayout = {\n  Attribute: Attribute,\n  Relation: Relation,\n  Priority: Priority,\n  VisualFormat: VisualFormat,\n  View: View,\n  SubView: SubView\n  //DOM: DOM\n};\n\nmodule.exports = AutoLayout;\n\n},{\"kiwi/ts/bin/kiwi\":2}],2:[function(require,module,exports){\n(function (root, factory) {\n  if (typeof define === 'function' && define.amd) {\n    // AMD. Register as an anonymous module unless amdModuleId is set\n    define([], function () {\n      return (root['kiwi'] = factory());\n    });\n  } else if (typeof exports === 'object') {\n    // Node. Does not work with strict CommonJS, but\n    // only CommonJS-like environments that support module.exports,\n    // like Node.\n    module.exports = factory();\n  } else {\n    root['kiwi'] = factory();\n  }\n}(this, function () {\n\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\nvar tsu;\n(function (tsu) {\n\n    /**\n    * An iterator for an array of items.\n    */\n    var ArrayIterator = (function () {\n        /*\n        * Construct a new ArrayIterator.\n        *\n        * @param array The array of items to iterate.\n        * @param [index] The index at which to start iteration.\n        */\n        function ArrayIterator(array, index) {\n            if (typeof index === \"undefined\") { index = 0; }\n            this._array = array;\n            this._index = Math.max(0, Math.min(index, array.length));\n        }\n        /**\n        * Returns the next item from the iterator or undefined.\n        */\n        ArrayIterator.prototype.__next__ = function () {\n            return this._array[this._index++];\n        };\n\n        /**\n        * Returns this same iterator.\n        */\n        ArrayIterator.prototype.__iter__ = function () {\n            return this;\n        };\n        return ArrayIterator;\n    })();\n    tsu.ArrayIterator = ArrayIterator;\n\n    /**\n    * A reverse iterator for an array of items.\n    */\n    var ReverseArrayIterator = (function () {\n        /**\n        * Construct a new ReverseArrayIterator.\n        *\n        * @param array The array of items to iterate.\n        * @param [index] The index at which to start iteration.\n        */\n        function ReverseArrayIterator(array, index) {\n            if (typeof index === \"undefined\") { index = array.length; }\n            this._array = array;\n            this._index = Math.max(0, Math.min(index, array.length));\n        }\n        /**\n        * Returns the next item from the iterator or undefined.\n        */\n        ReverseArrayIterator.prototype.__next__ = function () {\n            return this._array[--this._index];\n        };\n\n        /**\n        * Returns this same iterator.\n        */\n        ReverseArrayIterator.prototype.__iter__ = function () {\n            return this;\n        };\n        return ReverseArrayIterator;\n    })();\n    tsu.ReverseArrayIterator = ReverseArrayIterator;\n\n    \n\n    function iter(object) {\n        if (object instanceof Array) {\n            return new ArrayIterator(object);\n        }\n        return object.__iter__();\n    }\n    tsu.iter = iter;\n\n    \n\n    function reversed(object) {\n        if (object instanceof Array) {\n            return new ReverseArrayIterator(object);\n        }\n        return object.__reversed__();\n    }\n    tsu.reversed = reversed;\n\n    /**\n    * Returns the next value from an iterator, or undefined.\n    */\n    function next(iterator) {\n        return iterator.__next__();\n    }\n    tsu.next = next;\n\n\n    function forEach(object, callback) {\n        if (object instanceof Array) {\n            for (var i = 0, n = object.length; i < n; ++i) {\n                if (callback(object[i]) === false) {\n                    return;\n                }\n            }\n        } else {\n            var value;\n            var it = object.__iter__();\n            while ((value = it.__next__()) !== undefined) {\n                if (callback(value) === false) {\n                    return;\n                }\n            }\n        }\n    }\n    tsu.forEach = forEach;\n\n})(tsu || (tsu = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\nvar tsu;\n(function (tsu) {\n    \n\n    /**\n    * A class which defines a generic pair object.\n    */\n    var Pair = (function () {\n        /**\n        * Construct a new Pair object.\n        *\n        * @param first The first item of the pair.\n        * @param second The second item of the pair.\n        */\n        function Pair(first, second) {\n            this.first = first;\n            this.second = second;\n        }\n        /**\n        * Create a copy of the pair.\n        */\n        Pair.prototype.copy = function () {\n            return new Pair(this.first, this.second);\n        };\n        return Pair;\n    })();\n    tsu.Pair = Pair;\n})(tsu || (tsu = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n/// <reference path=\"iterator.ts\"/>\n/// <reference path=\"utility.ts\"/>\nvar tsu;\n(function (tsu) {\n    /**\n    * Perform a lower bound search on a sorted array.\n    *\n    * @param array The array of sorted items to search.\n    * @param value The value to located in the array.\n    * @param compare The value comparison function.\n    * @returns The index of the first element in the array which\n    *          compares greater than or equal to the given value.\n    */\n    function lowerBound(array, value, compare) {\n        var begin = 0;\n        var n = array.length;\n        var half;\n        var middle;\n        while (n > 0) {\n            half = n >> 1;\n            middle = begin + half;\n            if (compare(array[middle], value) < 0) {\n                begin = middle + 1;\n                n -= half + 1;\n            } else {\n                n = half;\n            }\n        }\n        return begin;\n    }\n    tsu.lowerBound = lowerBound;\n\n    /**\n    * Perform a binary search on a sorted array.\n    *\n    * @param array The array of sorted items to search.\n    * @param value The value to located in the array.\n    * @param compare The value comparison function.\n    * @returns The index of the found item, or -1.\n    */\n    function binarySearch(array, value, compare) {\n        var index = lowerBound(array, value, compare);\n        if (index === array.length) {\n            return -1;\n        }\n        var item = array[index];\n        if (compare(item, value) !== 0) {\n            return -1;\n        }\n        return index;\n    }\n    tsu.binarySearch = binarySearch;\n\n    /**\n    * Perform a binary find on a sorted array.\n    *\n    * @param array The array of sorted items to search.\n    * @param value The value to located in the array.\n    * @param compare The value comparison function.\n    * @returns The found item in the array, or undefined.\n    */\n    function binaryFind(array, value, compare) {\n        var index = lowerBound(array, value, compare);\n        if (index === array.length) {\n            return undefined;\n        }\n        var item = array[index];\n        if (compare(item, value) !== 0) {\n            return undefined;\n        }\n        return item;\n    }\n    tsu.binaryFind = binaryFind;\n\n})(tsu || (tsu = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n/// <reference path=\"iterator.ts\"/>\nvar tsu;\n(function (tsu) {\n    /**\n    * A base class for implementing array-based data structures.\n    *\n    * @class\n    */\n    var ArrayBase = (function () {\n        function ArrayBase() {\n            /*\n            * The internal data array.\n            *\n            * @protected\n            */\n            this._array = [];\n        }\n        /**\n        * Returns the number of items in the array.\n        */\n        ArrayBase.prototype.size = function () {\n            return this._array.length;\n        };\n\n        /**\n        * Returns true if the array is empty.\n        */\n        ArrayBase.prototype.empty = function () {\n            return this._array.length === 0;\n        };\n\n        /**\n        * Returns the item at the given array index.\n        *\n        * @param index The integer index of the desired item.\n        */\n        ArrayBase.prototype.itemAt = function (index) {\n            return this._array[index];\n        };\n\n        /**\n        * Removes and returns the item at the given index.\n        *\n        * @param index The integer index of the desired item.\n        */\n        ArrayBase.prototype.takeAt = function (index) {\n            return this._array.splice(index, 1)[0];\n        };\n\n        /**\n        * Clear the internal contents of array.\n        */\n        ArrayBase.prototype.clear = function () {\n            this._array = [];\n        };\n\n        /**\n        * Swap this array's contents with another array.\n        *\n        * @param other The array base to use for the swap.\n        */\n        ArrayBase.prototype.swap = function (other) {\n            var array = this._array;\n            this._array = other._array;\n            other._array = array;\n        };\n\n        /**\n        * Returns an iterator over the array of items.\n        */\n        ArrayBase.prototype.__iter__ = function () {\n            return tsu.iter(this._array);\n        };\n\n        /**\n        * Returns a reverse iterator over the array of items.\n        */\n        ArrayBase.prototype.__reversed__ = function () {\n            return tsu.reversed(this._array);\n        };\n        return ArrayBase;\n    })();\n    tsu.ArrayBase = ArrayBase;\n})(tsu || (tsu = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\nvar __extends = this.__extends || function (d, b) {\n    for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];\n    function __() { this.constructor = d; }\n    __.prototype = b.prototype;\n    d.prototype = new __();\n};\n/// <reference path=\"algorithm.ts\"/>\n/// <reference path=\"array_base.ts\"/>\n/// <reference path=\"iterator.ts\"/>\n/// <reference path=\"utility.ts\"/>\nvar tsu;\n(function (tsu) {\n    /**\n    * A mapping container build on a sorted array.\n    *\n    * @class\n    */\n    var AssociativeArray = (function (_super) {\n        __extends(AssociativeArray, _super);\n        /**\n        * Construct a new AssociativeArray.\n        *\n        * @param compare The key comparison function.\n        */\n        function AssociativeArray(compare) {\n            _super.call(this);\n            this._compare = compare;\n            this._wrapped = wrapCompare(compare);\n        }\n        /**\n        * Returns the key comparison function used by this array.\n        */\n        AssociativeArray.prototype.comparitor = function () {\n            return this._compare;\n        };\n\n        /**\n        * Return the array index of the given key, or -1.\n        *\n        * @param key The key to locate in the array.\n        */\n        AssociativeArray.prototype.indexOf = function (key) {\n            return tsu.binarySearch(this._array, key, this._wrapped);\n        };\n\n        /**\n        * Returns true if the key is in the array, false otherwise.\n        *\n        * @param key The key to locate in the array.\n        */\n        AssociativeArray.prototype.contains = function (key) {\n            return tsu.binarySearch(this._array, key, this._wrapped) >= 0;\n        };\n\n        /**\n        * Returns the pair associated with the given key, or undefined.\n        *\n        * @param key The key to locate in the array.\n        */\n        AssociativeArray.prototype.find = function (key) {\n            return tsu.binaryFind(this._array, key, this._wrapped);\n        };\n\n        /**\n        * Returns the pair associated with the key if it exists.\n        *\n        * If the key does not exist, a new pair will be created and\n        * inserted using the value created by the given factory.\n        *\n        * @param key The key to locate in the array.\n        * @param factory The function which creates the default value.\n        */\n        AssociativeArray.prototype.setDefault = function (key, factory) {\n            var array = this._array;\n            var index = tsu.lowerBound(array, key, this._wrapped);\n            if (index === array.length) {\n                var pair = new tsu.Pair(key, factory());\n                array.push(pair);\n                return pair;\n            }\n            var currPair = array[index];\n            if (this._compare(currPair.first, key) !== 0) {\n                var pair = new tsu.Pair(key, factory());\n                array.splice(index, 0, pair);\n                return pair;\n            }\n            return currPair;\n        };\n\n        /**\n        * Insert the pair into the array and return the pair.\n        *\n        * This will overwrite any existing entry in the array.\n        *\n        * @param key The key portion of the pair.\n        * @param value The value portion of the pair.\n        */\n        AssociativeArray.prototype.insert = function (key, value) {\n            var array = this._array;\n            var index = tsu.lowerBound(array, key, this._wrapped);\n            if (index === array.length) {\n                var pair = new tsu.Pair(key, value);\n                array.push(pair);\n                return pair;\n            }\n            var currPair = array[index];\n            if (this._compare(currPair.first, key) !== 0) {\n                var pair = new tsu.Pair(key, value);\n                array.splice(index, 0, pair);\n                return pair;\n            }\n            currPair.second = value;\n            return currPair;\n        };\n\n        AssociativeArray.prototype.update = function (object) {\n            var _this = this;\n            if (object instanceof AssociativeArray) {\n                var obj = object;\n                this._array = merge(this._array, obj._array, this._compare);\n            } else {\n                tsu.forEach(object, function (pair) {\n                    _this.insert(pair.first, pair.second);\n                });\n            }\n        };\n\n        /**\n        * Removes and returns the pair for the given key, or undefined.\n        *\n        * @param key The key to remove from the map.\n        */\n        AssociativeArray.prototype.erase = function (key) {\n            var array = this._array;\n            var index = tsu.binarySearch(array, key, this._wrapped);\n            if (index < 0) {\n                return undefined;\n            }\n            return array.splice(index, 1)[0];\n        };\n\n        /**\n        * Create a copy of this associative array.\n        */\n        AssociativeArray.prototype.copy = function () {\n            var theCopy = new AssociativeArray(this._compare);\n            var copyArray = theCopy._array;\n            var thisArray = this._array;\n            for (var i = 0, n = thisArray.length; i < n; ++i) {\n                copyArray.push(thisArray[i].copy());\n            }\n            return theCopy;\n        };\n        return AssociativeArray;\n    })(tsu.ArrayBase);\n    tsu.AssociativeArray = AssociativeArray;\n\n    /**\n    * An internal which wraps a comparison key function.\n    */\n    function wrapCompare(cmp) {\n        return function (pair, value) {\n            return cmp(pair.first, value);\n        };\n    }\n\n    /**\n    * An internal function which merges two ordered pair arrays.\n    */\n    function merge(first, second, compare) {\n        var i = 0, j = 0;\n        var len1 = first.length;\n        var len2 = second.length;\n        var merged = [];\n        while (i < len1 && j < len2) {\n            var a = first[i];\n            var b = second[j];\n            var v = compare(a.first, b.first);\n            if (v < 0) {\n                merged.push(a.copy());\n                ++i;\n            } else if (v > 0) {\n                merged.push(b.copy());\n                ++j;\n            } else {\n                merged.push(b.copy());\n                ++i;\n                ++j;\n            }\n        }\n        while (i < len1) {\n            merged.push(first[i].copy());\n            ++i;\n        }\n        while (j < len2) {\n            merged.push(second[j].copy());\n            ++j;\n        }\n        return merged;\n    }\n})(tsu || (tsu = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n/// <reference path=\"algorithm.ts\"/>\n/// <reference path=\"array_base.ts\"/>\n/// <reference path=\"associative_array.ts\"/>\n/// <reference path=\"iterator.ts\"/>\n/// <reference path=\"unique_array.ts\"/>\n/// <reference path=\"utility.ts\"/>\n\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n// <reference path=\"expression.ts\">\n// <reference path=\"strength.ts\">\n/**\n * Kiwi is an efficient implementation of the Cassowary constraint solving\n * algorithm, based on the seminal Cassowary paper.\n * It is *not* a refactoring or port of the original C++ solver, but\n * has been designed from the ground up to be lightweight and fast.\n *\n * **Example**\n * ```javascript\n * var kiwi = require('kiwi');\n *\n * // Create a solver\n * var solver = new kiwi.Solver();\n *\n * // Create and add some editable variables\n * var left = new kiwi.Variable();\n * var width = new kiwi.Variable();\n * solver.addEditVariable(left, kiwi.Strength.strong);\n * solver.addEditVariable(width, kiwi.Strength.strong);\n *\n * // Create a variable calculated through a constraint\n * var centerX = new kiwi.Variable();\n * var expr = new kiwi.Expression([-1, centerX], left, [0.5, width]);\n * solver.addConstraint(new kiwi.Constraint(expr, kiwi.Operator.Eq, kiwi.Strength.required));\n *\n * // Suggest some values to the solver\n * solver.suggestValue(left, 0);\n * solver.suggestValue(width, 500);\n *\n * // Lets solve the problem!\n * solver.updateVariables();\n * assert(centerX.value(), 250);\n * ```\n *\n * ##API Documentation\n * @module kiwi\n */\nvar kiwi;\n(function (kiwi) {\n    /**\n     * An enum defining the linear constraint operators.\n     *\n     * |Value|Operator|Description|\n     * |----|-----|-----|\n     * |`Le`|<=|Less than equal|\n     * |`Ge`|>=|Greater than equal|\n     * |`Eq`|==|Equal|\n     *\n     * @enum {Number}\n     */\n    (function (Operator) {\n        Operator[Operator[\"Le\"] = 0] = \"Le\";\n        Operator[Operator[\"Ge\"] = 1] = \"Ge\";\n        Operator[Operator[\"Eq\"] = 2] = \"Eq\"; // ==\n    })(kiwi.Operator || (kiwi.Operator = {}));\n    var Operator = kiwi.Operator;\n    /**\n     * A linear constraint equation.\n     *\n     * A constraint equation is composed of an expression, an operator,\n     * and a strength. The RHS of the equation is implicitly zero.\n     *\n     * @class\n     * @param {Expression} expression The constraint expression (LHS).\n     * @param {Operator} operator The equation operator.\n     * @param {Expression} [rhs] Right hand side of the expression.\n     * @param {Number} [strength=Strength.required] The strength of the constraint.\n     */\n    var Constraint = (function () {\n        function Constraint(expression, operator, rhs, strength) {\n            if (strength === void 0) { strength = kiwi.Strength.required; }\n            this._id = CnId++;\n            this._operator = operator;\n            this._strength = kiwi.Strength.clip(strength);\n            if ((rhs === undefined) && (expression instanceof kiwi.Expression)) {\n                this._expression = expression;\n            }\n            else {\n                this._expression = expression.minus(rhs);\n            }\n        }\n        /**\n          * A static constraint comparison function.\n          * @private\n          */\n        Constraint.Compare = function (a, b) {\n            return a.id() - b.id();\n        };\n        /**\n         * Returns the unique id number of the constraint.\n         * @private\n         */\n        Constraint.prototype.id = function () {\n            return this._id;\n        };\n        /**\n         * Returns the expression of the constraint.\n         *\n         * @return {Expression} expression\n         */\n        Constraint.prototype.expression = function () {\n            return this._expression;\n        };\n        /**\n         * Returns the relational operator of the constraint.\n         *\n         * @return {Operator} linear constraint operator\n         */\n        Constraint.prototype.op = function () {\n            return this._operator;\n        };\n        /**\n         * Returns the strength of the constraint.\n         *\n         * @return {Number} strength\n         */\n        Constraint.prototype.strength = function () {\n            return this._strength;\n        };\n        return Constraint;\n    })();\n    kiwi.Constraint = Constraint;\n    /**\n     * The internal constraint id counter.\n     * @private\n     */\n    var CnId = 0;\n})(kiwi || (kiwi = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n/// <reference path=\"../thirdparty/tsu.d.ts\"/>\nvar kiwi;\n(function (kiwi) {\n    function createMap(compare) {\n        return new tsu.AssociativeArray(compare);\n    }\n    kiwi.createMap = createMap;\n})(kiwi || (kiwi = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\nvar kiwi;\n(function (kiwi) {\n    /**\n     * The primary user constraint variable.\n     *\n     * @class\n     * @param {String} [name=\"\"] The name to associated with the variable.\n     */\n    var Variable = (function () {\n        function Variable(name) {\n            if (name === void 0) { name = \"\"; }\n            this._value = 0.0;\n            this._context = null;\n            this._id = VarId++;\n            this._name = name;\n        }\n        /**\n         * A static variable comparison function.\n         * @private\n         */\n        Variable.Compare = function (a, b) {\n            return a.id() - b.id();\n        };\n        /**\n         * Returns the unique id number of the variable.\n         * @private\n         */\n        Variable.prototype.id = function () {\n            return this._id;\n        };\n        /**\n         * Returns the name of the variable.\n         *\n         * @return {String} name of the variable\n         */\n        Variable.prototype.name = function () {\n            return this._name;\n        };\n        /**\n         * Set the name of the variable.\n         *\n         * @param {String} name Name of the variable\n         */\n        Variable.prototype.setName = function (name) {\n            this._name = name;\n        };\n        /**\n         * Returns the user context object of the variable.\n         * @private\n         */\n        Variable.prototype.context = function () {\n            return this._context;\n        };\n        /**\n         * Set the user context object of the variable.\n         * @private\n         */\n        Variable.prototype.setContext = function (context) {\n            this._context = context;\n        };\n        /**\n         * Returns the value of the variable.\n         *\n         * @return {Number} Calculated value\n         */\n        Variable.prototype.value = function () {\n            return this._value;\n        };\n        /**\n         * Set the value of the variable.\n         * @private\n         */\n        Variable.prototype.setValue = function (value) {\n            this._value = value;\n        };\n        /**\n         * Creates a new Expression by adding a number, variable or expression\n         * to the variable.\n         *\n         * @param {Number|Variable|Expression} value Value to add.\n         * @return {Expression} expression\n         */\n        Variable.prototype.plus = function (value) {\n            return new kiwi.Expression(this, value);\n        };\n        /**\n         * Creates a new Expression by substracting a number, variable or expression\n         * from the variable.\n         *\n         * @param {Number|Variable|Expression} value Value to substract.\n         * @return {Expression} expression\n         */\n        Variable.prototype.minus = function (value) {\n            return new kiwi.Expression(this, typeof value === 'number' ? -value : [-1, value]);\n        };\n        /**\n         * Creates a new Expression by multiplying with a fixed number.\n         *\n         * @param {Number} coefficient Coefficient to multiply with.\n         * @return {Expression} expression\n         */\n        Variable.prototype.multiply = function (coefficient) {\n            return new kiwi.Expression([coefficient, this]);\n        };\n        /**\n         * Creates a new Expression by dividing with a fixed number.\n         *\n         * @param {Number} coefficient Coefficient to divide by.\n         * @return {Expression} expression\n         */\n        Variable.prototype.divide = function (coefficient) {\n            return new kiwi.Expression([1 / coefficient, this]);\n        };\n        /**\n         * Returns the JSON representation of the variable.\n         * @private\n         */\n        Variable.prototype.toJSON = function () {\n            return {\n                name: this._name,\n                value: this._value\n            };\n        };\n        return Variable;\n    })();\n    kiwi.Variable = Variable;\n    /**\n     * The internal variable id counter.\n     * @private\n     */\n    var VarId = 0;\n})(kiwi || (kiwi = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n/// <reference path=\"../thirdparty/tsu.d.ts\"/>\n/// <reference path=\"maptype.ts\"/>\n/// <reference path=\"variable.ts\"/>\nvar kiwi;\n(function (kiwi) {\n    /**\n     * An expression of variable terms and a constant.\n     *\n     * The constructor accepts an arbitrary number of parameters,\n     * each of which must be one of the following types:\n     *  - number\n     *  - Variable\n     *  - Expression\n     *  - 2-tuple of [number, Variable|Expression]\n     *\n     * The parameters are summed. The tuples are multiplied.\n     *\n     * @class\n     * @param {...(number|Variable|Expression|Array)} args\n     */\n    var Expression = (function () {\n        function Expression() {\n            var parsed = parseArgs(arguments);\n            this._terms = parsed.terms;\n            this._constant = parsed.constant;\n        }\n        /**\n         * Returns the mapping of terms in the expression.\n         *\n         * This *must* be treated as const.\n         * @private\n         */\n        Expression.prototype.terms = function () {\n            return this._terms;\n        };\n        /**\n         * Returns the constant of the expression.\n         * @private\n         */\n        Expression.prototype.constant = function () {\n            return this._constant;\n        };\n        /**\n         * Returns the computed value of the expression.\n         *\n         * @private\n         * @return {Number} computed value of the expression\n         */\n        Expression.prototype.value = function () {\n            var result = this._constant;\n            for (var i = 0, n = this._terms.size(); i < n; i++) {\n                var pair = this._terms.itemAt(i);\n                result += pair.first.value() * pair.second;\n            }\n            return result;\n        };\n        /**\n         * Creates a new Expression by adding a number, variable or expression\n         * to the expression.\n         *\n         * @param {Number|Variable|Expression} value Value to add.\n         * @return {Expression} expression\n         */\n        Expression.prototype.plus = function (value) {\n            return new Expression(this, value);\n        };\n        /**\n         * Creates a new Expression by substracting a number, variable or expression\n         * from the expression.\n         *\n         * @param {Number|Variable|Expression} value Value to substract.\n         * @return {Expression} expression\n         */\n        Expression.prototype.minus = function (value) {\n            return new Expression(this, typeof value === 'number' ? -value : [-1, value]);\n        };\n        /**\n         * Creates a new Expression by multiplying with a fixed number.\n         *\n         * @param {Number} coefficient Coefficient to multiply with.\n         * @return {Expression} expression\n         */\n        Expression.prototype.multiply = function (coefficient) {\n            return new Expression([coefficient, this]);\n        };\n        /**\n         * Creates a new Expression by dividing with a fixed number.\n         *\n         * @param {Number} coefficient Coefficient to divide by.\n         * @return {Expression} expression\n         */\n        Expression.prototype.divide = function (coefficient) {\n            return new Expression([1 / coefficient, this]);\n        };\n        return Expression;\n    })();\n    kiwi.Expression = Expression;\n    /**\n     * An internal argument parsing function.\n     * @private\n     */\n    function parseArgs(args) {\n        var constant = 0.0;\n        var factory = function () { return 0.0; };\n        var terms = kiwi.createMap(kiwi.Variable.Compare);\n        for (var i = 0, n = args.length; i < n; ++i) {\n            var item = args[i];\n            if (typeof item === \"number\") {\n                constant += item;\n            }\n            else if (item instanceof kiwi.Variable) {\n                terms.setDefault(item, factory).second += 1.0;\n            }\n            else if (item instanceof Expression) {\n                constant += item.constant();\n                var terms2 = item.terms();\n                for (var j = 0, k = terms2.size(); j < k; j++) {\n                    var termPair = terms2.itemAt(j);\n                    terms.setDefault(termPair.first, factory).second += termPair.second;\n                }\n            }\n            else if (item instanceof Array) {\n                if (item.length !== 2) {\n                    throw new Error(\"array must have length 2\");\n                }\n                var value = item[0];\n                var value2 = item[1];\n                if (typeof value !== \"number\") {\n                    throw new Error(\"array item 0 must be a number\");\n                }\n                if (value2 instanceof kiwi.Variable) {\n                    terms.setDefault(value2, factory).second += value;\n                }\n                else if (value2 instanceof Expression) {\n                    constant += (value2.constant() * value);\n                    var terms2 = value2.terms();\n                    for (var j = 0, k = terms2.size(); j < k; j++) {\n                        var termPair = terms2.itemAt(j);\n                        terms.setDefault(termPair.first, factory).second += (termPair.second * value);\n                    }\n                }\n                else {\n                    throw new Error(\"array item 1 must be a variable or expression\");\n                }\n            }\n            else {\n                throw new Error(\"invalid Expression argument: \" + item);\n            }\n        }\n        return { terms: terms, constant: constant };\n    }\n})(kiwi || (kiwi = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\nvar kiwi;\n(function (kiwi) {\n    /**\n     * @class Strength\n     */\n    var Strength;\n    (function (Strength) {\n        /**\n         * Create a new symbolic strength.\n         *\n         * @param {Number} a strong\n         * @param {Number} b medium\n         * @param {Number} c weak\n         * @param {Number} [w] weight\n         * @return {Number} strength\n         */\n        function create(a, b, c, w) {\n            if (w === void 0) { w = 1.0; }\n            var result = 0.0;\n            result += Math.max(0.0, Math.min(1000.0, a * w)) * 1000000.0;\n            result += Math.max(0.0, Math.min(1000.0, b * w)) * 1000.0;\n            result += Math.max(0.0, Math.min(1000.0, c * w));\n            return result;\n        }\n        Strength.create = create;\n        /**\n         * The 'required' symbolic strength.\n         */\n        Strength.required = create(1000.0, 1000.0, 1000.0);\n        /**\n         * The 'strong' symbolic strength.\n         */\n        Strength.strong = create(1.0, 0.0, 0.0);\n        /**\n         * The 'medium' symbolic strength.\n         */\n        Strength.medium = create(0.0, 1.0, 0.0);\n        /**\n         * The 'weak' symbolic strength.\n         */\n        Strength.weak = create(0.0, 0.0, 1.0);\n        /**\n         * Clip a symbolic strength to the allowed min and max.\n         * @private\n         */\n        function clip(value) {\n            return Math.max(0.0, Math.min(Strength.required, value));\n        }\n        Strength.clip = clip;\n    })(Strength = kiwi.Strength || (kiwi.Strength = {}));\n})(kiwi || (kiwi = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n/// <reference path=\"../thirdparty/tsu.d.ts\"/>\n/// <reference path=\"constraint.ts\"/>\n/// <reference path=\"expression.ts\"/>\n/// <reference path=\"maptype.ts\"/>\n/// <reference path=\"strength.ts\"/>\n/// <reference path=\"variable.ts\"/>\nvar kiwi;\n(function (kiwi) {\n    /**\n     * The constraint solver class.\n     *\n     * @class\n     */\n    var Solver = (function () {\n        /**\n         * Construct a new Solver.\n         */\n        function Solver() {\n            this._cnMap = createCnMap();\n            this._rowMap = createRowMap();\n            this._varMap = createVarMap();\n            this._editMap = createEditMap();\n            this._infeasibleRows = [];\n            this._objective = new Row();\n            this._artificial = null;\n            this._idTick = 0;\n        }\n        /**\n         * Creates and add a constraint to the solver.\n         *\n         * @param {Expression|Variable} lhs Left hand side of the expression\n         * @param {Operator} operator Operator\n         * @param {Expression|Variable|Number} rhs Right hand side of the expression\n         * @param {Number} [strength=Strength.required] Strength\n         */\n        Solver.prototype.createConstraint = function (lhs, operator, rhs, strength) {\n            if (strength === void 0) { strength = kiwi.Strength.required; }\n            var cn = new kiwi.Constraint(lhs, operator, rhs, strength);\n            this.addConstraint(cn);\n            return cn;\n        };\n        /**\n         * Add a constraint to the solver.\n         *\n         * @param {Constraint} constraint Constraint to add to the solver\n         */\n        Solver.prototype.addConstraint = function (constraint) {\n            var cnPair = this._cnMap.find(constraint);\n            if (cnPair !== undefined) {\n                throw new Error(\"duplicate constraint\");\n            }\n            // Creating a row causes symbols to be reserved for the variables\n            // in the constraint. If this method exits with an exception,\n            // then its possible those variables will linger in the var map.\n            // Since its likely that those variables will be used in other\n            // constraints and since exceptional conditions are uncommon,\n            // i'm not too worried about aggressive cleanup of the var map.\n            var data = this._createRow(constraint);\n            var row = data.row;\n            var tag = data.tag;\n            var subject = this._chooseSubject(row, tag);\n            // If chooseSubject couldnt find a valid entering symbol, one\n            // last option is available if the entire row is composed of\n            // dummy variables. If the constant of the row is zero, then\n            // this represents redundant constraints and the new dummy\n            // marker can enter the basis. If the constant is non-zero,\n            // then it represents an unsatisfiable constraint.\n            if (subject.type() === 0 /* Invalid */ && row.allDummies()) {\n                if (!nearZero(row.constant())) {\n                    throw new Error(\"unsatisfiable constraint\");\n                }\n                else {\n                    subject = tag.marker;\n                }\n            }\n            // If an entering symbol still isn't found, then the row must\n            // be added using an artificial variable. If that fails, then\n            // the row represents an unsatisfiable constraint.\n            if (subject.type() === 0 /* Invalid */) {\n                if (!this._addWithArtificialVariable(row)) {\n                    throw new Error(\"unsatisfiable constraint\");\n                }\n            }\n            else {\n                row.solveFor(subject);\n                this._substitute(subject, row);\n                this._rowMap.insert(subject, row);\n            }\n            this._cnMap.insert(constraint, tag);\n            // Optimizing after each constraint is added performs less\n            // aggregate work due to a smaller average system size. It\n            // also ensures the solver remains in a consistent state.\n            this._optimize(this._objective);\n        };\n        /**\n         * Remove a constraint from the solver.\n         *\n         * @param {Constraint} constraint Constraint to remove from the solver\n         */\n        Solver.prototype.removeConstraint = function (constraint) {\n            var cnPair = this._cnMap.erase(constraint);\n            if (cnPair === undefined) {\n                throw new Error(\"unknown constraint\");\n            }\n            // Remove the error effects from the objective function\n            // *before* pivoting, or substitutions into the objective\n            // will lead to incorrect solver results.\n            this._removeConstraintEffects(constraint, cnPair.second);\n            // If the marker is basic, simply drop the row. Otherwise,\n            // pivot the marker into the basis and then drop the row.\n            var marker = cnPair.second.marker;\n            var rowPair = this._rowMap.erase(marker);\n            if (rowPair === undefined) {\n                var leaving = this._getMarkerLeavingSymbol(marker);\n                if (leaving.type() === 0 /* Invalid */) {\n                    throw new Error(\"failed to find leaving row\");\n                }\n                rowPair = this._rowMap.erase(leaving);\n                rowPair.second.solveForEx(leaving, marker);\n                this._substitute(marker, rowPair.second);\n            }\n            // Optimizing after each constraint is removed ensures that the\n            // solver remains consistent. It makes the solver api easier to\n            // use at a small tradeoff for speed.\n            this._optimize(this._objective);\n        };\n        /**\n         * Test whether the solver contains the constraint.\n         *\n         * @param {Constraint} constraint Constraint to test for\n         * @return {Bool} true or false\n         */\n        Solver.prototype.hasConstraint = function (constraint) {\n            return this._cnMap.contains(constraint);\n        };\n        /**\n         * Add an edit variable to the solver.\n         *\n         * @param {Variable} variable Edit variable to add to the solver\n         * @param {Number} strength Strength, should be less than `Strength.required`\n         */\n        Solver.prototype.addEditVariable = function (variable, strength) {\n            var editPair = this._editMap.find(variable);\n            if (editPair !== undefined) {\n                throw new Error(\"duplicate edit variable\");\n            }\n            strength = kiwi.Strength.clip(strength);\n            if (strength === kiwi.Strength.required) {\n                throw new Error(\"bad required strength\");\n            }\n            var expr = new kiwi.Expression(variable);\n            var cn = new kiwi.Constraint(expr, 2 /* Eq */, undefined, strength);\n            this.addConstraint(cn);\n            var tag = this._cnMap.find(cn).second;\n            var info = { tag: tag, constraint: cn, constant: 0.0 };\n            this._editMap.insert(variable, info);\n        };\n        /**\n         * Remove an edit variable from the solver.\n         *\n         * @param {Variable} variable Edit variable to remove from the solver\n         */\n        Solver.prototype.removeEditVariable = function (variable) {\n            var editPair = this._editMap.erase(variable);\n            if (editPair === undefined) {\n                throw new Error(\"unknown edit variable\");\n            }\n            this.removeConstraint(editPair.second.constraint);\n        };\n        /**\n         * Test whether the solver contains the edit variable.\n         *\n         * @param {Variable} variable Edit variable to test for\n         * @return {Bool} true or false\n         */\n        Solver.prototype.hasEditVariable = function (variable) {\n            return this._editMap.contains(variable);\n        };\n        /**\n         * Suggest the value of an edit variable.\n         *\n         * @param {Variable} variable Edit variable to suggest a value for\n         * @param {Number} value Suggested value\n         */\n        Solver.prototype.suggestValue = function (variable, value) {\n            var editPair = this._editMap.find(variable);\n            if (editPair === undefined) {\n                throw new Error(\"unknown edit variable\");\n            }\n            var rows = this._rowMap;\n            var info = editPair.second;\n            var delta = value - info.constant;\n            info.constant = value;\n            // Check first if the positive error variable is basic.\n            var marker = info.tag.marker;\n            var rowPair = rows.find(marker);\n            if (rowPair !== undefined) {\n                if (rowPair.second.add(-delta) < 0.0) {\n                    this._infeasibleRows.push(marker);\n                }\n                this._dualOptimize();\n                return;\n            }\n            // Check next if the negative error variable is basic.\n            var other = info.tag.other;\n            var rowPair = rows.find(other);\n            if (rowPair !== undefined) {\n                if (rowPair.second.add(delta) < 0.0) {\n                    this._infeasibleRows.push(other);\n                }\n                this._dualOptimize();\n                return;\n            }\n            for (var i = 0, n = rows.size(); i < n; ++i) {\n                var rowPair = rows.itemAt(i);\n                var row = rowPair.second;\n                var coeff = row.coefficientFor(marker);\n                if (coeff !== 0.0 && row.add(delta * coeff) < 0.0 && rowPair.first.type() !== 1 /* External */) {\n                    this._infeasibleRows.push(rowPair.first);\n                }\n            }\n            this._dualOptimize();\n        };\n        /**\n         * Update the values of the variables.\n         */\n        Solver.prototype.updateVariables = function () {\n            var vars = this._varMap;\n            var rows = this._rowMap;\n            for (var i = 0, n = vars.size(); i < n; ++i) {\n                var pair = vars.itemAt(i);\n                var rowPair = rows.find(pair.second);\n                if (rowPair !== undefined) {\n                    pair.first.setValue(rowPair.second.constant());\n                }\n                else {\n                    pair.first.setValue(0.0);\n                }\n            }\n        };\n        /**\n         * Get the symbol for the given variable.\n         *\n         * If a symbol does not exist for the variable, one will be created.\n         * @private\n         */\n        Solver.prototype._getVarSymbol = function (variable) {\n            var _this = this;\n            var factory = function () { return _this._makeSymbol(1 /* External */); };\n            return this._varMap.setDefault(variable, factory).second;\n        };\n        /**\n         * Create a new Row object for the given constraint.\n         *\n         * The terms in the constraint will be converted to cells in the row.\n         * Any term in the constraint with a coefficient of zero is ignored.\n         * This method uses the `_getVarSymbol` method to get the symbol for\n         * the variables added to the row. If the symbol for a given cell\n         * variable is basic, the cell variable will be substituted with the\n         * basic row.\n         *\n         * The necessary slack and error variables will be added to the row.\n         * If the constant for the row is negative, the sign for the row\n         * will be inverted so the constant becomes positive.\n         *\n         * Returns the created Row and the tag for tracking the constraint.\n         * @private\n         */\n        Solver.prototype._createRow = function (constraint) {\n            var expr = constraint.expression();\n            var row = new Row(expr.constant());\n            // Substitute the current basic variables into the row.\n            var terms = expr.terms();\n            for (var i = 0, n = terms.size(); i < n; ++i) {\n                var termPair = terms.itemAt(i);\n                if (!nearZero(termPair.second)) {\n                    var symbol = this._getVarSymbol(termPair.first);\n                    var basicPair = this._rowMap.find(symbol);\n                    if (basicPair !== undefined) {\n                        row.insertRow(basicPair.second, termPair.second);\n                    }\n                    else {\n                        row.insertSymbol(symbol, termPair.second);\n                    }\n                }\n            }\n            // Add the necessary slack, error, and dummy variables.\n            var objective = this._objective;\n            var strength = constraint.strength();\n            var tag = { marker: INVALID_SYMBOL, other: INVALID_SYMBOL };\n            switch (constraint.op()) {\n                case 0 /* Le */:\n                case 1 /* Ge */:\n                    {\n                        var coeff = constraint.op() === 0 /* Le */ ? 1.0 : -1.0;\n                        var slack = this._makeSymbol(2 /* Slack */);\n                        tag.marker = slack;\n                        row.insertSymbol(slack, coeff);\n                        if (strength < kiwi.Strength.required) {\n                            var error = this._makeSymbol(3 /* Error */);\n                            tag.other = error;\n                            row.insertSymbol(error, -coeff);\n                            objective.insertSymbol(error, strength);\n                        }\n                        break;\n                    }\n                case 2 /* Eq */:\n                    {\n                        if (strength < kiwi.Strength.required) {\n                            var errplus = this._makeSymbol(3 /* Error */);\n                            var errminus = this._makeSymbol(3 /* Error */);\n                            tag.marker = errplus;\n                            tag.other = errminus;\n                            row.insertSymbol(errplus, -1.0); // v = eplus - eminus\n                            row.insertSymbol(errminus, 1.0); // v - eplus + eminus = 0\n                            objective.insertSymbol(errplus, strength);\n                            objective.insertSymbol(errminus, strength);\n                        }\n                        else {\n                            var dummy = this._makeSymbol(4 /* Dummy */);\n                            tag.marker = dummy;\n                            row.insertSymbol(dummy);\n                        }\n                        break;\n                    }\n            }\n            // Ensure the row has a positive constant.\n            if (row.constant() < 0.0) {\n                row.reverseSign();\n            }\n            return { row: row, tag: tag };\n        };\n        /**\n         * Choose the subject for solving for the row.\n         *\n         * This method will choose the best subject for using as the solve\n         * target for the row. An invalid symbol will be returned if there\n         * is no valid target.\n         *\n         * The symbols are chosen according to the following precedence:\n         *\n         * 1) The first symbol representing an external variable.\n         * 2) A negative slack or error tag variable.\n         *\n         * If a subject cannot be found, an invalid symbol will be returned.\n         *\n         * @private\n         */\n        Solver.prototype._chooseSubject = function (row, tag) {\n            var cells = row.cells();\n            for (var i = 0, n = cells.size(); i < n; ++i) {\n                var pair = cells.itemAt(i);\n                if (pair.first.type() === 1 /* External */) {\n                    return pair.first;\n                }\n            }\n            var type = tag.marker.type();\n            if (type === 2 /* Slack */ || type === 3 /* Error */) {\n                if (row.coefficientFor(tag.marker) < 0.0) {\n                    return tag.marker;\n                }\n            }\n            type = tag.other.type();\n            if (type === 2 /* Slack */ || type === 3 /* Error */) {\n                if (row.coefficientFor(tag.other) < 0.0) {\n                    return tag.other;\n                }\n            }\n            return INVALID_SYMBOL;\n        };\n        /**\n         * Add the row to the tableau using an artificial variable.\n         *\n         * This will return false if the constraint cannot be satisfied.\n         *\n         * @private\n         */\n        Solver.prototype._addWithArtificialVariable = function (row) {\n            // Create and add the artificial variable to the tableau.\n            var art = this._makeSymbol(2 /* Slack */);\n            this._rowMap.insert(art, row.copy());\n            this._artificial = row.copy();\n            // Optimize the artificial objective. This is successful\n            // only if the artificial objective is optimized to zero.\n            this._optimize(this._artificial);\n            var success = nearZero(this._artificial.constant());\n            this._artificial = null;\n            // If the artificial variable is basic, pivot the row so that\n            // it becomes non-basic. If the row is constant, exit early.\n            var pair = this._rowMap.erase(art);\n            if (pair !== undefined) {\n                var basicRow = pair.second;\n                if (basicRow.isConstant()) {\n                    return success;\n                }\n                var entering = this._anyPivotableSymbol(basicRow);\n                if (entering.type() === 0 /* Invalid */) {\n                    return false; // unsatisfiable (will this ever happen?)\n                }\n                basicRow.solveForEx(art, entering);\n                this._substitute(entering, basicRow);\n                this._rowMap.insert(entering, basicRow);\n            }\n            // Remove the artificial variable from the tableau.\n            var rows = this._rowMap;\n            for (var i = 0, n = rows.size(); i < n; ++i) {\n                rows.itemAt(i).second.removeSymbol(art);\n            }\n            this._objective.removeSymbol(art);\n            return success;\n        };\n        /**\n         * Substitute the parametric symbol with the given row.\n         *\n         * This method will substitute all instances of the parametric symbol\n         * in the tableau and the objective function with the given row.\n         *\n         * @private\n         */\n        Solver.prototype._substitute = function (symbol, row) {\n            var rows = this._rowMap;\n            for (var i = 0, n = rows.size(); i < n; ++i) {\n                var pair = rows.itemAt(i);\n                pair.second.substitute(symbol, row);\n                if (pair.second.constant() < 0.0 && pair.first.type() !== 1 /* External */) {\n                    this._infeasibleRows.push(pair.first);\n                }\n            }\n            this._objective.substitute(symbol, row);\n            if (this._artificial) {\n                this._artificial.substitute(symbol, row);\n            }\n        };\n        /**\n         * Optimize the system for the given objective function.\n         *\n         * This method performs iterations of Phase 2 of the simplex method\n         * until the objective function reaches a minimum.\n         *\n         * @private\n         */\n        Solver.prototype._optimize = function (objective) {\n            while (true) {\n                var entering = this._getEnteringSymbol(objective);\n                if (entering.type() === 0 /* Invalid */) {\n                    return;\n                }\n                var leaving = this._getLeavingSymbol(entering);\n                if (leaving.type() === 0 /* Invalid */) {\n                    throw new Error(\"the objective is unbounded\");\n                }\n                // pivot the entering symbol into the basis\n                var row = this._rowMap.erase(leaving).second;\n                row.solveForEx(leaving, entering);\n                this._substitute(entering, row);\n                this._rowMap.insert(entering, row);\n            }\n        };\n        /**\n         * Optimize the system using the dual of the simplex method.\n         *\n         * The current state of the system should be such that the objective\n         * function is optimal, but not feasible. This method will perform\n         * an iteration of the dual simplex method to make the solution both\n         * optimal and feasible.\n         *\n         * @private\n         */\n        Solver.prototype._dualOptimize = function () {\n            var rows = this._rowMap;\n            var infeasible = this._infeasibleRows;\n            while (infeasible.length !== 0) {\n                var leaving = infeasible.pop();\n                var pair = rows.find(leaving);\n                if (pair !== undefined && pair.second.constant() < 0.0) {\n                    var entering = this._getDualEnteringSymbol(pair.second);\n                    if (entering.type() === 0 /* Invalid */) {\n                        throw new Error(\"dual optimize failed\");\n                    }\n                    // pivot the entering symbol into the basis\n                    var row = pair.second;\n                    rows.erase(leaving);\n                    row.solveForEx(leaving, entering);\n                    this._substitute(entering, row);\n                    rows.insert(entering, row);\n                }\n            }\n        };\n        /**\n         * Compute the entering variable for a pivot operation.\n         *\n         * This method will return first symbol in the objective function which\n         * is non-dummy and has a coefficient less than zero. If no symbol meets\n         * the criteria, it means the objective function is at a minimum, and an\n         * invalid symbol is returned.\n         *\n         * @private\n         */\n        Solver.prototype._getEnteringSymbol = function (objective) {\n            var cells = objective.cells();\n            for (var i = 0, n = cells.size(); i < n; ++i) {\n                var pair = cells.itemAt(i);\n                var symbol = pair.first;\n                if (pair.second < 0.0 && symbol.type() !== 4 /* Dummy */) {\n                    return symbol;\n                }\n            }\n            return INVALID_SYMBOL;\n        };\n        /**\n         * Compute the entering symbol for the dual optimize operation.\n         *\n         * This method will return the symbol in the row which has a positive\n         * coefficient and yields the minimum ratio for its respective symbol\n         * in the objective function. The provided row *must* be infeasible.\n         * If no symbol is found which meats the criteria, an invalid symbol\n         * is returned.\n         *\n         * @private\n         */\n        Solver.prototype._getDualEnteringSymbol = function (row) {\n            var ratio = Number.MAX_VALUE;\n            var entering = INVALID_SYMBOL;\n            var cells = row.cells();\n            for (var i = 0, n = cells.size(); i < n; ++i) {\n                var pair = cells.itemAt(i);\n                var symbol = pair.first;\n                var c = pair.second;\n                if (c > 0.0 && symbol.type() !== 4 /* Dummy */) {\n                    var coeff = this._objective.coefficientFor(symbol);\n                    var r = coeff / c;\n                    if (r < ratio) {\n                        ratio = r;\n                        entering = symbol;\n                    }\n                }\n            }\n            return entering;\n        };\n        /**\n         * Compute the symbol for pivot exit row.\n         *\n         * This method will return the symbol for the exit row in the row\n         * map. If no appropriate exit symbol is found, an invalid symbol\n         * will be returned. This indicates that the objective function is\n         * unbounded.\n         *\n         * @private\n         */\n        Solver.prototype._getLeavingSymbol = function (entering) {\n            var ratio = Number.MAX_VALUE;\n            var found = INVALID_SYMBOL;\n            var rows = this._rowMap;\n            for (var i = 0, n = rows.size(); i < n; ++i) {\n                var pair = rows.itemAt(i);\n                var symbol = pair.first;\n                if (symbol.type() !== 1 /* External */) {\n                    var row = pair.second;\n                    var temp = row.coefficientFor(entering);\n                    if (temp < 0.0) {\n                        var temp_ratio = -row.constant() / temp;\n                        if (temp_ratio < ratio) {\n                            ratio = temp_ratio;\n                            found = symbol;\n                        }\n                    }\n                }\n            }\n            return found;\n        };\n        /**\n         * Compute the leaving symbol for a marker variable.\n         *\n         * This method will return a symbol corresponding to a basic row\n         * which holds the given marker variable. The row will be chosen\n         * according to the following precedence:\n         *\n         * 1) The row with a restricted basic varible and a negative coefficient\n         *    for the marker with the smallest ratio of -constant / coefficient.\n         *\n         * 2) The row with a restricted basic variable and the smallest ratio\n         *    of constant / coefficient.\n         *\n         * 3) The last unrestricted row which contains the marker.\n         *\n         * If the marker does not exist in any row, an invalid symbol will be\n         * returned. This indicates an internal solver error since the marker\n         * *should* exist somewhere in the tableau.\n         *\n         * @private\n         */\n        Solver.prototype._getMarkerLeavingSymbol = function (marker) {\n            var dmax = Number.MAX_VALUE;\n            var r1 = dmax;\n            var r2 = dmax;\n            var invalid = INVALID_SYMBOL;\n            var first = invalid;\n            var second = invalid;\n            var third = invalid;\n            var rows = this._rowMap;\n            for (var i = 0, n = rows.size(); i < n; ++i) {\n                var pair = rows.itemAt(i);\n                var row = pair.second;\n                var c = row.coefficientFor(marker);\n                if (c === 0.0) {\n                    continue;\n                }\n                var symbol = pair.first;\n                if (symbol.type() === 1 /* External */) {\n                    third = symbol;\n                }\n                else if (c < 0.0) {\n                    var r = -row.constant() / c;\n                    if (r < r1) {\n                        r1 = r;\n                        first = symbol;\n                    }\n                }\n                else {\n                    var r = row.constant() / c;\n                    if (r < r2) {\n                        r2 = r;\n                        second = symbol;\n                    }\n                }\n            }\n            if (first !== invalid) {\n                return first;\n            }\n            if (second !== invalid) {\n                return second;\n            }\n            return third;\n        };\n        /**\n         * Remove the effects of a constraint on the objective function.\n         *\n         * @private\n         */\n        Solver.prototype._removeConstraintEffects = function (cn, tag) {\n            if (tag.marker.type() === 3 /* Error */) {\n                this._removeMarkerEffects(tag.marker, cn.strength());\n            }\n            if (tag.other.type() === 3 /* Error */) {\n                this._removeMarkerEffects(tag.other, cn.strength());\n            }\n        };\n        /**\n         * Remove the effects of an error marker on the objective function.\n         *\n         * @private\n         */\n        Solver.prototype._removeMarkerEffects = function (marker, strength) {\n            var pair = this._rowMap.find(marker);\n            if (pair !== undefined) {\n                this._objective.insertRow(pair.second, -strength);\n            }\n            else {\n                this._objective.insertSymbol(marker, -strength);\n            }\n        };\n        /**\n         * Get the first Slack or Error symbol in the row.\n         *\n         * If no such symbol is present, an invalid symbol will be returned.\n         *\n         * @private\n         */\n        Solver.prototype._anyPivotableSymbol = function (row) {\n            var cells = row.cells();\n            for (var i = 0, n = cells.size(); i < n; ++i) {\n                var pair = cells.itemAt(i);\n                var type = pair.first.type();\n                if (type === 2 /* Slack */ || type === 3 /* Error */) {\n                    return pair.first;\n                }\n            }\n            return INVALID_SYMBOL;\n        };\n        /**\n         * Returns a new Symbol of the given type.\n         *\n         * @private\n         */\n        Solver.prototype._makeSymbol = function (type) {\n            return new Symbol(type, this._idTick++);\n        };\n        return Solver;\n    })();\n    kiwi.Solver = Solver;\n    /**\n     * Test whether a value is approximately zero.\n     * @private\n     */\n    function nearZero(value) {\n        var eps = 1.0e-8;\n        return value < 0.0 ? -value < eps : value < eps;\n    }\n    /**\n     * An internal function for creating a constraint map.\n     * @private\n     */\n    function createCnMap() {\n        return kiwi.createMap(kiwi.Constraint.Compare);\n    }\n    /**\n     * An internal function for creating a row map.\n     * @private\n     */\n    function createRowMap() {\n        return kiwi.createMap(Symbol.Compare);\n    }\n    /**\n     * An internal function for creating a variable map.\n     * @private\n     */\n    function createVarMap() {\n        return kiwi.createMap(kiwi.Variable.Compare);\n    }\n    /**\n     * An internal function for creating an edit map.\n     * @private\n     */\n    function createEditMap() {\n        return kiwi.createMap(kiwi.Variable.Compare);\n    }\n    /**\n     * An enum defining the available symbol types.\n     * @private\n     */\n    var SymbolType;\n    (function (SymbolType) {\n        SymbolType[SymbolType[\"Invalid\"] = 0] = \"Invalid\";\n        SymbolType[SymbolType[\"External\"] = 1] = \"External\";\n        SymbolType[SymbolType[\"Slack\"] = 2] = \"Slack\";\n        SymbolType[SymbolType[\"Error\"] = 3] = \"Error\";\n        SymbolType[SymbolType[\"Dummy\"] = 4] = \"Dummy\";\n    })(SymbolType || (SymbolType = {}));\n    /**\n     * An internal class representing a symbol in the solver.\n     * @private\n     */\n    var Symbol = (function () {\n        /**\n         * Construct a new Symbol\n         *\n         * @param [type] The type of the symbol.\n         * @param [id] The unique id number of the symbol.\n         */\n        function Symbol(type, id) {\n            this._id = id;\n            this._type = type;\n        }\n        /**\n         * The static Symbol comparison function.\n         */\n        Symbol.Compare = function (a, b) {\n            return a.id() - b.id();\n        };\n        /**\n         * Returns the unique id number of the symbol.\n         */\n        Symbol.prototype.id = function () {\n            return this._id;\n        };\n        /**\n         * Returns the type of the symbol.\n         */\n        Symbol.prototype.type = function () {\n            return this._type;\n        };\n        return Symbol;\n    })();\n    /**\n     * A static invalid symbol\n     * @private\n     */\n    var INVALID_SYMBOL = new Symbol(0 /* Invalid */, -1);\n    /**\n     * An internal row class used by the solver.\n     * @private\n     */\n    var Row = (function () {\n        /**\n         * Construct a new Row.\n         */\n        function Row(constant) {\n            if (constant === void 0) { constant = 0.0; }\n            this._cellMap = kiwi.createMap(Symbol.Compare);\n            this._constant = constant;\n        }\n        /**\n         * Returns the mapping of symbols to coefficients.\n         */\n        Row.prototype.cells = function () {\n            return this._cellMap;\n        };\n        /**\n         * Returns the constant for the row.\n         */\n        Row.prototype.constant = function () {\n            return this._constant;\n        };\n        /**\n         * Returns true if the row is a constant value.\n         */\n        Row.prototype.isConstant = function () {\n            return this._cellMap.empty();\n        };\n        /**\n         * Returns true if the Row has all dummy symbols.\n         */\n        Row.prototype.allDummies = function () {\n            var cells = this._cellMap;\n            for (var i = 0, n = cells.size(); i < n; ++i) {\n                var pair = cells.itemAt(i);\n                if (pair.first.type() !== 4 /* Dummy */) {\n                    return false;\n                }\n            }\n            return true;\n        };\n        /**\n         * Create a copy of the row.\n         */\n        Row.prototype.copy = function () {\n            var theCopy = new Row(this._constant);\n            theCopy._cellMap = this._cellMap.copy();\n            return theCopy;\n        };\n        /**\n         * Add a constant value to the row constant.\n         *\n         * Returns the new value of the constant.\n         */\n        Row.prototype.add = function (value) {\n            return this._constant += value;\n        };\n        /**\n         * Insert the symbol into the row with the given coefficient.\n         *\n         * If the symbol already exists in the row, the coefficient\n         * will be added to the existing coefficient. If the resulting\n         * coefficient is zero, the symbol will be removed from the row.\n         */\n        Row.prototype.insertSymbol = function (symbol, coefficient) {\n            if (coefficient === void 0) { coefficient = 1.0; }\n            var pair = this._cellMap.setDefault(symbol, function () { return 0.0; });\n            if (nearZero(pair.second += coefficient)) {\n                this._cellMap.erase(symbol);\n            }\n        };\n        /**\n         * Insert a row into this row with a given coefficient.\n         *\n         * The constant and the cells of the other row will be\n         * multiplied by the coefficient and added to this row. Any\n         * cell with a resulting coefficient of zero will be removed\n         * from the row.\n         */\n        Row.prototype.insertRow = function (other, coefficient) {\n            if (coefficient === void 0) { coefficient = 1.0; }\n            this._constant += other._constant * coefficient;\n            var cells = other._cellMap;\n            for (var i = 0, n = cells.size(); i < n; ++i) {\n                var pair = cells.itemAt(i);\n                this.insertSymbol(pair.first, pair.second * coefficient);\n            }\n        };\n        /**\n         * Remove a symbol from the row.\n         */\n        Row.prototype.removeSymbol = function (symbol) {\n            this._cellMap.erase(symbol);\n        };\n        /**\n         * Reverse the sign of the constant and cells in the row.\n         */\n        Row.prototype.reverseSign = function () {\n            this._constant = -this._constant;\n            var cells = this._cellMap;\n            for (var i = 0, n = cells.size(); i < n; ++i) {\n                var pair = cells.itemAt(i);\n                pair.second = -pair.second;\n            }\n        };\n        /**\n         * Solve the row for the given symbol.\n         *\n         * This method assumes the row is of the form\n         * a * x + b * y + c = 0 and (assuming solve for x) will modify\n         * the row to represent the right hand side of\n         * x = -b/a * y - c / a. The target symbol will be removed from\n         * the row, and the constant and other cells will be multiplied\n         * by the negative inverse of the target coefficient.\n         *\n         * The given symbol *must* exist in the row.\n         */\n        Row.prototype.solveFor = function (symbol) {\n            var cells = this._cellMap;\n            var pair = cells.erase(symbol);\n            var coeff = -1.0 / pair.second;\n            this._constant *= coeff;\n            for (var i = 0, n = cells.size(); i < n; ++i) {\n                cells.itemAt(i).second *= coeff;\n            }\n        };\n        /**\n         * Solve the row for the given symbols.\n         *\n         * This method assumes the row is of the form\n         * x = b * y + c and will solve the row such that\n         * y = x / b - c / b. The rhs symbol will be removed from the\n         * row, the lhs added, and the result divided by the negative\n         * inverse of the rhs coefficient.\n         *\n         * The lhs symbol *must not* exist in the row, and the rhs\n         * symbol must* exist in the row.\n         */\n        Row.prototype.solveForEx = function (lhs, rhs) {\n            this.insertSymbol(lhs, -1.0);\n            this.solveFor(rhs);\n        };\n        /**\n         * Returns the coefficient for the given symbol.\n         */\n        Row.prototype.coefficientFor = function (symbol) {\n            var pair = this._cellMap.find(symbol);\n            return pair !== undefined ? pair.second : 0.0;\n        };\n        /**\n         * Substitute a symbol with the data from another row.\n         *\n         * Given a row of the form a * x + b and a substitution of the\n         * form x = 3 * y + c the row will be updated to reflect the\n         * expression 3 * a * y + a * c + b.\n         *\n         * If the symbol does not exist in the row, this is a no-op.\n         */\n        Row.prototype.substitute = function (symbol, row) {\n            var pair = this._cellMap.erase(symbol);\n            if (pair !== undefined) {\n                this.insertRow(row, pair.second);\n            }\n        };\n        return Row;\n    })();\n})(kiwi || (kiwi = {}));\n/*-----------------------------------------------------------------------------\n| Copyright (c) 2014, Nucleic Development Team.\n|\n| Distributed under the terms of the Modified BSD License.\n|\n| The full license is in the file COPYING.txt, distributed with this software.\n|----------------------------------------------------------------------------*/\n/// <reference path=\"constraint.ts\"/>\n/// <reference path=\"expression.ts\"/>\n/// <reference path=\"maptype.ts\"/>\n/// <reference path=\"solver.ts\"/>\n/// <reference path=\"strength.ts\"/>\n/// <reference path=\"variable.ts\"/>\n\nreturn kiwi;\n\n}));\n\n},{}]},{},[1])(1)\n});\n\n\n/*****************\n ** WEBPACK FOOTER\n ** /Users/hein/repos/autolayout/autolayout.js/dist/autolayout.kiwi.js\n ** module id = 51\n ** module chunks = 0\n **/","import View from 'famous/core/View';\nimport LayoutController from 'famous-flex/LayoutController';\nimport vflToLayout from '../vflToLayout';\nimport TabBarController from 'famous-flex/widgets/TabBarController';\nimport EditorView from './EditorView';\nimport SettingsView from './SettingsView';\n\nfunction getParameterByName(name) {\n    name = name.replace(/[\\[]/, '\\\\[').replace(/[\\]]/, '\\\\]');\n    var regex = new RegExp('[\\\\?&]' + name + '=([^&#]*)');\n    var results = regex.exec(location.search);\n    return results === null ? '' : decodeURIComponent(results[1].replace(/\\+/g, ' '));\n}\n\nclass InputView extends View {\n    constructor(options) {\n        super(options);\n\n        this.tabBarController = new TabBarController({\n            tabBarSize: 44,\n            tabBarPosition: TabBarController.Position.TOP,\n            tabBar: {\n                createRenderables: {\n                    selectedItemOverlay: true\n                }\n            }\n        });\n\n        this.editor = new EditorView();\n        this.settings = new SettingsView();\n\n        this.tabBarController.setItems([\n            {tabItem: 'Visual Format', view: this.editor},\n            {tabItem: 'Settings', view: this.settings}\n        ]);\n\n        this.layout = new LayoutController({\n            layout: vflToLayout(`\n                |[content]|\n                V:|[content]|\n            `),\n            dataSource: {\n                content: parseInt(getParameterByName('settings') || '1') ? this.tabBarController : this.editor\n            }\n        });\n\n        this.add(this.layout);\n    }\n}\n\nexport {InputView as default};\n\n\n\n/** WEBPACK FOOTER **\n ** ./views/InputView.js\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2015\n */\n\n/**\n * TabBarController.\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var View = require('famous/core/View');\n    var AnimationController = require('../AnimationController');\n    var TabBar = require('./TabBar');\n    var LayoutDockHelper = require('../helpers/LayoutDockHelper');\n    var LayoutController = require('../LayoutController');\n    var Easing = require('famous/transitions/Easing');\n\n    /**\n     * @class\n     * @param {Object} options Configurable options.\n     * @param {TabBarController.Position} [options.tabBarPosition] Position (default: BOTTOM).\n     * @param {Number} [options.tabBarSize] Size of the tabBar (default: 50).\n     * @param {Number} [options.tabBarZIndex] Z-index the tabBar is put above the content (AnimationController) (default: 10).\n     * @param {Object} [options.tabBar] Options that are passed to the TabBar.\n     * @param {Object} [options.animationController] Options that are passed to the AnimationController.\n     * @alias module:TabBarController\n     */\n    function TabBarController(options) {\n        View.apply(this, arguments);\n\n        _createRenderables.call(this);\n        _createLayout.call(this);\n        _setListeners.call(this);\n\n        this.tabBar.setOptions({\n            layoutController: {\n                direction: ((this.options.tabBarPosition === TabBarController.Position.TOP) || (this.options.tabBarPosition === TabBarController.Position.BOTTOM)) ? 0 : 1\n            }\n        });\n    }\n    TabBarController.prototype = Object.create(View.prototype);\n    TabBarController.prototype.constructor = TabBarController;\n\n    TabBarController.Position = {\n        TOP: 0,\n        BOTTOM: 1,\n        LEFT: 2,\n        RIGHT: 3\n    };\n\n    /**\n     * Default layout-function for the TabBarController. Supports simple\n     * docking to any of the four edges.\n     */\n    TabBarController.DEFAULT_LAYOUT = function(context, options) {\n        var dock = new LayoutDockHelper(context, options);\n        switch (this.options.tabBarPosition) {\n            case TabBarController.Position.TOP:\n                dock.top('tabBar', this.options.tabBarSize, this.options.tabBarZIndex);\n                break;\n            case TabBarController.Position.BOTTOM:\n                dock.bottom('tabBar', this.options.tabBarSize, this.options.tabBarZIndex);\n                break;\n            case TabBarController.Position.LEFT:\n                dock.left('tabBar', this.options.tabBarSize, this.options.tabBarZIndex);\n                break;\n            case TabBarController.Position.RIGHT:\n                dock.right('tabBar', this.options.tabBarSize, this.options.tabBarZIndex);\n                break;\n        }\n        dock.fill('content');\n    };\n\n    TabBarController.DEFAULT_OPTIONS = {\n        tabBarPosition: TabBarController.Position.BOTTOM,\n        tabBarSize: 50,\n        tabBarZIndex: 10,\n        tabBar: {\n            createRenderables: {\n                background: true\n            }\n        },\n        animationController: {\n            transition: {duration: 300, curve: Easing.inOutQuad},\n            animation: AnimationController.Animation.FadedZoom\n        }\n    };\n\n    /**\n     * Creates the renderables (tabBar, animationController).\n     */\n    function _createRenderables() {\n        this.tabBar = new TabBar(this.options.tabBar);\n        this.animationController = new AnimationController(this.options.animationController);\n        this._renderables = {\n            tabBar: this.tabBar,\n            content: this.animationController\n        };\n    }\n\n    /**\n     * Creates the outer (header-footer) layout.\n     */\n    function _createLayout() {\n        this.layout = new LayoutController(this.options.layoutController);\n        this.layout.setLayout(TabBarController.DEFAULT_LAYOUT.bind(this));\n        this.layout.setDataSource(this._renderables);\n        this.add(this.layout);\n    }\n\n    /**\n     * Sets the listeners.\n     */\n    function _setListeners() {\n        this.tabBar.on('tabchange', function(event) {\n            _updateView.call(this, event);\n            this._eventOutput.emit('tabchange', {\n                target: this,\n                index: event.index,\n                oldIndex: event.oldIndex,\n                item: this._items[event.index],\n                oldItem: ((event.oldIndex >= 0) && (event.oldIndex < this._items.length)) ? this._items[event.oldIndex] : undefined\n            });\n        }.bind(this));\n    }\n\n    /**\n     * Updates the view-container with the selected view.\n     */\n    function _updateView(event) {\n        var index = this.tabBar.getSelectedItemIndex();\n        this.animationController.halt();\n        if (index >= 0) {\n            this.animationController.show(this._items[index].view);\n        }\n        else {\n            this.animationController.hide();\n        }\n    }\n\n    /**\n     * Patches the TabBarController instance's options with the passed-in ones.\n     *\n     * @param {Object} options Configurable options.\n     * @param {TabBarController.Position} [options.tabBarPosition] Position (default: BOTTOM).\n     * @param {Number} [options.tabBarSize] Size of the tabBar (default: 50).\n     * @param {Number} [options.tabBarZIndex] Z-index the tabBar is put above the content (AnimationController) (default: 10).\n     * @param {Object} [options.tabBar] Options that are passed to the TabBar.\n     * @param {Object} [options.animationController] Options that are passed to the AnimationController.\n     * @return {TabBarController} this\n     */\n    TabBarController.prototype.setOptions = function(options) {\n        View.prototype.setOptions.call(this, options);\n        if (this.layout && options.layoutController) {\n            this.layout.setOptions(options.layoutController);\n        }\n        if (this.tabBar && options.tabBar) {\n            this.tabBar.setOptions(options.tabBar);\n        }\n        if (this.animationController && options.animationController) {\n            this.animationController(options.animationController);\n        }\n        if (this.layout && (options.tabBarPosition !== undefined)) {\n            this.tabBar.setOptions({\n                layoutController: {\n                    direction: ((options.tabBarPosition === TabBarController.Position.TOP) || (options.tabBarPosition === TabBarController.Position.BOTTOM)) ? 0 : 1\n                }\n            });\n        }\n        if (this.layout) {\n            this.layout.reflowLayout();\n        }\n        return this;\n    };\n\n    /**\n     * Sets the items for the tab-bar controller.\n     *\n     * Example 1:\n     *\n     * ```javascript\n     * var tabBarController = new TabBarController();\n     * tabBarController.setItems([\n     *   {tabItem: 'Profile', view: new ProfileView()},\n     *   {tabItem: 'Map', view: new MapView()},\n     *   {tabItem: 'Login', view: new LoginView()}\n     *   {tabItem: 'Settings', view: new SettingsView()}\n     * ]);\n     *```\n     *\n     * @param {Array} items Array of tab-bar controller items.\n     * @return {TabBarController} this\n     */\n    TabBarController.prototype.setItems = function(items) {\n        this._items = items;\n        var tabItems = [];\n        for (var i = 0; i < items.length; i++) {\n            tabItems.push(items[i].tabItem);\n        }\n        this.tabBar.setItems(tabItems);\n        _updateView.call(this);\n        return this;\n    };\n\n    /**\n     * Get the tab-items (also see `setItems`).\n     *\n     * @return {Array} tab-items\n     */\n    TabBarController.prototype.getItems = function() {\n        return this._items;\n    };\n\n    /**\n     * Sets the index of the selected tab.\n     *\n     * @param {Number} index selected index.\n     * @return {TabBar} this\n     */\n    TabBarController.prototype.setSelectedItemIndex = function(index) {\n        this.tabBar.setSelectedItemIndex(index);\n        return this;\n    };\n\n    /**\n     * Get the index of the selected tab-item.\n     *\n     * @return {Number} selected index\n     */\n    TabBarController.prototype.getSelectedItemIndex = function() {\n        return this.tabBar.getSelectedItemIndex();\n    };\n\n    module.exports = TabBarController;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/widgets/TabBarController.js\n ** module id = 53\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar EventHandler = require('./EventHandler');\nvar OptionsManager = require('./OptionsManager');\nvar RenderNode = require('./RenderNode');\nvar Utility = require('../utilities/Utility');\nfunction View(options) {\n    this._node = new RenderNode();\n    this._eventInput = new EventHandler();\n    this._eventOutput = new EventHandler();\n    EventHandler.setInputHandler(this, this._eventInput);\n    EventHandler.setOutputHandler(this, this._eventOutput);\n    this.options = Utility.clone(this.constructor.DEFAULT_OPTIONS || View.DEFAULT_OPTIONS);\n    this._optionsManager = new OptionsManager(this.options);\n    if (options)\n        this.setOptions(options);\n}\nView.DEFAULT_OPTIONS = {};\nView.prototype.getOptions = function getOptions(key) {\n    return this._optionsManager.getOptions(key);\n};\nView.prototype.setOptions = function setOptions(options) {\n    this._optionsManager.patch(options);\n};\nView.prototype.add = function add() {\n    return this._node.add.apply(this._node, arguments);\n};\nView.prototype._add = View.prototype.add;\nView.prototype.render = function render() {\n    return this._node.render();\n};\nView.prototype.getSize = function getSize() {\n    if (this._node && this._node.getSize) {\n        return this._node.getSize.apply(this._node, arguments) || this.options.size;\n    } else\n        return this.options.size;\n};\nmodule.exports = View;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/View.js\n ** module id = 54\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2015\n */\n\n/**\n * Animating between famo.us views in awesome ways.\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var View = require('famous/core/View');\n    var LayoutController = require('./LayoutController');\n    var Transform = require('famous/core/Transform');\n    var Modifier = require('famous/core/Modifier');\n    var StateModifier = require('famous/modifiers/StateModifier');\n    var RenderNode = require('famous/core/RenderNode');\n    var Timer = require('famous/utilities/Timer');\n    var Easing = require('famous/transitions/Easing');\n\n    /**\n     * @class\n     * @param {Object} [options] Configurable options.\n     * @param {Object} [options.transition] Transition options (default: `{duration: 400, curve: Easing.inOutQuad}`).\n     * @param {Function} [options.animation] Animation function (default: `AnimationController.Animation.Slide.Left`).\n     * @param {Number} [options.zIndexOffset] Optional z-index difference between the hiding & showing renderable (default: 0).\n     * @param {Number} [options.keepHiddenViewsInDOMCount] Keeps views in the DOM after they have been hidden (default: 0).\n     * @param {Object} [options.show] Show specific options.\n     * @param {Object} [options.show.transition] Show specific transition options.\n     * @param {Function} [options.show.animation] Show specific animation function.\n     * @param {Object} [options.hide] Hide specific options.\n     * @param {Object} [options.hide.transition] Hide specific transition options.\n     * @param {Function} [options.hide.animation] Hide specific animation function.\n     * @param {Object} [options.transfer] Transfer options.\n     * @param {Object} [options.transfer.transition] Transfer specific transition options.\n     * @param {Number} [options.transfer.zIndex] Z-index the tranferables are moved on top while animating (default: 10).\n     * @param {Bool} [options.transfer.fastResize] When enabled, scales the renderable i.s.o. resizing when doing the transfer animation (default: true).\n     * @param {Array} [options.transfer.items] Ids (key/value) pairs (source-id/target-id) of the renderables that should be transferred.\n     * @alias module:AnimationController\n     */\n    function AnimationController(options) {\n        View.apply(this, arguments);\n\n        this._size = [0, 0];\n        _createLayout.call(this);\n\n        if (options) {\n            this.setOptions(options);\n        }\n    }\n    AnimationController.prototype = Object.create(View.prototype);\n    AnimationController.prototype.constructor = AnimationController;\n\n    /**\n     * Out of the box supported animations.\n     */\n    AnimationController.Animation = {\n        Slide: {\n            Left: function(show, size) {\n                return {transform: Transform.translate(show ? size[0] : -size[0], 0, 0)};\n            },\n            Right: function(show, size) {\n                return {transform: Transform.translate(show ? -size[0] : size[0], 0, 0)};\n            },\n            Up: function(show, size) {\n                return {transform: Transform.translate(0, show ? size[1] : -size[1], 0)};\n            },\n            Down: function(show, size) {\n                return {transform: Transform.translate(0, show ? -size[1] : size[1], 0)};\n            }\n        },\n        Fade: function(show, size) {\n            return {\n                opacity: (this && (this.opacity !== undefined)) ? this.opacity : 0\n            };\n        },\n        Zoom: function(show, size) {\n            var scale = (this && (this.scale !== undefined)) ? this.scale : 0.5;\n            return {\n                transform: Transform.scale(scale, scale, 1),\n                align: [0.5, 0.5],\n                origin: [0.5, 0.5]\n            };\n        },\n        FadedZoom: function(show, size) {\n            var scale = show ? ((this && (this.showScale !== undefined)) ? this.showScale : 0.9) : ((this && (this.hideScale !== undefined)) ? this.hideScale : 1.1);\n            return {\n                opacity: (this && (this.opacity !== undefined)) ? this.opacity : 0,\n                transform: Transform.scale(scale, scale, 1),\n                align: [0.5, 0.5],\n                origin: [0.5, 0.5]\n            };\n        }\n        /*,\n        Flip: {\n            Left: function(show, size) {\n                return {transform: Transform.rotate(0, show ? Math.PI : -Math.PI, 0)};\n            },\n            Right: function(show, size) {\n                return {transform: Transform.rotate(0, show ? -Math.PI : Math.PI, 0)};\n            },\n            Up: function(show, size) {\n                return {transform: Transform.rotate(show ? Math.PI : -Math.PI, 0, 0)};\n            },\n            Down: function(show, size) {\n                return {transform: Transform.rotate(show ? -Math.PI : Math.PI, 0, 0)};\n            }\n        }*/\n    };\n\n    AnimationController.DEFAULT_OPTIONS = {\n        transition: {duration: 400, curve: Easing.inOutQuad},\n        animation: AnimationController.Animation.Fade,\n        show: {\n            // transition,\n            // animation\n        },\n        hide: {\n            // transition,\n            // animation\n        },\n        transfer: {\n            fastResize: true,\n            zIndex: 10 // z-index offset the items are translated while transferring\n            // transition,\n            // items: {\n            //   'image': 'image'\n            //   'image': ['image', 'image2']\n            // }\n        },\n        zIndexOffset: 0,\n        keepHiddenViewsInDOMCount: 0\n    };\n\n    var ItemState = {\n        NONE: 0,\n        HIDE: 1,\n        HIDING: 2,\n        HIDDEN: 3,\n        SHOW: 4,\n        SHOWING: 5,\n        VISIBLE: 6,\n        QUEUED: 7\n    };\n\n    /**\n     * Stacks the renderables on top of each other\n     * with a z-translation of this.options.zIndexOffset.\n     */\n    function ViewStackLayout(context, options) {\n        var set = {\n            size: context.size,\n            translate: [0, 0, 0]\n        };\n        this._size[0] = context.size[0];\n        this._size[1] = context.size[1];\n        var views = context.get('views');\n        var transferables = context.get('transferables');\n        var visibleCount = 0;\n        for (var i = 0; i < views.length; i++) {\n            var item = this._viewStack[i];\n            switch (item.state) {\n                case ItemState.HIDDEN:\n                    context.set(views[i], {\n                        size: context.size,\n                        translate: [context.size[0] * 2, context.size[1] * 2, 0]\n                    });\n                    break;\n\n                case ItemState.HIDE:\n                case ItemState.HIDING:\n                case ItemState.VISIBLE:\n                case ItemState.SHOW:\n                case ItemState.SHOWING:\n                    if (visibleCount < 2) {\n                        visibleCount++;\n\n                        // Layout view\n                        var view = views[i];\n                        context.set(view, set);\n\n                        // Layout any transferables\n                        for (var j = 0; j < transferables.length; j++) {\n                            for (var k = 0; k < item.transferables.length; k++) {\n                                if (transferables[j].renderNode === item.transferables[k].renderNode) {\n                                    context.set(transferables[j], {\n                                        translate: [0, 0, set.translate[2]],\n                                        size: [context.size[0], context.size[1]]\n                                    });\n                                }\n                            }\n                        }\n\n                        // Increase z-index for next view\n                        set.translate[2] += options.zIndexOffset;\n                    }\n                    break;\n            }\n        }\n    }\n\n    /**\n     * Creates the view-stack layout.\n     */\n    function _createLayout() {\n        this._renderables = {\n            views: [],\n            transferables: []\n        };\n        this._viewStack = [];\n        this.layout = new LayoutController({\n            layout: ViewStackLayout.bind(this),\n            layoutOptions: this.options,\n            dataSource: this._renderables\n        });\n        this.add(this.layout);\n        this.layout.on('layoutend', _processAnimations.bind(this));\n    }\n\n    /**\n     * Gets the spec from a spec.\n     */\n    function _getViewSpec(item, view, id, callback) {\n        if (!item.view) {\n            return;\n        }\n        var spec = view.getSpec(id);\n        if (spec && !spec.trueSizeRequested) {\n            callback(spec);\n        }\n        else {\n            Timer.after(_getViewSpec.bind(this, item, view, id, callback), 1);\n        }\n    }\n\n    /**\n     * Gets the transferable delegate for the given id.\n     */\n    function _getTransferable(item, view, id) {\n        // 1. If view supports getTransferable, use that\n        if (view.getTransferable) {\n            return view.getTransferable(id);\n        }\n        // 2. If view is derived from layoutcontroller, use that\n        if (view.getSpec && view.get && view.replace) {\n            if (view.get(id) !== undefined) {\n                return {\n                    get: function() {\n                        return view.get(id);\n                    },\n                    show: function(renderable) {\n                        view.replace(id, renderable);\n                    },\n                    getSpec: _getViewSpec.bind(this, item, view, id)\n                };\n            }\n        }\n        // 3. If view has an embedded layout, use that as fallback\n        if (view.layout) {\n            return _getTransferable.call(this, item, view.layout, id);\n        }\n    }\n\n    /**\n     * Begins visual transfer or renderables from the previous item\n     * to the new item.\n     */\n    function _initTransferableAnimations(item, prevItem, callback) {\n        var callbackCount = 0;\n        function waitForAll() {\n            callbackCount--;\n            if (callbackCount === 0) {\n                callback();\n            }\n        }\n        for (var sourceId in item.options.transfer.items) {\n            if (_initTransferableAnimation.call(this, item, prevItem, sourceId, waitForAll)) {\n                callbackCount++;\n            }\n        }\n        if (!callbackCount) {\n            callback();\n        }\n    }\n    function _initTransferableAnimation(item, prevItem, sourceId, callback) {\n        var target = item.options.transfer.items[sourceId];\n        var transferable = {};\n        transferable.source = _getTransferable.call(this, prevItem, prevItem.view, sourceId);\n        if (Array.isArray(target)) {\n            for (var i = 0; i < target.length; i++) {\n                transferable.target = _getTransferable.call(this, item, item.view, target[i]);\n                if (transferable.target) {\n                    break;\n                }\n            }\n        }\n        else {\n            transferable.target = _getTransferable.call(this, item, item.view, target);\n        }\n        if (transferable.source && transferable.target) {\n            transferable.source.getSpec(function(sourceSpec) {\n\n                // Replace source & target renderables in the views\n                // source: dummy-node\n                // target: target-renderable with opacity: 0.\n                transferable.sourceSpec = sourceSpec;\n                transferable.originalSource = transferable.source.get();\n                transferable.source.show(new RenderNode(new Modifier(sourceSpec)));\n                transferable.originalTarget = transferable.target.get();\n                var targetNode = new RenderNode(new Modifier({opacity: 0}));\n                targetNode.add(transferable.originalTarget);\n                transferable.target.show(targetNode);\n\n                // Take ownership of the source renderable.\n                // This renderable will be layouted by the layout-function\n                var zIndexMod = new Modifier({\n                    transform: Transform.translate(0, 0, item.options.transfer.zIndex)\n                });\n                transferable.mod = new StateModifier(sourceSpec);\n                transferable.renderNode = new RenderNode(zIndexMod);\n                transferable.renderNode.add(transferable.mod).add(transferable.originalSource);\n                item.transferables.push(transferable);\n                this._renderables.transferables.push(transferable.renderNode);\n                this.layout.reflowLayout();\n\n                // Wait for the target spec to have settled. This may take a couple render\n                // cycles if for instance, this involves a true-size renderable or the\n                // renderable is affected by other true-size renderables around itsself.\n                Timer.after(function() {\n                    var callbackCalled;\n                    transferable.target.getSpec(function(targetSpec, transition) {\n                        transferable.targetSpec = targetSpec;\n                        transferable.transition = transition;\n                        if (!callbackCalled) {\n                            callback();\n                        }\n                    }, true);\n                }, 1);\n            }.bind(this), false);\n            return true;\n        }\n        else {\n            return false;\n        }\n    }\n    function _startTransferableAnimations(item, callback) {\n        for (var j = 0; j < item.transferables.length; j++) {\n            var transferable = item.transferables[j];\n            transferable.mod.halt();\n            if ((transferable.sourceSpec.opacity !== undefined) || (transferable.targetSpec.opacity !== undefined)) {\n                transferable.mod.setOpacity((transferable.targetSpec.opacity === undefined) ? 1 : transferable.targetSpec.opacity, transferable.transition || item.options.transfer.transition);\n            }\n            if (item.options.transfer.fastResize) {\n                if (transferable.sourceSpec.transform || transferable.targetSpec.transform || transferable.sourceSpec.size || transferable.targetSpec.size) {\n                    var transform = transferable.targetSpec.transform || Transform.identity;\n                    if (transferable.sourceSpec.size && transferable.targetSpec.size) {\n                        transform = Transform.multiply(transform, Transform.scale(transferable.targetSpec.size[0] / transferable.sourceSpec.size[0], transferable.targetSpec.size[1] / transferable.sourceSpec.size[1], 1));\n                    }\n                    transferable.mod.setTransform(transform, transferable.transition || item.options.transfer.transition, callback);\n                    callback = undefined;\n                }\n            }\n            else {\n                if (transferable.sourceSpec.transform || transferable.targetSpec.transform) {\n                    transferable.mod.setTransform(transferable.targetSpec.transform || Transform.identity, transferable.transition || item.options.transfer.transition, callback);\n                    callback = undefined;\n                }\n                if (transferable.sourceSpec.size || transferable.targetSpec.size) {\n                    transferable.mod.setSize(transferable.targetSpec.size || transferable.sourceSpec.size, transferable.transition || item.options.transfer.transition, callback);\n                    callback = undefined;\n                }\n            }\n        }\n        if (callback) {\n            callback();\n        }\n    }\n\n    /**\n     * Called whenever the view has been shown and the\n     * transferable animations should be ended. This returns\n     * the renderables to their original views.\n     */\n    function _endTransferableAnimations(item) {\n        for (var j = 0; j < item.transferables.length; j++) {\n            var transferable = item.transferables[j];\n            for (var i = 0; i < this._renderables.transferables.length; i++) {\n                if (this._renderables.transferables[i] === transferable.renderNode) {\n                    this._renderables.transferables.splice(i, 1);\n                    break;\n                }\n            }\n            transferable.source.show(transferable.originalSource);\n            transferable.target.show(transferable.originalTarget);\n        }\n        item.transferables = [];\n        this.layout.reflowLayout();\n    }\n\n    /**\n     * Starts a show or hide animation.\n     */\n    function _processAnimations(event) {\n        var prevItem;\n        for (var i = 0; i < this._viewStack.length; i++) {\n            var item = this._viewStack[i];\n            switch (item.state) {\n                case ItemState.HIDE:\n                    item.state = ItemState.HIDING;\n                    _initHideAnimation.call(this, item, prevItem, event.size);\n                    _updateState.call(this);\n                    break;\n                case ItemState.SHOW:\n                    item.state = ItemState.SHOWING;\n                    _initShowAnimation.call(this, item, prevItem, event.size);\n                    _updateState.call(this);\n                    break;\n            }\n            prevItem = item;\n        }\n    }\n\n    /**\n     * Starts the view animation.\n     */\n    function _initShowAnimation(item, prevItem, size) {\n        var spec = item.options.show.animation ? item.options.show.animation.call(undefined, true, size) : {};\n        item.startSpec = spec;\n        item.endSpec = {\n            opacity: 1,\n            transform: Transform.identity\n        };\n        item.mod.halt();\n        if (spec.transform) {\n            item.mod.setTransform(spec.transform);\n        }\n        if (spec.opacity !== undefined) {\n            item.mod.setOpacity(spec.opacity);\n        }\n        if (spec.align) {\n            item.mod.setAlign(spec.align);\n        }\n        if (spec.origin) {\n            item.mod.setOrigin(spec.origin);\n        }\n        var startShowAnimation = _startShowAnimation.bind(this, item, spec);\n        var waitAndShow = item.wait ? function() {\n            item.wait.then(startShowAnimation, startShowAnimation);\n        } : startShowAnimation;\n        if (prevItem) {\n            _initTransferableAnimations.call(this, item, prevItem, waitAndShow);\n        }\n        else {\n            waitAndShow();\n        }\n    }\n\n    /**\n     * Starts the show animation whenever init has completed.\n     */\n    function _startShowAnimation(item, spec) {\n        if (!item.halted) {\n            var callback = item.showCallback;\n            if (spec.transform) {\n                item.mod.setTransform(Transform.identity, item.options.show.transition, callback);\n                callback = undefined;\n            }\n            if (spec.opacity !== undefined) {\n                item.mod.setOpacity(1, item.options.show.transition, callback);\n                callback = undefined;\n            }\n            _startTransferableAnimations.call(this, item, callback);\n        }\n    }\n\n    /**\n     * Helper function for interpolating between start/end state based on percentage.\n     */\n    function _interpolate(start, end, perc) {\n        return start + ((end - start) * perc);\n    }\n\n    /**\n     * Halts a item at a given frame. The frame is provided as a percentage\n     * of the whole transition.\n     */\n    function _haltItemAtFrame(item, perc) {\n        item.mod.halt();\n        item.halted = true;\n        if (item.startSpec && (perc !== undefined)) {\n            if ((item.startSpec.opacity !== undefined) && (item.endSpec.opacity !== undefined)) {\n                item.mod.setOpacity(_interpolate(item.startSpec.opacity, item.endSpec.opacity, perc));\n            }\n            if (item.startSpec.transform && item.endSpec.transform) {\n                var transform = [];\n                for (var i = 0; i < item.startSpec.transform.length; i++) {\n                    transform.push(_interpolate(item.startSpec.transform[i], item.endSpec.transform[i], perc));\n                }\n                item.mod.setTransform(transform);\n            }\n        }\n    }\n\n    /**\n     * Waits for the animation to start.\n     */\n    function _initHideAnimation(item, prevItem, size) {\n        var startHideAnimation = _startHideAnimation.bind(this, item, prevItem, size);\n        if (item.wait) {\n            item.wait.then(startHideAnimation, startHideAnimation);\n        }\n        else {\n            startHideAnimation();\n        }\n    }\n\n    /**\n     * Starts the hide animation.\n     */\n    function _startHideAnimation(item, prevItem, size) {\n        var spec = item.options.hide.animation ? item.options.hide.animation.call(undefined, false, size) : {};\n        item.endSpec = spec;\n        item.startSpec = {\n            opacity: 1,\n            transform: Transform.identity\n        };\n        if (!item.halted) {\n            item.mod.halt();\n            var callback = item.hideCallback;\n            if (spec.transform) {\n                item.mod.setTransform(spec.transform, item.options.hide.transition, callback);\n                callback = undefined;\n            }\n            if (spec.opacity !== undefined) {\n                item.mod.setOpacity(spec.opacity, item.options.hide.transition, callback);\n                callback = undefined;\n            }\n            if (callback) {\n                callback();\n            }\n        }\n    }\n\n    /**\n     * Sets the options for an item.\n     */\n    function _setItemOptions(item, options, callback) {\n        item.options = {\n            show: {\n                transition: this.options.show.transition || this.options.transition,\n                animation: this.options.show.animation || this.options.animation\n            },\n            hide: {\n                transition: this.options.hide.transition || this.options.transition,\n                animation: this.options.hide.animation || this.options.animation\n            },\n            transfer: {\n                transition: this.options.transfer.transition || this.options.transition,\n                items: this.options.transfer.items || {},\n                zIndex: this.options.transfer.zIndex,\n                fastResize: this.options.transfer.fastResize\n            }\n        };\n        if (options) {\n            item.options.show.transition = (options.show ? options.show.transition : undefined) || options.transition || item.options.show.transition;\n            if (options && options.show && (options.show.animation !== undefined)) {\n                item.options.show.animation = options.show.animation;\n            }\n            else if (options && (options.animation !== undefined)) {\n                item.options.show.animation = options.animation;\n            }\n            item.options.transfer.transition = (options.transfer ? options.transfer.transition : undefined) || options.transition || item.options.transfer.transition;\n            item.options.transfer.items = (options.transfer ? options.transfer.items : undefined) || item.options.transfer.items;\n            item.options.transfer.zIndex = (options.transfer && (options.transfer.zIndex !== undefined)) ? options.transfer.zIndex : item.options.transfer.zIndex;\n            item.options.transfer.fastResize = (options.transfer && (options.transfer.fastResize !== undefined)) ? options.transfer.fastResize : item.options.transfer.fastResize;\n        }\n        item.showCallback = function() {\n            item.showCallback = undefined;\n            item.state = ItemState.VISIBLE;\n            _updateState.call(this);\n            _endTransferableAnimations.call(this, item);\n            item.endSpec = undefined;\n            item.startSpec = undefined;\n            if (callback) {\n                callback();\n            }\n        }.bind(this);\n    }\n\n    /**\n     * Updates the state.\n     */\n    function _updateState() {\n        var prevItem;\n        var invalidated = false;\n        var hiddenViewCount = 0;\n        var i = 0;\n        while (i < this._viewStack.length) {\n            if (this._viewStack[i].state === ItemState.HIDDEN) {\n                hiddenViewCount++;\n                for (var j = 0; j < this._viewStack.length; j++) {\n                    if ((this._viewStack[j].state !== ItemState.HIDDEN) &&\n                        (this._viewStack[j].view === this._viewStack[i].view)) {\n                        this._viewStack[i].view = undefined;\n                        this._renderables.views.splice(i, 1);\n                        this._viewStack.splice(i, 1);\n                        i--;\n                        hiddenViewCount--;\n                        break;\n                    }\n                }\n            }\n            i++;\n        }\n        while (hiddenViewCount > this.options.keepHiddenViewsInDOMCount) {\n            this._viewStack[0].view = undefined;\n            this._renderables.views.splice(0, 1);\n            this._viewStack.splice(0, 1);\n            hiddenViewCount--;\n        }\n        for (i = hiddenViewCount; i < (Math.min(this._viewStack.length - hiddenViewCount, 2) + hiddenViewCount); i++) {\n            var item = this._viewStack[i];\n            if (item.state === ItemState.QUEUED) {\n                if (!prevItem ||\n                    (prevItem.state === ItemState.VISIBLE) ||\n                    (prevItem.state === ItemState.HIDING)) {\n                    if (prevItem && (prevItem.state === ItemState.VISIBLE)) {\n                        prevItem.state = ItemState.HIDE;\n                        prevItem.wait = item.wait;\n                    }\n                    item.state = ItemState.SHOW;\n                    invalidated = true;\n                }\n                break;\n            }\n            else if ((item.state === ItemState.VISIBLE) && item.hide) {\n                item.state = ItemState.HIDE;\n            }\n            if ((item.state === ItemState.SHOW) || (item.state === ItemState.HIDE)) {\n                this.layout.reflowLayout();\n            }\n            prevItem = item;\n        }\n        if (invalidated) {\n            _updateState.call(this);\n            this.layout.reflowLayout();\n        }\n    }\n\n    function _resume() {\n        for (var i = 0; i < Math.min(this._viewStack.length, 2); i++) {\n            var item = this._viewStack[i];\n            if (item.halted) {\n                item.halted = false;\n                if (item.endSpec) {\n                    var callback;\n                    switch (item.state) {\n                        case ItemState.HIDE:\n                        case ItemState.HIDING:\n                            callback = item.hideCallback;\n                            break;\n                        case ItemState.SHOW:\n                        case ItemState.SHOWING:\n                            callback = item.showCallback;\n                            break;\n                    }\n                    item.mod.halt();\n                    if (item.endSpec.transform) {\n                        item.mod.setTransform(item.endSpec.transform, item.options.show.transition, callback);\n                        callback = undefined;\n                    }\n                    if (item.endSpec.opacity !== undefined) {\n                        item.mod.setOpacity(item.endSpec.opacity, item.options.show.transition, callback);\n                    }\n                    if (callback) {\n                        callback();\n                    }\n                }\n            }\n        }\n    }\n\n    /**\n     * Shows a renderable using an animation and hides the old renderable.\n     *\n     * When multiple show operations are executed, they are queued and\n     * shown in that sequence. Use `.halt` to cancel any pending show\n     * operations from the queue.\n     *\n     * @param {Renderable} renderable View or surface to show\n     * @param {Object} [options] Options.\n     * @param {Object} [options.transition] Transition options for both show & hide.\n     * @param {Function} [options.animation] Animation function for both show & hide.\n     * @param {Promise} [options.wait] A promise to wait for before running the animation.\n     * @param {Object} [options.show] Show specific options.\n     * @param {Object} [options.show.transition] Show specific transition options.\n     * @param {Function} [options.show.animation] Show specific animation function.\n     * @param {Object} [options.hide] Hide specific options.\n     * @param {Object} [options.hide.transition] Hide specific transition options.\n     * @param {Function} [options.hide.animation] Hide specific animation function.\n     * @param {Object} [options.transfer] Transfer options.\n     * @param {Object} [options.transfer.transition] Transfer specific transition options.\n     * @param {Number} [options.transfer.zIndex] Z-index the tranferables are moved on top while animating.\n     * @param {Array} [options.transfer.items] Ids (key/value) pairs (source-id/target-id) of the renderables that should be transferred.\n     * @param {Function} [callback] Function that is called on completion.\n     * @return {AnimationController} this\n     */\n    AnimationController.prototype.show = function(renderable, options, callback) {\n        _resume.call(this, renderable);\n        if (!renderable) {\n            return this.hide(options, callback);\n        }\n        var item = this._viewStack.length ? this._viewStack[this._viewStack.length - 1] : undefined;\n        if (item && (item.view === renderable) && (item.state !== ItemState.HIDDEN)) {\n            item.hide = false;\n            if (item.state === ItemState.HIDE) {\n                item.state = ItemState.QUEUED;\n                _setItemOptions.call(this, item, options, callback);\n                _updateState.call(this);\n            }\n            else if (callback) {\n                callback();\n            }\n            return this;\n        }\n        if (item && (item.state !== ItemState.HIDING) && options) {\n            item.options.hide.transition = (options.hide ? options.hide.transition : undefined) || options.transition || item.options.hide.transition;\n            if (options && options.hide && (options.hide.animation !== undefined)) {\n                item.options.hide.animation = options.hide.animation;\n            }\n            else if (options && (options.animation !== undefined)) {\n                item.options.hide.animation = options.animation;\n            }\n        }\n        item = {\n            view: renderable,\n            mod: new StateModifier(),\n            state: ItemState.QUEUED,\n            callback: callback,\n            transferables: [], // renderables currently being transfered\n            wait: options ? options.wait : undefined\n        };\n        item.node = new RenderNode(item.mod);\n        item.node.add(renderable);\n        _setItemOptions.call(this, item, options, callback);\n        item.hideCallback = function() {\n            item.hideCallback = undefined;\n            item.state = ItemState.HIDDEN;\n            _updateState.call(this);\n            this.layout.reflowLayout();\n        }.bind(this);\n        this._renderables.views.push(item.node);\n        this._viewStack.push(item);\n        _updateState.call(this);\n        return this;\n    };\n\n    /**\n     * Hides the current view with an animation.\n     *\n     * @param {Object} [options] Hide options\n     * @param {Object} [options.transition] Hide transition options.\n     * @param {Function} [options.animation] Hide animation function.\n     * @param {Function} [callback] Function that is called an completion.\n     * @return {AnimationController} this\n     */\n    AnimationController.prototype.hide = function(options, callback) {\n        _resume.call(this);\n        var item = this._viewStack.length ? this._viewStack[this._viewStack.length - 1] : undefined;\n        if (!item || (item.state === ItemState.HIDING)) {\n            return this;\n        }\n        item.hide = true;\n        if (options) {\n            item.options.hide.transition = (options.hide ? options.hide.transition : undefined) || options.transition || item.options.hide.transition;\n            if (options && options.hide && (options.hide.animation !== undefined)) {\n                item.options.hide.animation = options.hide.animation;\n            }\n            else if (options && (options.animation !== undefined)) {\n                item.options.hide.animation = options.animation;\n            }\n        }\n        item.hideCallback = function() {\n            item.hideCallback = undefined;\n            item.state = ItemState.HIDDEN;\n            _updateState.call(this);\n            this.layout.reflowLayout();\n            if (callback) {\n                callback();\n            }\n        }.bind(this);\n        _updateState.call(this);\n        return this;\n    };\n\n    /**\n     * Clears the queue of any pending show animations.\n     *\n     * @param {Boolean} [stopAnimation] Freezes the current animation.\n     * @param {Number} [framePerc] Frame at which to freeze the animation (in percentage).\n     * @return {AnimationController} this\n     */\n    AnimationController.prototype.halt = function(stopAnimation, framePerc) {\n        var item;\n        for (var i = 0; i < this._viewStack.length; i++) {\n            if (stopAnimation) {\n                item = this._viewStack[i];\n                switch (item.state) {\n                    case ItemState.SHOW:\n                    case ItemState.SHOWING:\n                    case ItemState.HIDE:\n                    case ItemState.HIDING:\n                    case ItemState.VISIBLE:\n                        _haltItemAtFrame(item, framePerc);\n                        break;\n                }\n            }\n            else {\n                item = this._viewStack[this._viewStack.length - 1];\n                if ((item.state === ItemState.QUEUED) || (item.state === ItemState.SHOW)) {\n                    this._renderables.views.splice(this._viewStack.length - 1, 1);\n                    this._viewStack.splice(this._viewStack.length - 1, 1);\n                    item.view = undefined;\n                }\n                else {\n                    break;\n                }\n            }\n        }\n        return this;\n    };\n\n    /**\n     * Aborts the currently active show or hide operation, effectively\n     * reversing the animation.\n     *\n     * @param {Function} [callback] Function that is called on completion.\n     * @return {AnimationController} this\n     */\n    AnimationController.prototype.abort = function(callback) {\n        if ((this._viewStack.length >= 2) && (this._viewStack[0].state === ItemState.HIDING) && (this._viewStack[1].state === ItemState.SHOWING)) {\n            var prevItem = this._viewStack[0];\n            var item = this._viewStack[1];\n            var swapSpec;\n\n            item.halted = true;\n            swapSpec = item.endSpec;\n            item.endSpec = item.startSpec;\n            item.startSpec = swapSpec;\n            item.state = ItemState.HIDING;\n            item.hideCallback = function() {\n                item.hideCallback = undefined;\n                item.state = ItemState.HIDDEN;\n                _updateState.call(this);\n                this.layout.reflowLayout();\n            }.bind(this);\n\n            prevItem.halted = true;\n            swapSpec = prevItem.endSpec;\n            prevItem.endSpec = prevItem.startSpec;\n            prevItem.startSpec = swapSpec;\n            prevItem.state = ItemState.SHOWING;\n            prevItem.showCallback = function() {\n                prevItem.showCallback = undefined;\n                prevItem.state = ItemState.VISIBLE;\n                _updateState.call(this);\n                _endTransferableAnimations.call(this, prevItem);\n                prevItem.endSpec = undefined;\n                prevItem.startSpec = undefined;\n                if (callback) {\n                    callback();\n                }\n            }.bind(this);\n\n            _resume.call(this);\n        }\n        return this;\n    };\n\n    /**\n     * Gets the currently visible or being shown renderable.\n     *\n     * @return {Renderable} currently visible view/surface\n     */\n    AnimationController.prototype.get = function() {\n        for (var i = 0; i < this._viewStack.length; i++) {\n            var item = this._viewStack[i];\n            if ((item.state === ItemState.VISIBLE) ||\n                (item.state === ItemState.SHOW) ||\n                (item.state === ItemState.SHOWING)) {\n                return item.view;\n            }\n        }\n        return undefined;\n    };\n\n    /**\n     * Gets the size of the view.\n     *\n     * @return {Array.Number} size\n     */\n    AnimationController.prototype.getSize = function() {\n        return this._size || this.options.size;\n    };\n\n    module.exports = AnimationController;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/AnimationController.js\n ** module id = 55\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Modifier = require('../core/Modifier');\nvar Transform = require('../core/Transform');\nvar Transitionable = require('../transitions/Transitionable');\nvar TransitionableTransform = require('../transitions/TransitionableTransform');\nfunction StateModifier(options) {\n    this._transformState = new TransitionableTransform(Transform.identity);\n    this._opacityState = new Transitionable(1);\n    this._originState = new Transitionable([\n        0,\n        0\n    ]);\n    this._alignState = new Transitionable([\n        0,\n        0\n    ]);\n    this._sizeState = new Transitionable([\n        0,\n        0\n    ]);\n    this._proportionsState = new Transitionable([\n        0,\n        0\n    ]);\n    this._modifier = new Modifier({\n        transform: this._transformState,\n        opacity: this._opacityState,\n        origin: null,\n        align: null,\n        size: null,\n        proportions: null\n    });\n    this._hasOrigin = false;\n    this._hasAlign = false;\n    this._hasSize = false;\n    this._hasProportions = false;\n    if (options) {\n        if (options.transform)\n            this.setTransform(options.transform);\n        if (options.opacity !== undefined)\n            this.setOpacity(options.opacity);\n        if (options.origin)\n            this.setOrigin(options.origin);\n        if (options.align)\n            this.setAlign(options.align);\n        if (options.size)\n            this.setSize(options.size);\n        if (options.proportions)\n            this.setProportions(options.proportions);\n    }\n}\nStateModifier.prototype.setTransform = function setTransform(transform, transition, callback) {\n    this._transformState.set(transform, transition, callback);\n    return this;\n};\nStateModifier.prototype.setOpacity = function setOpacity(opacity, transition, callback) {\n    this._opacityState.set(opacity, transition, callback);\n    return this;\n};\nStateModifier.prototype.setOrigin = function setOrigin(origin, transition, callback) {\n    if (origin === null) {\n        if (this._hasOrigin) {\n            this._modifier.originFrom(null);\n            this._hasOrigin = false;\n        }\n        return this;\n    } else if (!this._hasOrigin) {\n        this._hasOrigin = true;\n        this._modifier.originFrom(this._originState);\n    }\n    this._originState.set(origin, transition, callback);\n    return this;\n};\nStateModifier.prototype.setAlign = function setOrigin(align, transition, callback) {\n    if (align === null) {\n        if (this._hasAlign) {\n            this._modifier.alignFrom(null);\n            this._hasAlign = false;\n        }\n        return this;\n    } else if (!this._hasAlign) {\n        this._hasAlign = true;\n        this._modifier.alignFrom(this._alignState);\n    }\n    this._alignState.set(align, transition, callback);\n    return this;\n};\nStateModifier.prototype.setSize = function setSize(size, transition, callback) {\n    if (size === null) {\n        if (this._hasSize) {\n            this._modifier.sizeFrom(null);\n            this._hasSize = false;\n        }\n        return this;\n    } else if (!this._hasSize) {\n        this._hasSize = true;\n        this._modifier.sizeFrom(this._sizeState);\n    }\n    this._sizeState.set(size, transition, callback);\n    return this;\n};\nStateModifier.prototype.setProportions = function setSize(proportions, transition, callback) {\n    if (proportions === null) {\n        if (this._hasProportions) {\n            this._modifier.proportionsFrom(null);\n            this._hasProportions = false;\n        }\n        return this;\n    } else if (!this._hasProportions) {\n        this._hasProportions = true;\n        this._modifier.proportionsFrom(this._proportionsState);\n    }\n    this._proportionsState.set(proportions, transition, callback);\n    return this;\n};\nStateModifier.prototype.halt = function halt() {\n    this._transformState.halt();\n    this._opacityState.halt();\n    this._originState.halt();\n    this._alignState.halt();\n    this._sizeState.halt();\n    this._proportionsState.halt();\n};\nStateModifier.prototype.getTransform = function getTransform() {\n    return this._transformState.get();\n};\nStateModifier.prototype.getFinalTransform = function getFinalTransform() {\n    return this._transformState.getFinal();\n};\nStateModifier.prototype.getOpacity = function getOpacity() {\n    return this._opacityState.get();\n};\nStateModifier.prototype.getOrigin = function getOrigin() {\n    return this._hasOrigin ? this._originState.get() : null;\n};\nStateModifier.prototype.getAlign = function getAlign() {\n    return this._hasAlign ? this._alignState.get() : null;\n};\nStateModifier.prototype.getSize = function getSize() {\n    return this._hasSize ? this._sizeState.get() : null;\n};\nStateModifier.prototype.getProportions = function getProportions() {\n    return this._hasProportions ? this._proportionsState.get() : null;\n};\nStateModifier.prototype.modify = function modify(target) {\n    return this._modifier.modify(target);\n};\nmodule.exports = StateModifier;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/modifiers/StateModifier.js\n ** module id = 56\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Transform = require('./Transform');\nvar Transitionable = require('../transitions/Transitionable');\nvar TransitionableTransform = require('../transitions/TransitionableTransform');\nfunction Modifier(options) {\n    this._transformGetter = null;\n    this._opacityGetter = null;\n    this._originGetter = null;\n    this._alignGetter = null;\n    this._sizeGetter = null;\n    this._proportionGetter = null;\n    this._legacyStates = {};\n    this._output = {\n        transform: Transform.identity,\n        opacity: 1,\n        origin: null,\n        align: null,\n        size: null,\n        proportions: null,\n        target: null\n    };\n    if (options) {\n        if (options.transform)\n            this.transformFrom(options.transform);\n        if (options.opacity !== undefined)\n            this.opacityFrom(options.opacity);\n        if (options.origin)\n            this.originFrom(options.origin);\n        if (options.align)\n            this.alignFrom(options.align);\n        if (options.size)\n            this.sizeFrom(options.size);\n        if (options.proportions)\n            this.proportionsFrom(options.proportions);\n    }\n}\nModifier.prototype.transformFrom = function transformFrom(transform) {\n    if (transform instanceof Function)\n        this._transformGetter = transform;\n    else if (transform instanceof Object && transform.get)\n        this._transformGetter = transform.get.bind(transform);\n    else {\n        this._transformGetter = null;\n        this._output.transform = transform;\n    }\n    return this;\n};\nModifier.prototype.opacityFrom = function opacityFrom(opacity) {\n    if (opacity instanceof Function)\n        this._opacityGetter = opacity;\n    else if (opacity instanceof Object && opacity.get)\n        this._opacityGetter = opacity.get.bind(opacity);\n    else {\n        this._opacityGetter = null;\n        this._output.opacity = opacity;\n    }\n    return this;\n};\nModifier.prototype.originFrom = function originFrom(origin) {\n    if (origin instanceof Function)\n        this._originGetter = origin;\n    else if (origin instanceof Object && origin.get)\n        this._originGetter = origin.get.bind(origin);\n    else {\n        this._originGetter = null;\n        this._output.origin = origin;\n    }\n    return this;\n};\nModifier.prototype.alignFrom = function alignFrom(align) {\n    if (align instanceof Function)\n        this._alignGetter = align;\n    else if (align instanceof Object && align.get)\n        this._alignGetter = align.get.bind(align);\n    else {\n        this._alignGetter = null;\n        this._output.align = align;\n    }\n    return this;\n};\nModifier.prototype.sizeFrom = function sizeFrom(size) {\n    if (size instanceof Function)\n        this._sizeGetter = size;\n    else if (size instanceof Object && size.get)\n        this._sizeGetter = size.get.bind(size);\n    else {\n        this._sizeGetter = null;\n        this._output.size = size;\n    }\n    return this;\n};\nModifier.prototype.proportionsFrom = function proportionsFrom(proportions) {\n    if (proportions instanceof Function)\n        this._proportionGetter = proportions;\n    else if (proportions instanceof Object && proportions.get)\n        this._proportionGetter = proportions.get.bind(proportions);\n    else {\n        this._proportionGetter = null;\n        this._output.proportions = proportions;\n    }\n    return this;\n};\nModifier.prototype.setTransform = function setTransform(transform, transition, callback) {\n    if (transition || this._legacyStates.transform) {\n        if (!this._legacyStates.transform) {\n            this._legacyStates.transform = new TransitionableTransform(this._output.transform);\n        }\n        if (!this._transformGetter)\n            this.transformFrom(this._legacyStates.transform);\n        this._legacyStates.transform.set(transform, transition, callback);\n        return this;\n    } else\n        return this.transformFrom(transform);\n};\nModifier.prototype.setOpacity = function setOpacity(opacity, transition, callback) {\n    if (transition || this._legacyStates.opacity) {\n        if (!this._legacyStates.opacity) {\n            this._legacyStates.opacity = new Transitionable(this._output.opacity);\n        }\n        if (!this._opacityGetter)\n            this.opacityFrom(this._legacyStates.opacity);\n        return this._legacyStates.opacity.set(opacity, transition, callback);\n    } else\n        return this.opacityFrom(opacity);\n};\nModifier.prototype.setOrigin = function setOrigin(origin, transition, callback) {\n    if (transition || this._legacyStates.origin) {\n        if (!this._legacyStates.origin) {\n            this._legacyStates.origin = new Transitionable(this._output.origin || [\n                0,\n                0\n            ]);\n        }\n        if (!this._originGetter)\n            this.originFrom(this._legacyStates.origin);\n        this._legacyStates.origin.set(origin, transition, callback);\n        return this;\n    } else\n        return this.originFrom(origin);\n};\nModifier.prototype.setAlign = function setAlign(align, transition, callback) {\n    if (transition || this._legacyStates.align) {\n        if (!this._legacyStates.align) {\n            this._legacyStates.align = new Transitionable(this._output.align || [\n                0,\n                0\n            ]);\n        }\n        if (!this._alignGetter)\n            this.alignFrom(this._legacyStates.align);\n        this._legacyStates.align.set(align, transition, callback);\n        return this;\n    } else\n        return this.alignFrom(align);\n};\nModifier.prototype.setSize = function setSize(size, transition, callback) {\n    if (size && (transition || this._legacyStates.size)) {\n        if (!this._legacyStates.size) {\n            this._legacyStates.size = new Transitionable(this._output.size || [\n                0,\n                0\n            ]);\n        }\n        if (!this._sizeGetter)\n            this.sizeFrom(this._legacyStates.size);\n        this._legacyStates.size.set(size, transition, callback);\n        return this;\n    } else\n        return this.sizeFrom(size);\n};\nModifier.prototype.setProportions = function setProportions(proportions, transition, callback) {\n    if (proportions && (transition || this._legacyStates.proportions)) {\n        if (!this._legacyStates.proportions) {\n            this._legacyStates.proportions = new Transitionable(this._output.proportions || [\n                0,\n                0\n            ]);\n        }\n        if (!this._proportionGetter)\n            this.proportionsFrom(this._legacyStates.proportions);\n        this._legacyStates.proportions.set(proportions, transition, callback);\n        return this;\n    } else\n        return this.proportionsFrom(proportions);\n};\nModifier.prototype.halt = function halt() {\n    if (this._legacyStates.transform)\n        this._legacyStates.transform.halt();\n    if (this._legacyStates.opacity)\n        this._legacyStates.opacity.halt();\n    if (this._legacyStates.origin)\n        this._legacyStates.origin.halt();\n    if (this._legacyStates.align)\n        this._legacyStates.align.halt();\n    if (this._legacyStates.size)\n        this._legacyStates.size.halt();\n    if (this._legacyStates.proportions)\n        this._legacyStates.proportions.halt();\n    this._transformGetter = null;\n    this._opacityGetter = null;\n    this._originGetter = null;\n    this._alignGetter = null;\n    this._sizeGetter = null;\n    this._proportionGetter = null;\n};\nModifier.prototype.getTransform = function getTransform() {\n    return this._transformGetter();\n};\nModifier.prototype.getFinalTransform = function getFinalTransform() {\n    return this._legacyStates.transform ? this._legacyStates.transform.getFinal() : this._output.transform;\n};\nModifier.prototype.getOpacity = function getOpacity() {\n    return this._opacityGetter();\n};\nModifier.prototype.getOrigin = function getOrigin() {\n    return this._originGetter();\n};\nModifier.prototype.getAlign = function getAlign() {\n    return this._alignGetter();\n};\nModifier.prototype.getSize = function getSize() {\n    return this._sizeGetter ? this._sizeGetter() : this._output.size;\n};\nModifier.prototype.getProportions = function getProportions() {\n    return this._proportionGetter ? this._proportionGetter() : this._output.proportions;\n};\nfunction _update() {\n    if (this._transformGetter)\n        this._output.transform = this._transformGetter();\n    if (this._opacityGetter)\n        this._output.opacity = this._opacityGetter();\n    if (this._originGetter)\n        this._output.origin = this._originGetter();\n    if (this._alignGetter)\n        this._output.align = this._alignGetter();\n    if (this._sizeGetter)\n        this._output.size = this._sizeGetter();\n    if (this._proportionGetter)\n        this._output.proportions = this._proportionGetter();\n}\nModifier.prototype.modify = function modify(target) {\n    _update.call(this);\n    this._output.target = target;\n    return this._output;\n};\nmodule.exports = Modifier;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/core/Modifier.js\n ** module id = 57\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Transitionable = require('./Transitionable');\nvar Transform = require('../core/Transform');\nvar Utility = require('../utilities/Utility');\nfunction TransitionableTransform(transform) {\n    this._final = Transform.identity.slice();\n    this._finalTranslate = [\n        0,\n        0,\n        0\n    ];\n    this._finalRotate = [\n        0,\n        0,\n        0\n    ];\n    this._finalSkew = [\n        0,\n        0,\n        0\n    ];\n    this._finalScale = [\n        1,\n        1,\n        1\n    ];\n    this.translate = new Transitionable(this._finalTranslate);\n    this.rotate = new Transitionable(this._finalRotate);\n    this.skew = new Transitionable(this._finalSkew);\n    this.scale = new Transitionable(this._finalScale);\n    if (transform)\n        this.set(transform);\n}\nfunction _build() {\n    return Transform.build({\n        translate: this.translate.get(),\n        rotate: this.rotate.get(),\n        skew: this.skew.get(),\n        scale: this.scale.get()\n    });\n}\nfunction _buildFinal() {\n    return Transform.build({\n        translate: this._finalTranslate,\n        rotate: this._finalRotate,\n        skew: this._finalSkew,\n        scale: this._finalScale\n    });\n}\nTransitionableTransform.prototype.setTranslate = function setTranslate(translate, transition, callback) {\n    this._finalTranslate = translate;\n    this._final = _buildFinal.call(this);\n    this.translate.set(translate, transition, callback);\n    return this;\n};\nTransitionableTransform.prototype.setScale = function setScale(scale, transition, callback) {\n    this._finalScale = scale;\n    this._final = _buildFinal.call(this);\n    this.scale.set(scale, transition, callback);\n    return this;\n};\nTransitionableTransform.prototype.setRotate = function setRotate(eulerAngles, transition, callback) {\n    this._finalRotate = eulerAngles;\n    this._final = _buildFinal.call(this);\n    this.rotate.set(eulerAngles, transition, callback);\n    return this;\n};\nTransitionableTransform.prototype.setSkew = function setSkew(skewAngles, transition, callback) {\n    this._finalSkew = skewAngles;\n    this._final = _buildFinal.call(this);\n    this.skew.set(skewAngles, transition, callback);\n    return this;\n};\nTransitionableTransform.prototype.set = function set(transform, transition, callback) {\n    var components = Transform.interpret(transform);\n    this._finalTranslate = components.translate;\n    this._finalRotate = components.rotate;\n    this._finalSkew = components.skew;\n    this._finalScale = components.scale;\n    this._final = transform;\n    var _callback = callback ? Utility.after(4, callback) : null;\n    this.translate.set(components.translate, transition, _callback);\n    this.rotate.set(components.rotate, transition, _callback);\n    this.skew.set(components.skew, transition, _callback);\n    this.scale.set(components.scale, transition, _callback);\n    return this;\n};\nTransitionableTransform.prototype.setDefaultTransition = function setDefaultTransition(transition) {\n    this.translate.setDefault(transition);\n    this.rotate.setDefault(transition);\n    this.skew.setDefault(transition);\n    this.scale.setDefault(transition);\n};\nTransitionableTransform.prototype.get = function get() {\n    if (this.isActive()) {\n        return _build.call(this);\n    } else\n        return this._final;\n};\nTransitionableTransform.prototype.getFinal = function getFinal() {\n    return this._final;\n};\nTransitionableTransform.prototype.isActive = function isActive() {\n    return this.translate.isActive() || this.rotate.isActive() || this.scale.isActive() || this.skew.isActive();\n};\nTransitionableTransform.prototype.halt = function halt() {\n    this.translate.halt();\n    this.rotate.halt();\n    this.skew.halt();\n    this.scale.halt();\n    this._final = this.get();\n    this._finalTranslate = this.translate.get();\n    this._finalRotate = this.rotate.get();\n    this._finalSkew = this.skew.get();\n    this._finalScale = this.scale.get();\n    return this;\n};\nmodule.exports = TransitionableTransform;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/transitions/TransitionableTransform.js\n ** module id = 58\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar FamousEngine = require('../core/Engine');\nvar _event = 'prerender';\nvar getTime = window.performance && window.performance.now ? function () {\n    return window.performance.now();\n} : function () {\n    return Date.now();\n};\nfunction addTimerFunction(fn) {\n    FamousEngine.on(_event, fn);\n    return fn;\n}\nfunction setTimeout(fn, duration) {\n    var t = getTime();\n    var callback = function () {\n        var t2 = getTime();\n        if (t2 - t >= duration) {\n            fn.apply(this, arguments);\n            FamousEngine.removeListener(_event, callback);\n        }\n    };\n    return addTimerFunction(callback);\n}\nfunction setInterval(fn, duration) {\n    var t = getTime();\n    var callback = function () {\n        var t2 = getTime();\n        if (t2 - t >= duration) {\n            fn.apply(this, arguments);\n            t = getTime();\n        }\n    };\n    return addTimerFunction(callback);\n}\nfunction after(fn, numTicks) {\n    if (numTicks === undefined)\n        return undefined;\n    var callback = function () {\n        numTicks--;\n        if (numTicks <= 0) {\n            fn.apply(this, arguments);\n            clear(callback);\n        }\n    };\n    return addTimerFunction(callback);\n}\nfunction every(fn, numTicks) {\n    numTicks = numTicks || 1;\n    var initial = numTicks;\n    var callback = function () {\n        numTicks--;\n        if (numTicks <= 0) {\n            fn.apply(this, arguments);\n            numTicks = initial;\n        }\n    };\n    return addTimerFunction(callback);\n}\nfunction clear(fn) {\n    FamousEngine.removeListener(_event, fn);\n}\nfunction debounce(func, wait) {\n    var timeout;\n    var ctx;\n    var timestamp;\n    var result;\n    var args;\n    return function () {\n        ctx = this;\n        args = arguments;\n        timestamp = getTime();\n        var fn = function () {\n            var last = getTime - timestamp;\n            if (last < wait) {\n                timeout = setTimeout(fn, wait - last);\n            } else {\n                timeout = null;\n                result = func.apply(ctx, args);\n            }\n        };\n        clear(timeout);\n        timeout = setTimeout(fn, wait);\n        return result;\n    };\n}\nmodule.exports = {\n    setTimeout: setTimeout,\n    setInterval: setInterval,\n    debounce: debounce,\n    after: after,\n    every: every,\n    clear: clear\n};\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/utilities/Timer.js\n ** module id = 59\n ** module chunks = 0\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Easing = {\n    inQuad: function (t) {\n        return t * t;\n    },\n    outQuad: function (t) {\n        return -(t -= 1) * t + 1;\n    },\n    inOutQuad: function (t) {\n        if ((t /= 0.5) < 1)\n            return 0.5 * t * t;\n        return -0.5 * (--t * (t - 2) - 1);\n    },\n    inCubic: function (t) {\n        return t * t * t;\n    },\n    outCubic: function (t) {\n        return --t * t * t + 1;\n    },\n    inOutCubic: function (t) {\n        if ((t /= 0.5) < 1)\n            return 0.5 * t * t * t;\n        return 0.5 * ((t -= 2) * t * t + 2);\n    },\n    inQuart: function (t) {\n        return t * t * t * t;\n    },\n    outQuart: function (t) {\n        return -(--t * t * t * t - 1);\n    },\n    inOutQuart: function (t) {\n        if ((t /= 0.5) < 1)\n            return 0.5 * t * t * t * t;\n        return -0.5 * ((t -= 2) * t * t * t - 2);\n    },\n    inQuint: function (t) {\n        return t * t * t * t * t;\n    },\n    outQuint: function (t) {\n        return --t * t * t * t * t + 1;\n    },\n    inOutQuint: function (t) {\n        if ((t /= 0.5) < 1)\n            return 0.5 * t * t * t * t * t;\n        return 0.5 * ((t -= 2) * t * t * t * t + 2);\n    },\n    inSine: function (t) {\n        return -1 * Math.cos(t * (Math.PI / 2)) + 1;\n    },\n    outSine: function (t) {\n        return Math.sin(t * (Math.PI / 2));\n    },\n    inOutSine: function (t) {\n        return -0.5 * (Math.cos(Math.PI * t) - 1);\n    },\n    inExpo: function (t) {\n        return t === 0 ? 0 : Math.pow(2, 10 * (t - 1));\n    },\n    outExpo: function (t) {\n        return t === 1 ? 1 : -Math.pow(2, -10 * t) + 1;\n    },\n    inOutExpo: function (t) {\n        if (t === 0)\n            return 0;\n        if (t === 1)\n            return 1;\n        if ((t /= 0.5) < 1)\n            return 0.5 * Math.pow(2, 10 * (t - 1));\n        return 0.5 * (-Math.pow(2, -10 * --t) + 2);\n    },\n    inCirc: function (t) {\n        return -(Math.sqrt(1 - t * t) - 1);\n    },\n    outCirc: function (t) {\n        return Math.sqrt(1 - --t * t);\n    },\n    inOutCirc: function (t) {\n        if ((t /= 0.5) < 1)\n            return -0.5 * (Math.sqrt(1 - t * t) - 1);\n        return 0.5 * (Math.sqrt(1 - (t -= 2) * t) + 1);\n    },\n    inElastic: function (t) {\n        var s = 1.70158;\n        var p = 0;\n        var a = 1;\n        if (t === 0)\n            return 0;\n        if (t === 1)\n            return 1;\n        if (!p)\n            p = 0.3;\n        s = p / (2 * Math.PI) * Math.asin(1 / a);\n        return -(a * Math.pow(2, 10 * (t -= 1)) * Math.sin((t - s) * (2 * Math.PI) / p));\n    },\n    outElastic: function (t) {\n        var s = 1.70158;\n        var p = 0;\n        var a = 1;\n        if (t === 0)\n            return 0;\n        if (t === 1)\n            return 1;\n        if (!p)\n            p = 0.3;\n        s = p / (2 * Math.PI) * Math.asin(1 / a);\n        return a * Math.pow(2, -10 * t) * Math.sin((t - s) * (2 * Math.PI) / p) + 1;\n    },\n    inOutElastic: function (t) {\n        var s = 1.70158;\n        var p = 0;\n        var a = 1;\n        if (t === 0)\n            return 0;\n        if ((t /= 0.5) === 2)\n            return 1;\n        if (!p)\n            p = 0.3 * 1.5;\n        s = p / (2 * Math.PI) * Math.asin(1 / a);\n        if (t < 1)\n            return -0.5 * (a * Math.pow(2, 10 * (t -= 1)) * Math.sin((t - s) * (2 * Math.PI) / p));\n        return a * Math.pow(2, -10 * (t -= 1)) * Math.sin((t - s) * (2 * Math.PI) / p) * 0.5 + 1;\n    },\n    inBack: function (t, s) {\n        if (s === undefined)\n            s = 1.70158;\n        return t * t * ((s + 1) * t - s);\n    },\n    outBack: function (t, s) {\n        if (s === undefined)\n            s = 1.70158;\n        return --t * t * ((s + 1) * t + s) + 1;\n    },\n    inOutBack: function (t, s) {\n        if (s === undefined)\n            s = 1.70158;\n        if ((t /= 0.5) < 1)\n            return 0.5 * (t * t * (((s *= 1.525) + 1) * t - s));\n        return 0.5 * ((t -= 2) * t * (((s *= 1.525) + 1) * t + s) + 2);\n    },\n    inBounce: function (t) {\n        return 1 - Easing.outBounce(1 - t);\n    },\n    outBounce: function (t) {\n        if (t < 1 / 2.75) {\n            return 7.5625 * t * t;\n        } else if (t < 2 / 2.75) {\n            return 7.5625 * (t -= 1.5 / 2.75) * t + 0.75;\n        } else if (t < 2.5 / 2.75) {\n            return 7.5625 * (t -= 2.25 / 2.75) * t + 0.9375;\n        } else {\n            return 7.5625 * (t -= 2.625 / 2.75) * t + 0.984375;\n        }\n    },\n    inOutBounce: function (t) {\n        if (t < 0.5)\n            return Easing.inBounce(t * 2) * 0.5;\n        return Easing.outBounce(t * 2 - 1) * 0.5 + 0.5;\n    }\n};\nmodule.exports = Easing;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/transitions/Easing.js\n ** module id = 60\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2015\n */\n\n/**\n * TabBar widget for famo.us.\n *\n * ```javascript\n * var TabBar = require('famous-flex/widgets/TabBar');\n *\n * var tabBar = new TabBar({\n *   classes: ['black'],\n *   createRenderables: {\n *     background: true,\n *     selectedItemOverlay: true,\n *     spacers: true\n *   }\n * });\n * tabBar.setItems([\n *   'one',\n *   'two',\n *   'three'\n * ]);\n * this.add(tabBar); // add to the render-tree\n *\n * tabBar.on('tabchange', function(event) {\n *   console.log('new tab selected: ' + event.index);\n * });\n * ```\n *\n * The surfaces that are created, use the the css-classes `ff-widget` and `ff-tabbar`.\n * You can add additional css-classes by using the `classes` option in the constructor.\n *\n * Example css styles for a black theme:\n *\n * ```css\n * .ff-tabbar.background.black {\n *   background-color: #101010;\n * }\n * .ff-tabbar.item.black {\n *   color: #f7f3f7;\n * }\n * .ff-tabbar.selectedItemOverlay.black {\n *   border-bottom: 6px solid #30b6e7;\n * }\n * .ff-tabbar.spacer.black:after {\n *   content: \"\";\n *   background-color: #333333;\n *   width: 100%;\n *   top: 10px;\n *   bottom: 10px;\n *   position: absolute;\n * }\n * ```\n *\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var Surface = require('famous/core/Surface');\n    var View = require('famous/core/View');\n    var LayoutController = require('../LayoutController');\n    var TabBarLayout = require('../layouts/TabBarLayout');\n\n    /**\n     * @class\n     * @extends View\n     * @param {Object} options Configurable options.\n     * @param {Object} [options.tabBarLayout] Layout-options that are passed to the TabBarLayout.\n     * @param {Object} [options.layoutController] Options that are passed to the underlying layout-controller.\n     * @param {Array.String} [options.classes] Css-classes that are added to the surfaces that are created.\n     * @param {Object} [options.createRenderables] Options that specify which renderables should be created.\n     * @alias module:TabBar\n     */\n    function TabBar(options) {\n        View.apply(this, arguments);\n\n        // init\n        this._selectedItemIndex = -1;\n        options = options || {};\n        this.classes = options.classes ? this.classes.concat(options.classes) : this.classes;\n\n        // create TabBar layout\n        this.layout = new LayoutController(this.options.layoutController);\n        this.add(this.layout);\n        this.layout.pipe(this._eventOutput);\n\n        // create initial renderables\n        this._renderables = {\n            items: [],\n            spacers: [],\n            background: _createRenderable.call(this, 'background'),\n            selectedItemOverlay: _createRenderable.call(this, 'selectedItemOverlay')\n        };\n\n        this.setOptions(this.options);\n    }\n    TabBar.prototype = Object.create(View.prototype);\n    TabBar.prototype.constructor = TabBar;\n    TabBar.prototype.classes = ['ff-widget', 'ff-tabbar'];\n\n    TabBar.DEFAULT_OPTIONS = {\n        tabBarLayout: {\n            margins: [0, 0, 0, 0],\n            spacing: 0\n        },\n        createRenderables: {\n            item: true,\n            background: false,\n            selectedItemOverlay: false,\n            spacer: false\n        },\n        layoutController: {\n            autoPipeEvents: true,\n            layout: TabBarLayout,\n            flow: true,\n            flowOptions: {\n                reflowOnResize: false,\n                spring: {\n                    dampingRatio: 0.8,\n                    period: 300\n                }\n            }\n        }\n    };\n\n    /**\n     * Helper function that is called whenever a new item is selected\n     */\n    function _setSelectedItem(index) {\n        if (index !== this._selectedItemIndex) {\n            var oldIndex = this._selectedItemIndex;\n            this._selectedItemIndex = index;\n            this.layout.setLayoutOptions({\n                selectedItemIndex: index\n            });\n            if ((oldIndex >= 0) && this._renderables.items[oldIndex].removeClass){\n                this._renderables.items[oldIndex].removeClass('selected');\n            }\n            if (this._renderables.items[index].addClass) {\n                this._renderables.items[index].addClass('selected');\n            }\n            if (oldIndex >= 0) {\n                this._eventOutput.emit('tabchange', {\n                    target: this,\n                    index: index,\n                    oldIndex: oldIndex,\n                    item: this._renderables.items[index],\n                    oldItem: ((oldIndex >= 0) && (oldIndex < this._renderables.items.length)) ? this._renderables.items[oldIndex] : undefined\n                });\n            }\n        }\n    }\n\n    /**\n     * Creates a new renderable for the given renderable-id.\n     *\n     */\n    function _createRenderable (id, data) {\n        var option = this.options.createRenderables[id];\n        if (option instanceof Function) {\n            return option.call(this, id, data);\n        }\n        else if (!option) {\n            return undefined;\n        }\n        if ((data !== undefined) && (data instanceof Object)) {\n            return data;\n        }\n        var surface = new Surface({\n            classes: this.classes,\n            content: data ? ('<div>' + data + '</div>') : undefined\n        });\n        surface.addClass(id);\n        if (id === 'item') {\n            if (this.options.tabBarLayout && this.options.tabBarLayout.itemSize && (this.options.tabBarLayout.itemSize === true)) {\n                surface.setSize(this.layout.getDirection() ? [undefined, true] : [true, undefined]);\n            }\n        }\n        return surface;\n    }\n\n    /**\n     * Patches the TabBar instance's options with the passed-in ones.\n     *\n     * @param {Object} options Configurable options.\n     * @param {Object} [options.tabBarLayout] Layout-options that are passed to the TabBarLayout.\n     * @param {Object} [options.layoutController] Options that are passed to the underlying layout-controller.\n     * @return {TabBar} this\n     */\n    TabBar.prototype.setOptions = function(options) {\n        View.prototype.setOptions.call(this, options);\n        if (!this.layout) {\n            return this;\n        }\n        if (options.tabBarLayout !== undefined) {\n            this.layout.setLayoutOptions(options.tabBarLayout);\n        }\n        if (options.layoutController) {\n            this.layout.setOptions(options.layoutController);\n        }\n        return this;\n    };\n\n    /**\n     * Sets the items for the tab-bar.\n     *\n     * Example 1:\n     *\n     * ```javascript\n     * var tabBar = new TabBar();\n     * tabBar.setItems([\n     *   'one',\n     *   'two',\n     *   'three'\n     * ]);\n     *```\n     *\n     * Example using Ionic icons:\n     *\n     * ```javascript\n     * var tabBar = new TabBar();\n     * tabBar.setItems([\n     *   '<div class=\"icon ion-flag\"></div>Flag',\n     *   '<div class=\"icon ion-map\"></div>Map',\n     *   '<div class=\"icon ion-gear-a\"></div>Settings'\n     * ]);\n     *```\n     *\n     * CSS:\n     *\n     * ```css\n     * .ff-tabbar.item {\n     *   font-size: 12px;\n     * }\n     * .ff-tabbar.item .icon {\n     *   font-size: 24px;\n     * }\n     * ```\n     *\n     * @param {Array} items Array of tab-item renderables.\n     * @return {TabBar} this\n     */\n    TabBar.prototype.setItems = function(items) {\n        var currentIndex = this._selectedItemIndex;\n        this._selectedItemIndex = -1;\n        this._renderables.items = [];\n        this._renderables.spacers = [];\n        if (items) {\n            for (var i = 0; i < items.length; i++) {\n                var item = _createRenderable.call(this, 'item', items[i]);\n                if (item.on) {\n                    item.on('click', _setSelectedItem.bind(this, i));\n                }\n                this._renderables.items.push(item);\n                if ((i < (items.length - 1))) {\n                    var spacer = _createRenderable.call(this, 'spacer', ' ');\n                    if (spacer) {\n                        this._renderables.spacers.push(spacer);\n                    }\n                }\n            }\n        }\n        this.layout.setDataSource(this._renderables);\n        if (this._renderables.items.length) {\n            _setSelectedItem.call(this, Math.max(Math.min(currentIndex, this._renderables.items.length - 1), 0));\n        }\n        return this;\n    };\n\n    /**\n     * Get the tab-item renderables for the tab-bar.\n     *\n     * @return {Array} tab-item renderables\n     */\n    TabBar.prototype.getItems = function() {\n        return this._renderables.items;\n    };\n\n    /**\n     * Get the spec (size, transform, etc..) of the given tab-item.\n     *\n     * @param {Number} index Index of the tab-item.\n     * @return {Spec} item spec\n     */\n    TabBar.prototype.getItemSpec = function(index, normalize) {\n        return this.layout.getSpec(this._renderables.items[index], normalize);\n    };\n\n    /**\n     * Sets the index of the selected tab.\n     *\n     * @param {Number} index selected index.\n     * @return {TabBar} this\n     */\n    TabBar.prototype.setSelectedItemIndex = function(index) {\n        _setSelectedItem.call(this, index);\n        return this;\n    };\n\n    /**\n     * Get the index of the selected tab-item.\n     *\n     * @return {Number} selected index\n     */\n    TabBar.prototype.getSelectedItemIndex = function() {\n        return this._selectedItemIndex;\n    };\n\n    /**\n     * Get the size of the widget.\n     *\n     * @return {Array} size.\n     */\n    TabBar.prototype.getSize = function() {\n        return this.options.size || (this.layout ? this.layout.getSize() : View.prototype.getSize.call(this));\n    };\n\n    module.exports = TabBar;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/widgets/TabBar.js\n ** module id = 61\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2015\n */\n\n/**\n * Tab-bar layout supporting both horizontal (default) and vertical orientation.\n *\n * |options|type|description|\n * |---|---|---|\n * |`[margins]`|Number/Array|Margins shorthand (e.g. 5, [10, 20], [2, 5, 2, 10])|\n * |`[spacing]`|Number|Space in between items|\n * |`[zIncrement]`|Number|Z-translation increment used to stack the elements correctly (default: 2)|\n * |`[itemSize]`|Number/Bool|Width or height of the item (see below)|\n *\n * `itemSize` can have of the following values:\n *\n * |itemSize|description|\n * |---|---|---|\n * |`undefined`|When itemSize is undefined or omitted, all items are spread out equally over the full size.|\n * |`Number`|Size of the item.|\n * |`true`|Use the size of the renderable (calls `getSize` on the item).|\n *\n * Example:\n *\n * ```javascript\n * var TabBarLayout = require('famous-flex/layouts/TabBarLayout');\n *\n * var layout = new LayoutController({\n *   layout: TabBarLayout,\n *   layoutOptions: {\n *     itemSize: undefined,   // undefined = fill equally to full width\n *     margins: [5, 1, 5, 1], // margins to utilize\n *     spacing: 10            // space in between items\n *   },\n *   dataSource: {\n *     background: new Surface({properties: {backgroundColor: 'black'}}),\n *     items: [\n *       new Surface({ content: 'one' }),\n *       new Surface({ content: 'two' }),\n *       new Surface({ content: 'three' })\n *     ],\n *     spacers: [ // spacers in between the items\n *       new Surface({properties: {backgroundColor: 'gray'}}),\n *       new Surface({properties: {backgroundColor: 'gray'}})\n *     ],\n *     selectedItemOverlay: {\n *       new Surface({ properties: {borderBottom: '4px solid blue'}})\n *     }\n *   }\n * });\n * ```\n * @module\n */\ndefine(function(require, exports, module) {\n\n    // import dependencies\n    var Utility = require('famous/utilities/Utility');\n    var LayoutUtility = require('../LayoutUtility');\n\n    // Define capabilities of this layout function\n    var capabilities = {\n        sequence: true,\n        direction: [Utility.Direction.X, Utility.Direction.Y],\n        trueSize: true\n    };\n\n    // global data\n    var size;\n    var direction;\n    var revDirection;\n    var items;\n    var spacers;\n    var margins;\n    var spacing;\n    var sizeLeft;\n    var set = {\n        size: [0, 0],\n        translate: [0, 0, 0],\n        align: [0, 0],\n        origin: [0, 0]\n    };\n    var nodeSize;\n    var offset;\n    var zIncrement;\n\n    // Layout function\n    function TabBarLayout(context, options) {\n\n        // Prepare data\n        size = context.size;\n        direction = context.direction;\n        revDirection = direction ? 0 : 1;\n        spacing = options.spacing || 0;\n        items = context.get('items');\n        spacers = context.get('spacers');\n        margins = LayoutUtility.normalizeMargins(options.margins);\n        zIncrement = options.zIncrement || 2;\n        set.size[0] = context.size[0];\n        set.size[1] = context.size[1];\n        set.size[revDirection] -= (margins[1 - revDirection] + margins[3 - revDirection]);\n        set.translate[0] = 0;\n        set.translate[1] = 0;\n        set.translate[2] = zIncrement;\n        set.translate[revDirection] = margins[direction ? 3 : 0];\n        set.align[0] = 0;\n        set.align[1] = 0;\n        set.origin[0] = 0;\n        set.origin[1] = 0;\n\n        // When no item-size specified, spread all items\n        // out equally over the full width/height, taking into\n        // account margins & spacing\n        offset = direction ? margins[0] : margins[3];\n        sizeLeft = size[direction] - (offset + (direction ? margins[2] : margins[1]));\n        sizeLeft -= ((items.length - 1) * spacing);\n        for (var i = 0; i < items.length; i++) {\n\n            // Calculate item size\n            if (options.itemSize === undefined) {\n                nodeSize = Math.round(sizeLeft / (items.length - i));\n            }\n            else {\n                nodeSize = (options.itemSize === true) ? context.resolveSize(items[i], size)[direction] : options.itemSize;\n            }\n\n            // Calculate length used\n            set.scrollLength = nodeSize;\n            if (i === 0) {\n                set.scrollLength += direction ? margins[0] : margins[3];\n            }\n            if (i === (items.length - 1)) {\n                set.scrollLength += direction ? margins[2] : margins[1];\n            }\n            else {\n                set.scrollLength += spacing;\n            }\n\n            // Position item\n            set.size[direction] = nodeSize;\n            set.translate[direction] = offset;\n            context.set(items[i], set);\n            offset += nodeSize;\n            sizeLeft -= nodeSize;\n\n            // Place selected item overlay\n            if (i === options.selectedItemIndex) {\n                set.scrollLength = 0;\n                set.translate[direction] += (nodeSize / 2);\n                set.translate[2] = zIncrement * 2;\n                set.origin[direction] = 0.5;\n                context.set('selectedItemOverlay', set);\n                set.origin[direction] = 0;\n                set.translate[2] = zIncrement;\n            }\n\n            // Position spacer (optional)\n            if (i < (items.length - 1)) {\n                if (spacers && (i < spacers.length)) {\n                    set.size[direction] = spacing;\n                    set.translate[direction] = offset;\n                    context.set(spacers[i], set);\n                }\n                offset += spacing;\n            }\n            else {\n                offset += direction ? margins[2] : margins[1];\n            }\n        }\n\n        // Set background\n        set.scrollLength = 0;\n        set.size[0] = size[0];\n        set.size[1] = size[1];\n        set.size[direction] = size[direction];\n        set.translate[0] = 0;\n        set.translate[1] = 0;\n        set.translate[2] = 0;\n        set.translate[direction] = 0;\n        context.set('background', set);\n    }\n\n    TabBarLayout.Capabilities = capabilities;\n    TabBarLayout.Name = 'TabBarLayout';\n    TabBarLayout.Description = 'TabBar widget layout';\n    module.exports = TabBarLayout;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous-flex/src/layouts/TabBarLayout.js\n ** module id = 62\n ** module chunks = 0\n **/","/**\n * This Source Code is licensed under the MIT license. If a copy of the\n * MIT-license was not distributed with this file, You can obtain one at:\n * http://opensource.org/licenses/mit-license.html.\n *\n * @author: Hein Rutjes (IjzerenHein)\n * @license MIT\n * @copyright Gloey Apps, 2015\n */\n\n// import dependencies\nvar AutoLayout = require('autolayout');\n\nfunction _setSpacing(view, spacing) {\n    view.setSpacing(spacing);\n}\n\nfunction _setIntrinsicWidths(context, view, widths) {\n    for (var key in widths) {\n        var subView = view.subViews[key];\n        if (subView) {\n            subView.intrinsicWidth = (widths[key] === true) ? context.resolveSize(key, context.size)[0] : widths[key];\n        }\n    }\n}\n\nfunction _setIntrinsicHeights(context, view, heights) {\n    for (var key in heights) {\n        var subView = view.subViews[key];\n        if (subView) {\n            subView.intrinsicHeight = (heights[key] === true) ? context.resolveSize(key, context.size)[1] : heights[key];\n        }\n    }\n}\n\nfunction _setViewPortSize(context, view, vp) {\n    var size = [\n        ((vp.width !== undefined) && (vp.width !== true)) ? vp.width : Math.max(Math.min(context.size[0], vp['max-width'] || context.size[0]), vp['min-width'] || 0),\n        ((vp.height !== undefined) && (vp.height !== true)) ? vp.height : Math.max(Math.min(context.size[1], vp['max-height'] || context.size[1]), vp['min-height'] || 0)\n    ];\n    if ((vp.width === true) && (vp.height === true)) {\n        size[0] = view.fittingWidth;\n        size[1] = view.fittingHeight;\n    }\n    else if (vp.width === true) {\n        view.setSize(undefined, size[1]);\n        size[0] = view.fittingWidth;\n        // TODO ASPECT RATIO?\n    }\n    else if (vp.height === true) {\n        view.setSize(size[0], undefined);\n        size[1] = view.fittingHeight;\n        // TODO ASPECT RATIO?\n    }\n    else {\n        size = vp['aspect-ratio'] ? [\n            Math.min(size[0], size[1] * vp['aspect-ratio']),\n            Math.min(size[1], size[0] / vp['aspect-ratio'])\n        ] : size;\n        view.setSize(size[0], size[1]);\n    }\n    return size;\n}\n\nfunction vflToLayout(visualFormat, viewOptions) {\n    var view = new AutoLayout.View(viewOptions);\n    try {\n        var constraints = AutoLayout.VisualFormat.parse(visualFormat, {extended: true, strict: false});\n        var metaInfo = AutoLayout.VisualFormat.parseMetaInfo ? AutoLayout.VisualFormat.parseMetaInfo(visualFormat) : {};\n        view.addConstraints(constraints);\n        var dummyOptions = {};\n        return function(context, options) {\n            options = options || dummyOptions;\n            var key;\n            var subView;\n            var x;\n            var y;\n            var zIndex = options.zIndex || 0;\n            if (options.spacing || metaInfo.spacing) {\n                _setSpacing(view, options.spacing || metaInfo.spacing);\n            }\n            if (options.widths || metaInfo.widths) {\n                _setIntrinsicWidths(context, view, options.widths || metaInfo.widths);\n            }\n            if (options.heights || metaInfo.heights) {\n                _setIntrinsicHeights(context, view, options.heights || metaInfo.heights);\n            }\n            if (options.viewport || metaInfo.viewport) {\n                var size = _setViewPortSize(context, view, options.viewport || metaInfo.viewport);\n                x = (context.size[0] - size[0]) / 2;\n                y = (context.size[1] - size[1]) / 2;\n            }\n            else {\n                view.setSize(context.size[0], context.size[1]);\n                x = 0;\n                y = 0;\n            }\n            for (key in view.subViews) {\n                subView = view.subViews[key];\n                if ((key.indexOf('_') !== 0) && (subView.type !== 'stack')) {\n                    context.set(subView.name, {\n                        size: [subView.width, subView.height],\n                        translate: [x + subView.left, y + subView.top, zIndex + (subView.zIndex * 5)]\n                    });\n                }\n            }\n        };\n    }\n    catch (err) {\n        console.log(err); //eslint-disable-line no-console\n    }\n}\n\nmodule.exports = vflToLayout;\n\n\n\n/** WEBPACK FOOTER **\n ** ./vflToLayout.js\n **/","import View from 'famous/core/View';\nimport LayoutController from 'famous-flex/LayoutController';\nimport vflToLayout from '../vflToLayout';\nimport Surface from 'famous/core/Surface';\nimport CodeMirror from 'codemirror';\nimport VflMode from '../mode/vfl/vfl'; //eslint-disable-line no-unused-vars\n\nfunction getParameterByName(name) {\n    name = name.replace(/[\\[]/, '\\\\[').replace(/[\\]]/, '\\\\]');\n    var regex = new RegExp('[\\\\?&]' + name + '=([^&#]*)');\n    var results = regex.exec(location.search);\n    return results === null ? '' : decodeURIComponent(results[1].replace(/\\+/g, ' '));\n}\n\nvar vfl = getParameterByName('vfl');\nif (vfl === 'example') {\n    vfl = `|-[child1(child3)]-[child3]-|\n|-[child2(child4)]-[child4]-|\n[child5(child4)]-|\nV:|-[child1(child2)]-[child2]-|\nV:|-[child3(child4,child5)]-[child4]-[child5]-|`;\n}\nif (vfl === 'stack') {\n    vfl = `V:|-[col1:[child1(child2,child3)]-[child2]-[child3]]-|\nV:|-[col2:[child4(child5)]-[child5]]-|\nH:|-[col1(col2)]-[col2]-|`;\n}\nif (vfl === 'rgb') {\n    vfl = `//viewport aspect-ratio:3/1 max-height:300\n//colors red:#FF0000 green:#00FF00 blue:#0000FF\n//shapes red:circle green:circle blue:circle\nH:|-[row:[red(green,blue)]-[green]-[blue]]-|\nV:|[row]|`;\n}\nvfl = vfl || `|-[child(==child2/2)]-[child2]-|\nV:|-[child]-|\nV:|-[child2]-|`;\n\nclass EditorView extends View {\n    constructor(options) {\n        super(options);\n\n        this.elm = document.createElement('div');\n        this.surface = new Surface({\n            content: this.elm,\n            classes: ['editor']\n        });\n        this.surface.on('deploy', () => {\n            if (!this.editor) {\n                this.editor = new CodeMirror(this.elm, {\n                    lineNumbers: true,\n                    theme: 'vfl'\n                });\n                this.editor.setValue(vfl);\n                this.editor.on('change', this._onChange.bind(this));\n            }\n        });\n\n        this.layout = new LayoutController({\n            layout: vflToLayout(`\n                |[content]|\n                V:|[content]|\n            `),\n            dataSource: {\n                content: this.surface\n            }\n        });\n        this.add(this.layout);\n    }\n\n    _onChange() {\n        var val = this.editor.getValue();\n        if (val !== this._vfl) {\n            this._vfl = val;\n            this._eventOutput.emit('update');\n        }\n    }\n\n    get visualFormat() {\n        return this.editor ? this.editor.getValue() : vfl;\n    }\n}\n\nexport {EditorView as default};\n\n\n\n/** WEBPACK FOOTER **\n ** ./views/EditorView.js\n **/","// CodeMirror, copyright (c) by Marijn Haverbeke and others\n// Distributed under an MIT license: http://codemirror.net/LICENSE\n\n// This is CodeMirror (http://codemirror.net), a code editor\n// implemented in JavaScript on top of the browser's DOM.\n//\n// You can find some technical background for some of the code below\n// at http://marijnhaverbeke.nl/blog/#cm-internals .\n\n(function(mod) {\n  if (typeof exports == \"object\" && typeof module == \"object\") // CommonJS\n    module.exports = mod();\n  else if (typeof define == \"function\" && define.amd) // AMD\n    return define([], mod);\n  else // Plain browser env\n    this.CodeMirror = mod();\n})(function() {\n  \"use strict\";\n\n  // BROWSER SNIFFING\n\n  // Kludges for bugs and behavior differences that can't be feature\n  // detected are enabled based on userAgent etc sniffing.\n\n  var gecko = /gecko\\/\\d/i.test(navigator.userAgent);\n  var ie_upto10 = /MSIE \\d/.test(navigator.userAgent);\n  var ie_11up = /Trident\\/(?:[7-9]|\\d{2,})\\..*rv:(\\d+)/.exec(navigator.userAgent);\n  var ie = ie_upto10 || ie_11up;\n  var ie_version = ie && (ie_upto10 ? document.documentMode || 6 : ie_11up[1]);\n  var webkit = /WebKit\\//.test(navigator.userAgent);\n  var qtwebkit = webkit && /Qt\\/\\d+\\.\\d+/.test(navigator.userAgent);\n  var chrome = /Chrome\\//.test(navigator.userAgent);\n  var presto = /Opera\\//.test(navigator.userAgent);\n  var safari = /Apple Computer/.test(navigator.vendor);\n  var mac_geMountainLion = /Mac OS X 1\\d\\D([8-9]|\\d\\d)\\D/.test(navigator.userAgent);\n  var phantom = /PhantomJS/.test(navigator.userAgent);\n\n  var ios = /AppleWebKit/.test(navigator.userAgent) && /Mobile\\/\\w+/.test(navigator.userAgent);\n  // This is woefully incomplete. Suggestions for alternative methods welcome.\n  var mobile = ios || /Android|webOS|BlackBerry|Opera Mini|Opera Mobi|IEMobile/i.test(navigator.userAgent);\n  var mac = ios || /Mac/.test(navigator.platform);\n  var windows = /win/i.test(navigator.platform);\n\n  var presto_version = presto && navigator.userAgent.match(/Version\\/(\\d*\\.\\d*)/);\n  if (presto_version) presto_version = Number(presto_version[1]);\n  if (presto_version && presto_version >= 15) { presto = false; webkit = true; }\n  // Some browsers use the wrong event properties to signal cmd/ctrl on OS X\n  var flipCtrlCmd = mac && (qtwebkit || presto && (presto_version == null || presto_version < 12.11));\n  var captureRightClick = gecko || (ie && ie_version >= 9);\n\n  // Optimize some code when these features are not used.\n  var sawReadOnlySpans = false, sawCollapsedSpans = false;\n\n  // EDITOR CONSTRUCTOR\n\n  // A CodeMirror instance represents an editor. This is the object\n  // that user code is usually dealing with.\n\n  function CodeMirror(place, options) {\n    if (!(this instanceof CodeMirror)) return new CodeMirror(place, options);\n\n    this.options = options = options ? copyObj(options) : {};\n    // Determine effective options based on given values and defaults.\n    copyObj(defaults, options, false);\n    setGuttersForLineNumbers(options);\n\n    var doc = options.value;\n    if (typeof doc == \"string\") doc = new Doc(doc, options.mode);\n    this.doc = doc;\n\n    var input = new CodeMirror.inputStyles[options.inputStyle](this);\n    var display = this.display = new Display(place, doc, input);\n    display.wrapper.CodeMirror = this;\n    updateGutters(this);\n    themeChanged(this);\n    if (options.lineWrapping)\n      this.display.wrapper.className += \" CodeMirror-wrap\";\n    if (options.autofocus && !mobile) display.input.focus();\n    initScrollbars(this);\n\n    this.state = {\n      keyMaps: [],  // stores maps added by addKeyMap\n      overlays: [], // highlighting overlays, as added by addOverlay\n      modeGen: 0,   // bumped when mode/overlay changes, used to invalidate highlighting info\n      overwrite: false,\n      delayingBlurEvent: false,\n      focused: false,\n      suppressEdits: false, // used to disable editing during key handlers when in readOnly mode\n      pasteIncoming: false, cutIncoming: false, // help recognize paste/cut edits in input.poll\n      draggingText: false,\n      highlight: new Delayed(), // stores highlight worker timeout\n      keySeq: null,  // Unfinished key sequence\n      specialChars: null\n    };\n\n    var cm = this;\n\n    // Override magic textarea content restore that IE sometimes does\n    // on our hidden textarea on reload\n    if (ie && ie_version < 11) setTimeout(function() { cm.display.input.reset(true); }, 20);\n\n    registerEventHandlers(this);\n    ensureGlobalHandlers();\n\n    startOperation(this);\n    this.curOp.forceUpdate = true;\n    attachDoc(this, doc);\n\n    if ((options.autofocus && !mobile) || cm.hasFocus())\n      setTimeout(bind(onFocus, this), 20);\n    else\n      onBlur(this);\n\n    for (var opt in optionHandlers) if (optionHandlers.hasOwnProperty(opt))\n      optionHandlers[opt](this, options[opt], Init);\n    maybeUpdateLineNumberWidth(this);\n    if (options.finishInit) options.finishInit(this);\n    for (var i = 0; i < initHooks.length; ++i) initHooks[i](this);\n    endOperation(this);\n    // Suppress optimizelegibility in Webkit, since it breaks text\n    // measuring on line wrapping boundaries.\n    if (webkit && options.lineWrapping &&\n        getComputedStyle(display.lineDiv).textRendering == \"optimizelegibility\")\n      display.lineDiv.style.textRendering = \"auto\";\n  }\n\n  // DISPLAY CONSTRUCTOR\n\n  // The display handles the DOM integration, both for input reading\n  // and content drawing. It holds references to DOM nodes and\n  // display-related state.\n\n  function Display(place, doc, input) {\n    var d = this;\n    this.input = input;\n\n    // Covers bottom-right square when both scrollbars are present.\n    d.scrollbarFiller = elt(\"div\", null, \"CodeMirror-scrollbar-filler\");\n    d.scrollbarFiller.setAttribute(\"cm-not-content\", \"true\");\n    // Covers bottom of gutter when coverGutterNextToScrollbar is on\n    // and h scrollbar is present.\n    d.gutterFiller = elt(\"div\", null, \"CodeMirror-gutter-filler\");\n    d.gutterFiller.setAttribute(\"cm-not-content\", \"true\");\n    // Will contain the actual code, positioned to cover the viewport.\n    d.lineDiv = elt(\"div\", null, \"CodeMirror-code\");\n    // Elements are added to these to represent selection and cursors.\n    d.selectionDiv = elt(\"div\", null, null, \"position: relative; z-index: 1\");\n    d.cursorDiv = elt(\"div\", null, \"CodeMirror-cursors\");\n    // A visibility: hidden element used to find the size of things.\n    d.measure = elt(\"div\", null, \"CodeMirror-measure\");\n    // When lines outside of the viewport are measured, they are drawn in this.\n    d.lineMeasure = elt(\"div\", null, \"CodeMirror-measure\");\n    // Wraps everything that needs to exist inside the vertically-padded coordinate system\n    d.lineSpace = elt(\"div\", [d.measure, d.lineMeasure, d.selectionDiv, d.cursorDiv, d.lineDiv],\n                      null, \"position: relative; outline: none\");\n    // Moved around its parent to cover visible view.\n    d.mover = elt(\"div\", [elt(\"div\", [d.lineSpace], \"CodeMirror-lines\")], null, \"position: relative\");\n    // Set to the height of the document, allowing scrolling.\n    d.sizer = elt(\"div\", [d.mover], \"CodeMirror-sizer\");\n    d.sizerWidth = null;\n    // Behavior of elts with overflow: auto and padding is\n    // inconsistent across browsers. This is used to ensure the\n    // scrollable area is big enough.\n    d.heightForcer = elt(\"div\", null, null, \"position: absolute; height: \" + scrollerGap + \"px; width: 1px;\");\n    // Will contain the gutters, if any.\n    d.gutters = elt(\"div\", null, \"CodeMirror-gutters\");\n    d.lineGutter = null;\n    // Actual scrollable element.\n    d.scroller = elt(\"div\", [d.sizer, d.heightForcer, d.gutters], \"CodeMirror-scroll\");\n    d.scroller.setAttribute(\"tabIndex\", \"-1\");\n    // The element in which the editor lives.\n    d.wrapper = elt(\"div\", [d.scrollbarFiller, d.gutterFiller, d.scroller], \"CodeMirror\");\n\n    // Work around IE7 z-index bug (not perfect, hence IE7 not really being supported)\n    if (ie && ie_version < 8) { d.gutters.style.zIndex = -1; d.scroller.style.paddingRight = 0; }\n    if (!webkit && !(gecko && mobile)) d.scroller.draggable = true;\n\n    if (place) {\n      if (place.appendChild) place.appendChild(d.wrapper);\n      else place(d.wrapper);\n    }\n\n    // Current rendered range (may be bigger than the view window).\n    d.viewFrom = d.viewTo = doc.first;\n    d.reportedViewFrom = d.reportedViewTo = doc.first;\n    // Information about the rendered lines.\n    d.view = [];\n    d.renderedView = null;\n    // Holds info about a single rendered line when it was rendered\n    // for measurement, while not in view.\n    d.externalMeasured = null;\n    // Empty space (in pixels) above the view\n    d.viewOffset = 0;\n    d.lastWrapHeight = d.lastWrapWidth = 0;\n    d.updateLineNumbers = null;\n\n    d.nativeBarWidth = d.barHeight = d.barWidth = 0;\n    d.scrollbarsClipped = false;\n\n    // Used to only resize the line number gutter when necessary (when\n    // the amount of lines crosses a boundary that makes its width change)\n    d.lineNumWidth = d.lineNumInnerWidth = d.lineNumChars = null;\n    // Set to true when a non-horizontal-scrolling line widget is\n    // added. As an optimization, line widget aligning is skipped when\n    // this is false.\n    d.alignWidgets = false;\n\n    d.cachedCharWidth = d.cachedTextHeight = d.cachedPaddingH = null;\n\n    // Tracks the maximum line length so that the horizontal scrollbar\n    // can be kept static when scrolling.\n    d.maxLine = null;\n    d.maxLineLength = 0;\n    d.maxLineChanged = false;\n\n    // Used for measuring wheel scrolling granularity\n    d.wheelDX = d.wheelDY = d.wheelStartX = d.wheelStartY = null;\n\n    // True when shift is held down.\n    d.shift = false;\n\n    // Used to track whether anything happened since the context menu\n    // was opened.\n    d.selForContextMenu = null;\n\n    d.activeTouch = null;\n\n    input.init(d);\n  }\n\n  // STATE UPDATES\n\n  // Used to get the editor into a consistent state again when options change.\n\n  function loadMode(cm) {\n    cm.doc.mode = CodeMirror.getMode(cm.options, cm.doc.modeOption);\n    resetModeState(cm);\n  }\n\n  function resetModeState(cm) {\n    cm.doc.iter(function(line) {\n      if (line.stateAfter) line.stateAfter = null;\n      if (line.styles) line.styles = null;\n    });\n    cm.doc.frontier = cm.doc.first;\n    startWorker(cm, 100);\n    cm.state.modeGen++;\n    if (cm.curOp) regChange(cm);\n  }\n\n  function wrappingChanged(cm) {\n    if (cm.options.lineWrapping) {\n      addClass(cm.display.wrapper, \"CodeMirror-wrap\");\n      cm.display.sizer.style.minWidth = \"\";\n      cm.display.sizerWidth = null;\n    } else {\n      rmClass(cm.display.wrapper, \"CodeMirror-wrap\");\n      findMaxLine(cm);\n    }\n    estimateLineHeights(cm);\n    regChange(cm);\n    clearCaches(cm);\n    setTimeout(function(){updateScrollbars(cm);}, 100);\n  }\n\n  // Returns a function that estimates the height of a line, to use as\n  // first approximation until the line becomes visible (and is thus\n  // properly measurable).\n  function estimateHeight(cm) {\n    var th = textHeight(cm.display), wrapping = cm.options.lineWrapping;\n    var perLine = wrapping && Math.max(5, cm.display.scroller.clientWidth / charWidth(cm.display) - 3);\n    return function(line) {\n      if (lineIsHidden(cm.doc, line)) return 0;\n\n      var widgetsHeight = 0;\n      if (line.widgets) for (var i = 0; i < line.widgets.length; i++) {\n        if (line.widgets[i].height) widgetsHeight += line.widgets[i].height;\n      }\n\n      if (wrapping)\n        return widgetsHeight + (Math.ceil(line.text.length / perLine) || 1) * th;\n      else\n        return widgetsHeight + th;\n    };\n  }\n\n  function estimateLineHeights(cm) {\n    var doc = cm.doc, est = estimateHeight(cm);\n    doc.iter(function(line) {\n      var estHeight = est(line);\n      if (estHeight != line.height) updateLineHeight(line, estHeight);\n    });\n  }\n\n  function themeChanged(cm) {\n    cm.display.wrapper.className = cm.display.wrapper.className.replace(/\\s*cm-s-\\S+/g, \"\") +\n      cm.options.theme.replace(/(^|\\s)\\s*/g, \" cm-s-\");\n    clearCaches(cm);\n  }\n\n  function guttersChanged(cm) {\n    updateGutters(cm);\n    regChange(cm);\n    setTimeout(function(){alignHorizontally(cm);}, 20);\n  }\n\n  // Rebuild the gutter elements, ensure the margin to the left of the\n  // code matches their width.\n  function updateGutters(cm) {\n    var gutters = cm.display.gutters, specs = cm.options.gutters;\n    removeChildren(gutters);\n    for (var i = 0; i < specs.length; ++i) {\n      var gutterClass = specs[i];\n      var gElt = gutters.appendChild(elt(\"div\", null, \"CodeMirror-gutter \" + gutterClass));\n      if (gutterClass == \"CodeMirror-linenumbers\") {\n        cm.display.lineGutter = gElt;\n        gElt.style.width = (cm.display.lineNumWidth || 1) + \"px\";\n      }\n    }\n    gutters.style.display = i ? \"\" : \"none\";\n    updateGutterSpace(cm);\n  }\n\n  function updateGutterSpace(cm) {\n    var width = cm.display.gutters.offsetWidth;\n    cm.display.sizer.style.marginLeft = width + \"px\";\n  }\n\n  // Compute the character length of a line, taking into account\n  // collapsed ranges (see markText) that might hide parts, and join\n  // other lines onto it.\n  function lineLength(line) {\n    if (line.height == 0) return 0;\n    var len = line.text.length, merged, cur = line;\n    while (merged = collapsedSpanAtStart(cur)) {\n      var found = merged.find(0, true);\n      cur = found.from.line;\n      len += found.from.ch - found.to.ch;\n    }\n    cur = line;\n    while (merged = collapsedSpanAtEnd(cur)) {\n      var found = merged.find(0, true);\n      len -= cur.text.length - found.from.ch;\n      cur = found.to.line;\n      len += cur.text.length - found.to.ch;\n    }\n    return len;\n  }\n\n  // Find the longest line in the document.\n  function findMaxLine(cm) {\n    var d = cm.display, doc = cm.doc;\n    d.maxLine = getLine(doc, doc.first);\n    d.maxLineLength = lineLength(d.maxLine);\n    d.maxLineChanged = true;\n    doc.iter(function(line) {\n      var len = lineLength(line);\n      if (len > d.maxLineLength) {\n        d.maxLineLength = len;\n        d.maxLine = line;\n      }\n    });\n  }\n\n  // Make sure the gutters options contains the element\n  // \"CodeMirror-linenumbers\" when the lineNumbers option is true.\n  function setGuttersForLineNumbers(options) {\n    var found = indexOf(options.gutters, \"CodeMirror-linenumbers\");\n    if (found == -1 && options.lineNumbers) {\n      options.gutters = options.gutters.concat([\"CodeMirror-linenumbers\"]);\n    } else if (found > -1 && !options.lineNumbers) {\n      options.gutters = options.gutters.slice(0);\n      options.gutters.splice(found, 1);\n    }\n  }\n\n  // SCROLLBARS\n\n  // Prepare DOM reads needed to update the scrollbars. Done in one\n  // shot to minimize update/measure roundtrips.\n  function measureForScrollbars(cm) {\n    var d = cm.display, gutterW = d.gutters.offsetWidth;\n    var docH = Math.round(cm.doc.height + paddingVert(cm.display));\n    return {\n      clientHeight: d.scroller.clientHeight,\n      viewHeight: d.wrapper.clientHeight,\n      scrollWidth: d.scroller.scrollWidth, clientWidth: d.scroller.clientWidth,\n      viewWidth: d.wrapper.clientWidth,\n      barLeft: cm.options.fixedGutter ? gutterW : 0,\n      docHeight: docH,\n      scrollHeight: docH + scrollGap(cm) + d.barHeight,\n      nativeBarWidth: d.nativeBarWidth,\n      gutterWidth: gutterW\n    };\n  }\n\n  function NativeScrollbars(place, scroll, cm) {\n    this.cm = cm;\n    var vert = this.vert = elt(\"div\", [elt(\"div\", null, null, \"min-width: 1px\")], \"CodeMirror-vscrollbar\");\n    var horiz = this.horiz = elt(\"div\", [elt(\"div\", null, null, \"height: 100%; min-height: 1px\")], \"CodeMirror-hscrollbar\");\n    place(vert); place(horiz);\n\n    on(vert, \"scroll\", function() {\n      if (vert.clientHeight) scroll(vert.scrollTop, \"vertical\");\n    });\n    on(horiz, \"scroll\", function() {\n      if (horiz.clientWidth) scroll(horiz.scrollLeft, \"horizontal\");\n    });\n\n    this.checkedOverlay = false;\n    // Need to set a minimum width to see the scrollbar on IE7 (but must not set it on IE8).\n    if (ie && ie_version < 8) this.horiz.style.minHeight = this.vert.style.minWidth = \"18px\";\n  }\n\n  NativeScrollbars.prototype = copyObj({\n    update: function(measure) {\n      var needsH = measure.scrollWidth > measure.clientWidth + 1;\n      var needsV = measure.scrollHeight > measure.clientHeight + 1;\n      var sWidth = measure.nativeBarWidth;\n\n      if (needsV) {\n        this.vert.style.display = \"block\";\n        this.vert.style.bottom = needsH ? sWidth + \"px\" : \"0\";\n        var totalHeight = measure.viewHeight - (needsH ? sWidth : 0);\n        // A bug in IE8 can cause this value to be negative, so guard it.\n        this.vert.firstChild.style.height =\n          Math.max(0, measure.scrollHeight - measure.clientHeight + totalHeight) + \"px\";\n      } else {\n        this.vert.style.display = \"\";\n        this.vert.firstChild.style.height = \"0\";\n      }\n\n      if (needsH) {\n        this.horiz.style.display = \"block\";\n        this.horiz.style.right = needsV ? sWidth + \"px\" : \"0\";\n        this.horiz.style.left = measure.barLeft + \"px\";\n        var totalWidth = measure.viewWidth - measure.barLeft - (needsV ? sWidth : 0);\n        this.horiz.firstChild.style.width =\n          (measure.scrollWidth - measure.clientWidth + totalWidth) + \"px\";\n      } else {\n        this.horiz.style.display = \"\";\n        this.horiz.firstChild.style.width = \"0\";\n      }\n\n      if (!this.checkedOverlay && measure.clientHeight > 0) {\n        if (sWidth == 0) this.overlayHack();\n        this.checkedOverlay = true;\n      }\n\n      return {right: needsV ? sWidth : 0, bottom: needsH ? sWidth : 0};\n    },\n    setScrollLeft: function(pos) {\n      if (this.horiz.scrollLeft != pos) this.horiz.scrollLeft = pos;\n    },\n    setScrollTop: function(pos) {\n      if (this.vert.scrollTop != pos) this.vert.scrollTop = pos;\n    },\n    overlayHack: function() {\n      var w = mac && !mac_geMountainLion ? \"12px\" : \"18px\";\n      this.horiz.style.minHeight = this.vert.style.minWidth = w;\n      var self = this;\n      var barMouseDown = function(e) {\n        if (e_target(e) != self.vert && e_target(e) != self.horiz)\n          operation(self.cm, onMouseDown)(e);\n      };\n      on(this.vert, \"mousedown\", barMouseDown);\n      on(this.horiz, \"mousedown\", barMouseDown);\n    },\n    clear: function() {\n      var parent = this.horiz.parentNode;\n      parent.removeChild(this.horiz);\n      parent.removeChild(this.vert);\n    }\n  }, NativeScrollbars.prototype);\n\n  function NullScrollbars() {}\n\n  NullScrollbars.prototype = copyObj({\n    update: function() { return {bottom: 0, right: 0}; },\n    setScrollLeft: function() {},\n    setScrollTop: function() {},\n    clear: function() {}\n  }, NullScrollbars.prototype);\n\n  CodeMirror.scrollbarModel = {\"native\": NativeScrollbars, \"null\": NullScrollbars};\n\n  function initScrollbars(cm) {\n    if (cm.display.scrollbars) {\n      cm.display.scrollbars.clear();\n      if (cm.display.scrollbars.addClass)\n        rmClass(cm.display.wrapper, cm.display.scrollbars.addClass);\n    }\n\n    cm.display.scrollbars = new CodeMirror.scrollbarModel[cm.options.scrollbarStyle](function(node) {\n      cm.display.wrapper.insertBefore(node, cm.display.scrollbarFiller);\n      // Prevent clicks in the scrollbars from killing focus\n      on(node, \"mousedown\", function() {\n        if (cm.state.focused) setTimeout(function() { cm.display.input.focus(); }, 0);\n      });\n      node.setAttribute(\"cm-not-content\", \"true\");\n    }, function(pos, axis) {\n      if (axis == \"horizontal\") setScrollLeft(cm, pos);\n      else setScrollTop(cm, pos);\n    }, cm);\n    if (cm.display.scrollbars.addClass)\n      addClass(cm.display.wrapper, cm.display.scrollbars.addClass);\n  }\n\n  function updateScrollbars(cm, measure) {\n    if (!measure) measure = measureForScrollbars(cm);\n    var startWidth = cm.display.barWidth, startHeight = cm.display.barHeight;\n    updateScrollbarsInner(cm, measure);\n    for (var i = 0; i < 4 && startWidth != cm.display.barWidth || startHeight != cm.display.barHeight; i++) {\n      if (startWidth != cm.display.barWidth && cm.options.lineWrapping)\n        updateHeightsInViewport(cm);\n      updateScrollbarsInner(cm, measureForScrollbars(cm));\n      startWidth = cm.display.barWidth; startHeight = cm.display.barHeight;\n    }\n  }\n\n  // Re-synchronize the fake scrollbars with the actual size of the\n  // content.\n  function updateScrollbarsInner(cm, measure) {\n    var d = cm.display;\n    var sizes = d.scrollbars.update(measure);\n\n    d.sizer.style.paddingRight = (d.barWidth = sizes.right) + \"px\";\n    d.sizer.style.paddingBottom = (d.barHeight = sizes.bottom) + \"px\";\n\n    if (sizes.right && sizes.bottom) {\n      d.scrollbarFiller.style.display = \"block\";\n      d.scrollbarFiller.style.height = sizes.bottom + \"px\";\n      d.scrollbarFiller.style.width = sizes.right + \"px\";\n    } else d.scrollbarFiller.style.display = \"\";\n    if (sizes.bottom && cm.options.coverGutterNextToScrollbar && cm.options.fixedGutter) {\n      d.gutterFiller.style.display = \"block\";\n      d.gutterFiller.style.height = sizes.bottom + \"px\";\n      d.gutterFiller.style.width = measure.gutterWidth + \"px\";\n    } else d.gutterFiller.style.display = \"\";\n  }\n\n  // Compute the lines that are visible in a given viewport (defaults\n  // the the current scroll position). viewport may contain top,\n  // height, and ensure (see op.scrollToPos) properties.\n  function visibleLines(display, doc, viewport) {\n    var top = viewport && viewport.top != null ? Math.max(0, viewport.top) : display.scroller.scrollTop;\n    top = Math.floor(top - paddingTop(display));\n    var bottom = viewport && viewport.bottom != null ? viewport.bottom : top + display.wrapper.clientHeight;\n\n    var from = lineAtHeight(doc, top), to = lineAtHeight(doc, bottom);\n    // Ensure is a {from: {line, ch}, to: {line, ch}} object, and\n    // forces those lines into the viewport (if possible).\n    if (viewport && viewport.ensure) {\n      var ensureFrom = viewport.ensure.from.line, ensureTo = viewport.ensure.to.line;\n      if (ensureFrom < from) {\n        from = ensureFrom;\n        to = lineAtHeight(doc, heightAtLine(getLine(doc, ensureFrom)) + display.wrapper.clientHeight);\n      } else if (Math.min(ensureTo, doc.lastLine()) >= to) {\n        from = lineAtHeight(doc, heightAtLine(getLine(doc, ensureTo)) - display.wrapper.clientHeight);\n        to = ensureTo;\n      }\n    }\n    return {from: from, to: Math.max(to, from + 1)};\n  }\n\n  // LINE NUMBERS\n\n  // Re-align line numbers and gutter marks to compensate for\n  // horizontal scrolling.\n  function alignHorizontally(cm) {\n    var display = cm.display, view = display.view;\n    if (!display.alignWidgets && (!display.gutters.firstChild || !cm.options.fixedGutter)) return;\n    var comp = compensateForHScroll(display) - display.scroller.scrollLeft + cm.doc.scrollLeft;\n    var gutterW = display.gutters.offsetWidth, left = comp + \"px\";\n    for (var i = 0; i < view.length; i++) if (!view[i].hidden) {\n      if (cm.options.fixedGutter && view[i].gutter)\n        view[i].gutter.style.left = left;\n      var align = view[i].alignable;\n      if (align) for (var j = 0; j < align.length; j++)\n        align[j].style.left = left;\n    }\n    if (cm.options.fixedGutter)\n      display.gutters.style.left = (comp + gutterW) + \"px\";\n  }\n\n  // Used to ensure that the line number gutter is still the right\n  // size for the current document size. Returns true when an update\n  // is needed.\n  function maybeUpdateLineNumberWidth(cm) {\n    if (!cm.options.lineNumbers) return false;\n    var doc = cm.doc, last = lineNumberFor(cm.options, doc.first + doc.size - 1), display = cm.display;\n    if (last.length != display.lineNumChars) {\n      var test = display.measure.appendChild(elt(\"div\", [elt(\"div\", last)],\n                                                 \"CodeMirror-linenumber CodeMirror-gutter-elt\"));\n      var innerW = test.firstChild.offsetWidth, padding = test.offsetWidth - innerW;\n      display.lineGutter.style.width = \"\";\n      display.lineNumInnerWidth = Math.max(innerW, display.lineGutter.offsetWidth - padding) + 1;\n      display.lineNumWidth = display.lineNumInnerWidth + padding;\n      display.lineNumChars = display.lineNumInnerWidth ? last.length : -1;\n      display.lineGutter.style.width = display.lineNumWidth + \"px\";\n      updateGutterSpace(cm);\n      return true;\n    }\n    return false;\n  }\n\n  function lineNumberFor(options, i) {\n    return String(options.lineNumberFormatter(i + options.firstLineNumber));\n  }\n\n  // Computes display.scroller.scrollLeft + display.gutters.offsetWidth,\n  // but using getBoundingClientRect to get a sub-pixel-accurate\n  // result.\n  function compensateForHScroll(display) {\n    return display.scroller.getBoundingClientRect().left - display.sizer.getBoundingClientRect().left;\n  }\n\n  // DISPLAY DRAWING\n\n  function DisplayUpdate(cm, viewport, force) {\n    var display = cm.display;\n\n    this.viewport = viewport;\n    // Store some values that we'll need later (but don't want to force a relayout for)\n    this.visible = visibleLines(display, cm.doc, viewport);\n    this.editorIsHidden = !display.wrapper.offsetWidth;\n    this.wrapperHeight = display.wrapper.clientHeight;\n    this.wrapperWidth = display.wrapper.clientWidth;\n    this.oldDisplayWidth = displayWidth(cm);\n    this.force = force;\n    this.dims = getDimensions(cm);\n    this.events = [];\n  }\n\n  DisplayUpdate.prototype.signal = function(emitter, type) {\n    if (hasHandler(emitter, type))\n      this.events.push(arguments);\n  };\n  DisplayUpdate.prototype.finish = function() {\n    for (var i = 0; i < this.events.length; i++)\n      signal.apply(null, this.events[i]);\n  };\n\n  function maybeClipScrollbars(cm) {\n    var display = cm.display;\n    if (!display.scrollbarsClipped && display.scroller.offsetWidth) {\n      display.nativeBarWidth = display.scroller.offsetWidth - display.scroller.clientWidth;\n      display.heightForcer.style.height = scrollGap(cm) + \"px\";\n      display.sizer.style.marginBottom = -display.nativeBarWidth + \"px\";\n      display.sizer.style.borderRightWidth = scrollGap(cm) + \"px\";\n      display.scrollbarsClipped = true;\n    }\n  }\n\n  // Does the actual updating of the line display. Bails out\n  // (returning false) when there is nothing to be done and forced is\n  // false.\n  function updateDisplayIfNeeded(cm, update) {\n    var display = cm.display, doc = cm.doc;\n\n    if (update.editorIsHidden) {\n      resetView(cm);\n      return false;\n    }\n\n    // Bail out if the visible area is already rendered and nothing changed.\n    if (!update.force &&\n        update.visible.from >= display.viewFrom && update.visible.to <= display.viewTo &&\n        (display.updateLineNumbers == null || display.updateLineNumbers >= display.viewTo) &&\n        display.renderedView == display.view && countDirtyView(cm) == 0)\n      return false;\n\n    if (maybeUpdateLineNumberWidth(cm)) {\n      resetView(cm);\n      update.dims = getDimensions(cm);\n    }\n\n    // Compute a suitable new viewport (from & to)\n    var end = doc.first + doc.size;\n    var from = Math.max(update.visible.from - cm.options.viewportMargin, doc.first);\n    var to = Math.min(end, update.visible.to + cm.options.viewportMargin);\n    if (display.viewFrom < from && from - display.viewFrom < 20) from = Math.max(doc.first, display.viewFrom);\n    if (display.viewTo > to && display.viewTo - to < 20) to = Math.min(end, display.viewTo);\n    if (sawCollapsedSpans) {\n      from = visualLineNo(cm.doc, from);\n      to = visualLineEndNo(cm.doc, to);\n    }\n\n    var different = from != display.viewFrom || to != display.viewTo ||\n      display.lastWrapHeight != update.wrapperHeight || display.lastWrapWidth != update.wrapperWidth;\n    adjustView(cm, from, to);\n\n    display.viewOffset = heightAtLine(getLine(cm.doc, display.viewFrom));\n    // Position the mover div to align with the current scroll position\n    cm.display.mover.style.top = display.viewOffset + \"px\";\n\n    var toUpdate = countDirtyView(cm);\n    if (!different && toUpdate == 0 && !update.force && display.renderedView == display.view &&\n        (display.updateLineNumbers == null || display.updateLineNumbers >= display.viewTo))\n      return false;\n\n    // For big changes, we hide the enclosing element during the\n    // update, since that speeds up the operations on most browsers.\n    var focused = activeElt();\n    if (toUpdate > 4) display.lineDiv.style.display = \"none\";\n    patchDisplay(cm, display.updateLineNumbers, update.dims);\n    if (toUpdate > 4) display.lineDiv.style.display = \"\";\n    display.renderedView = display.view;\n    // There might have been a widget with a focused element that got\n    // hidden or updated, if so re-focus it.\n    if (focused && activeElt() != focused && focused.offsetHeight) focused.focus();\n\n    // Prevent selection and cursors from interfering with the scroll\n    // width and height.\n    removeChildren(display.cursorDiv);\n    removeChildren(display.selectionDiv);\n    display.gutters.style.height = 0;\n\n    if (different) {\n      display.lastWrapHeight = update.wrapperHeight;\n      display.lastWrapWidth = update.wrapperWidth;\n      startWorker(cm, 400);\n    }\n\n    display.updateLineNumbers = null;\n\n    return true;\n  }\n\n  function postUpdateDisplay(cm, update) {\n    var viewport = update.viewport;\n    for (var first = true;; first = false) {\n      if (!first || !cm.options.lineWrapping || update.oldDisplayWidth == displayWidth(cm)) {\n        // Clip forced viewport to actual scrollable area.\n        if (viewport && viewport.top != null)\n          viewport = {top: Math.min(cm.doc.height + paddingVert(cm.display) - displayHeight(cm), viewport.top)};\n        // Updated line heights might result in the drawn area not\n        // actually covering the viewport. Keep looping until it does.\n        update.visible = visibleLines(cm.display, cm.doc, viewport);\n        if (update.visible.from >= cm.display.viewFrom && update.visible.to <= cm.display.viewTo)\n          break;\n      }\n      if (!updateDisplayIfNeeded(cm, update)) break;\n      updateHeightsInViewport(cm);\n      var barMeasure = measureForScrollbars(cm);\n      updateSelection(cm);\n      setDocumentHeight(cm, barMeasure);\n      updateScrollbars(cm, barMeasure);\n    }\n\n    update.signal(cm, \"update\", cm);\n    if (cm.display.viewFrom != cm.display.reportedViewFrom || cm.display.viewTo != cm.display.reportedViewTo) {\n      update.signal(cm, \"viewportChange\", cm, cm.display.viewFrom, cm.display.viewTo);\n      cm.display.reportedViewFrom = cm.display.viewFrom; cm.display.reportedViewTo = cm.display.viewTo;\n    }\n  }\n\n  function updateDisplaySimple(cm, viewport) {\n    var update = new DisplayUpdate(cm, viewport);\n    if (updateDisplayIfNeeded(cm, update)) {\n      updateHeightsInViewport(cm);\n      postUpdateDisplay(cm, update);\n      var barMeasure = measureForScrollbars(cm);\n      updateSelection(cm);\n      setDocumentHeight(cm, barMeasure);\n      updateScrollbars(cm, barMeasure);\n      update.finish();\n    }\n  }\n\n  function setDocumentHeight(cm, measure) {\n    cm.display.sizer.style.minHeight = measure.docHeight + \"px\";\n    var total = measure.docHeight + cm.display.barHeight;\n    cm.display.heightForcer.style.top = total + \"px\";\n    cm.display.gutters.style.height = Math.max(total + scrollGap(cm), measure.clientHeight) + \"px\";\n  }\n\n  // Read the actual heights of the rendered lines, and update their\n  // stored heights to match.\n  function updateHeightsInViewport(cm) {\n    var display = cm.display;\n    var prevBottom = display.lineDiv.offsetTop;\n    for (var i = 0; i < display.view.length; i++) {\n      var cur = display.view[i], height;\n      if (cur.hidden) continue;\n      if (ie && ie_version < 8) {\n        var bot = cur.node.offsetTop + cur.node.offsetHeight;\n        height = bot - prevBottom;\n        prevBottom = bot;\n      } else {\n        var box = cur.node.getBoundingClientRect();\n        height = box.bottom - box.top;\n      }\n      var diff = cur.line.height - height;\n      if (height < 2) height = textHeight(display);\n      if (diff > .001 || diff < -.001) {\n        updateLineHeight(cur.line, height);\n        updateWidgetHeight(cur.line);\n        if (cur.rest) for (var j = 0; j < cur.rest.length; j++)\n          updateWidgetHeight(cur.rest[j]);\n      }\n    }\n  }\n\n  // Read and store the height of line widgets associated with the\n  // given line.\n  function updateWidgetHeight(line) {\n    if (line.widgets) for (var i = 0; i < line.widgets.length; ++i)\n      line.widgets[i].height = line.widgets[i].node.offsetHeight;\n  }\n\n  // Do a bulk-read of the DOM positions and sizes needed to draw the\n  // view, so that we don't interleave reading and writing to the DOM.\n  function getDimensions(cm) {\n    var d = cm.display, left = {}, width = {};\n    var gutterLeft = d.gutters.clientLeft;\n    for (var n = d.gutters.firstChild, i = 0; n; n = n.nextSibling, ++i) {\n      left[cm.options.gutters[i]] = n.offsetLeft + n.clientLeft + gutterLeft;\n      width[cm.options.gutters[i]] = n.clientWidth;\n    }\n    return {fixedPos: compensateForHScroll(d),\n            gutterTotalWidth: d.gutters.offsetWidth,\n            gutterLeft: left,\n            gutterWidth: width,\n            wrapperWidth: d.wrapper.clientWidth};\n  }\n\n  // Sync the actual display DOM structure with display.view, removing\n  // nodes for lines that are no longer in view, and creating the ones\n  // that are not there yet, and updating the ones that are out of\n  // date.\n  function patchDisplay(cm, updateNumbersFrom, dims) {\n    var display = cm.display, lineNumbers = cm.options.lineNumbers;\n    var container = display.lineDiv, cur = container.firstChild;\n\n    function rm(node) {\n      var next = node.nextSibling;\n      // Works around a throw-scroll bug in OS X Webkit\n      if (webkit && mac && cm.display.currentWheelTarget == node)\n        node.style.display = \"none\";\n      else\n        node.parentNode.removeChild(node);\n      return next;\n    }\n\n    var view = display.view, lineN = display.viewFrom;\n    // Loop over the elements in the view, syncing cur (the DOM nodes\n    // in display.lineDiv) with the view as we go.\n    for (var i = 0; i < view.length; i++) {\n      var lineView = view[i];\n      if (lineView.hidden) {\n      } else if (!lineView.node || lineView.node.parentNode != container) { // Not drawn yet\n        var node = buildLineElement(cm, lineView, lineN, dims);\n        container.insertBefore(node, cur);\n      } else { // Already drawn\n        while (cur != lineView.node) cur = rm(cur);\n        var updateNumber = lineNumbers && updateNumbersFrom != null &&\n          updateNumbersFrom <= lineN && lineView.lineNumber;\n        if (lineView.changes) {\n          if (indexOf(lineView.changes, \"gutter\") > -1) updateNumber = false;\n          updateLineForChanges(cm, lineView, lineN, dims);\n        }\n        if (updateNumber) {\n          removeChildren(lineView.lineNumber);\n          lineView.lineNumber.appendChild(document.createTextNode(lineNumberFor(cm.options, lineN)));\n        }\n        cur = lineView.node.nextSibling;\n      }\n      lineN += lineView.size;\n    }\n    while (cur) cur = rm(cur);\n  }\n\n  // When an aspect of a line changes, a string is added to\n  // lineView.changes. This updates the relevant part of the line's\n  // DOM structure.\n  function updateLineForChanges(cm, lineView, lineN, dims) {\n    for (var j = 0; j < lineView.changes.length; j++) {\n      var type = lineView.changes[j];\n      if (type == \"text\") updateLineText(cm, lineView);\n      else if (type == \"gutter\") updateLineGutter(cm, lineView, lineN, dims);\n      else if (type == \"class\") updateLineClasses(lineView);\n      else if (type == \"widget\") updateLineWidgets(cm, lineView, dims);\n    }\n    lineView.changes = null;\n  }\n\n  // Lines with gutter elements, widgets or a background class need to\n  // be wrapped, and have the extra elements added to the wrapper div\n  function ensureLineWrapped(lineView) {\n    if (lineView.node == lineView.text) {\n      lineView.node = elt(\"div\", null, null, \"position: relative\");\n      if (lineView.text.parentNode)\n        lineView.text.parentNode.replaceChild(lineView.node, lineView.text);\n      lineView.node.appendChild(lineView.text);\n      if (ie && ie_version < 8) lineView.node.style.zIndex = 2;\n    }\n    return lineView.node;\n  }\n\n  function updateLineBackground(lineView) {\n    var cls = lineView.bgClass ? lineView.bgClass + \" \" + (lineView.line.bgClass || \"\") : lineView.line.bgClass;\n    if (cls) cls += \" CodeMirror-linebackground\";\n    if (lineView.background) {\n      if (cls) lineView.background.className = cls;\n      else { lineView.background.parentNode.removeChild(lineView.background); lineView.background = null; }\n    } else if (cls) {\n      var wrap = ensureLineWrapped(lineView);\n      lineView.background = wrap.insertBefore(elt(\"div\", null, cls), wrap.firstChild);\n    }\n  }\n\n  // Wrapper around buildLineContent which will reuse the structure\n  // in display.externalMeasured when possible.\n  function getLineContent(cm, lineView) {\n    var ext = cm.display.externalMeasured;\n    if (ext && ext.line == lineView.line) {\n      cm.display.externalMeasured = null;\n      lineView.measure = ext.measure;\n      return ext.built;\n    }\n    return buildLineContent(cm, lineView);\n  }\n\n  // Redraw the line's text. Interacts with the background and text\n  // classes because the mode may output tokens that influence these\n  // classes.\n  function updateLineText(cm, lineView) {\n    var cls = lineView.text.className;\n    var built = getLineContent(cm, lineView);\n    if (lineView.text == lineView.node) lineView.node = built.pre;\n    lineView.text.parentNode.replaceChild(built.pre, lineView.text);\n    lineView.text = built.pre;\n    if (built.bgClass != lineView.bgClass || built.textClass != lineView.textClass) {\n      lineView.bgClass = built.bgClass;\n      lineView.textClass = built.textClass;\n      updateLineClasses(lineView);\n    } else if (cls) {\n      lineView.text.className = cls;\n    }\n  }\n\n  function updateLineClasses(lineView) {\n    updateLineBackground(lineView);\n    if (lineView.line.wrapClass)\n      ensureLineWrapped(lineView).className = lineView.line.wrapClass;\n    else if (lineView.node != lineView.text)\n      lineView.node.className = \"\";\n    var textClass = lineView.textClass ? lineView.textClass + \" \" + (lineView.line.textClass || \"\") : lineView.line.textClass;\n    lineView.text.className = textClass || \"\";\n  }\n\n  function updateLineGutter(cm, lineView, lineN, dims) {\n    if (lineView.gutter) {\n      lineView.node.removeChild(lineView.gutter);\n      lineView.gutter = null;\n    }\n    var markers = lineView.line.gutterMarkers;\n    if (cm.options.lineNumbers || markers) {\n      var wrap = ensureLineWrapped(lineView);\n      var gutterWrap = lineView.gutter = elt(\"div\", null, \"CodeMirror-gutter-wrapper\", \"left: \" +\n                                             (cm.options.fixedGutter ? dims.fixedPos : -dims.gutterTotalWidth) +\n                                             \"px; width: \" + dims.gutterTotalWidth + \"px\");\n      cm.display.input.setUneditable(gutterWrap);\n      wrap.insertBefore(gutterWrap, lineView.text);\n      if (lineView.line.gutterClass)\n        gutterWrap.className += \" \" + lineView.line.gutterClass;\n      if (cm.options.lineNumbers && (!markers || !markers[\"CodeMirror-linenumbers\"]))\n        lineView.lineNumber = gutterWrap.appendChild(\n          elt(\"div\", lineNumberFor(cm.options, lineN),\n              \"CodeMirror-linenumber CodeMirror-gutter-elt\",\n              \"left: \" + dims.gutterLeft[\"CodeMirror-linenumbers\"] + \"px; width: \"\n              + cm.display.lineNumInnerWidth + \"px\"));\n      if (markers) for (var k = 0; k < cm.options.gutters.length; ++k) {\n        var id = cm.options.gutters[k], found = markers.hasOwnProperty(id) && markers[id];\n        if (found)\n          gutterWrap.appendChild(elt(\"div\", [found], \"CodeMirror-gutter-elt\", \"left: \" +\n                                     dims.gutterLeft[id] + \"px; width: \" + dims.gutterWidth[id] + \"px\"));\n      }\n    }\n  }\n\n  function updateLineWidgets(cm, lineView, dims) {\n    if (lineView.alignable) lineView.alignable = null;\n    for (var node = lineView.node.firstChild, next; node; node = next) {\n      var next = node.nextSibling;\n      if (node.className == \"CodeMirror-linewidget\")\n        lineView.node.removeChild(node);\n    }\n    insertLineWidgets(cm, lineView, dims);\n  }\n\n  // Build a line's DOM representation from scratch\n  function buildLineElement(cm, lineView, lineN, dims) {\n    var built = getLineContent(cm, lineView);\n    lineView.text = lineView.node = built.pre;\n    if (built.bgClass) lineView.bgClass = built.bgClass;\n    if (built.textClass) lineView.textClass = built.textClass;\n\n    updateLineClasses(lineView);\n    updateLineGutter(cm, lineView, lineN, dims);\n    insertLineWidgets(cm, lineView, dims);\n    return lineView.node;\n  }\n\n  // A lineView may contain multiple logical lines (when merged by\n  // collapsed spans). The widgets for all of them need to be drawn.\n  function insertLineWidgets(cm, lineView, dims) {\n    insertLineWidgetsFor(cm, lineView.line, lineView, dims, true);\n    if (lineView.rest) for (var i = 0; i < lineView.rest.length; i++)\n      insertLineWidgetsFor(cm, lineView.rest[i], lineView, dims, false);\n  }\n\n  function insertLineWidgetsFor(cm, line, lineView, dims, allowAbove) {\n    if (!line.widgets) return;\n    var wrap = ensureLineWrapped(lineView);\n    for (var i = 0, ws = line.widgets; i < ws.length; ++i) {\n      var widget = ws[i], node = elt(\"div\", [widget.node], \"CodeMirror-linewidget\");\n      if (!widget.handleMouseEvents) node.setAttribute(\"cm-ignore-events\", \"true\");\n      positionLineWidget(widget, node, lineView, dims);\n      cm.display.input.setUneditable(node);\n      if (allowAbove && widget.above)\n        wrap.insertBefore(node, lineView.gutter || lineView.text);\n      else\n        wrap.appendChild(node);\n      signalLater(widget, \"redraw\");\n    }\n  }\n\n  function positionLineWidget(widget, node, lineView, dims) {\n    if (widget.noHScroll) {\n      (lineView.alignable || (lineView.alignable = [])).push(node);\n      var width = dims.wrapperWidth;\n      node.style.left = dims.fixedPos + \"px\";\n      if (!widget.coverGutter) {\n        width -= dims.gutterTotalWidth;\n        node.style.paddingLeft = dims.gutterTotalWidth + \"px\";\n      }\n      node.style.width = width + \"px\";\n    }\n    if (widget.coverGutter) {\n      node.style.zIndex = 5;\n      node.style.position = \"relative\";\n      if (!widget.noHScroll) node.style.marginLeft = -dims.gutterTotalWidth + \"px\";\n    }\n  }\n\n  // POSITION OBJECT\n\n  // A Pos instance represents a position within the text.\n  var Pos = CodeMirror.Pos = function(line, ch) {\n    if (!(this instanceof Pos)) return new Pos(line, ch);\n    this.line = line; this.ch = ch;\n  };\n\n  // Compare two positions, return 0 if they are the same, a negative\n  // number when a is less, and a positive number otherwise.\n  var cmp = CodeMirror.cmpPos = function(a, b) { return a.line - b.line || a.ch - b.ch; };\n\n  function copyPos(x) {return Pos(x.line, x.ch);}\n  function maxPos(a, b) { return cmp(a, b) < 0 ? b : a; }\n  function minPos(a, b) { return cmp(a, b) < 0 ? a : b; }\n\n  // INPUT HANDLING\n\n  function ensureFocus(cm) {\n    if (!cm.state.focused) { cm.display.input.focus(); onFocus(cm); }\n  }\n\n  function isReadOnly(cm) {\n    return cm.options.readOnly || cm.doc.cantEdit;\n  }\n\n  // This will be set to an array of strings when copying, so that,\n  // when pasting, we know what kind of selections the copied text\n  // was made out of.\n  var lastCopied = null;\n\n  function applyTextInput(cm, inserted, deleted, sel, origin) {\n    var doc = cm.doc;\n    cm.display.shift = false;\n    if (!sel) sel = doc.sel;\n\n    var textLines = splitLines(inserted), multiPaste = null;\n    // When pasing N lines into N selections, insert one line per selection\n    if (cm.state.pasteIncoming && sel.ranges.length > 1) {\n      if (lastCopied && lastCopied.join(\"\\n\") == inserted)\n        multiPaste = sel.ranges.length % lastCopied.length == 0 && map(lastCopied, splitLines);\n      else if (textLines.length == sel.ranges.length)\n        multiPaste = map(textLines, function(l) { return [l]; });\n    }\n\n    // Normal behavior is to insert the new text into every selection\n    for (var i = sel.ranges.length - 1; i >= 0; i--) {\n      var range = sel.ranges[i];\n      var from = range.from(), to = range.to();\n      if (range.empty()) {\n        if (deleted && deleted > 0) // Handle deletion\n          from = Pos(from.line, from.ch - deleted);\n        else if (cm.state.overwrite && !cm.state.pasteIncoming) // Handle overwrite\n          to = Pos(to.line, Math.min(getLine(doc, to.line).text.length, to.ch + lst(textLines).length));\n      }\n      var updateInput = cm.curOp.updateInput;\n      var changeEvent = {from: from, to: to, text: multiPaste ? multiPaste[i % multiPaste.length] : textLines,\n                         origin: origin || (cm.state.pasteIncoming ? \"paste\" : cm.state.cutIncoming ? \"cut\" : \"+input\")};\n      makeChange(cm.doc, changeEvent);\n      signalLater(cm, \"inputRead\", cm, changeEvent);\n    }\n    if (inserted && !cm.state.pasteIncoming)\n      triggerElectric(cm, inserted);\n\n    ensureCursorVisible(cm);\n    cm.curOp.updateInput = updateInput;\n    cm.curOp.typing = true;\n    cm.state.pasteIncoming = cm.state.cutIncoming = false;\n  }\n\n  function triggerElectric(cm, inserted) {\n    // When an 'electric' character is inserted, immediately trigger a reindent\n    if (!cm.options.electricChars || !cm.options.smartIndent) return;\n    var sel = cm.doc.sel;\n\n    for (var i = sel.ranges.length - 1; i >= 0; i--) {\n      var range = sel.ranges[i];\n      if (range.head.ch > 100 || (i && sel.ranges[i - 1].head.line == range.head.line)) continue;\n      var mode = cm.getModeAt(range.head);\n      var indented = false;\n      if (mode.electricChars) {\n        for (var j = 0; j < mode.electricChars.length; j++)\n          if (inserted.indexOf(mode.electricChars.charAt(j)) > -1) {\n            indented = indentLine(cm, range.head.line, \"smart\");\n            break;\n          }\n      } else if (mode.electricInput) {\n        if (mode.electricInput.test(getLine(cm.doc, range.head.line).text.slice(0, range.head.ch)))\n          indented = indentLine(cm, range.head.line, \"smart\");\n      }\n      if (indented) signalLater(cm, \"electricInput\", cm, range.head.line);\n    }\n  }\n\n  function copyableRanges(cm) {\n    var text = [], ranges = [];\n    for (var i = 0; i < cm.doc.sel.ranges.length; i++) {\n      var line = cm.doc.sel.ranges[i].head.line;\n      var lineRange = {anchor: Pos(line, 0), head: Pos(line + 1, 0)};\n      ranges.push(lineRange);\n      text.push(cm.getRange(lineRange.anchor, lineRange.head));\n    }\n    return {text: text, ranges: ranges};\n  }\n\n  function disableBrowserMagic(field) {\n    field.setAttribute(\"autocorrect\", \"off\");\n    field.setAttribute(\"autocapitalize\", \"off\");\n    field.setAttribute(\"spellcheck\", \"false\");\n  }\n\n  // TEXTAREA INPUT STYLE\n\n  function TextareaInput(cm) {\n    this.cm = cm;\n    // See input.poll and input.reset\n    this.prevInput = \"\";\n\n    // Flag that indicates whether we expect input to appear real soon\n    // now (after some event like 'keypress' or 'input') and are\n    // polling intensively.\n    this.pollingFast = false;\n    // Self-resetting timeout for the poller\n    this.polling = new Delayed();\n    // Tracks when input.reset has punted to just putting a short\n    // string into the textarea instead of the full selection.\n    this.inaccurateSelection = false;\n    // Used to work around IE issue with selection being forgotten when focus moves away from textarea\n    this.hasSelection = false;\n    this.composing = null;\n  };\n\n  function hiddenTextarea() {\n    var te = elt(\"textarea\", null, null, \"position: absolute; padding: 0; width: 1px; height: 1em; outline: none\");\n    var div = elt(\"div\", [te], null, \"overflow: hidden; position: relative; width: 3px; height: 0px;\");\n    // The textarea is kept positioned near the cursor to prevent the\n    // fact that it'll be scrolled into view on input from scrolling\n    // our fake cursor out of view. On webkit, when wrap=off, paste is\n    // very slow. So make the area wide instead.\n    if (webkit) te.style.width = \"1000px\";\n    else te.setAttribute(\"wrap\", \"off\");\n    // If border: 0; -- iOS fails to open keyboard (issue #1287)\n    if (ios) te.style.border = \"1px solid black\";\n    disableBrowserMagic(te);\n    return div;\n  }\n\n  TextareaInput.prototype = copyObj({\n    init: function(display) {\n      var input = this, cm = this.cm;\n\n      // Wraps and hides input textarea\n      var div = this.wrapper = hiddenTextarea();\n      // The semihidden textarea that is focused when the editor is\n      // focused, and receives input.\n      var te = this.textarea = div.firstChild;\n      display.wrapper.insertBefore(div, display.wrapper.firstChild);\n\n      // Needed to hide big blue blinking cursor on Mobile Safari (doesn't seem to work in iOS 8 anymore)\n      if (ios) te.style.width = \"0px\";\n\n      on(te, \"input\", function() {\n        if (ie && ie_version >= 9 && input.hasSelection) input.hasSelection = null;\n        input.poll();\n      });\n\n      on(te, \"paste\", function() {\n        // Workaround for webkit bug https://bugs.webkit.org/show_bug.cgi?id=90206\n        // Add a char to the end of textarea before paste occur so that\n        // selection doesn't span to the end of textarea.\n        if (webkit && !cm.state.fakedLastChar && !(new Date - cm.state.lastMiddleDown < 200)) {\n          var start = te.selectionStart, end = te.selectionEnd;\n          te.value += \"$\";\n          // The selection end needs to be set before the start, otherwise there\n          // can be an intermediate non-empty selection between the two, which\n          // can override the middle-click paste buffer on linux and cause the\n          // wrong thing to get pasted.\n          te.selectionEnd = end;\n          te.selectionStart = start;\n          cm.state.fakedLastChar = true;\n        }\n        cm.state.pasteIncoming = true;\n        input.fastPoll();\n      });\n\n      function prepareCopyCut(e) {\n        if (cm.somethingSelected()) {\n          lastCopied = cm.getSelections();\n          if (input.inaccurateSelection) {\n            input.prevInput = \"\";\n            input.inaccurateSelection = false;\n            te.value = lastCopied.join(\"\\n\");\n            selectInput(te);\n          }\n        } else if (!cm.options.lineWiseCopyCut) {\n          return;\n        } else {\n          var ranges = copyableRanges(cm);\n          lastCopied = ranges.text;\n          if (e.type == \"cut\") {\n            cm.setSelections(ranges.ranges, null, sel_dontScroll);\n          } else {\n            input.prevInput = \"\";\n            te.value = ranges.text.join(\"\\n\");\n            selectInput(te);\n          }\n        }\n        if (e.type == \"cut\") cm.state.cutIncoming = true;\n      }\n      on(te, \"cut\", prepareCopyCut);\n      on(te, \"copy\", prepareCopyCut);\n\n      on(display.scroller, \"paste\", function(e) {\n        if (eventInWidget(display, e)) return;\n        cm.state.pasteIncoming = true;\n        input.focus();\n      });\n\n      // Prevent normal selection in the editor (we handle our own)\n      on(display.lineSpace, \"selectstart\", function(e) {\n        if (!eventInWidget(display, e)) e_preventDefault(e);\n      });\n\n      on(te, \"compositionstart\", function() {\n        var start = cm.getCursor(\"from\");\n        input.composing = {\n          start: start,\n          range: cm.markText(start, cm.getCursor(\"to\"), {className: \"CodeMirror-composing\"})\n        };\n      });\n      on(te, \"compositionend\", function() {\n        if (input.composing) {\n          input.poll();\n          input.composing.range.clear();\n          input.composing = null;\n        }\n      });\n    },\n\n    prepareSelection: function() {\n      // Redraw the selection and/or cursor\n      var cm = this.cm, display = cm.display, doc = cm.doc;\n      var result = prepareSelection(cm);\n\n      // Move the hidden textarea near the cursor to prevent scrolling artifacts\n      if (cm.options.moveInputWithCursor) {\n        var headPos = cursorCoords(cm, doc.sel.primary().head, \"div\");\n        var wrapOff = display.wrapper.getBoundingClientRect(), lineOff = display.lineDiv.getBoundingClientRect();\n        result.teTop = Math.max(0, Math.min(display.wrapper.clientHeight - 10,\n                                            headPos.top + lineOff.top - wrapOff.top));\n        result.teLeft = Math.max(0, Math.min(display.wrapper.clientWidth - 10,\n                                             headPos.left + lineOff.left - wrapOff.left));\n      }\n\n      return result;\n    },\n\n    showSelection: function(drawn) {\n      var cm = this.cm, display = cm.display;\n      removeChildrenAndAdd(display.cursorDiv, drawn.cursors);\n      removeChildrenAndAdd(display.selectionDiv, drawn.selection);\n      if (drawn.teTop != null) {\n        this.wrapper.style.top = drawn.teTop + \"px\";\n        this.wrapper.style.left = drawn.teLeft + \"px\";\n      }\n    },\n\n    // Reset the input to correspond to the selection (or to be empty,\n    // when not typing and nothing is selected)\n    reset: function(typing) {\n      if (this.contextMenuPending) return;\n      var minimal, selected, cm = this.cm, doc = cm.doc;\n      if (cm.somethingSelected()) {\n        this.prevInput = \"\";\n        var range = doc.sel.primary();\n        minimal = hasCopyEvent &&\n          (range.to().line - range.from().line > 100 || (selected = cm.getSelection()).length > 1000);\n        var content = minimal ? \"-\" : selected || cm.getSelection();\n        this.textarea.value = content;\n        if (cm.state.focused) selectInput(this.textarea);\n        if (ie && ie_version >= 9) this.hasSelection = content;\n      } else if (!typing) {\n        this.prevInput = this.textarea.value = \"\";\n        if (ie && ie_version >= 9) this.hasSelection = null;\n      }\n      this.inaccurateSelection = minimal;\n    },\n\n    getField: function() { return this.textarea; },\n\n    supportsTouch: function() { return false; },\n\n    focus: function() {\n      if (this.cm.options.readOnly != \"nocursor\" && (!mobile || activeElt() != this.textarea)) {\n        try { this.textarea.focus(); }\n        catch (e) {} // IE8 will throw if the textarea is display: none or not in DOM\n      }\n    },\n\n    blur: function() { this.textarea.blur(); },\n\n    resetPosition: function() {\n      this.wrapper.style.top = this.wrapper.style.left = 0;\n    },\n\n    receivedFocus: function() { this.slowPoll(); },\n\n    // Poll for input changes, using the normal rate of polling. This\n    // runs as long as the editor is focused.\n    slowPoll: function() {\n      var input = this;\n      if (input.pollingFast) return;\n      input.polling.set(this.cm.options.pollInterval, function() {\n        input.poll();\n        if (input.cm.state.focused) input.slowPoll();\n      });\n    },\n\n    // When an event has just come in that is likely to add or change\n    // something in the input textarea, we poll faster, to ensure that\n    // the change appears on the screen quickly.\n    fastPoll: function() {\n      var missed = false, input = this;\n      input.pollingFast = true;\n      function p() {\n        var changed = input.poll();\n        if (!changed && !missed) {missed = true; input.polling.set(60, p);}\n        else {input.pollingFast = false; input.slowPoll();}\n      }\n      input.polling.set(20, p);\n    },\n\n    // Read input from the textarea, and update the document to match.\n    // When something is selected, it is present in the textarea, and\n    // selected (unless it is huge, in which case a placeholder is\n    // used). When nothing is selected, the cursor sits after previously\n    // seen text (can be empty), which is stored in prevInput (we must\n    // not reset the textarea when typing, because that breaks IME).\n    poll: function() {\n      var cm = this.cm, input = this.textarea, prevInput = this.prevInput;\n      // Since this is called a *lot*, try to bail out as cheaply as\n      // possible when it is clear that nothing happened. hasSelection\n      // will be the case when there is a lot of text in the textarea,\n      // in which case reading its value would be expensive.\n      if (!cm.state.focused || (hasSelection(input) && !prevInput) ||\n          isReadOnly(cm) || cm.options.disableInput || cm.state.keySeq)\n        return false;\n      // See paste handler for more on the fakedLastChar kludge\n      if (cm.state.pasteIncoming && cm.state.fakedLastChar) {\n        input.value = input.value.substring(0, input.value.length - 1);\n        cm.state.fakedLastChar = false;\n      }\n      var text = input.value;\n      // If nothing changed, bail.\n      if (text == prevInput && !cm.somethingSelected()) return false;\n      // Work around nonsensical selection resetting in IE9/10, and\n      // inexplicable appearance of private area unicode characters on\n      // some key combos in Mac (#2689).\n      if (ie && ie_version >= 9 && this.hasSelection === text ||\n          mac && /[\\uf700-\\uf7ff]/.test(text)) {\n        cm.display.input.reset();\n        return false;\n      }\n\n      if (cm.doc.sel == cm.display.selForContextMenu) {\n        var first = text.charCodeAt(0);\n        if (first == 0x200b && !prevInput) prevInput = \"\\u200b\";\n        if (first == 0x21da) { this.reset(); return this.cm.execCommand(\"undo\"); }\n      }\n      // Find the part of the input that is actually new\n      var same = 0, l = Math.min(prevInput.length, text.length);\n      while (same < l && prevInput.charCodeAt(same) == text.charCodeAt(same)) ++same;\n\n      var self = this;\n      runInOp(cm, function() {\n        applyTextInput(cm, text.slice(same), prevInput.length - same,\n                       null, self.composing ? \"*compose\" : null);\n\n        // Don't leave long text in the textarea, since it makes further polling slow\n        if (text.length > 1000 || text.indexOf(\"\\n\") > -1) input.value = self.prevInput = \"\";\n        else self.prevInput = text;\n\n        if (self.composing) {\n          self.composing.range.clear();\n          self.composing.range = cm.markText(self.composing.start, cm.getCursor(\"to\"),\n                                             {className: \"CodeMirror-composing\"});\n        }\n      });\n      return true;\n    },\n\n    ensurePolled: function() {\n      if (this.pollingFast && this.poll()) this.pollingFast = false;\n    },\n\n    onKeyPress: function() {\n      if (ie && ie_version >= 9) this.hasSelection = null;\n      this.fastPoll();\n    },\n\n    onContextMenu: function(e) {\n      var input = this, cm = input.cm, display = cm.display, te = input.textarea;\n      var pos = posFromMouse(cm, e), scrollPos = display.scroller.scrollTop;\n      if (!pos || presto) return; // Opera is difficult.\n\n      // Reset the current text selection only if the click is done outside of the selection\n      // and 'resetSelectionOnContextMenu' option is true.\n      var reset = cm.options.resetSelectionOnContextMenu;\n      if (reset && cm.doc.sel.contains(pos) == -1)\n        operation(cm, setSelection)(cm.doc, simpleSelection(pos), sel_dontScroll);\n\n      var oldCSS = te.style.cssText;\n      input.wrapper.style.position = \"absolute\";\n      te.style.cssText = \"position: fixed; width: 30px; height: 30px; top: \" + (e.clientY - 5) +\n        \"px; left: \" + (e.clientX - 5) + \"px; z-index: 1000; background: \" +\n        (ie ? \"rgba(255, 255, 255, .05)\" : \"transparent\") +\n        \"; outline: none; border-width: 0; outline: none; overflow: hidden; opacity: .05; filter: alpha(opacity=5);\";\n      if (webkit) var oldScrollY = window.scrollY; // Work around Chrome issue (#2712)\n      display.input.focus();\n      if (webkit) window.scrollTo(null, oldScrollY);\n      display.input.reset();\n      // Adds \"Select all\" to context menu in FF\n      if (!cm.somethingSelected()) te.value = input.prevInput = \" \";\n      input.contextMenuPending = true;\n      display.selForContextMenu = cm.doc.sel;\n      clearTimeout(display.detectingSelectAll);\n\n      // Select-all will be greyed out if there's nothing to select, so\n      // this adds a zero-width space so that we can later check whether\n      // it got selected.\n      function prepareSelectAllHack() {\n        if (te.selectionStart != null) {\n          var selected = cm.somethingSelected();\n          var extval = \"\\u200b\" + (selected ? te.value : \"\");\n          te.value = \"\\u21da\"; // Used to catch context-menu undo\n          te.value = extval;\n          input.prevInput = selected ? \"\" : \"\\u200b\";\n          te.selectionStart = 1; te.selectionEnd = extval.length;\n          // Re-set this, in case some other handler touched the\n          // selection in the meantime.\n          display.selForContextMenu = cm.doc.sel;\n        }\n      }\n      function rehide() {\n        input.contextMenuPending = false;\n        input.wrapper.style.position = \"relative\";\n        te.style.cssText = oldCSS;\n        if (ie && ie_version < 9) display.scrollbars.setScrollTop(display.scroller.scrollTop = scrollPos);\n\n        // Try to detect the user choosing select-all\n        if (te.selectionStart != null) {\n          if (!ie || (ie && ie_version < 9)) prepareSelectAllHack();\n          var i = 0, poll = function() {\n            if (display.selForContextMenu == cm.doc.sel && te.selectionStart == 0 &&\n                te.selectionEnd > 0 && input.prevInput == \"\\u200b\")\n              operation(cm, commands.selectAll)(cm);\n            else if (i++ < 10) display.detectingSelectAll = setTimeout(poll, 500);\n            else display.input.reset();\n          };\n          display.detectingSelectAll = setTimeout(poll, 200);\n        }\n      }\n\n      if (ie && ie_version >= 9) prepareSelectAllHack();\n      if (captureRightClick) {\n        e_stop(e);\n        var mouseup = function() {\n          off(window, \"mouseup\", mouseup);\n          setTimeout(rehide, 20);\n        };\n        on(window, \"mouseup\", mouseup);\n      } else {\n        setTimeout(rehide, 50);\n      }\n    },\n\n    setUneditable: nothing,\n\n    needsContentAttribute: false\n  }, TextareaInput.prototype);\n\n  // CONTENTEDITABLE INPUT STYLE\n\n  function ContentEditableInput(cm) {\n    this.cm = cm;\n    this.lastAnchorNode = this.lastAnchorOffset = this.lastFocusNode = this.lastFocusOffset = null;\n    this.polling = new Delayed();\n    this.gracePeriod = false;\n  }\n\n  ContentEditableInput.prototype = copyObj({\n    init: function(display) {\n      var input = this, cm = input.cm;\n      var div = input.div = display.lineDiv;\n      div.contentEditable = \"true\";\n      disableBrowserMagic(div);\n\n      on(div, \"paste\", function(e) {\n        var pasted = e.clipboardData && e.clipboardData.getData(\"text/plain\");\n        if (pasted) {\n          e.preventDefault();\n          cm.replaceSelection(pasted, null, \"paste\");\n        }\n      });\n\n      on(div, \"compositionstart\", function(e) {\n        var data = e.data;\n        input.composing = {sel: cm.doc.sel, data: data, startData: data};\n        if (!data) return;\n        var prim = cm.doc.sel.primary();\n        var line = cm.getLine(prim.head.line);\n        var found = line.indexOf(data, Math.max(0, prim.head.ch - data.length));\n        if (found > -1 && found <= prim.head.ch)\n          input.composing.sel = simpleSelection(Pos(prim.head.line, found),\n                                                Pos(prim.head.line, found + data.length));\n      });\n      on(div, \"compositionupdate\", function(e) {\n        input.composing.data = e.data;\n      });\n      on(div, \"compositionend\", function(e) {\n        var ours = input.composing;\n        if (!ours) return;\n        if (e.data != ours.startData && !/\\u200b/.test(e.data))\n          ours.data = e.data;\n        // Need a small delay to prevent other code (input event,\n        // selection polling) from doing damage when fired right after\n        // compositionend.\n        setTimeout(function() {\n          if (!ours.handled)\n            input.applyComposition(ours);\n          if (input.composing == ours)\n            input.composing = null;\n        }, 50);\n      });\n\n      on(div, \"touchstart\", function() {\n        input.forceCompositionEnd();\n      });\n\n      on(div, \"input\", function() {\n        if (input.composing) return;\n        if (!input.pollContent())\n          runInOp(input.cm, function() {regChange(cm);});\n      });\n\n      function onCopyCut(e) {\n        if (cm.somethingSelected()) {\n          lastCopied = cm.getSelections();\n          if (e.type == \"cut\") cm.replaceSelection(\"\", null, \"cut\");\n        } else if (!cm.options.lineWiseCopyCut) {\n          return;\n        } else {\n          var ranges = copyableRanges(cm);\n          lastCopied = ranges.text;\n          if (e.type == \"cut\") {\n            cm.operation(function() {\n              cm.setSelections(ranges.ranges, 0, sel_dontScroll);\n              cm.replaceSelection(\"\", null, \"cut\");\n            });\n          }\n        }\n        // iOS exposes the clipboard API, but seems to discard content inserted into it\n        if (e.clipboardData && !ios) {\n          e.preventDefault();\n          e.clipboardData.clearData();\n          e.clipboardData.setData(\"text/plain\", lastCopied.join(\"\\n\"));\n        } else {\n          // Old-fashioned briefly-focus-a-textarea hack\n          var kludge = hiddenTextarea(), te = kludge.firstChild;\n          cm.display.lineSpace.insertBefore(kludge, cm.display.lineSpace.firstChild);\n          te.value = lastCopied.join(\"\\n\");\n          var hadFocus = document.activeElement;\n          selectInput(te);\n          setTimeout(function() {\n            cm.display.lineSpace.removeChild(kludge);\n            hadFocus.focus();\n          }, 50);\n        }\n      }\n      on(div, \"copy\", onCopyCut);\n      on(div, \"cut\", onCopyCut);\n    },\n\n    prepareSelection: function() {\n      var result = prepareSelection(this.cm, false);\n      result.focus = this.cm.state.focused;\n      return result;\n    },\n\n    showSelection: function(info) {\n      if (!info || !this.cm.display.view.length) return;\n      if (info.focus) this.showPrimarySelection();\n      this.showMultipleSelections(info);\n    },\n\n    showPrimarySelection: function() {\n      var sel = window.getSelection(), prim = this.cm.doc.sel.primary();\n      var curAnchor = domToPos(this.cm, sel.anchorNode, sel.anchorOffset);\n      var curFocus = domToPos(this.cm, sel.focusNode, sel.focusOffset);\n      if (curAnchor && !curAnchor.bad && curFocus && !curFocus.bad &&\n          cmp(minPos(curAnchor, curFocus), prim.from()) == 0 &&\n          cmp(maxPos(curAnchor, curFocus), prim.to()) == 0)\n        return;\n\n      var start = posToDOM(this.cm, prim.from());\n      var end = posToDOM(this.cm, prim.to());\n      if (!start && !end) return;\n\n      var view = this.cm.display.view;\n      var old = sel.rangeCount && sel.getRangeAt(0);\n      if (!start) {\n        start = {node: view[0].measure.map[2], offset: 0};\n      } else if (!end) { // FIXME dangerously hacky\n        var measure = view[view.length - 1].measure;\n        var map = measure.maps ? measure.maps[measure.maps.length - 1] : measure.map;\n        end = {node: map[map.length - 1], offset: map[map.length - 2] - map[map.length - 3]};\n      }\n\n      try { var rng = range(start.node, start.offset, end.offset, end.node); }\n      catch(e) {} // Our model of the DOM might be outdated, in which case the range we try to set can be impossible\n      if (rng) {\n        sel.removeAllRanges();\n        sel.addRange(rng);\n        if (old && sel.anchorNode == null) sel.addRange(old);\n        else if (gecko) this.startGracePeriod();\n      }\n      this.rememberSelection();\n    },\n\n    startGracePeriod: function() {\n      var input = this;\n      clearTimeout(this.gracePeriod);\n      this.gracePeriod = setTimeout(function() {\n        input.gracePeriod = false;\n        if (input.selectionChanged())\n          input.cm.operation(function() { input.cm.curOp.selectionChanged = true; });\n      }, 20);\n    },\n\n    showMultipleSelections: function(info) {\n      removeChildrenAndAdd(this.cm.display.cursorDiv, info.cursors);\n      removeChildrenAndAdd(this.cm.display.selectionDiv, info.selection);\n    },\n\n    rememberSelection: function() {\n      var sel = window.getSelection();\n      this.lastAnchorNode = sel.anchorNode; this.lastAnchorOffset = sel.anchorOffset;\n      this.lastFocusNode = sel.focusNode; this.lastFocusOffset = sel.focusOffset;\n    },\n\n    selectionInEditor: function() {\n      var sel = window.getSelection();\n      if (!sel.rangeCount) return false;\n      var node = sel.getRangeAt(0).commonAncestorContainer;\n      return contains(this.div, node);\n    },\n\n    focus: function() {\n      if (this.cm.options.readOnly != \"nocursor\") this.div.focus();\n    },\n    blur: function() { this.div.blur(); },\n    getField: function() { return this.div; },\n\n    supportsTouch: function() { return true; },\n\n    receivedFocus: function() {\n      var input = this;\n      if (this.selectionInEditor())\n        this.pollSelection();\n      else\n        runInOp(this.cm, function() { input.cm.curOp.selectionChanged = true; });\n\n      function poll() {\n        if (input.cm.state.focused) {\n          input.pollSelection();\n          input.polling.set(input.cm.options.pollInterval, poll);\n        }\n      }\n      this.polling.set(this.cm.options.pollInterval, poll);\n    },\n\n    selectionChanged: function() {\n      var sel = window.getSelection();\n      return sel.anchorNode != this.lastAnchorNode || sel.anchorOffset != this.lastAnchorOffset ||\n        sel.focusNode != this.lastFocusNode || sel.focusOffset != this.lastFocusOffset;\n    },\n\n    pollSelection: function() {\n      if (!this.composing && !this.gracePeriod && this.selectionChanged()) {\n        var sel = window.getSelection(), cm = this.cm;\n        this.rememberSelection();\n        var anchor = domToPos(cm, sel.anchorNode, sel.anchorOffset);\n        var head = domToPos(cm, sel.focusNode, sel.focusOffset);\n        if (anchor && head) runInOp(cm, function() {\n          setSelection(cm.doc, simpleSelection(anchor, head), sel_dontScroll);\n          if (anchor.bad || head.bad) cm.curOp.selectionChanged = true;\n        });\n      }\n    },\n\n    pollContent: function() {\n      var cm = this.cm, display = cm.display, sel = cm.doc.sel.primary();\n      var from = sel.from(), to = sel.to();\n      if (from.line < display.viewFrom || to.line > display.viewTo - 1) return false;\n\n      var fromIndex;\n      if (from.line == display.viewFrom || (fromIndex = findViewIndex(cm, from.line)) == 0) {\n        var fromLine = lineNo(display.view[0].line);\n        var fromNode = display.view[0].node;\n      } else {\n        var fromLine = lineNo(display.view[fromIndex].line);\n        var fromNode = display.view[fromIndex - 1].node.nextSibling;\n      }\n      var toIndex = findViewIndex(cm, to.line);\n      if (toIndex == display.view.length - 1) {\n        var toLine = display.viewTo - 1;\n        var toNode = display.view[toIndex].node;\n      } else {\n        var toLine = lineNo(display.view[toIndex + 1].line) - 1;\n        var toNode = display.view[toIndex + 1].node.previousSibling;\n      }\n\n      var newText = splitLines(domTextBetween(cm, fromNode, toNode, fromLine, toLine));\n      var oldText = getBetween(cm.doc, Pos(fromLine, 0), Pos(toLine, getLine(cm.doc, toLine).text.length));\n      while (newText.length > 1 && oldText.length > 1) {\n        if (lst(newText) == lst(oldText)) { newText.pop(); oldText.pop(); toLine--; }\n        else if (newText[0] == oldText[0]) { newText.shift(); oldText.shift(); fromLine++; }\n        else break;\n      }\n\n      var cutFront = 0, cutEnd = 0;\n      var newTop = newText[0], oldTop = oldText[0], maxCutFront = Math.min(newTop.length, oldTop.length);\n      while (cutFront < maxCutFront && newTop.charCodeAt(cutFront) == oldTop.charCodeAt(cutFront))\n        ++cutFront;\n      var newBot = lst(newText), oldBot = lst(oldText);\n      var maxCutEnd = Math.min(newBot.length - (newText.length == 1 ? cutFront : 0),\n                               oldBot.length - (oldText.length == 1 ? cutFront : 0));\n      while (cutEnd < maxCutEnd &&\n             newBot.charCodeAt(newBot.length - cutEnd - 1) == oldBot.charCodeAt(oldBot.length - cutEnd - 1))\n        ++cutEnd;\n\n      newText[newText.length - 1] = newBot.slice(0, newBot.length - cutEnd);\n      newText[0] = newText[0].slice(cutFront);\n\n      var chFrom = Pos(fromLine, cutFront);\n      var chTo = Pos(toLine, oldText.length ? lst(oldText).length - cutEnd : 0);\n      if (newText.length > 1 || newText[0] || cmp(chFrom, chTo)) {\n        replaceRange(cm.doc, newText, chFrom, chTo, \"+input\");\n        return true;\n      }\n    },\n\n    ensurePolled: function() {\n      this.forceCompositionEnd();\n    },\n    reset: function() {\n      this.forceCompositionEnd();\n    },\n    forceCompositionEnd: function() {\n      if (!this.composing || this.composing.handled) return;\n      this.applyComposition(this.composing);\n      this.composing.handled = true;\n      this.div.blur();\n      this.div.focus();\n    },\n    applyComposition: function(composing) {\n      if (composing.data && composing.data != composing.startData)\n        operation(this.cm, applyTextInput)(this.cm, composing.data, 0, composing.sel);\n    },\n\n    setUneditable: function(node) {\n      node.setAttribute(\"contenteditable\", \"false\");\n    },\n\n    onKeyPress: function(e) {\n      e.preventDefault();\n      operation(this.cm, applyTextInput)(this.cm, String.fromCharCode(e.charCode == null ? e.keyCode : e.charCode), 0);\n    },\n\n    onContextMenu: nothing,\n    resetPosition: nothing,\n\n    needsContentAttribute: true\n  }, ContentEditableInput.prototype);\n\n  function posToDOM(cm, pos) {\n    var view = findViewForLine(cm, pos.line);\n    if (!view || view.hidden) return null;\n    var line = getLine(cm.doc, pos.line);\n    var info = mapFromLineView(view, line, pos.line);\n\n    var order = getOrder(line), side = \"left\";\n    if (order) {\n      var partPos = getBidiPartAt(order, pos.ch);\n      side = partPos % 2 ? \"right\" : \"left\";\n    }\n    var result = nodeAndOffsetInLineMap(info.map, pos.ch, side);\n    result.offset = result.collapse == \"right\" ? result.end : result.start;\n    return result;\n  }\n\n  function badPos(pos, bad) { if (bad) pos.bad = true; return pos; }\n\n  function domToPos(cm, node, offset) {\n    var lineNode;\n    if (node == cm.display.lineDiv) {\n      lineNode = cm.display.lineDiv.childNodes[offset];\n      if (!lineNode) return badPos(cm.clipPos(Pos(cm.display.viewTo - 1)), true);\n      node = null; offset = 0;\n    } else {\n      for (lineNode = node;; lineNode = lineNode.parentNode) {\n        if (!lineNode || lineNode == cm.display.lineDiv) return null;\n        if (lineNode.parentNode && lineNode.parentNode == cm.display.lineDiv) break;\n      }\n    }\n    for (var i = 0; i < cm.display.view.length; i++) {\n      var lineView = cm.display.view[i];\n      if (lineView.node == lineNode)\n        return locateNodeInLineView(lineView, node, offset);\n    }\n  }\n\n  function locateNodeInLineView(lineView, node, offset) {\n    var wrapper = lineView.text.firstChild, bad = false;\n    if (!node || !contains(wrapper, node)) return badPos(Pos(lineNo(lineView.line), 0), true);\n    if (node == wrapper) {\n      bad = true;\n      node = wrapper.childNodes[offset];\n      offset = 0;\n      if (!node) {\n        var line = lineView.rest ? lst(lineView.rest) : lineView.line;\n        return badPos(Pos(lineNo(line), line.text.length), bad);\n      }\n    }\n\n    var textNode = node.nodeType == 3 ? node : null, topNode = node;\n    if (!textNode && node.childNodes.length == 1 && node.firstChild.nodeType == 3) {\n      textNode = node.firstChild;\n      if (offset) offset = textNode.nodeValue.length;\n    }\n    while (topNode.parentNode != wrapper) topNode = topNode.parentNode;\n    var measure = lineView.measure, maps = measure.maps;\n\n    function find(textNode, topNode, offset) {\n      for (var i = -1; i < (maps ? maps.length : 0); i++) {\n        var map = i < 0 ? measure.map : maps[i];\n        for (var j = 0; j < map.length; j += 3) {\n          var curNode = map[j + 2];\n          if (curNode == textNode || curNode == topNode) {\n            var line = lineNo(i < 0 ? lineView.line : lineView.rest[i]);\n            var ch = map[j] + offset;\n            if (offset < 0 || curNode != textNode) ch = map[j + (offset ? 1 : 0)];\n            return Pos(line, ch);\n          }\n        }\n      }\n    }\n    var found = find(textNode, topNode, offset);\n    if (found) return badPos(found, bad);\n\n    // FIXME this is all really shaky. might handle the few cases it needs to handle, but likely to cause problems\n    for (var after = topNode.nextSibling, dist = textNode ? textNode.nodeValue.length - offset : 0; after; after = after.nextSibling) {\n      found = find(after, after.firstChild, 0);\n      if (found)\n        return badPos(Pos(found.line, found.ch - dist), bad);\n      else\n        dist += after.textContent.length;\n    }\n    for (var before = topNode.previousSibling, dist = offset; before; before = before.previousSibling) {\n      found = find(before, before.firstChild, -1);\n      if (found)\n        return badPos(Pos(found.line, found.ch + dist), bad);\n      else\n        dist += after.textContent.length;\n    }\n  }\n\n  function domTextBetween(cm, from, to, fromLine, toLine) {\n    var text = \"\", closing = false;\n    function recognizeMarker(id) { return function(marker) { return marker.id == id; }; }\n    function walk(node) {\n      if (node.nodeType == 1) {\n        var cmText = node.getAttribute(\"cm-text\");\n        if (cmText != null) {\n          if (cmText == \"\") cmText = node.textContent.replace(/\\u200b/g, \"\");\n          text += cmText;\n          return;\n        }\n        var markerID = node.getAttribute(\"cm-marker\"), range;\n        if (markerID) {\n          var found = cm.findMarks(Pos(fromLine, 0), Pos(toLine + 1, 0), recognizeMarker(+markerID));\n          if (found.length && (range = found[0].find()))\n            text += getBetween(cm.doc, range.from, range.to).join(\"\\n\");\n          return;\n        }\n        if (node.getAttribute(\"contenteditable\") == \"false\") return;\n        for (var i = 0; i < node.childNodes.length; i++)\n          walk(node.childNodes[i]);\n        if (/^(pre|div|p)$/i.test(node.nodeName))\n          closing = true;\n      } else if (node.nodeType == 3) {\n        var val = node.nodeValue;\n        if (!val) return;\n        if (closing) {\n          text += \"\\n\";\n          closing = false;\n        }\n        text += val;\n      }\n    }\n    for (;;) {\n      walk(from);\n      if (from == to) break;\n      from = from.nextSibling;\n    }\n    return text;\n  }\n\n  CodeMirror.inputStyles = {\"textarea\": TextareaInput, \"contenteditable\": ContentEditableInput};\n\n  // SELECTION / CURSOR\n\n  // Selection objects are immutable. A new one is created every time\n  // the selection changes. A selection is one or more non-overlapping\n  // (and non-touching) ranges, sorted, and an integer that indicates\n  // which one is the primary selection (the one that's scrolled into\n  // view, that getCursor returns, etc).\n  function Selection(ranges, primIndex) {\n    this.ranges = ranges;\n    this.primIndex = primIndex;\n  }\n\n  Selection.prototype = {\n    primary: function() { return this.ranges[this.primIndex]; },\n    equals: function(other) {\n      if (other == this) return true;\n      if (other.primIndex != this.primIndex || other.ranges.length != this.ranges.length) return false;\n      for (var i = 0; i < this.ranges.length; i++) {\n        var here = this.ranges[i], there = other.ranges[i];\n        if (cmp(here.anchor, there.anchor) != 0 || cmp(here.head, there.head) != 0) return false;\n      }\n      return true;\n    },\n    deepCopy: function() {\n      for (var out = [], i = 0; i < this.ranges.length; i++)\n        out[i] = new Range(copyPos(this.ranges[i].anchor), copyPos(this.ranges[i].head));\n      return new Selection(out, this.primIndex);\n    },\n    somethingSelected: function() {\n      for (var i = 0; i < this.ranges.length; i++)\n        if (!this.ranges[i].empty()) return true;\n      return false;\n    },\n    contains: function(pos, end) {\n      if (!end) end = pos;\n      for (var i = 0; i < this.ranges.length; i++) {\n        var range = this.ranges[i];\n        if (cmp(end, range.from()) >= 0 && cmp(pos, range.to()) <= 0)\n          return i;\n      }\n      return -1;\n    }\n  };\n\n  function Range(anchor, head) {\n    this.anchor = anchor; this.head = head;\n  }\n\n  Range.prototype = {\n    from: function() { return minPos(this.anchor, this.head); },\n    to: function() { return maxPos(this.anchor, this.head); },\n    empty: function() {\n      return this.head.line == this.anchor.line && this.head.ch == this.anchor.ch;\n    }\n  };\n\n  // Take an unsorted, potentially overlapping set of ranges, and\n  // build a selection out of it. 'Consumes' ranges array (modifying\n  // it).\n  function normalizeSelection(ranges, primIndex) {\n    var prim = ranges[primIndex];\n    ranges.sort(function(a, b) { return cmp(a.from(), b.from()); });\n    primIndex = indexOf(ranges, prim);\n    for (var i = 1; i < ranges.length; i++) {\n      var cur = ranges[i], prev = ranges[i - 1];\n      if (cmp(prev.to(), cur.from()) >= 0) {\n        var from = minPos(prev.from(), cur.from()), to = maxPos(prev.to(), cur.to());\n        var inv = prev.empty() ? cur.from() == cur.head : prev.from() == prev.head;\n        if (i <= primIndex) --primIndex;\n        ranges.splice(--i, 2, new Range(inv ? to : from, inv ? from : to));\n      }\n    }\n    return new Selection(ranges, primIndex);\n  }\n\n  function simpleSelection(anchor, head) {\n    return new Selection([new Range(anchor, head || anchor)], 0);\n  }\n\n  // Most of the external API clips given positions to make sure they\n  // actually exist within the document.\n  function clipLine(doc, n) {return Math.max(doc.first, Math.min(n, doc.first + doc.size - 1));}\n  function clipPos(doc, pos) {\n    if (pos.line < doc.first) return Pos(doc.first, 0);\n    var last = doc.first + doc.size - 1;\n    if (pos.line > last) return Pos(last, getLine(doc, last).text.length);\n    return clipToLen(pos, getLine(doc, pos.line).text.length);\n  }\n  function clipToLen(pos, linelen) {\n    var ch = pos.ch;\n    if (ch == null || ch > linelen) return Pos(pos.line, linelen);\n    else if (ch < 0) return Pos(pos.line, 0);\n    else return pos;\n  }\n  function isLine(doc, l) {return l >= doc.first && l < doc.first + doc.size;}\n  function clipPosArray(doc, array) {\n    for (var out = [], i = 0; i < array.length; i++) out[i] = clipPos(doc, array[i]);\n    return out;\n  }\n\n  // SELECTION UPDATES\n\n  // The 'scroll' parameter given to many of these indicated whether\n  // the new cursor position should be scrolled into view after\n  // modifying the selection.\n\n  // If shift is held or the extend flag is set, extends a range to\n  // include a given position (and optionally a second position).\n  // Otherwise, simply returns the range between the given positions.\n  // Used for cursor motion and such.\n  function extendRange(doc, range, head, other) {\n    if (doc.cm && doc.cm.display.shift || doc.extend) {\n      var anchor = range.anchor;\n      if (other) {\n        var posBefore = cmp(head, anchor) < 0;\n        if (posBefore != (cmp(other, anchor) < 0)) {\n          anchor = head;\n          head = other;\n        } else if (posBefore != (cmp(head, other) < 0)) {\n          head = other;\n        }\n      }\n      return new Range(anchor, head);\n    } else {\n      return new Range(other || head, head);\n    }\n  }\n\n  // Extend the primary selection range, discard the rest.\n  function extendSelection(doc, head, other, options) {\n    setSelection(doc, new Selection([extendRange(doc, doc.sel.primary(), head, other)], 0), options);\n  }\n\n  // Extend all selections (pos is an array of selections with length\n  // equal the number of selections)\n  function extendSelections(doc, heads, options) {\n    for (var out = [], i = 0; i < doc.sel.ranges.length; i++)\n      out[i] = extendRange(doc, doc.sel.ranges[i], heads[i], null);\n    var newSel = normalizeSelection(out, doc.sel.primIndex);\n    setSelection(doc, newSel, options);\n  }\n\n  // Updates a single range in the selection.\n  function replaceOneSelection(doc, i, range, options) {\n    var ranges = doc.sel.ranges.slice(0);\n    ranges[i] = range;\n    setSelection(doc, normalizeSelection(ranges, doc.sel.primIndex), options);\n  }\n\n  // Reset the selection to a single range.\n  function setSimpleSelection(doc, anchor, head, options) {\n    setSelection(doc, simpleSelection(anchor, head), options);\n  }\n\n  // Give beforeSelectionChange handlers a change to influence a\n  // selection update.\n  function filterSelectionChange(doc, sel) {\n    var obj = {\n      ranges: sel.ranges,\n      update: function(ranges) {\n        this.ranges = [];\n        for (var i = 0; i < ranges.length; i++)\n          this.ranges[i] = new Range(clipPos(doc, ranges[i].anchor),\n                                     clipPos(doc, ranges[i].head));\n      }\n    };\n    signal(doc, \"beforeSelectionChange\", doc, obj);\n    if (doc.cm) signal(doc.cm, \"beforeSelectionChange\", doc.cm, obj);\n    if (obj.ranges != sel.ranges) return normalizeSelection(obj.ranges, obj.ranges.length - 1);\n    else return sel;\n  }\n\n  function setSelectionReplaceHistory(doc, sel, options) {\n    var done = doc.history.done, last = lst(done);\n    if (last && last.ranges) {\n      done[done.length - 1] = sel;\n      setSelectionNoUndo(doc, sel, options);\n    } else {\n      setSelection(doc, sel, options);\n    }\n  }\n\n  // Set a new selection.\n  function setSelection(doc, sel, options) {\n    setSelectionNoUndo(doc, sel, options);\n    addSelectionToHistory(doc, doc.sel, doc.cm ? doc.cm.curOp.id : NaN, options);\n  }\n\n  function setSelectionNoUndo(doc, sel, options) {\n    if (hasHandler(doc, \"beforeSelectionChange\") || doc.cm && hasHandler(doc.cm, \"beforeSelectionChange\"))\n      sel = filterSelectionChange(doc, sel);\n\n    var bias = options && options.bias ||\n      (cmp(sel.primary().head, doc.sel.primary().head) < 0 ? -1 : 1);\n    setSelectionInner(doc, skipAtomicInSelection(doc, sel, bias, true));\n\n    if (!(options && options.scroll === false) && doc.cm)\n      ensureCursorVisible(doc.cm);\n  }\n\n  function setSelectionInner(doc, sel) {\n    if (sel.equals(doc.sel)) return;\n\n    doc.sel = sel;\n\n    if (doc.cm) {\n      doc.cm.curOp.updateInput = doc.cm.curOp.selectionChanged = true;\n      signalCursorActivity(doc.cm);\n    }\n    signalLater(doc, \"cursorActivity\", doc);\n  }\n\n  // Verify that the selection does not partially select any atomic\n  // marked ranges.\n  function reCheckSelection(doc) {\n    setSelectionInner(doc, skipAtomicInSelection(doc, doc.sel, null, false), sel_dontScroll);\n  }\n\n  // Return a selection that does not partially select any atomic\n  // ranges.\n  function skipAtomicInSelection(doc, sel, bias, mayClear) {\n    var out;\n    for (var i = 0; i < sel.ranges.length; i++) {\n      var range = sel.ranges[i];\n      var newAnchor = skipAtomic(doc, range.anchor, bias, mayClear);\n      var newHead = skipAtomic(doc, range.head, bias, mayClear);\n      if (out || newAnchor != range.anchor || newHead != range.head) {\n        if (!out) out = sel.ranges.slice(0, i);\n        out[i] = new Range(newAnchor, newHead);\n      }\n    }\n    return out ? normalizeSelection(out, sel.primIndex) : sel;\n  }\n\n  // Ensure a given position is not inside an atomic range.\n  function skipAtomic(doc, pos, bias, mayClear) {\n    var flipped = false, curPos = pos;\n    var dir = bias || 1;\n    doc.cantEdit = false;\n    search: for (;;) {\n      var line = getLine(doc, curPos.line);\n      if (line.markedSpans) {\n        for (var i = 0; i < line.markedSpans.length; ++i) {\n          var sp = line.markedSpans[i], m = sp.marker;\n          if ((sp.from == null || (m.inclusiveLeft ? sp.from <= curPos.ch : sp.from < curPos.ch)) &&\n              (sp.to == null || (m.inclusiveRight ? sp.to >= curPos.ch : sp.to > curPos.ch))) {\n            if (mayClear) {\n              signal(m, \"beforeCursorEnter\");\n              if (m.explicitlyCleared) {\n                if (!line.markedSpans) break;\n                else {--i; continue;}\n              }\n            }\n            if (!m.atomic) continue;\n            var newPos = m.find(dir < 0 ? -1 : 1);\n            if (cmp(newPos, curPos) == 0) {\n              newPos.ch += dir;\n              if (newPos.ch < 0) {\n                if (newPos.line > doc.first) newPos = clipPos(doc, Pos(newPos.line - 1));\n                else newPos = null;\n              } else if (newPos.ch > line.text.length) {\n                if (newPos.line < doc.first + doc.size - 1) newPos = Pos(newPos.line + 1, 0);\n                else newPos = null;\n              }\n              if (!newPos) {\n                if (flipped) {\n                  // Driven in a corner -- no valid cursor position found at all\n                  // -- try again *with* clearing, if we didn't already\n                  if (!mayClear) return skipAtomic(doc, pos, bias, true);\n                  // Otherwise, turn off editing until further notice, and return the start of the doc\n                  doc.cantEdit = true;\n                  return Pos(doc.first, 0);\n                }\n                flipped = true; newPos = pos; dir = -dir;\n              }\n            }\n            curPos = newPos;\n            continue search;\n          }\n        }\n      }\n      return curPos;\n    }\n  }\n\n  // SELECTION DRAWING\n\n  function updateSelection(cm) {\n    cm.display.input.showSelection(cm.display.input.prepareSelection());\n  }\n\n  function prepareSelection(cm, primary) {\n    var doc = cm.doc, result = {};\n    var curFragment = result.cursors = document.createDocumentFragment();\n    var selFragment = result.selection = document.createDocumentFragment();\n\n    for (var i = 0; i < doc.sel.ranges.length; i++) {\n      if (primary === false && i == doc.sel.primIndex) continue;\n      var range = doc.sel.ranges[i];\n      var collapsed = range.empty();\n      if (collapsed || cm.options.showCursorWhenSelecting)\n        drawSelectionCursor(cm, range, curFragment);\n      if (!collapsed)\n        drawSelectionRange(cm, range, selFragment);\n    }\n    return result;\n  }\n\n  // Draws a cursor for the given range\n  function drawSelectionCursor(cm, range, output) {\n    var pos = cursorCoords(cm, range.head, \"div\", null, null, !cm.options.singleCursorHeightPerLine);\n\n    var cursor = output.appendChild(elt(\"div\", \"\\u00a0\", \"CodeMirror-cursor\"));\n    cursor.style.left = pos.left + \"px\";\n    cursor.style.top = pos.top + \"px\";\n    cursor.style.height = Math.max(0, pos.bottom - pos.top) * cm.options.cursorHeight + \"px\";\n\n    if (pos.other) {\n      // Secondary cursor, shown when on a 'jump' in bi-directional text\n      var otherCursor = output.appendChild(elt(\"div\", \"\\u00a0\", \"CodeMirror-cursor CodeMirror-secondarycursor\"));\n      otherCursor.style.display = \"\";\n      otherCursor.style.left = pos.other.left + \"px\";\n      otherCursor.style.top = pos.other.top + \"px\";\n      otherCursor.style.height = (pos.other.bottom - pos.other.top) * .85 + \"px\";\n    }\n  }\n\n  // Draws the given range as a highlighted selection\n  function drawSelectionRange(cm, range, output) {\n    var display = cm.display, doc = cm.doc;\n    var fragment = document.createDocumentFragment();\n    var padding = paddingH(cm.display), leftSide = padding.left;\n    var rightSide = Math.max(display.sizerWidth, displayWidth(cm) - display.sizer.offsetLeft) - padding.right;\n\n    function add(left, top, width, bottom) {\n      if (top < 0) top = 0;\n      top = Math.round(top);\n      bottom = Math.round(bottom);\n      fragment.appendChild(elt(\"div\", null, \"CodeMirror-selected\", \"position: absolute; left: \" + left +\n                               \"px; top: \" + top + \"px; width: \" + (width == null ? rightSide - left : width) +\n                               \"px; height: \" + (bottom - top) + \"px\"));\n    }\n\n    function drawForLine(line, fromArg, toArg) {\n      var lineObj = getLine(doc, line);\n      var lineLen = lineObj.text.length;\n      var start, end;\n      function coords(ch, bias) {\n        return charCoords(cm, Pos(line, ch), \"div\", lineObj, bias);\n      }\n\n      iterateBidiSections(getOrder(lineObj), fromArg || 0, toArg == null ? lineLen : toArg, function(from, to, dir) {\n        var leftPos = coords(from, \"left\"), rightPos, left, right;\n        if (from == to) {\n          rightPos = leftPos;\n          left = right = leftPos.left;\n        } else {\n          rightPos = coords(to - 1, \"right\");\n          if (dir == \"rtl\") { var tmp = leftPos; leftPos = rightPos; rightPos = tmp; }\n          left = leftPos.left;\n          right = rightPos.right;\n        }\n        if (fromArg == null && from == 0) left = leftSide;\n        if (rightPos.top - leftPos.top > 3) { // Different lines, draw top part\n          add(left, leftPos.top, null, leftPos.bottom);\n          left = leftSide;\n          if (leftPos.bottom < rightPos.top) add(left, leftPos.bottom, null, rightPos.top);\n        }\n        if (toArg == null && to == lineLen) right = rightSide;\n        if (!start || leftPos.top < start.top || leftPos.top == start.top && leftPos.left < start.left)\n          start = leftPos;\n        if (!end || rightPos.bottom > end.bottom || rightPos.bottom == end.bottom && rightPos.right > end.right)\n          end = rightPos;\n        if (left < leftSide + 1) left = leftSide;\n        add(left, rightPos.top, right - left, rightPos.bottom);\n      });\n      return {start: start, end: end};\n    }\n\n    var sFrom = range.from(), sTo = range.to();\n    if (sFrom.line == sTo.line) {\n      drawForLine(sFrom.line, sFrom.ch, sTo.ch);\n    } else {\n      var fromLine = getLine(doc, sFrom.line), toLine = getLine(doc, sTo.line);\n      var singleVLine = visualLine(fromLine) == visualLine(toLine);\n      var leftEnd = drawForLine(sFrom.line, sFrom.ch, singleVLine ? fromLine.text.length + 1 : null).end;\n      var rightStart = drawForLine(sTo.line, singleVLine ? 0 : null, sTo.ch).start;\n      if (singleVLine) {\n        if (leftEnd.top < rightStart.top - 2) {\n          add(leftEnd.right, leftEnd.top, null, leftEnd.bottom);\n          add(leftSide, rightStart.top, rightStart.left, rightStart.bottom);\n        } else {\n          add(leftEnd.right, leftEnd.top, rightStart.left - leftEnd.right, leftEnd.bottom);\n        }\n      }\n      if (leftEnd.bottom < rightStart.top)\n        add(leftSide, leftEnd.bottom, null, rightStart.top);\n    }\n\n    output.appendChild(fragment);\n  }\n\n  // Cursor-blinking\n  function restartBlink(cm) {\n    if (!cm.state.focused) return;\n    var display = cm.display;\n    clearInterval(display.blinker);\n    var on = true;\n    display.cursorDiv.style.visibility = \"\";\n    if (cm.options.cursorBlinkRate > 0)\n      display.blinker = setInterval(function() {\n        display.cursorDiv.style.visibility = (on = !on) ? \"\" : \"hidden\";\n      }, cm.options.cursorBlinkRate);\n    else if (cm.options.cursorBlinkRate < 0)\n      display.cursorDiv.style.visibility = \"hidden\";\n  }\n\n  // HIGHLIGHT WORKER\n\n  function startWorker(cm, time) {\n    if (cm.doc.mode.startState && cm.doc.frontier < cm.display.viewTo)\n      cm.state.highlight.set(time, bind(highlightWorker, cm));\n  }\n\n  function highlightWorker(cm) {\n    var doc = cm.doc;\n    if (doc.frontier < doc.first) doc.frontier = doc.first;\n    if (doc.frontier >= cm.display.viewTo) return;\n    var end = +new Date + cm.options.workTime;\n    var state = copyState(doc.mode, getStateBefore(cm, doc.frontier));\n    var changedLines = [];\n\n    doc.iter(doc.frontier, Math.min(doc.first + doc.size, cm.display.viewTo + 500), function(line) {\n      if (doc.frontier >= cm.display.viewFrom) { // Visible\n        var oldStyles = line.styles;\n        var highlighted = highlightLine(cm, line, state, true);\n        line.styles = highlighted.styles;\n        var oldCls = line.styleClasses, newCls = highlighted.classes;\n        if (newCls) line.styleClasses = newCls;\n        else if (oldCls) line.styleClasses = null;\n        var ischange = !oldStyles || oldStyles.length != line.styles.length ||\n          oldCls != newCls && (!oldCls || !newCls || oldCls.bgClass != newCls.bgClass || oldCls.textClass != newCls.textClass);\n        for (var i = 0; !ischange && i < oldStyles.length; ++i) ischange = oldStyles[i] != line.styles[i];\n        if (ischange) changedLines.push(doc.frontier);\n        line.stateAfter = copyState(doc.mode, state);\n      } else {\n        processLine(cm, line.text, state);\n        line.stateAfter = doc.frontier % 5 == 0 ? copyState(doc.mode, state) : null;\n      }\n      ++doc.frontier;\n      if (+new Date > end) {\n        startWorker(cm, cm.options.workDelay);\n        return true;\n      }\n    });\n    if (changedLines.length) runInOp(cm, function() {\n      for (var i = 0; i < changedLines.length; i++)\n        regLineChange(cm, changedLines[i], \"text\");\n    });\n  }\n\n  // Finds the line to start with when starting a parse. Tries to\n  // find a line with a stateAfter, so that it can start with a\n  // valid state. If that fails, it returns the line with the\n  // smallest indentation, which tends to need the least context to\n  // parse correctly.\n  function findStartLine(cm, n, precise) {\n    var minindent, minline, doc = cm.doc;\n    var lim = precise ? -1 : n - (cm.doc.mode.innerMode ? 1000 : 100);\n    for (var search = n; search > lim; --search) {\n      if (search <= doc.first) return doc.first;\n      var line = getLine(doc, search - 1);\n      if (line.stateAfter && (!precise || search <= doc.frontier)) return search;\n      var indented = countColumn(line.text, null, cm.options.tabSize);\n      if (minline == null || minindent > indented) {\n        minline = search - 1;\n        minindent = indented;\n      }\n    }\n    return minline;\n  }\n\n  function getStateBefore(cm, n, precise) {\n    var doc = cm.doc, display = cm.display;\n    if (!doc.mode.startState) return true;\n    var pos = findStartLine(cm, n, precise), state = pos > doc.first && getLine(doc, pos-1).stateAfter;\n    if (!state) state = startState(doc.mode);\n    else state = copyState(doc.mode, state);\n    doc.iter(pos, n, function(line) {\n      processLine(cm, line.text, state);\n      var save = pos == n - 1 || pos % 5 == 0 || pos >= display.viewFrom && pos < display.viewTo;\n      line.stateAfter = save ? copyState(doc.mode, state) : null;\n      ++pos;\n    });\n    if (precise) doc.frontier = pos;\n    return state;\n  }\n\n  // POSITION MEASUREMENT\n\n  function paddingTop(display) {return display.lineSpace.offsetTop;}\n  function paddingVert(display) {return display.mover.offsetHeight - display.lineSpace.offsetHeight;}\n  function paddingH(display) {\n    if (display.cachedPaddingH) return display.cachedPaddingH;\n    var e = removeChildrenAndAdd(display.measure, elt(\"pre\", \"x\"));\n    var style = window.getComputedStyle ? window.getComputedStyle(e) : e.currentStyle;\n    var data = {left: parseInt(style.paddingLeft), right: parseInt(style.paddingRight)};\n    if (!isNaN(data.left) && !isNaN(data.right)) display.cachedPaddingH = data;\n    return data;\n  }\n\n  function scrollGap(cm) { return scrollerGap - cm.display.nativeBarWidth; }\n  function displayWidth(cm) {\n    return cm.display.scroller.clientWidth - scrollGap(cm) - cm.display.barWidth;\n  }\n  function displayHeight(cm) {\n    return cm.display.scroller.clientHeight - scrollGap(cm) - cm.display.barHeight;\n  }\n\n  // Ensure the lineView.wrapping.heights array is populated. This is\n  // an array of bottom offsets for the lines that make up a drawn\n  // line. When lineWrapping is on, there might be more than one\n  // height.\n  function ensureLineHeights(cm, lineView, rect) {\n    var wrapping = cm.options.lineWrapping;\n    var curWidth = wrapping && displayWidth(cm);\n    if (!lineView.measure.heights || wrapping && lineView.measure.width != curWidth) {\n      var heights = lineView.measure.heights = [];\n      if (wrapping) {\n        lineView.measure.width = curWidth;\n        var rects = lineView.text.firstChild.getClientRects();\n        for (var i = 0; i < rects.length - 1; i++) {\n          var cur = rects[i], next = rects[i + 1];\n          if (Math.abs(cur.bottom - next.bottom) > 2)\n            heights.push((cur.bottom + next.top) / 2 - rect.top);\n        }\n      }\n      heights.push(rect.bottom - rect.top);\n    }\n  }\n\n  // Find a line map (mapping character offsets to text nodes) and a\n  // measurement cache for the given line number. (A line view might\n  // contain multiple lines when collapsed ranges are present.)\n  function mapFromLineView(lineView, line, lineN) {\n    if (lineView.line == line)\n      return {map: lineView.measure.map, cache: lineView.measure.cache};\n    for (var i = 0; i < lineView.rest.length; i++)\n      if (lineView.rest[i] == line)\n        return {map: lineView.measure.maps[i], cache: lineView.measure.caches[i]};\n    for (var i = 0; i < lineView.rest.length; i++)\n      if (lineNo(lineView.rest[i]) > lineN)\n        return {map: lineView.measure.maps[i], cache: lineView.measure.caches[i], before: true};\n  }\n\n  // Render a line into the hidden node display.externalMeasured. Used\n  // when measurement is needed for a line that's not in the viewport.\n  function updateExternalMeasurement(cm, line) {\n    line = visualLine(line);\n    var lineN = lineNo(line);\n    var view = cm.display.externalMeasured = new LineView(cm.doc, line, lineN);\n    view.lineN = lineN;\n    var built = view.built = buildLineContent(cm, view);\n    view.text = built.pre;\n    removeChildrenAndAdd(cm.display.lineMeasure, built.pre);\n    return view;\n  }\n\n  // Get a {top, bottom, left, right} box (in line-local coordinates)\n  // for a given character.\n  function measureChar(cm, line, ch, bias) {\n    return measureCharPrepared(cm, prepareMeasureForLine(cm, line), ch, bias);\n  }\n\n  // Find a line view that corresponds to the given line number.\n  function findViewForLine(cm, lineN) {\n    if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)\n      return cm.display.view[findViewIndex(cm, lineN)];\n    var ext = cm.display.externalMeasured;\n    if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)\n      return ext;\n  }\n\n  // Measurement can be split in two steps, the set-up work that\n  // applies to the whole line, and the measurement of the actual\n  // character. Functions like coordsChar, that need to do a lot of\n  // measurements in a row, can thus ensure that the set-up work is\n  // only done once.\n  function prepareMeasureForLine(cm, line) {\n    var lineN = lineNo(line);\n    var view = findViewForLine(cm, lineN);\n    if (view && !view.text)\n      view = null;\n    else if (view && view.changes)\n      updateLineForChanges(cm, view, lineN, getDimensions(cm));\n    if (!view)\n      view = updateExternalMeasurement(cm, line);\n\n    var info = mapFromLineView(view, line, lineN);\n    return {\n      line: line, view: view, rect: null,\n      map: info.map, cache: info.cache, before: info.before,\n      hasHeights: false\n    };\n  }\n\n  // Given a prepared measurement object, measures the position of an\n  // actual character (or fetches it from the cache).\n  function measureCharPrepared(cm, prepared, ch, bias, varHeight) {\n    if (prepared.before) ch = -1;\n    var key = ch + (bias || \"\"), found;\n    if (prepared.cache.hasOwnProperty(key)) {\n      found = prepared.cache[key];\n    } else {\n      if (!prepared.rect)\n        prepared.rect = prepared.view.text.getBoundingClientRect();\n      if (!prepared.hasHeights) {\n        ensureLineHeights(cm, prepared.view, prepared.rect);\n        prepared.hasHeights = true;\n      }\n      found = measureCharInner(cm, prepared, ch, bias);\n      if (!found.bogus) prepared.cache[key] = found;\n    }\n    return {left: found.left, right: found.right,\n            top: varHeight ? found.rtop : found.top,\n            bottom: varHeight ? found.rbottom : found.bottom};\n  }\n\n  var nullRect = {left: 0, right: 0, top: 0, bottom: 0};\n\n  function nodeAndOffsetInLineMap(map, ch, bias) {\n    var node, start, end, collapse;\n    // First, search the line map for the text node corresponding to,\n    // or closest to, the target character.\n    for (var i = 0; i < map.length; i += 3) {\n      var mStart = map[i], mEnd = map[i + 1];\n      if (ch < mStart) {\n        start = 0; end = 1;\n        collapse = \"left\";\n      } else if (ch < mEnd) {\n        start = ch - mStart;\n        end = start + 1;\n      } else if (i == map.length - 3 || ch == mEnd && map[i + 3] > ch) {\n        end = mEnd - mStart;\n        start = end - 1;\n        if (ch >= mEnd) collapse = \"right\";\n      }\n      if (start != null) {\n        node = map[i + 2];\n        if (mStart == mEnd && bias == (node.insertLeft ? \"left\" : \"right\"))\n          collapse = bias;\n        if (bias == \"left\" && start == 0)\n          while (i && map[i - 2] == map[i - 3] && map[i - 1].insertLeft) {\n            node = map[(i -= 3) + 2];\n            collapse = \"left\";\n          }\n        if (bias == \"right\" && start == mEnd - mStart)\n          while (i < map.length - 3 && map[i + 3] == map[i + 4] && !map[i + 5].insertLeft) {\n            node = map[(i += 3) + 2];\n            collapse = \"right\";\n          }\n        break;\n      }\n    }\n    return {node: node, start: start, end: end, collapse: collapse, coverStart: mStart, coverEnd: mEnd};\n  }\n\n  function measureCharInner(cm, prepared, ch, bias) {\n    var place = nodeAndOffsetInLineMap(prepared.map, ch, bias);\n    var node = place.node, start = place.start, end = place.end, collapse = place.collapse;\n\n    var rect;\n    if (node.nodeType == 3) { // If it is a text node, use a range to retrieve the coordinates.\n      for (var i = 0; i < 4; i++) { // Retry a maximum of 4 times when nonsense rectangles are returned\n        while (start && isExtendingChar(prepared.line.text.charAt(place.coverStart + start))) --start;\n        while (place.coverStart + end < place.coverEnd && isExtendingChar(prepared.line.text.charAt(place.coverStart + end))) ++end;\n        if (ie && ie_version < 9 && start == 0 && end == place.coverEnd - place.coverStart) {\n          rect = node.parentNode.getBoundingClientRect();\n        } else if (ie && cm.options.lineWrapping) {\n          var rects = range(node, start, end).getClientRects();\n          if (rects.length)\n            rect = rects[bias == \"right\" ? rects.length - 1 : 0];\n          else\n            rect = nullRect;\n        } else {\n          rect = range(node, start, end).getBoundingClientRect() || nullRect;\n        }\n        if (rect.left || rect.right || start == 0) break;\n        end = start;\n        start = start - 1;\n        collapse = \"right\";\n      }\n      if (ie && ie_version < 11) rect = maybeUpdateRectForZooming(cm.display.measure, rect);\n    } else { // If it is a widget, simply get the box for the whole widget.\n      if (start > 0) collapse = bias = \"right\";\n      var rects;\n      if (cm.options.lineWrapping && (rects = node.getClientRects()).length > 1)\n        rect = rects[bias == \"right\" ? rects.length - 1 : 0];\n      else\n        rect = node.getBoundingClientRect();\n    }\n    if (ie && ie_version < 9 && !start && (!rect || !rect.left && !rect.right)) {\n      var rSpan = node.parentNode.getClientRects()[0];\n      if (rSpan)\n        rect = {left: rSpan.left, right: rSpan.left + charWidth(cm.display), top: rSpan.top, bottom: rSpan.bottom};\n      else\n        rect = nullRect;\n    }\n\n    var rtop = rect.top - prepared.rect.top, rbot = rect.bottom - prepared.rect.top;\n    var mid = (rtop + rbot) / 2;\n    var heights = prepared.view.measure.heights;\n    for (var i = 0; i < heights.length - 1; i++)\n      if (mid < heights[i]) break;\n    var top = i ? heights[i - 1] : 0, bot = heights[i];\n    var result = {left: (collapse == \"right\" ? rect.right : rect.left) - prepared.rect.left,\n                  right: (collapse == \"left\" ? rect.left : rect.right) - prepared.rect.left,\n                  top: top, bottom: bot};\n    if (!rect.left && !rect.right) result.bogus = true;\n    if (!cm.options.singleCursorHeightPerLine) { result.rtop = rtop; result.rbottom = rbot; }\n\n    return result;\n  }\n\n  // Work around problem with bounding client rects on ranges being\n  // returned incorrectly when zoomed on IE10 and below.\n  function maybeUpdateRectForZooming(measure, rect) {\n    if (!window.screen || screen.logicalXDPI == null ||\n        screen.logicalXDPI == screen.deviceXDPI || !hasBadZoomedRects(measure))\n      return rect;\n    var scaleX = screen.logicalXDPI / screen.deviceXDPI;\n    var scaleY = screen.logicalYDPI / screen.deviceYDPI;\n    return {left: rect.left * scaleX, right: rect.right * scaleX,\n            top: rect.top * scaleY, bottom: rect.bottom * scaleY};\n  }\n\n  function clearLineMeasurementCacheFor(lineView) {\n    if (lineView.measure) {\n      lineView.measure.cache = {};\n      lineView.measure.heights = null;\n      if (lineView.rest) for (var i = 0; i < lineView.rest.length; i++)\n        lineView.measure.caches[i] = {};\n    }\n  }\n\n  function clearLineMeasurementCache(cm) {\n    cm.display.externalMeasure = null;\n    removeChildren(cm.display.lineMeasure);\n    for (var i = 0; i < cm.display.view.length; i++)\n      clearLineMeasurementCacheFor(cm.display.view[i]);\n  }\n\n  function clearCaches(cm) {\n    clearLineMeasurementCache(cm);\n    cm.display.cachedCharWidth = cm.display.cachedTextHeight = cm.display.cachedPaddingH = null;\n    if (!cm.options.lineWrapping) cm.display.maxLineChanged = true;\n    cm.display.lineNumChars = null;\n  }\n\n  function pageScrollX() { return window.pageXOffset || (document.documentElement || document.body).scrollLeft; }\n  function pageScrollY() { return window.pageYOffset || (document.documentElement || document.body).scrollTop; }\n\n  // Converts a {top, bottom, left, right} box from line-local\n  // coordinates into another coordinate system. Context may be one of\n  // \"line\", \"div\" (display.lineDiv), \"local\"/null (editor), \"window\",\n  // or \"page\".\n  function intoCoordSystem(cm, lineObj, rect, context) {\n    if (lineObj.widgets) for (var i = 0; i < lineObj.widgets.length; ++i) if (lineObj.widgets[i].above) {\n      var size = widgetHeight(lineObj.widgets[i]);\n      rect.top += size; rect.bottom += size;\n    }\n    if (context == \"line\") return rect;\n    if (!context) context = \"local\";\n    var yOff = heightAtLine(lineObj);\n    if (context == \"local\") yOff += paddingTop(cm.display);\n    else yOff -= cm.display.viewOffset;\n    if (context == \"page\" || context == \"window\") {\n      var lOff = cm.display.lineSpace.getBoundingClientRect();\n      yOff += lOff.top + (context == \"window\" ? 0 : pageScrollY());\n      var xOff = lOff.left + (context == \"window\" ? 0 : pageScrollX());\n      rect.left += xOff; rect.right += xOff;\n    }\n    rect.top += yOff; rect.bottom += yOff;\n    return rect;\n  }\n\n  // Coverts a box from \"div\" coords to another coordinate system.\n  // Context may be \"window\", \"page\", \"div\", or \"local\"/null.\n  function fromCoordSystem(cm, coords, context) {\n    if (context == \"div\") return coords;\n    var left = coords.left, top = coords.top;\n    // First move into \"page\" coordinate system\n    if (context == \"page\") {\n      left -= pageScrollX();\n      top -= pageScrollY();\n    } else if (context == \"local\" || !context) {\n      var localBox = cm.display.sizer.getBoundingClientRect();\n      left += localBox.left;\n      top += localBox.top;\n    }\n\n    var lineSpaceBox = cm.display.lineSpace.getBoundingClientRect();\n    return {left: left - lineSpaceBox.left, top: top - lineSpaceBox.top};\n  }\n\n  function charCoords(cm, pos, context, lineObj, bias) {\n    if (!lineObj) lineObj = getLine(cm.doc, pos.line);\n    return intoCoordSystem(cm, lineObj, measureChar(cm, lineObj, pos.ch, bias), context);\n  }\n\n  // Returns a box for a given cursor position, which may have an\n  // 'other' property containing the position of the secondary cursor\n  // on a bidi boundary.\n  function cursorCoords(cm, pos, context, lineObj, preparedMeasure, varHeight) {\n    lineObj = lineObj || getLine(cm.doc, pos.line);\n    if (!preparedMeasure) preparedMeasure = prepareMeasureForLine(cm, lineObj);\n    function get(ch, right) {\n      var m = measureCharPrepared(cm, preparedMeasure, ch, right ? \"right\" : \"left\", varHeight);\n      if (right) m.left = m.right; else m.right = m.left;\n      return intoCoordSystem(cm, lineObj, m, context);\n    }\n    function getBidi(ch, partPos) {\n      var part = order[partPos], right = part.level % 2;\n      if (ch == bidiLeft(part) && partPos && part.level < order[partPos - 1].level) {\n        part = order[--partPos];\n        ch = bidiRight(part) - (part.level % 2 ? 0 : 1);\n        right = true;\n      } else if (ch == bidiRight(part) && partPos < order.length - 1 && part.level < order[partPos + 1].level) {\n        part = order[++partPos];\n        ch = bidiLeft(part) - part.level % 2;\n        right = false;\n      }\n      if (right && ch == part.to && ch > part.from) return get(ch - 1);\n      return get(ch, right);\n    }\n    var order = getOrder(lineObj), ch = pos.ch;\n    if (!order) return get(ch);\n    var partPos = getBidiPartAt(order, ch);\n    var val = getBidi(ch, partPos);\n    if (bidiOther != null) val.other = getBidi(ch, bidiOther);\n    return val;\n  }\n\n  // Used to cheaply estimate the coordinates for a position. Used for\n  // intermediate scroll updates.\n  function estimateCoords(cm, pos) {\n    var left = 0, pos = clipPos(cm.doc, pos);\n    if (!cm.options.lineWrapping) left = charWidth(cm.display) * pos.ch;\n    var lineObj = getLine(cm.doc, pos.line);\n    var top = heightAtLine(lineObj) + paddingTop(cm.display);\n    return {left: left, right: left, top: top, bottom: top + lineObj.height};\n  }\n\n  // Positions returned by coordsChar contain some extra information.\n  // xRel is the relative x position of the input coordinates compared\n  // to the found position (so xRel > 0 means the coordinates are to\n  // the right of the character position, for example). When outside\n  // is true, that means the coordinates lie outside the line's\n  // vertical range.\n  function PosWithInfo(line, ch, outside, xRel) {\n    var pos = Pos(line, ch);\n    pos.xRel = xRel;\n    if (outside) pos.outside = true;\n    return pos;\n  }\n\n  // Compute the character position closest to the given coordinates.\n  // Input must be lineSpace-local (\"div\" coordinate system).\n  function coordsChar(cm, x, y) {\n    var doc = cm.doc;\n    y += cm.display.viewOffset;\n    if (y < 0) return PosWithInfo(doc.first, 0, true, -1);\n    var lineN = lineAtHeight(doc, y), last = doc.first + doc.size - 1;\n    if (lineN > last)\n      return PosWithInfo(doc.first + doc.size - 1, getLine(doc, last).text.length, true, 1);\n    if (x < 0) x = 0;\n\n    var lineObj = getLine(doc, lineN);\n    for (;;) {\n      var found = coordsCharInner(cm, lineObj, lineN, x, y);\n      var merged = collapsedSpanAtEnd(lineObj);\n      var mergedPos = merged && merged.find(0, true);\n      if (merged && (found.ch > mergedPos.from.ch || found.ch == mergedPos.from.ch && found.xRel > 0))\n        lineN = lineNo(lineObj = mergedPos.to.line);\n      else\n        return found;\n    }\n  }\n\n  function coordsCharInner(cm, lineObj, lineNo, x, y) {\n    var innerOff = y - heightAtLine(lineObj);\n    var wrongLine = false, adjust = 2 * cm.display.wrapper.clientWidth;\n    var preparedMeasure = prepareMeasureForLine(cm, lineObj);\n\n    function getX(ch) {\n      var sp = cursorCoords(cm, Pos(lineNo, ch), \"line\", lineObj, preparedMeasure);\n      wrongLine = true;\n      if (innerOff > sp.bottom) return sp.left - adjust;\n      else if (innerOff < sp.top) return sp.left + adjust;\n      else wrongLine = false;\n      return sp.left;\n    }\n\n    var bidi = getOrder(lineObj), dist = lineObj.text.length;\n    var from = lineLeft(lineObj), to = lineRight(lineObj);\n    var fromX = getX(from), fromOutside = wrongLine, toX = getX(to), toOutside = wrongLine;\n\n    if (x > toX) return PosWithInfo(lineNo, to, toOutside, 1);\n    // Do a binary search between these bounds.\n    for (;;) {\n      if (bidi ? to == from || to == moveVisually(lineObj, from, 1) : to - from <= 1) {\n        var ch = x < fromX || x - fromX <= toX - x ? from : to;\n        var xDiff = x - (ch == from ? fromX : toX);\n        while (isExtendingChar(lineObj.text.charAt(ch))) ++ch;\n        var pos = PosWithInfo(lineNo, ch, ch == from ? fromOutside : toOutside,\n                              xDiff < -1 ? -1 : xDiff > 1 ? 1 : 0);\n        return pos;\n      }\n      var step = Math.ceil(dist / 2), middle = from + step;\n      if (bidi) {\n        middle = from;\n        for (var i = 0; i < step; ++i) middle = moveVisually(lineObj, middle, 1);\n      }\n      var middleX = getX(middle);\n      if (middleX > x) {to = middle; toX = middleX; if (toOutside = wrongLine) toX += 1000; dist = step;}\n      else {from = middle; fromX = middleX; fromOutside = wrongLine; dist -= step;}\n    }\n  }\n\n  var measureText;\n  // Compute the default text height.\n  function textHeight(display) {\n    if (display.cachedTextHeight != null) return display.cachedTextHeight;\n    if (measureText == null) {\n      measureText = elt(\"pre\");\n      // Measure a bunch of lines, for browsers that compute\n      // fractional heights.\n      for (var i = 0; i < 49; ++i) {\n        measureText.appendChild(document.createTextNode(\"x\"));\n        measureText.appendChild(elt(\"br\"));\n      }\n      measureText.appendChild(document.createTextNode(\"x\"));\n    }\n    removeChildrenAndAdd(display.measure, measureText);\n    var height = measureText.offsetHeight / 50;\n    if (height > 3) display.cachedTextHeight = height;\n    removeChildren(display.measure);\n    return height || 1;\n  }\n\n  // Compute the default character width.\n  function charWidth(display) {\n    if (display.cachedCharWidth != null) return display.cachedCharWidth;\n    var anchor = elt(\"span\", \"xxxxxxxxxx\");\n    var pre = elt(\"pre\", [anchor]);\n    removeChildrenAndAdd(display.measure, pre);\n    var rect = anchor.getBoundingClientRect(), width = (rect.right - rect.left) / 10;\n    if (width > 2) display.cachedCharWidth = width;\n    return width || 10;\n  }\n\n  // OPERATIONS\n\n  // Operations are used to wrap a series of changes to the editor\n  // state in such a way that each change won't have to update the\n  // cursor and display (which would be awkward, slow, and\n  // error-prone). Instead, display updates are batched and then all\n  // combined and executed at once.\n\n  var operationGroup = null;\n\n  var nextOpId = 0;\n  // Start a new operation.\n  function startOperation(cm) {\n    cm.curOp = {\n      cm: cm,\n      viewChanged: false,      // Flag that indicates that lines might need to be redrawn\n      startHeight: cm.doc.height, // Used to detect need to update scrollbar\n      forceUpdate: false,      // Used to force a redraw\n      updateInput: null,       // Whether to reset the input textarea\n      typing: false,           // Whether this reset should be careful to leave existing text (for compositing)\n      changeObjs: null,        // Accumulated changes, for firing change events\n      cursorActivityHandlers: null, // Set of handlers to fire cursorActivity on\n      cursorActivityCalled: 0, // Tracks which cursorActivity handlers have been called already\n      selectionChanged: false, // Whether the selection needs to be redrawn\n      updateMaxLine: false,    // Set when the widest line needs to be determined anew\n      scrollLeft: null, scrollTop: null, // Intermediate scroll position, not pushed to DOM yet\n      scrollToPos: null,       // Used to scroll to a specific position\n      focus: false,\n      id: ++nextOpId           // Unique ID\n    };\n    if (operationGroup) {\n      operationGroup.ops.push(cm.curOp);\n    } else {\n      cm.curOp.ownsGroup = operationGroup = {\n        ops: [cm.curOp],\n        delayedCallbacks: []\n      };\n    }\n  }\n\n  function fireCallbacksForOps(group) {\n    // Calls delayed callbacks and cursorActivity handlers until no\n    // new ones appear\n    var callbacks = group.delayedCallbacks, i = 0;\n    do {\n      for (; i < callbacks.length; i++)\n        callbacks[i]();\n      for (var j = 0; j < group.ops.length; j++) {\n        var op = group.ops[j];\n        if (op.cursorActivityHandlers)\n          while (op.cursorActivityCalled < op.cursorActivityHandlers.length)\n            op.cursorActivityHandlers[op.cursorActivityCalled++](op.cm);\n      }\n    } while (i < callbacks.length);\n  }\n\n  // Finish an operation, updating the display and signalling delayed events\n  function endOperation(cm) {\n    var op = cm.curOp, group = op.ownsGroup;\n    if (!group) return;\n\n    try { fireCallbacksForOps(group); }\n    finally {\n      operationGroup = null;\n      for (var i = 0; i < group.ops.length; i++)\n        group.ops[i].cm.curOp = null;\n      endOperations(group);\n    }\n  }\n\n  // The DOM updates done when an operation finishes are batched so\n  // that the minimum number of relayouts are required.\n  function endOperations(group) {\n    var ops = group.ops;\n    for (var i = 0; i < ops.length; i++) // Read DOM\n      endOperation_R1(ops[i]);\n    for (var i = 0; i < ops.length; i++) // Write DOM (maybe)\n      endOperation_W1(ops[i]);\n    for (var i = 0; i < ops.length; i++) // Read DOM\n      endOperation_R2(ops[i]);\n    for (var i = 0; i < ops.length; i++) // Write DOM (maybe)\n      endOperation_W2(ops[i]);\n    for (var i = 0; i < ops.length; i++) // Read DOM\n      endOperation_finish(ops[i]);\n  }\n\n  function endOperation_R1(op) {\n    var cm = op.cm, display = cm.display;\n    maybeClipScrollbars(cm);\n    if (op.updateMaxLine) findMaxLine(cm);\n\n    op.mustUpdate = op.viewChanged || op.forceUpdate || op.scrollTop != null ||\n      op.scrollToPos && (op.scrollToPos.from.line < display.viewFrom ||\n                         op.scrollToPos.to.line >= display.viewTo) ||\n      display.maxLineChanged && cm.options.lineWrapping;\n    op.update = op.mustUpdate &&\n      new DisplayUpdate(cm, op.mustUpdate && {top: op.scrollTop, ensure: op.scrollToPos}, op.forceUpdate);\n  }\n\n  function endOperation_W1(op) {\n    op.updatedDisplay = op.mustUpdate && updateDisplayIfNeeded(op.cm, op.update);\n  }\n\n  function endOperation_R2(op) {\n    var cm = op.cm, display = cm.display;\n    if (op.updatedDisplay) updateHeightsInViewport(cm);\n\n    op.barMeasure = measureForScrollbars(cm);\n\n    // If the max line changed since it was last measured, measure it,\n    // and ensure the document's width matches it.\n    // updateDisplay_W2 will use these properties to do the actual resizing\n    if (display.maxLineChanged && !cm.options.lineWrapping) {\n      op.adjustWidthTo = measureChar(cm, display.maxLine, display.maxLine.text.length).left + 3;\n      cm.display.sizerWidth = op.adjustWidthTo;\n      op.barMeasure.scrollWidth =\n        Math.max(display.scroller.clientWidth, display.sizer.offsetLeft + op.adjustWidthTo + scrollGap(cm) + cm.display.barWidth);\n      op.maxScrollLeft = Math.max(0, display.sizer.offsetLeft + op.adjustWidthTo - displayWidth(cm));\n    }\n\n    if (op.updatedDisplay || op.selectionChanged)\n      op.preparedSelection = display.input.prepareSelection();\n  }\n\n  function endOperation_W2(op) {\n    var cm = op.cm;\n\n    if (op.adjustWidthTo != null) {\n      cm.display.sizer.style.minWidth = op.adjustWidthTo + \"px\";\n      if (op.maxScrollLeft < cm.doc.scrollLeft)\n        setScrollLeft(cm, Math.min(cm.display.scroller.scrollLeft, op.maxScrollLeft), true);\n      cm.display.maxLineChanged = false;\n    }\n\n    if (op.preparedSelection)\n      cm.display.input.showSelection(op.preparedSelection);\n    if (op.updatedDisplay)\n      setDocumentHeight(cm, op.barMeasure);\n    if (op.updatedDisplay || op.startHeight != cm.doc.height)\n      updateScrollbars(cm, op.barMeasure);\n\n    if (op.selectionChanged) restartBlink(cm);\n\n    if (cm.state.focused && op.updateInput)\n      cm.display.input.reset(op.typing);\n    if (op.focus && op.focus == activeElt()) ensureFocus(op.cm);\n  }\n\n  function endOperation_finish(op) {\n    var cm = op.cm, display = cm.display, doc = cm.doc;\n\n    if (op.updatedDisplay) postUpdateDisplay(cm, op.update);\n\n    // Abort mouse wheel delta measurement, when scrolling explicitly\n    if (display.wheelStartX != null && (op.scrollTop != null || op.scrollLeft != null || op.scrollToPos))\n      display.wheelStartX = display.wheelStartY = null;\n\n    // Propagate the scroll position to the actual DOM scroller\n    if (op.scrollTop != null && (display.scroller.scrollTop != op.scrollTop || op.forceScroll)) {\n      doc.scrollTop = Math.max(0, Math.min(display.scroller.scrollHeight - display.scroller.clientHeight, op.scrollTop));\n      display.scrollbars.setScrollTop(doc.scrollTop);\n      display.scroller.scrollTop = doc.scrollTop;\n    }\n    if (op.scrollLeft != null && (display.scroller.scrollLeft != op.scrollLeft || op.forceScroll)) {\n      doc.scrollLeft = Math.max(0, Math.min(display.scroller.scrollWidth - displayWidth(cm), op.scrollLeft));\n      display.scrollbars.setScrollLeft(doc.scrollLeft);\n      display.scroller.scrollLeft = doc.scrollLeft;\n      alignHorizontally(cm);\n    }\n    // If we need to scroll a specific position into view, do so.\n    if (op.scrollToPos) {\n      var coords = scrollPosIntoView(cm, clipPos(doc, op.scrollToPos.from),\n                                     clipPos(doc, op.scrollToPos.to), op.scrollToPos.margin);\n      if (op.scrollToPos.isCursor && cm.state.focused) maybeScrollWindow(cm, coords);\n    }\n\n    // Fire events for markers that are hidden/unidden by editing or\n    // undoing\n    var hidden = op.maybeHiddenMarkers, unhidden = op.maybeUnhiddenMarkers;\n    if (hidden) for (var i = 0; i < hidden.length; ++i)\n      if (!hidden[i].lines.length) signal(hidden[i], \"hide\");\n    if (unhidden) for (var i = 0; i < unhidden.length; ++i)\n      if (unhidden[i].lines.length) signal(unhidden[i], \"unhide\");\n\n    if (display.wrapper.offsetHeight)\n      doc.scrollTop = cm.display.scroller.scrollTop;\n\n    // Fire change events, and delayed event handlers\n    if (op.changeObjs)\n      signal(cm, \"changes\", cm, op.changeObjs);\n    if (op.update)\n      op.update.finish();\n  }\n\n  // Run the given function in an operation\n  function runInOp(cm, f) {\n    if (cm.curOp) return f();\n    startOperation(cm);\n    try { return f(); }\n    finally { endOperation(cm); }\n  }\n  // Wraps a function in an operation. Returns the wrapped function.\n  function operation(cm, f) {\n    return function() {\n      if (cm.curOp) return f.apply(cm, arguments);\n      startOperation(cm);\n      try { return f.apply(cm, arguments); }\n      finally { endOperation(cm); }\n    };\n  }\n  // Used to add methods to editor and doc instances, wrapping them in\n  // operations.\n  function methodOp(f) {\n    return function() {\n      if (this.curOp) return f.apply(this, arguments);\n      startOperation(this);\n      try { return f.apply(this, arguments); }\n      finally { endOperation(this); }\n    };\n  }\n  function docMethodOp(f) {\n    return function() {\n      var cm = this.cm;\n      if (!cm || cm.curOp) return f.apply(this, arguments);\n      startOperation(cm);\n      try { return f.apply(this, arguments); }\n      finally { endOperation(cm); }\n    };\n  }\n\n  // VIEW TRACKING\n\n  // These objects are used to represent the visible (currently drawn)\n  // part of the document. A LineView may correspond to multiple\n  // logical lines, if those are connected by collapsed ranges.\n  function LineView(doc, line, lineN) {\n    // The starting line\n    this.line = line;\n    // Continuing lines, if any\n    this.rest = visualLineContinued(line);\n    // Number of logical lines in this visual line\n    this.size = this.rest ? lineNo(lst(this.rest)) - lineN + 1 : 1;\n    this.node = this.text = null;\n    this.hidden = lineIsHidden(doc, line);\n  }\n\n  // Create a range of LineView objects for the given lines.\n  function buildViewArray(cm, from, to) {\n    var array = [], nextPos;\n    for (var pos = from; pos < to; pos = nextPos) {\n      var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);\n      nextPos = pos + view.size;\n      array.push(view);\n    }\n    return array;\n  }\n\n  // Updates the display.view data structure for a given change to the\n  // document. From and to are in pre-change coordinates. Lendiff is\n  // the amount of lines added or subtracted by the change. This is\n  // used for changes that span multiple lines, or change the way\n  // lines are divided into visual lines. regLineChange (below)\n  // registers single-line changes.\n  function regChange(cm, from, to, lendiff) {\n    if (from == null) from = cm.doc.first;\n    if (to == null) to = cm.doc.first + cm.doc.size;\n    if (!lendiff) lendiff = 0;\n\n    var display = cm.display;\n    if (lendiff && to < display.viewTo &&\n        (display.updateLineNumbers == null || display.updateLineNumbers > from))\n      display.updateLineNumbers = from;\n\n    cm.curOp.viewChanged = true;\n\n    if (from >= display.viewTo) { // Change after\n      if (sawCollapsedSpans && visualLineNo(cm.doc, from) < display.viewTo)\n        resetView(cm);\n    } else if (to <= display.viewFrom) { // Change before\n      if (sawCollapsedSpans && visualLineEndNo(cm.doc, to + lendiff) > display.viewFrom) {\n        resetView(cm);\n      } else {\n        display.viewFrom += lendiff;\n        display.viewTo += lendiff;\n      }\n    } else if (from <= display.viewFrom && to >= display.viewTo) { // Full overlap\n      resetView(cm);\n    } else if (from <= display.viewFrom) { // Top overlap\n      var cut = viewCuttingPoint(cm, to, to + lendiff, 1);\n      if (cut) {\n        display.view = display.view.slice(cut.index);\n        display.viewFrom = cut.lineN;\n        display.viewTo += lendiff;\n      } else {\n        resetView(cm);\n      }\n    } else if (to >= display.viewTo) { // Bottom overlap\n      var cut = viewCuttingPoint(cm, from, from, -1);\n      if (cut) {\n        display.view = display.view.slice(0, cut.index);\n        display.viewTo = cut.lineN;\n      } else {\n        resetView(cm);\n      }\n    } else { // Gap in the middle\n      var cutTop = viewCuttingPoint(cm, from, from, -1);\n      var cutBot = viewCuttingPoint(cm, to, to + lendiff, 1);\n      if (cutTop && cutBot) {\n        display.view = display.view.slice(0, cutTop.index)\n          .concat(buildViewArray(cm, cutTop.lineN, cutBot.lineN))\n          .concat(display.view.slice(cutBot.index));\n        display.viewTo += lendiff;\n      } else {\n        resetView(cm);\n      }\n    }\n\n    var ext = display.externalMeasured;\n    if (ext) {\n      if (to < ext.lineN)\n        ext.lineN += lendiff;\n      else if (from < ext.lineN + ext.size)\n        display.externalMeasured = null;\n    }\n  }\n\n  // Register a change to a single line. Type must be one of \"text\",\n  // \"gutter\", \"class\", \"widget\"\n  function regLineChange(cm, line, type) {\n    cm.curOp.viewChanged = true;\n    var display = cm.display, ext = cm.display.externalMeasured;\n    if (ext && line >= ext.lineN && line < ext.lineN + ext.size)\n      display.externalMeasured = null;\n\n    if (line < display.viewFrom || line >= display.viewTo) return;\n    var lineView = display.view[findViewIndex(cm, line)];\n    if (lineView.node == null) return;\n    var arr = lineView.changes || (lineView.changes = []);\n    if (indexOf(arr, type) == -1) arr.push(type);\n  }\n\n  // Clear the view.\n  function resetView(cm) {\n    cm.display.viewFrom = cm.display.viewTo = cm.doc.first;\n    cm.display.view = [];\n    cm.display.viewOffset = 0;\n  }\n\n  // Find the view element corresponding to a given line. Return null\n  // when the line isn't visible.\n  function findViewIndex(cm, n) {\n    if (n >= cm.display.viewTo) return null;\n    n -= cm.display.viewFrom;\n    if (n < 0) return null;\n    var view = cm.display.view;\n    for (var i = 0; i < view.length; i++) {\n      n -= view[i].size;\n      if (n < 0) return i;\n    }\n  }\n\n  function viewCuttingPoint(cm, oldN, newN, dir) {\n    var index = findViewIndex(cm, oldN), diff, view = cm.display.view;\n    if (!sawCollapsedSpans || newN == cm.doc.first + cm.doc.size)\n      return {index: index, lineN: newN};\n    for (var i = 0, n = cm.display.viewFrom; i < index; i++)\n      n += view[i].size;\n    if (n != oldN) {\n      if (dir > 0) {\n        if (index == view.length - 1) return null;\n        diff = (n + view[index].size) - oldN;\n        index++;\n      } else {\n        diff = n - oldN;\n      }\n      oldN += diff; newN += diff;\n    }\n    while (visualLineNo(cm.doc, newN) != newN) {\n      if (index == (dir < 0 ? 0 : view.length - 1)) return null;\n      newN += dir * view[index - (dir < 0 ? 1 : 0)].size;\n      index += dir;\n    }\n    return {index: index, lineN: newN};\n  }\n\n  // Force the view to cover a given range, adding empty view element\n  // or clipping off existing ones as needed.\n  function adjustView(cm, from, to) {\n    var display = cm.display, view = display.view;\n    if (view.length == 0 || from >= display.viewTo || to <= display.viewFrom) {\n      display.view = buildViewArray(cm, from, to);\n      display.viewFrom = from;\n    } else {\n      if (display.viewFrom > from)\n        display.view = buildViewArray(cm, from, display.viewFrom).concat(display.view);\n      else if (display.viewFrom < from)\n        display.view = display.view.slice(findViewIndex(cm, from));\n      display.viewFrom = from;\n      if (display.viewTo < to)\n        display.view = display.view.concat(buildViewArray(cm, display.viewTo, to));\n      else if (display.viewTo > to)\n        display.view = display.view.slice(0, findViewIndex(cm, to));\n    }\n    display.viewTo = to;\n  }\n\n  // Count the number of lines in the view whose DOM representation is\n  // out of date (or nonexistent).\n  function countDirtyView(cm) {\n    var view = cm.display.view, dirty = 0;\n    for (var i = 0; i < view.length; i++) {\n      var lineView = view[i];\n      if (!lineView.hidden && (!lineView.node || lineView.changes)) ++dirty;\n    }\n    return dirty;\n  }\n\n  // EVENT HANDLERS\n\n  // Attach the necessary event handlers when initializing the editor\n  function registerEventHandlers(cm) {\n    var d = cm.display;\n    on(d.scroller, \"mousedown\", operation(cm, onMouseDown));\n    // Older IE's will not fire a second mousedown for a double click\n    if (ie && ie_version < 11)\n      on(d.scroller, \"dblclick\", operation(cm, function(e) {\n        if (signalDOMEvent(cm, e)) return;\n        var pos = posFromMouse(cm, e);\n        if (!pos || clickInGutter(cm, e) || eventInWidget(cm.display, e)) return;\n        e_preventDefault(e);\n        var word = cm.findWordAt(pos);\n        extendSelection(cm.doc, word.anchor, word.head);\n      }));\n    else\n      on(d.scroller, \"dblclick\", function(e) { signalDOMEvent(cm, e) || e_preventDefault(e); });\n    // Some browsers fire contextmenu *after* opening the menu, at\n    // which point we can't mess with it anymore. Context menu is\n    // handled in onMouseDown for these browsers.\n    if (!captureRightClick) on(d.scroller, \"contextmenu\", function(e) {onContextMenu(cm, e);});\n\n    // Used to suppress mouse event handling when a touch happens\n    var touchFinished, prevTouch = {end: 0};\n    function finishTouch() {\n      if (d.activeTouch) {\n        touchFinished = setTimeout(function() {d.activeTouch = null;}, 1000);\n        prevTouch = d.activeTouch;\n        prevTouch.end = +new Date;\n      }\n    };\n    function isMouseLikeTouchEvent(e) {\n      if (e.touches.length != 1) return false;\n      var touch = e.touches[0];\n      return touch.radiusX <= 1 && touch.radiusY <= 1;\n    }\n    function farAway(touch, other) {\n      if (other.left == null) return true;\n      var dx = other.left - touch.left, dy = other.top - touch.top;\n      return dx * dx + dy * dy > 20 * 20;\n    }\n    on(d.scroller, \"touchstart\", function(e) {\n      if (!isMouseLikeTouchEvent(e)) {\n        clearTimeout(touchFinished);\n        var now = +new Date;\n        d.activeTouch = {start: now, moved: false,\n                         prev: now - prevTouch.end <= 300 ? prevTouch : null};\n        if (e.touches.length == 1) {\n          d.activeTouch.left = e.touches[0].pageX;\n          d.activeTouch.top = e.touches[0].pageY;\n        }\n      }\n    });\n    on(d.scroller, \"touchmove\", function() {\n      if (d.activeTouch) d.activeTouch.moved = true;\n    });\n    on(d.scroller, \"touchend\", function(e) {\n      var touch = d.activeTouch;\n      if (touch && !eventInWidget(d, e) && touch.left != null &&\n          !touch.moved && new Date - touch.start < 300) {\n        var pos = cm.coordsChar(d.activeTouch, \"page\"), range;\n        if (!touch.prev || farAway(touch, touch.prev)) // Single tap\n          range = new Range(pos, pos);\n        else if (!touch.prev.prev || farAway(touch, touch.prev.prev)) // Double tap\n          range = cm.findWordAt(pos);\n        else // Triple tap\n          range = new Range(Pos(pos.line, 0), clipPos(cm.doc, Pos(pos.line + 1, 0)));\n        cm.setSelection(range.anchor, range.head);\n        cm.focus();\n        e_preventDefault(e);\n      }\n      finishTouch();\n    });\n    on(d.scroller, \"touchcancel\", finishTouch);\n\n    // Sync scrolling between fake scrollbars and real scrollable\n    // area, ensure viewport is updated when scrolling.\n    on(d.scroller, \"scroll\", function() {\n      if (d.scroller.clientHeight) {\n        setScrollTop(cm, d.scroller.scrollTop);\n        setScrollLeft(cm, d.scroller.scrollLeft, true);\n        signal(cm, \"scroll\", cm);\n      }\n    });\n\n    // Listen to wheel events in order to try and update the viewport on time.\n    on(d.scroller, \"mousewheel\", function(e){onScrollWheel(cm, e);});\n    on(d.scroller, \"DOMMouseScroll\", function(e){onScrollWheel(cm, e);});\n\n    // Prevent wrapper from ever scrolling\n    on(d.wrapper, \"scroll\", function() { d.wrapper.scrollTop = d.wrapper.scrollLeft = 0; });\n\n    d.dragFunctions = {\n      simple: function(e) {if (!signalDOMEvent(cm, e)) e_stop(e);},\n      start: function(e){onDragStart(cm, e);},\n      drop: operation(cm, onDrop)\n    };\n\n    var inp = d.input.getField();\n    on(inp, \"keyup\", function(e) { onKeyUp.call(cm, e); });\n    on(inp, \"keydown\", operation(cm, onKeyDown));\n    on(inp, \"keypress\", operation(cm, onKeyPress));\n    on(inp, \"focus\", bind(onFocus, cm));\n    on(inp, \"blur\", bind(onBlur, cm));\n  }\n\n  function dragDropChanged(cm, value, old) {\n    var wasOn = old && old != CodeMirror.Init;\n    if (!value != !wasOn) {\n      var funcs = cm.display.dragFunctions;\n      var toggle = value ? on : off;\n      toggle(cm.display.scroller, \"dragstart\", funcs.start);\n      toggle(cm.display.scroller, \"dragenter\", funcs.simple);\n      toggle(cm.display.scroller, \"dragover\", funcs.simple);\n      toggle(cm.display.scroller, \"drop\", funcs.drop);\n    }\n  }\n\n  // Called when the window resizes\n  function onResize(cm) {\n    var d = cm.display;\n    if (d.lastWrapHeight == d.wrapper.clientHeight && d.lastWrapWidth == d.wrapper.clientWidth)\n      return;\n    // Might be a text scaling operation, clear size caches.\n    d.cachedCharWidth = d.cachedTextHeight = d.cachedPaddingH = null;\n    d.scrollbarsClipped = false;\n    cm.setSize();\n  }\n\n  // MOUSE EVENTS\n\n  // Return true when the given mouse event happened in a widget\n  function eventInWidget(display, e) {\n    for (var n = e_target(e); n != display.wrapper; n = n.parentNode) {\n      if (!n || (n.nodeType == 1 && n.getAttribute(\"cm-ignore-events\") == \"true\") ||\n          (n.parentNode == display.sizer && n != display.mover))\n        return true;\n    }\n  }\n\n  // Given a mouse event, find the corresponding position. If liberal\n  // is false, it checks whether a gutter or scrollbar was clicked,\n  // and returns null if it was. forRect is used by rectangular\n  // selections, and tries to estimate a character position even for\n  // coordinates beyond the right of the text.\n  function posFromMouse(cm, e, liberal, forRect) {\n    var display = cm.display;\n    if (!liberal && e_target(e).getAttribute(\"cm-not-content\") == \"true\") return null;\n\n    var x, y, space = display.lineSpace.getBoundingClientRect();\n    // Fails unpredictably on IE[67] when mouse is dragged around quickly.\n    try { x = e.clientX - space.left; y = e.clientY - space.top; }\n    catch (e) { return null; }\n    var coords = coordsChar(cm, x, y), line;\n    if (forRect && coords.xRel == 1 && (line = getLine(cm.doc, coords.line).text).length == coords.ch) {\n      var colDiff = countColumn(line, line.length, cm.options.tabSize) - line.length;\n      coords = Pos(coords.line, Math.max(0, Math.round((x - paddingH(cm.display).left) / charWidth(cm.display)) - colDiff));\n    }\n    return coords;\n  }\n\n  // A mouse down can be a single click, double click, triple click,\n  // start of selection drag, start of text drag, new cursor\n  // (ctrl-click), rectangle drag (alt-drag), or xwin\n  // middle-click-paste. Or it might be a click on something we should\n  // not interfere with, such as a scrollbar or widget.\n  function onMouseDown(e) {\n    var cm = this, display = cm.display;\n    if (display.activeTouch && display.input.supportsTouch() || signalDOMEvent(cm, e)) return;\n    display.shift = e.shiftKey;\n\n    if (eventInWidget(display, e)) {\n      if (!webkit) {\n        // Briefly turn off draggability, to allow widgets to do\n        // normal dragging things.\n        display.scroller.draggable = false;\n        setTimeout(function(){display.scroller.draggable = true;}, 100);\n      }\n      return;\n    }\n    if (clickInGutter(cm, e)) return;\n    var start = posFromMouse(cm, e);\n    window.focus();\n\n    switch (e_button(e)) {\n    case 1:\n      if (start)\n        leftButtonDown(cm, e, start);\n      else if (e_target(e) == display.scroller)\n        e_preventDefault(e);\n      break;\n    case 2:\n      if (webkit) cm.state.lastMiddleDown = +new Date;\n      if (start) extendSelection(cm.doc, start);\n      setTimeout(function() {display.input.focus();}, 20);\n      e_preventDefault(e);\n      break;\n    case 3:\n      if (captureRightClick) onContextMenu(cm, e);\n      else delayBlurEvent(cm);\n      break;\n    }\n  }\n\n  var lastClick, lastDoubleClick;\n  function leftButtonDown(cm, e, start) {\n    if (ie) setTimeout(bind(ensureFocus, cm), 0);\n    else cm.curOp.focus = activeElt();\n\n    var now = +new Date, type;\n    if (lastDoubleClick && lastDoubleClick.time > now - 400 && cmp(lastDoubleClick.pos, start) == 0) {\n      type = \"triple\";\n    } else if (lastClick && lastClick.time > now - 400 && cmp(lastClick.pos, start) == 0) {\n      type = \"double\";\n      lastDoubleClick = {time: now, pos: start};\n    } else {\n      type = \"single\";\n      lastClick = {time: now, pos: start};\n    }\n\n    var sel = cm.doc.sel, modifier = mac ? e.metaKey : e.ctrlKey, contained;\n    if (cm.options.dragDrop && dragAndDrop && !isReadOnly(cm) &&\n        type == \"single\" && (contained = sel.contains(start)) > -1 &&\n        !sel.ranges[contained].empty())\n      leftButtonStartDrag(cm, e, start, modifier);\n    else\n      leftButtonSelect(cm, e, start, type, modifier);\n  }\n\n  // Start a text drag. When it ends, see if any dragging actually\n  // happen, and treat as a click if it didn't.\n  function leftButtonStartDrag(cm, e, start, modifier) {\n    var display = cm.display, startTime = +new Date;\n    var dragEnd = operation(cm, function(e2) {\n      if (webkit) display.scroller.draggable = false;\n      cm.state.draggingText = false;\n      off(document, \"mouseup\", dragEnd);\n      off(display.scroller, \"drop\", dragEnd);\n      if (Math.abs(e.clientX - e2.clientX) + Math.abs(e.clientY - e2.clientY) < 10) {\n        e_preventDefault(e2);\n        if (!modifier && +new Date - 200 < startTime)\n          extendSelection(cm.doc, start);\n        // Work around unexplainable focus problem in IE9 (#2127) and Chrome (#3081)\n        if (webkit || ie && ie_version == 9)\n          setTimeout(function() {document.body.focus(); display.input.focus();}, 20);\n        else\n          display.input.focus();\n      }\n    });\n    // Let the drag handler handle this.\n    if (webkit) display.scroller.draggable = true;\n    cm.state.draggingText = dragEnd;\n    // IE's approach to draggable\n    if (display.scroller.dragDrop) display.scroller.dragDrop();\n    on(document, \"mouseup\", dragEnd);\n    on(display.scroller, \"drop\", dragEnd);\n  }\n\n  // Normal selection, as opposed to text dragging.\n  function leftButtonSelect(cm, e, start, type, addNew) {\n    var display = cm.display, doc = cm.doc;\n    e_preventDefault(e);\n\n    var ourRange, ourIndex, startSel = doc.sel, ranges = startSel.ranges;\n    if (addNew && !e.shiftKey) {\n      ourIndex = doc.sel.contains(start);\n      if (ourIndex > -1)\n        ourRange = ranges[ourIndex];\n      else\n        ourRange = new Range(start, start);\n    } else {\n      ourRange = doc.sel.primary();\n      ourIndex = doc.sel.primIndex;\n    }\n\n    if (e.altKey) {\n      type = \"rect\";\n      if (!addNew) ourRange = new Range(start, start);\n      start = posFromMouse(cm, e, true, true);\n      ourIndex = -1;\n    } else if (type == \"double\") {\n      var word = cm.findWordAt(start);\n      if (cm.display.shift || doc.extend)\n        ourRange = extendRange(doc, ourRange, word.anchor, word.head);\n      else\n        ourRange = word;\n    } else if (type == \"triple\") {\n      var line = new Range(Pos(start.line, 0), clipPos(doc, Pos(start.line + 1, 0)));\n      if (cm.display.shift || doc.extend)\n        ourRange = extendRange(doc, ourRange, line.anchor, line.head);\n      else\n        ourRange = line;\n    } else {\n      ourRange = extendRange(doc, ourRange, start);\n    }\n\n    if (!addNew) {\n      ourIndex = 0;\n      setSelection(doc, new Selection([ourRange], 0), sel_mouse);\n      startSel = doc.sel;\n    } else if (ourIndex == -1) {\n      ourIndex = ranges.length;\n      setSelection(doc, normalizeSelection(ranges.concat([ourRange]), ourIndex),\n                   {scroll: false, origin: \"*mouse\"});\n    } else if (ranges.length > 1 && ranges[ourIndex].empty() && type == \"single\" && !e.shiftKey) {\n      setSelection(doc, normalizeSelection(ranges.slice(0, ourIndex).concat(ranges.slice(ourIndex + 1)), 0));\n      startSel = doc.sel;\n    } else {\n      replaceOneSelection(doc, ourIndex, ourRange, sel_mouse);\n    }\n\n    var lastPos = start;\n    function extendTo(pos) {\n      if (cmp(lastPos, pos) == 0) return;\n      lastPos = pos;\n\n      if (type == \"rect\") {\n        var ranges = [], tabSize = cm.options.tabSize;\n        var startCol = countColumn(getLine(doc, start.line).text, start.ch, tabSize);\n        var posCol = countColumn(getLine(doc, pos.line).text, pos.ch, tabSize);\n        var left = Math.min(startCol, posCol), right = Math.max(startCol, posCol);\n        for (var line = Math.min(start.line, pos.line), end = Math.min(cm.lastLine(), Math.max(start.line, pos.line));\n             line <= end; line++) {\n          var text = getLine(doc, line).text, leftPos = findColumn(text, left, tabSize);\n          if (left == right)\n            ranges.push(new Range(Pos(line, leftPos), Pos(line, leftPos)));\n          else if (text.length > leftPos)\n            ranges.push(new Range(Pos(line, leftPos), Pos(line, findColumn(text, right, tabSize))));\n        }\n        if (!ranges.length) ranges.push(new Range(start, start));\n        setSelection(doc, normalizeSelection(startSel.ranges.slice(0, ourIndex).concat(ranges), ourIndex),\n                     {origin: \"*mouse\", scroll: false});\n        cm.scrollIntoView(pos);\n      } else {\n        var oldRange = ourRange;\n        var anchor = oldRange.anchor, head = pos;\n        if (type != \"single\") {\n          if (type == \"double\")\n            var range = cm.findWordAt(pos);\n          else\n            var range = new Range(Pos(pos.line, 0), clipPos(doc, Pos(pos.line + 1, 0)));\n          if (cmp(range.anchor, anchor) > 0) {\n            head = range.head;\n            anchor = minPos(oldRange.from(), range.anchor);\n          } else {\n            head = range.anchor;\n            anchor = maxPos(oldRange.to(), range.head);\n          }\n        }\n        var ranges = startSel.ranges.slice(0);\n        ranges[ourIndex] = new Range(clipPos(doc, anchor), head);\n        setSelection(doc, normalizeSelection(ranges, ourIndex), sel_mouse);\n      }\n    }\n\n    var editorSize = display.wrapper.getBoundingClientRect();\n    // Used to ensure timeout re-tries don't fire when another extend\n    // happened in the meantime (clearTimeout isn't reliable -- at\n    // least on Chrome, the timeouts still happen even when cleared,\n    // if the clear happens after their scheduled firing time).\n    var counter = 0;\n\n    function extend(e) {\n      var curCount = ++counter;\n      var cur = posFromMouse(cm, e, true, type == \"rect\");\n      if (!cur) return;\n      if (cmp(cur, lastPos) != 0) {\n        cm.curOp.focus = activeElt();\n        extendTo(cur);\n        var visible = visibleLines(display, doc);\n        if (cur.line >= visible.to || cur.line < visible.from)\n          setTimeout(operation(cm, function(){if (counter == curCount) extend(e);}), 150);\n      } else {\n        var outside = e.clientY < editorSize.top ? -20 : e.clientY > editorSize.bottom ? 20 : 0;\n        if (outside) setTimeout(operation(cm, function() {\n          if (counter != curCount) return;\n          display.scroller.scrollTop += outside;\n          extend(e);\n        }), 50);\n      }\n    }\n\n    function done(e) {\n      counter = Infinity;\n      e_preventDefault(e);\n      display.input.focus();\n      off(document, \"mousemove\", move);\n      off(document, \"mouseup\", up);\n      doc.history.lastSelOrigin = null;\n    }\n\n    var move = operation(cm, function(e) {\n      if (!e_button(e)) done(e);\n      else extend(e);\n    });\n    var up = operation(cm, done);\n    on(document, \"mousemove\", move);\n    on(document, \"mouseup\", up);\n  }\n\n  // Determines whether an event happened in the gutter, and fires the\n  // handlers for the corresponding event.\n  function gutterEvent(cm, e, type, prevent, signalfn) {\n    try { var mX = e.clientX, mY = e.clientY; }\n    catch(e) { return false; }\n    if (mX >= Math.floor(cm.display.gutters.getBoundingClientRect().right)) return false;\n    if (prevent) e_preventDefault(e);\n\n    var display = cm.display;\n    var lineBox = display.lineDiv.getBoundingClientRect();\n\n    if (mY > lineBox.bottom || !hasHandler(cm, type)) return e_defaultPrevented(e);\n    mY -= lineBox.top - display.viewOffset;\n\n    for (var i = 0; i < cm.options.gutters.length; ++i) {\n      var g = display.gutters.childNodes[i];\n      if (g && g.getBoundingClientRect().right >= mX) {\n        var line = lineAtHeight(cm.doc, mY);\n        var gutter = cm.options.gutters[i];\n        signalfn(cm, type, cm, line, gutter, e);\n        return e_defaultPrevented(e);\n      }\n    }\n  }\n\n  function clickInGutter(cm, e) {\n    return gutterEvent(cm, e, \"gutterClick\", true, signalLater);\n  }\n\n  // Kludge to work around strange IE behavior where it'll sometimes\n  // re-fire a series of drag-related events right after the drop (#1551)\n  var lastDrop = 0;\n\n  function onDrop(e) {\n    var cm = this;\n    if (signalDOMEvent(cm, e) || eventInWidget(cm.display, e))\n      return;\n    e_preventDefault(e);\n    if (ie) lastDrop = +new Date;\n    var pos = posFromMouse(cm, e, true), files = e.dataTransfer.files;\n    if (!pos || isReadOnly(cm)) return;\n    // Might be a file drop, in which case we simply extract the text\n    // and insert it.\n    if (files && files.length && window.FileReader && window.File) {\n      var n = files.length, text = Array(n), read = 0;\n      var loadFile = function(file, i) {\n        var reader = new FileReader;\n        reader.onload = operation(cm, function() {\n          text[i] = reader.result;\n          if (++read == n) {\n            pos = clipPos(cm.doc, pos);\n            var change = {from: pos, to: pos, text: splitLines(text.join(\"\\n\")), origin: \"paste\"};\n            makeChange(cm.doc, change);\n            setSelectionReplaceHistory(cm.doc, simpleSelection(pos, changeEnd(change)));\n          }\n        });\n        reader.readAsText(file);\n      };\n      for (var i = 0; i < n; ++i) loadFile(files[i], i);\n    } else { // Normal drop\n      // Don't do a replace if the drop happened inside of the selected text.\n      if (cm.state.draggingText && cm.doc.sel.contains(pos) > -1) {\n        cm.state.draggingText(e);\n        // Ensure the editor is re-focused\n        setTimeout(function() {cm.display.input.focus();}, 20);\n        return;\n      }\n      try {\n        var text = e.dataTransfer.getData(\"Text\");\n        if (text) {\n          if (cm.state.draggingText && !(mac ? e.altKey : e.ctrlKey))\n            var selected = cm.listSelections();\n          setSelectionNoUndo(cm.doc, simpleSelection(pos, pos));\n          if (selected) for (var i = 0; i < selected.length; ++i)\n            replaceRange(cm.doc, \"\", selected[i].anchor, selected[i].head, \"drag\");\n          cm.replaceSelection(text, \"around\", \"paste\");\n          cm.display.input.focus();\n        }\n      }\n      catch(e){}\n    }\n  }\n\n  function onDragStart(cm, e) {\n    if (ie && (!cm.state.draggingText || +new Date - lastDrop < 100)) { e_stop(e); return; }\n    if (signalDOMEvent(cm, e) || eventInWidget(cm.display, e)) return;\n\n    e.dataTransfer.setData(\"Text\", cm.getSelection());\n\n    // Use dummy image instead of default browsers image.\n    // Recent Safari (~6.0.2) have a tendency to segfault when this happens, so we don't do it there.\n    if (e.dataTransfer.setDragImage && !safari) {\n      var img = elt(\"img\", null, null, \"position: fixed; left: 0; top: 0;\");\n      img.src = \"data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==\";\n      if (presto) {\n        img.width = img.height = 1;\n        cm.display.wrapper.appendChild(img);\n        // Force a relayout, or Opera won't use our image for some obscure reason\n        img._top = img.offsetTop;\n      }\n      e.dataTransfer.setDragImage(img, 0, 0);\n      if (presto) img.parentNode.removeChild(img);\n    }\n  }\n\n  // SCROLL EVENTS\n\n  // Sync the scrollable area and scrollbars, ensure the viewport\n  // covers the visible area.\n  function setScrollTop(cm, val) {\n    if (Math.abs(cm.doc.scrollTop - val) < 2) return;\n    cm.doc.scrollTop = val;\n    if (!gecko) updateDisplaySimple(cm, {top: val});\n    if (cm.display.scroller.scrollTop != val) cm.display.scroller.scrollTop = val;\n    cm.display.scrollbars.setScrollTop(val);\n    if (gecko) updateDisplaySimple(cm);\n    startWorker(cm, 100);\n  }\n  // Sync scroller and scrollbar, ensure the gutter elements are\n  // aligned.\n  function setScrollLeft(cm, val, isScroller) {\n    if (isScroller ? val == cm.doc.scrollLeft : Math.abs(cm.doc.scrollLeft - val) < 2) return;\n    val = Math.min(val, cm.display.scroller.scrollWidth - cm.display.scroller.clientWidth);\n    cm.doc.scrollLeft = val;\n    alignHorizontally(cm);\n    if (cm.display.scroller.scrollLeft != val) cm.display.scroller.scrollLeft = val;\n    cm.display.scrollbars.setScrollLeft(val);\n  }\n\n  // Since the delta values reported on mouse wheel events are\n  // unstandardized between browsers and even browser versions, and\n  // generally horribly unpredictable, this code starts by measuring\n  // the scroll effect that the first few mouse wheel events have,\n  // and, from that, detects the way it can convert deltas to pixel\n  // offsets afterwards.\n  //\n  // The reason we want to know the amount a wheel event will scroll\n  // is that it gives us a chance to update the display before the\n  // actual scrolling happens, reducing flickering.\n\n  var wheelSamples = 0, wheelPixelsPerUnit = null;\n  // Fill in a browser-detected starting value on browsers where we\n  // know one. These don't have to be accurate -- the result of them\n  // being wrong would just be a slight flicker on the first wheel\n  // scroll (if it is large enough).\n  if (ie) wheelPixelsPerUnit = -.53;\n  else if (gecko) wheelPixelsPerUnit = 15;\n  else if (chrome) wheelPixelsPerUnit = -.7;\n  else if (safari) wheelPixelsPerUnit = -1/3;\n\n  var wheelEventDelta = function(e) {\n    var dx = e.wheelDeltaX, dy = e.wheelDeltaY;\n    if (dx == null && e.detail && e.axis == e.HORIZONTAL_AXIS) dx = e.detail;\n    if (dy == null && e.detail && e.axis == e.VERTICAL_AXIS) dy = e.detail;\n    else if (dy == null) dy = e.wheelDelta;\n    return {x: dx, y: dy};\n  };\n  CodeMirror.wheelEventPixels = function(e) {\n    var delta = wheelEventDelta(e);\n    delta.x *= wheelPixelsPerUnit;\n    delta.y *= wheelPixelsPerUnit;\n    return delta;\n  };\n\n  function onScrollWheel(cm, e) {\n    var delta = wheelEventDelta(e), dx = delta.x, dy = delta.y;\n\n    var display = cm.display, scroll = display.scroller;\n    // Quit if there's nothing to scroll here\n    if (!(dx && scroll.scrollWidth > scroll.clientWidth ||\n          dy && scroll.scrollHeight > scroll.clientHeight)) return;\n\n    // Webkit browsers on OS X abort momentum scrolls when the target\n    // of the scroll event is removed from the scrollable element.\n    // This hack (see related code in patchDisplay) makes sure the\n    // element is kept around.\n    if (dy && mac && webkit) {\n      outer: for (var cur = e.target, view = display.view; cur != scroll; cur = cur.parentNode) {\n        for (var i = 0; i < view.length; i++) {\n          if (view[i].node == cur) {\n            cm.display.currentWheelTarget = cur;\n            break outer;\n          }\n        }\n      }\n    }\n\n    // On some browsers, horizontal scrolling will cause redraws to\n    // happen before the gutter has been realigned, causing it to\n    // wriggle around in a most unseemly way. When we have an\n    // estimated pixels/delta value, we just handle horizontal\n    // scrolling entirely here. It'll be slightly off from native, but\n    // better than glitching out.\n    if (dx && !gecko && !presto && wheelPixelsPerUnit != null) {\n      if (dy)\n        setScrollTop(cm, Math.max(0, Math.min(scroll.scrollTop + dy * wheelPixelsPerUnit, scroll.scrollHeight - scroll.clientHeight)));\n      setScrollLeft(cm, Math.max(0, Math.min(scroll.scrollLeft + dx * wheelPixelsPerUnit, scroll.scrollWidth - scroll.clientWidth)));\n      e_preventDefault(e);\n      display.wheelStartX = null; // Abort measurement, if in progress\n      return;\n    }\n\n    // 'Project' the visible viewport to cover the area that is being\n    // scrolled into view (if we know enough to estimate it).\n    if (dy && wheelPixelsPerUnit != null) {\n      var pixels = dy * wheelPixelsPerUnit;\n      var top = cm.doc.scrollTop, bot = top + display.wrapper.clientHeight;\n      if (pixels < 0) top = Math.max(0, top + pixels - 50);\n      else bot = Math.min(cm.doc.height, bot + pixels + 50);\n      updateDisplaySimple(cm, {top: top, bottom: bot});\n    }\n\n    if (wheelSamples < 20) {\n      if (display.wheelStartX == null) {\n        display.wheelStartX = scroll.scrollLeft; display.wheelStartY = scroll.scrollTop;\n        display.wheelDX = dx; display.wheelDY = dy;\n        setTimeout(function() {\n          if (display.wheelStartX == null) return;\n          var movedX = scroll.scrollLeft - display.wheelStartX;\n          var movedY = scroll.scrollTop - display.wheelStartY;\n          var sample = (movedY && display.wheelDY && movedY / display.wheelDY) ||\n            (movedX && display.wheelDX && movedX / display.wheelDX);\n          display.wheelStartX = display.wheelStartY = null;\n          if (!sample) return;\n          wheelPixelsPerUnit = (wheelPixelsPerUnit * wheelSamples + sample) / (wheelSamples + 1);\n          ++wheelSamples;\n        }, 200);\n      } else {\n        display.wheelDX += dx; display.wheelDY += dy;\n      }\n    }\n  }\n\n  // KEY EVENTS\n\n  // Run a handler that was bound to a key.\n  function doHandleBinding(cm, bound, dropShift) {\n    if (typeof bound == \"string\") {\n      bound = commands[bound];\n      if (!bound) return false;\n    }\n    // Ensure previous input has been read, so that the handler sees a\n    // consistent view of the document\n    cm.display.input.ensurePolled();\n    var prevShift = cm.display.shift, done = false;\n    try {\n      if (isReadOnly(cm)) cm.state.suppressEdits = true;\n      if (dropShift) cm.display.shift = false;\n      done = bound(cm) != Pass;\n    } finally {\n      cm.display.shift = prevShift;\n      cm.state.suppressEdits = false;\n    }\n    return done;\n  }\n\n  function lookupKeyForEditor(cm, name, handle) {\n    for (var i = 0; i < cm.state.keyMaps.length; i++) {\n      var result = lookupKey(name, cm.state.keyMaps[i], handle, cm);\n      if (result) return result;\n    }\n    return (cm.options.extraKeys && lookupKey(name, cm.options.extraKeys, handle, cm))\n      || lookupKey(name, cm.options.keyMap, handle, cm);\n  }\n\n  var stopSeq = new Delayed;\n  function dispatchKey(cm, name, e, handle) {\n    var seq = cm.state.keySeq;\n    if (seq) {\n      if (isModifierKey(name)) return \"handled\";\n      stopSeq.set(50, function() {\n        if (cm.state.keySeq == seq) {\n          cm.state.keySeq = null;\n          cm.display.input.reset();\n        }\n      });\n      name = seq + \" \" + name;\n    }\n    var result = lookupKeyForEditor(cm, name, handle);\n\n    if (result == \"multi\")\n      cm.state.keySeq = name;\n    if (result == \"handled\")\n      signalLater(cm, \"keyHandled\", cm, name, e);\n\n    if (result == \"handled\" || result == \"multi\") {\n      e_preventDefault(e);\n      restartBlink(cm);\n    }\n\n    if (seq && !result && /\\'$/.test(name)) {\n      e_preventDefault(e);\n      return true;\n    }\n    return !!result;\n  }\n\n  // Handle a key from the keydown event.\n  function handleKeyBinding(cm, e) {\n    var name = keyName(e, true);\n    if (!name) return false;\n\n    if (e.shiftKey && !cm.state.keySeq) {\n      // First try to resolve full name (including 'Shift-'). Failing\n      // that, see if there is a cursor-motion command (starting with\n      // 'go') bound to the keyname without 'Shift-'.\n      return dispatchKey(cm, \"Shift-\" + name, e, function(b) {return doHandleBinding(cm, b, true);})\n          || dispatchKey(cm, name, e, function(b) {\n               if (typeof b == \"string\" ? /^go[A-Z]/.test(b) : b.motion)\n                 return doHandleBinding(cm, b);\n             });\n    } else {\n      return dispatchKey(cm, name, e, function(b) { return doHandleBinding(cm, b); });\n    }\n  }\n\n  // Handle a key from the keypress event\n  function handleCharBinding(cm, e, ch) {\n    return dispatchKey(cm, \"'\" + ch + \"'\", e,\n                       function(b) { return doHandleBinding(cm, b, true); });\n  }\n\n  var lastStoppedKey = null;\n  function onKeyDown(e) {\n    var cm = this;\n    cm.curOp.focus = activeElt();\n    if (signalDOMEvent(cm, e)) return;\n    // IE does strange things with escape.\n    if (ie && ie_version < 11 && e.keyCode == 27) e.returnValue = false;\n    var code = e.keyCode;\n    cm.display.shift = code == 16 || e.shiftKey;\n    var handled = handleKeyBinding(cm, e);\n    if (presto) {\n      lastStoppedKey = handled ? code : null;\n      // Opera has no cut event... we try to at least catch the key combo\n      if (!handled && code == 88 && !hasCopyEvent && (mac ? e.metaKey : e.ctrlKey))\n        cm.replaceSelection(\"\", null, \"cut\");\n    }\n\n    // Turn mouse into crosshair when Alt is held on Mac.\n    if (code == 18 && !/\\bCodeMirror-crosshair\\b/.test(cm.display.lineDiv.className))\n      showCrossHair(cm);\n  }\n\n  function showCrossHair(cm) {\n    var lineDiv = cm.display.lineDiv;\n    addClass(lineDiv, \"CodeMirror-crosshair\");\n\n    function up(e) {\n      if (e.keyCode == 18 || !e.altKey) {\n        rmClass(lineDiv, \"CodeMirror-crosshair\");\n        off(document, \"keyup\", up);\n        off(document, \"mouseover\", up);\n      }\n    }\n    on(document, \"keyup\", up);\n    on(document, \"mouseover\", up);\n  }\n\n  function onKeyUp(e) {\n    if (e.keyCode == 16) this.doc.sel.shift = false;\n    signalDOMEvent(this, e);\n  }\n\n  function onKeyPress(e) {\n    var cm = this;\n    if (eventInWidget(cm.display, e) || signalDOMEvent(cm, e) || e.ctrlKey && !e.altKey || mac && e.metaKey) return;\n    var keyCode = e.keyCode, charCode = e.charCode;\n    if (presto && keyCode == lastStoppedKey) {lastStoppedKey = null; e_preventDefault(e); return;}\n    if ((presto && (!e.which || e.which < 10)) && handleKeyBinding(cm, e)) return;\n    var ch = String.fromCharCode(charCode == null ? keyCode : charCode);\n    if (handleCharBinding(cm, e, ch)) return;\n    cm.display.input.onKeyPress(e);\n  }\n\n  // FOCUS/BLUR EVENTS\n\n  function delayBlurEvent(cm) {\n    cm.state.delayingBlurEvent = true;\n    setTimeout(function() {\n      if (cm.state.delayingBlurEvent) {\n        cm.state.delayingBlurEvent = false;\n        onBlur(cm);\n      }\n    }, 100);\n  }\n\n  function onFocus(cm) {\n    if (cm.state.delayingBlurEvent) cm.state.delayingBlurEvent = false;\n\n    if (cm.options.readOnly == \"nocursor\") return;\n    if (!cm.state.focused) {\n      signal(cm, \"focus\", cm);\n      cm.state.focused = true;\n      addClass(cm.display.wrapper, \"CodeMirror-focused\");\n      // This test prevents this from firing when a context\n      // menu is closed (since the input reset would kill the\n      // select-all detection hack)\n      if (!cm.curOp && cm.display.selForContextMenu != cm.doc.sel) {\n        cm.display.input.reset();\n        if (webkit) setTimeout(function() { cm.display.input.reset(true); }, 20); // Issue #1730\n      }\n      cm.display.input.receivedFocus();\n    }\n    restartBlink(cm);\n  }\n  function onBlur(cm) {\n    if (cm.state.delayingBlurEvent) return;\n\n    if (cm.state.focused) {\n      signal(cm, \"blur\", cm);\n      cm.state.focused = false;\n      rmClass(cm.display.wrapper, \"CodeMirror-focused\");\n    }\n    clearInterval(cm.display.blinker);\n    setTimeout(function() {if (!cm.state.focused) cm.display.shift = false;}, 150);\n  }\n\n  // CONTEXT MENU HANDLING\n\n  // To make the context menu work, we need to briefly unhide the\n  // textarea (making it as unobtrusive as possible) to let the\n  // right-click take effect on it.\n  function onContextMenu(cm, e) {\n    if (eventInWidget(cm.display, e) || contextMenuInGutter(cm, e)) return;\n    cm.display.input.onContextMenu(e);\n  }\n\n  function contextMenuInGutter(cm, e) {\n    if (!hasHandler(cm, \"gutterContextMenu\")) return false;\n    return gutterEvent(cm, e, \"gutterContextMenu\", false, signal);\n  }\n\n  // UPDATING\n\n  // Compute the position of the end of a change (its 'to' property\n  // refers to the pre-change end).\n  var changeEnd = CodeMirror.changeEnd = function(change) {\n    if (!change.text) return change.to;\n    return Pos(change.from.line + change.text.length - 1,\n               lst(change.text).length + (change.text.length == 1 ? change.from.ch : 0));\n  };\n\n  // Adjust a position to refer to the post-change position of the\n  // same text, or the end of the change if the change covers it.\n  function adjustForChange(pos, change) {\n    if (cmp(pos, change.from) < 0) return pos;\n    if (cmp(pos, change.to) <= 0) return changeEnd(change);\n\n    var line = pos.line + change.text.length - (change.to.line - change.from.line) - 1, ch = pos.ch;\n    if (pos.line == change.to.line) ch += changeEnd(change).ch - change.to.ch;\n    return Pos(line, ch);\n  }\n\n  function computeSelAfterChange(doc, change) {\n    var out = [];\n    for (var i = 0; i < doc.sel.ranges.length; i++) {\n      var range = doc.sel.ranges[i];\n      out.push(new Range(adjustForChange(range.anchor, change),\n                         adjustForChange(range.head, change)));\n    }\n    return normalizeSelection(out, doc.sel.primIndex);\n  }\n\n  function offsetPos(pos, old, nw) {\n    if (pos.line == old.line)\n      return Pos(nw.line, pos.ch - old.ch + nw.ch);\n    else\n      return Pos(nw.line + (pos.line - old.line), pos.ch);\n  }\n\n  // Used by replaceSelections to allow moving the selection to the\n  // start or around the replaced test. Hint may be \"start\" or \"around\".\n  function computeReplacedSel(doc, changes, hint) {\n    var out = [];\n    var oldPrev = Pos(doc.first, 0), newPrev = oldPrev;\n    for (var i = 0; i < changes.length; i++) {\n      var change = changes[i];\n      var from = offsetPos(change.from, oldPrev, newPrev);\n      var to = offsetPos(changeEnd(change), oldPrev, newPrev);\n      oldPrev = change.to;\n      newPrev = to;\n      if (hint == \"around\") {\n        var range = doc.sel.ranges[i], inv = cmp(range.head, range.anchor) < 0;\n        out[i] = new Range(inv ? to : from, inv ? from : to);\n      } else {\n        out[i] = new Range(from, from);\n      }\n    }\n    return new Selection(out, doc.sel.primIndex);\n  }\n\n  // Allow \"beforeChange\" event handlers to influence a change\n  function filterChange(doc, change, update) {\n    var obj = {\n      canceled: false,\n      from: change.from,\n      to: change.to,\n      text: change.text,\n      origin: change.origin,\n      cancel: function() { this.canceled = true; }\n    };\n    if (update) obj.update = function(from, to, text, origin) {\n      if (from) this.from = clipPos(doc, from);\n      if (to) this.to = clipPos(doc, to);\n      if (text) this.text = text;\n      if (origin !== undefined) this.origin = origin;\n    };\n    signal(doc, \"beforeChange\", doc, obj);\n    if (doc.cm) signal(doc.cm, \"beforeChange\", doc.cm, obj);\n\n    if (obj.canceled) return null;\n    return {from: obj.from, to: obj.to, text: obj.text, origin: obj.origin};\n  }\n\n  // Apply a change to a document, and add it to the document's\n  // history, and propagating it to all linked documents.\n  function makeChange(doc, change, ignoreReadOnly) {\n    if (doc.cm) {\n      if (!doc.cm.curOp) return operation(doc.cm, makeChange)(doc, change, ignoreReadOnly);\n      if (doc.cm.state.suppressEdits) return;\n    }\n\n    if (hasHandler(doc, \"beforeChange\") || doc.cm && hasHandler(doc.cm, \"beforeChange\")) {\n      change = filterChange(doc, change, true);\n      if (!change) return;\n    }\n\n    // Possibly split or suppress the update based on the presence\n    // of read-only spans in its range.\n    var split = sawReadOnlySpans && !ignoreReadOnly && removeReadOnlyRanges(doc, change.from, change.to);\n    if (split) {\n      for (var i = split.length - 1; i >= 0; --i)\n        makeChangeInner(doc, {from: split[i].from, to: split[i].to, text: i ? [\"\"] : change.text});\n    } else {\n      makeChangeInner(doc, change);\n    }\n  }\n\n  function makeChangeInner(doc, change) {\n    if (change.text.length == 1 && change.text[0] == \"\" && cmp(change.from, change.to) == 0) return;\n    var selAfter = computeSelAfterChange(doc, change);\n    addChangeToHistory(doc, change, selAfter, doc.cm ? doc.cm.curOp.id : NaN);\n\n    makeChangeSingleDoc(doc, change, selAfter, stretchSpansOverChange(doc, change));\n    var rebased = [];\n\n    linkedDocs(doc, function(doc, sharedHist) {\n      if (!sharedHist && indexOf(rebased, doc.history) == -1) {\n        rebaseHist(doc.history, change);\n        rebased.push(doc.history);\n      }\n      makeChangeSingleDoc(doc, change, null, stretchSpansOverChange(doc, change));\n    });\n  }\n\n  // Revert a change stored in a document's history.\n  function makeChangeFromHistory(doc, type, allowSelectionOnly) {\n    if (doc.cm && doc.cm.state.suppressEdits) return;\n\n    var hist = doc.history, event, selAfter = doc.sel;\n    var source = type == \"undo\" ? hist.done : hist.undone, dest = type == \"undo\" ? hist.undone : hist.done;\n\n    // Verify that there is a useable event (so that ctrl-z won't\n    // needlessly clear selection events)\n    for (var i = 0; i < source.length; i++) {\n      event = source[i];\n      if (allowSelectionOnly ? event.ranges && !event.equals(doc.sel) : !event.ranges)\n        break;\n    }\n    if (i == source.length) return;\n    hist.lastOrigin = hist.lastSelOrigin = null;\n\n    for (;;) {\n      event = source.pop();\n      if (event.ranges) {\n        pushSelectionToHistory(event, dest);\n        if (allowSelectionOnly && !event.equals(doc.sel)) {\n          setSelection(doc, event, {clearRedo: false});\n          return;\n        }\n        selAfter = event;\n      }\n      else break;\n    }\n\n    // Build up a reverse change object to add to the opposite history\n    // stack (redo when undoing, and vice versa).\n    var antiChanges = [];\n    pushSelectionToHistory(selAfter, dest);\n    dest.push({changes: antiChanges, generation: hist.generation});\n    hist.generation = event.generation || ++hist.maxGeneration;\n\n    var filter = hasHandler(doc, \"beforeChange\") || doc.cm && hasHandler(doc.cm, \"beforeChange\");\n\n    for (var i = event.changes.length - 1; i >= 0; --i) {\n      var change = event.changes[i];\n      change.origin = type;\n      if (filter && !filterChange(doc, change, false)) {\n        source.length = 0;\n        return;\n      }\n\n      antiChanges.push(historyChangeFromChange(doc, change));\n\n      var after = i ? computeSelAfterChange(doc, change) : lst(source);\n      makeChangeSingleDoc(doc, change, after, mergeOldSpans(doc, change));\n      if (!i && doc.cm) doc.cm.scrollIntoView({from: change.from, to: changeEnd(change)});\n      var rebased = [];\n\n      // Propagate to the linked documents\n      linkedDocs(doc, function(doc, sharedHist) {\n        if (!sharedHist && indexOf(rebased, doc.history) == -1) {\n          rebaseHist(doc.history, change);\n          rebased.push(doc.history);\n        }\n        makeChangeSingleDoc(doc, change, null, mergeOldSpans(doc, change));\n      });\n    }\n  }\n\n  // Sub-views need their line numbers shifted when text is added\n  // above or below them in the parent document.\n  function shiftDoc(doc, distance) {\n    if (distance == 0) return;\n    doc.first += distance;\n    doc.sel = new Selection(map(doc.sel.ranges, function(range) {\n      return new Range(Pos(range.anchor.line + distance, range.anchor.ch),\n                       Pos(range.head.line + distance, range.head.ch));\n    }), doc.sel.primIndex);\n    if (doc.cm) {\n      regChange(doc.cm, doc.first, doc.first - distance, distance);\n      for (var d = doc.cm.display, l = d.viewFrom; l < d.viewTo; l++)\n        regLineChange(doc.cm, l, \"gutter\");\n    }\n  }\n\n  // More lower-level change function, handling only a single document\n  // (not linked ones).\n  function makeChangeSingleDoc(doc, change, selAfter, spans) {\n    if (doc.cm && !doc.cm.curOp)\n      return operation(doc.cm, makeChangeSingleDoc)(doc, change, selAfter, spans);\n\n    if (change.to.line < doc.first) {\n      shiftDoc(doc, change.text.length - 1 - (change.to.line - change.from.line));\n      return;\n    }\n    if (change.from.line > doc.lastLine()) return;\n\n    // Clip the change to the size of this doc\n    if (change.from.line < doc.first) {\n      var shift = change.text.length - 1 - (doc.first - change.from.line);\n      shiftDoc(doc, shift);\n      change = {from: Pos(doc.first, 0), to: Pos(change.to.line + shift, change.to.ch),\n                text: [lst(change.text)], origin: change.origin};\n    }\n    var last = doc.lastLine();\n    if (change.to.line > last) {\n      change = {from: change.from, to: Pos(last, getLine(doc, last).text.length),\n                text: [change.text[0]], origin: change.origin};\n    }\n\n    change.removed = getBetween(doc, change.from, change.to);\n\n    if (!selAfter) selAfter = computeSelAfterChange(doc, change);\n    if (doc.cm) makeChangeSingleDocInEditor(doc.cm, change, spans);\n    else updateDoc(doc, change, spans);\n    setSelectionNoUndo(doc, selAfter, sel_dontScroll);\n  }\n\n  // Handle the interaction of a change to a document with the editor\n  // that this document is part of.\n  function makeChangeSingleDocInEditor(cm, change, spans) {\n    var doc = cm.doc, display = cm.display, from = change.from, to = change.to;\n\n    var recomputeMaxLength = false, checkWidthStart = from.line;\n    if (!cm.options.lineWrapping) {\n      checkWidthStart = lineNo(visualLine(getLine(doc, from.line)));\n      doc.iter(checkWidthStart, to.line + 1, function(line) {\n        if (line == display.maxLine) {\n          recomputeMaxLength = true;\n          return true;\n        }\n      });\n    }\n\n    if (doc.sel.contains(change.from, change.to) > -1)\n      signalCursorActivity(cm);\n\n    updateDoc(doc, change, spans, estimateHeight(cm));\n\n    if (!cm.options.lineWrapping) {\n      doc.iter(checkWidthStart, from.line + change.text.length, function(line) {\n        var len = lineLength(line);\n        if (len > display.maxLineLength) {\n          display.maxLine = line;\n          display.maxLineLength = len;\n          display.maxLineChanged = true;\n          recomputeMaxLength = false;\n        }\n      });\n      if (recomputeMaxLength) cm.curOp.updateMaxLine = true;\n    }\n\n    // Adjust frontier, schedule worker\n    doc.frontier = Math.min(doc.frontier, from.line);\n    startWorker(cm, 400);\n\n    var lendiff = change.text.length - (to.line - from.line) - 1;\n    // Remember that these lines changed, for updating the display\n    if (change.full)\n      regChange(cm);\n    else if (from.line == to.line && change.text.length == 1 && !isWholeLineUpdate(cm.doc, change))\n      regLineChange(cm, from.line, \"text\");\n    else\n      regChange(cm, from.line, to.line + 1, lendiff);\n\n    var changesHandler = hasHandler(cm, \"changes\"), changeHandler = hasHandler(cm, \"change\");\n    if (changeHandler || changesHandler) {\n      var obj = {\n        from: from, to: to,\n        text: change.text,\n        removed: change.removed,\n        origin: change.origin\n      };\n      if (changeHandler) signalLater(cm, \"change\", cm, obj);\n      if (changesHandler) (cm.curOp.changeObjs || (cm.curOp.changeObjs = [])).push(obj);\n    }\n    cm.display.selForContextMenu = null;\n  }\n\n  function replaceRange(doc, code, from, to, origin) {\n    if (!to) to = from;\n    if (cmp(to, from) < 0) { var tmp = to; to = from; from = tmp; }\n    if (typeof code == \"string\") code = splitLines(code);\n    makeChange(doc, {from: from, to: to, text: code, origin: origin});\n  }\n\n  // SCROLLING THINGS INTO VIEW\n\n  // If an editor sits on the top or bottom of the window, partially\n  // scrolled out of view, this ensures that the cursor is visible.\n  function maybeScrollWindow(cm, coords) {\n    if (signalDOMEvent(cm, \"scrollCursorIntoView\")) return;\n\n    var display = cm.display, box = display.sizer.getBoundingClientRect(), doScroll = null;\n    if (coords.top + box.top < 0) doScroll = true;\n    else if (coords.bottom + box.top > (window.innerHeight || document.documentElement.clientHeight)) doScroll = false;\n    if (doScroll != null && !phantom) {\n      var scrollNode = elt(\"div\", \"\\u200b\", null, \"position: absolute; top: \" +\n                           (coords.top - display.viewOffset - paddingTop(cm.display)) + \"px; height: \" +\n                           (coords.bottom - coords.top + scrollGap(cm) + display.barHeight) + \"px; left: \" +\n                           coords.left + \"px; width: 2px;\");\n      cm.display.lineSpace.appendChild(scrollNode);\n      scrollNode.scrollIntoView(doScroll);\n      cm.display.lineSpace.removeChild(scrollNode);\n    }\n  }\n\n  // Scroll a given position into view (immediately), verifying that\n  // it actually became visible (as line heights are accurately\n  // measured, the position of something may 'drift' during drawing).\n  function scrollPosIntoView(cm, pos, end, margin) {\n    if (margin == null) margin = 0;\n    for (var limit = 0; limit < 5; limit++) {\n      var changed = false, coords = cursorCoords(cm, pos);\n      var endCoords = !end || end == pos ? coords : cursorCoords(cm, end);\n      var scrollPos = calculateScrollPos(cm, Math.min(coords.left, endCoords.left),\n                                         Math.min(coords.top, endCoords.top) - margin,\n                                         Math.max(coords.left, endCoords.left),\n                                         Math.max(coords.bottom, endCoords.bottom) + margin);\n      var startTop = cm.doc.scrollTop, startLeft = cm.doc.scrollLeft;\n      if (scrollPos.scrollTop != null) {\n        setScrollTop(cm, scrollPos.scrollTop);\n        if (Math.abs(cm.doc.scrollTop - startTop) > 1) changed = true;\n      }\n      if (scrollPos.scrollLeft != null) {\n        setScrollLeft(cm, scrollPos.scrollLeft);\n        if (Math.abs(cm.doc.scrollLeft - startLeft) > 1) changed = true;\n      }\n      if (!changed) break;\n    }\n    return coords;\n  }\n\n  // Scroll a given set of coordinates into view (immediately).\n  function scrollIntoView(cm, x1, y1, x2, y2) {\n    var scrollPos = calculateScrollPos(cm, x1, y1, x2, y2);\n    if (scrollPos.scrollTop != null) setScrollTop(cm, scrollPos.scrollTop);\n    if (scrollPos.scrollLeft != null) setScrollLeft(cm, scrollPos.scrollLeft);\n  }\n\n  // Calculate a new scroll position needed to scroll the given\n  // rectangle into view. Returns an object with scrollTop and\n  // scrollLeft properties. When these are undefined, the\n  // vertical/horizontal position does not need to be adjusted.\n  function calculateScrollPos(cm, x1, y1, x2, y2) {\n    var display = cm.display, snapMargin = textHeight(cm.display);\n    if (y1 < 0) y1 = 0;\n    var screentop = cm.curOp && cm.curOp.scrollTop != null ? cm.curOp.scrollTop : display.scroller.scrollTop;\n    var screen = displayHeight(cm), result = {};\n    if (y2 - y1 > screen) y2 = y1 + screen;\n    var docBottom = cm.doc.height + paddingVert(display);\n    var atTop = y1 < snapMargin, atBottom = y2 > docBottom - snapMargin;\n    if (y1 < screentop) {\n      result.scrollTop = atTop ? 0 : y1;\n    } else if (y2 > screentop + screen) {\n      var newTop = Math.min(y1, (atBottom ? docBottom : y2) - screen);\n      if (newTop != screentop) result.scrollTop = newTop;\n    }\n\n    var screenleft = cm.curOp && cm.curOp.scrollLeft != null ? cm.curOp.scrollLeft : display.scroller.scrollLeft;\n    var screenw = displayWidth(cm) - (cm.options.fixedGutter ? display.gutters.offsetWidth : 0);\n    var tooWide = x2 - x1 > screenw;\n    if (tooWide) x2 = x1 + screenw;\n    if (x1 < 10)\n      result.scrollLeft = 0;\n    else if (x1 < screenleft)\n      result.scrollLeft = Math.max(0, x1 - (tooWide ? 0 : 10));\n    else if (x2 > screenw + screenleft - 3)\n      result.scrollLeft = x2 + (tooWide ? 0 : 10) - screenw;\n    return result;\n  }\n\n  // Store a relative adjustment to the scroll position in the current\n  // operation (to be applied when the operation finishes).\n  function addToScrollPos(cm, left, top) {\n    if (left != null || top != null) resolveScrollToPos(cm);\n    if (left != null)\n      cm.curOp.scrollLeft = (cm.curOp.scrollLeft == null ? cm.doc.scrollLeft : cm.curOp.scrollLeft) + left;\n    if (top != null)\n      cm.curOp.scrollTop = (cm.curOp.scrollTop == null ? cm.doc.scrollTop : cm.curOp.scrollTop) + top;\n  }\n\n  // Make sure that at the end of the operation the current cursor is\n  // shown.\n  function ensureCursorVisible(cm) {\n    resolveScrollToPos(cm);\n    var cur = cm.getCursor(), from = cur, to = cur;\n    if (!cm.options.lineWrapping) {\n      from = cur.ch ? Pos(cur.line, cur.ch - 1) : cur;\n      to = Pos(cur.line, cur.ch + 1);\n    }\n    cm.curOp.scrollToPos = {from: from, to: to, margin: cm.options.cursorScrollMargin, isCursor: true};\n  }\n\n  // When an operation has its scrollToPos property set, and another\n  // scroll action is applied before the end of the operation, this\n  // 'simulates' scrolling that position into view in a cheap way, so\n  // that the effect of intermediate scroll commands is not ignored.\n  function resolveScrollToPos(cm) {\n    var range = cm.curOp.scrollToPos;\n    if (range) {\n      cm.curOp.scrollToPos = null;\n      var from = estimateCoords(cm, range.from), to = estimateCoords(cm, range.to);\n      var sPos = calculateScrollPos(cm, Math.min(from.left, to.left),\n                                    Math.min(from.top, to.top) - range.margin,\n                                    Math.max(from.right, to.right),\n                                    Math.max(from.bottom, to.bottom) + range.margin);\n      cm.scrollTo(sPos.scrollLeft, sPos.scrollTop);\n    }\n  }\n\n  // API UTILITIES\n\n  // Indent the given line. The how parameter can be \"smart\",\n  // \"add\"/null, \"subtract\", or \"prev\". When aggressive is false\n  // (typically set to true for forced single-line indents), empty\n  // lines are not indented, and places where the mode returns Pass\n  // are left alone.\n  function indentLine(cm, n, how, aggressive) {\n    var doc = cm.doc, state;\n    if (how == null) how = \"add\";\n    if (how == \"smart\") {\n      // Fall back to \"prev\" when the mode doesn't have an indentation\n      // method.\n      if (!doc.mode.indent) how = \"prev\";\n      else state = getStateBefore(cm, n);\n    }\n\n    var tabSize = cm.options.tabSize;\n    var line = getLine(doc, n), curSpace = countColumn(line.text, null, tabSize);\n    if (line.stateAfter) line.stateAfter = null;\n    var curSpaceString = line.text.match(/^\\s*/)[0], indentation;\n    if (!aggressive && !/\\S/.test(line.text)) {\n      indentation = 0;\n      how = \"not\";\n    } else if (how == \"smart\") {\n      indentation = doc.mode.indent(state, line.text.slice(curSpaceString.length), line.text);\n      if (indentation == Pass || indentation > 150) {\n        if (!aggressive) return;\n        how = \"prev\";\n      }\n    }\n    if (how == \"prev\") {\n      if (n > doc.first) indentation = countColumn(getLine(doc, n-1).text, null, tabSize);\n      else indentation = 0;\n    } else if (how == \"add\") {\n      indentation = curSpace + cm.options.indentUnit;\n    } else if (how == \"subtract\") {\n      indentation = curSpace - cm.options.indentUnit;\n    } else if (typeof how == \"number\") {\n      indentation = curSpace + how;\n    }\n    indentation = Math.max(0, indentation);\n\n    var indentString = \"\", pos = 0;\n    if (cm.options.indentWithTabs)\n      for (var i = Math.floor(indentation / tabSize); i; --i) {pos += tabSize; indentString += \"\\t\";}\n    if (pos < indentation) indentString += spaceStr(indentation - pos);\n\n    if (indentString != curSpaceString) {\n      replaceRange(doc, indentString, Pos(n, 0), Pos(n, curSpaceString.length), \"+input\");\n      line.stateAfter = null;\n      return true;\n    } else {\n      // Ensure that, if the cursor was in the whitespace at the start\n      // of the line, it is moved to the end of that space.\n      for (var i = 0; i < doc.sel.ranges.length; i++) {\n        var range = doc.sel.ranges[i];\n        if (range.head.line == n && range.head.ch < curSpaceString.length) {\n          var pos = Pos(n, curSpaceString.length);\n          replaceOneSelection(doc, i, new Range(pos, pos));\n          break;\n        }\n      }\n    }\n  }\n\n  // Utility for applying a change to a line by handle or number,\n  // returning the number and optionally registering the line as\n  // changed.\n  function changeLine(doc, handle, changeType, op) {\n    var no = handle, line = handle;\n    if (typeof handle == \"number\") line = getLine(doc, clipLine(doc, handle));\n    else no = lineNo(handle);\n    if (no == null) return null;\n    if (op(line, no) && doc.cm) regLineChange(doc.cm, no, changeType);\n    return line;\n  }\n\n  // Helper for deleting text near the selection(s), used to implement\n  // backspace, delete, and similar functionality.\n  function deleteNearSelection(cm, compute) {\n    var ranges = cm.doc.sel.ranges, kill = [];\n    // Build up a set of ranges to kill first, merging overlapping\n    // ranges.\n    for (var i = 0; i < ranges.length; i++) {\n      var toKill = compute(ranges[i]);\n      while (kill.length && cmp(toKill.from, lst(kill).to) <= 0) {\n        var replaced = kill.pop();\n        if (cmp(replaced.from, toKill.from) < 0) {\n          toKill.from = replaced.from;\n          break;\n        }\n      }\n      kill.push(toKill);\n    }\n    // Next, remove those actual ranges.\n    runInOp(cm, function() {\n      for (var i = kill.length - 1; i >= 0; i--)\n        replaceRange(cm.doc, \"\", kill[i].from, kill[i].to, \"+delete\");\n      ensureCursorVisible(cm);\n    });\n  }\n\n  // Used for horizontal relative motion. Dir is -1 or 1 (left or\n  // right), unit can be \"char\", \"column\" (like char, but doesn't\n  // cross line boundaries), \"word\" (across next word), or \"group\" (to\n  // the start of next group of word or non-word-non-whitespace\n  // chars). The visually param controls whether, in right-to-left\n  // text, direction 1 means to move towards the next index in the\n  // string, or towards the character to the right of the current\n  // position. The resulting position will have a hitSide=true\n  // property if it reached the end of the document.\n  function findPosH(doc, pos, dir, unit, visually) {\n    var line = pos.line, ch = pos.ch, origDir = dir;\n    var lineObj = getLine(doc, line);\n    var possible = true;\n    function findNextLine() {\n      var l = line + dir;\n      if (l < doc.first || l >= doc.first + doc.size) return (possible = false);\n      line = l;\n      return lineObj = getLine(doc, l);\n    }\n    function moveOnce(boundToLine) {\n      var next = (visually ? moveVisually : moveLogically)(lineObj, ch, dir, true);\n      if (next == null) {\n        if (!boundToLine && findNextLine()) {\n          if (visually) ch = (dir < 0 ? lineRight : lineLeft)(lineObj);\n          else ch = dir < 0 ? lineObj.text.length : 0;\n        } else return (possible = false);\n      } else ch = next;\n      return true;\n    }\n\n    if (unit == \"char\") moveOnce();\n    else if (unit == \"column\") moveOnce(true);\n    else if (unit == \"word\" || unit == \"group\") {\n      var sawType = null, group = unit == \"group\";\n      var helper = doc.cm && doc.cm.getHelper(pos, \"wordChars\");\n      for (var first = true;; first = false) {\n        if (dir < 0 && !moveOnce(!first)) break;\n        var cur = lineObj.text.charAt(ch) || \"\\n\";\n        var type = isWordChar(cur, helper) ? \"w\"\n          : group && cur == \"\\n\" ? \"n\"\n          : !group || /\\s/.test(cur) ? null\n          : \"p\";\n        if (group && !first && !type) type = \"s\";\n        if (sawType && sawType != type) {\n          if (dir < 0) {dir = 1; moveOnce();}\n          break;\n        }\n\n        if (type) sawType = type;\n        if (dir > 0 && !moveOnce(!first)) break;\n      }\n    }\n    var result = skipAtomic(doc, Pos(line, ch), origDir, true);\n    if (!possible) result.hitSide = true;\n    return result;\n  }\n\n  // For relative vertical movement. Dir may be -1 or 1. Unit can be\n  // \"page\" or \"line\". The resulting position will have a hitSide=true\n  // property if it reached the end of the document.\n  function findPosV(cm, pos, dir, unit) {\n    var doc = cm.doc, x = pos.left, y;\n    if (unit == \"page\") {\n      var pageSize = Math.min(cm.display.wrapper.clientHeight, window.innerHeight || document.documentElement.clientHeight);\n      y = pos.top + dir * (pageSize - (dir < 0 ? 1.5 : .5) * textHeight(cm.display));\n    } else if (unit == \"line\") {\n      y = dir > 0 ? pos.bottom + 3 : pos.top - 3;\n    }\n    for (;;) {\n      var target = coordsChar(cm, x, y);\n      if (!target.outside) break;\n      if (dir < 0 ? y <= 0 : y >= doc.height) { target.hitSide = true; break; }\n      y += dir * 5;\n    }\n    return target;\n  }\n\n  // EDITOR METHODS\n\n  // The publicly visible API. Note that methodOp(f) means\n  // 'wrap f in an operation, performed on its `this` parameter'.\n\n  // This is not the complete set of editor methods. Most of the\n  // methods defined on the Doc type are also injected into\n  // CodeMirror.prototype, for backwards compatibility and\n  // convenience.\n\n  CodeMirror.prototype = {\n    constructor: CodeMirror,\n    focus: function(){window.focus(); this.display.input.focus();},\n\n    setOption: function(option, value) {\n      var options = this.options, old = options[option];\n      if (options[option] == value && option != \"mode\") return;\n      options[option] = value;\n      if (optionHandlers.hasOwnProperty(option))\n        operation(this, optionHandlers[option])(this, value, old);\n    },\n\n    getOption: function(option) {return this.options[option];},\n    getDoc: function() {return this.doc;},\n\n    addKeyMap: function(map, bottom) {\n      this.state.keyMaps[bottom ? \"push\" : \"unshift\"](getKeyMap(map));\n    },\n    removeKeyMap: function(map) {\n      var maps = this.state.keyMaps;\n      for (var i = 0; i < maps.length; ++i)\n        if (maps[i] == map || maps[i].name == map) {\n          maps.splice(i, 1);\n          return true;\n        }\n    },\n\n    addOverlay: methodOp(function(spec, options) {\n      var mode = spec.token ? spec : CodeMirror.getMode(this.options, spec);\n      if (mode.startState) throw new Error(\"Overlays may not be stateful.\");\n      this.state.overlays.push({mode: mode, modeSpec: spec, opaque: options && options.opaque});\n      this.state.modeGen++;\n      regChange(this);\n    }),\n    removeOverlay: methodOp(function(spec) {\n      var overlays = this.state.overlays;\n      for (var i = 0; i < overlays.length; ++i) {\n        var cur = overlays[i].modeSpec;\n        if (cur == spec || typeof spec == \"string\" && cur.name == spec) {\n          overlays.splice(i, 1);\n          this.state.modeGen++;\n          regChange(this);\n          return;\n        }\n      }\n    }),\n\n    indentLine: methodOp(function(n, dir, aggressive) {\n      if (typeof dir != \"string\" && typeof dir != \"number\") {\n        if (dir == null) dir = this.options.smartIndent ? \"smart\" : \"prev\";\n        else dir = dir ? \"add\" : \"subtract\";\n      }\n      if (isLine(this.doc, n)) indentLine(this, n, dir, aggressive);\n    }),\n    indentSelection: methodOp(function(how) {\n      var ranges = this.doc.sel.ranges, end = -1;\n      for (var i = 0; i < ranges.length; i++) {\n        var range = ranges[i];\n        if (!range.empty()) {\n          var from = range.from(), to = range.to();\n          var start = Math.max(end, from.line);\n          end = Math.min(this.lastLine(), to.line - (to.ch ? 0 : 1)) + 1;\n          for (var j = start; j < end; ++j)\n            indentLine(this, j, how);\n          var newRanges = this.doc.sel.ranges;\n          if (from.ch == 0 && ranges.length == newRanges.length && newRanges[i].from().ch > 0)\n            replaceOneSelection(this.doc, i, new Range(from, newRanges[i].to()), sel_dontScroll);\n        } else if (range.head.line > end) {\n          indentLine(this, range.head.line, how, true);\n          end = range.head.line;\n          if (i == this.doc.sel.primIndex) ensureCursorVisible(this);\n        }\n      }\n    }),\n\n    // Fetch the parser token for a given character. Useful for hacks\n    // that want to inspect the mode state (say, for completion).\n    getTokenAt: function(pos, precise) {\n      return takeToken(this, pos, precise);\n    },\n\n    getLineTokens: function(line, precise) {\n      return takeToken(this, Pos(line), precise, true);\n    },\n\n    getTokenTypeAt: function(pos) {\n      pos = clipPos(this.doc, pos);\n      var styles = getLineStyles(this, getLine(this.doc, pos.line));\n      var before = 0, after = (styles.length - 1) / 2, ch = pos.ch;\n      var type;\n      if (ch == 0) type = styles[2];\n      else for (;;) {\n        var mid = (before + after) >> 1;\n        if ((mid ? styles[mid * 2 - 1] : 0) >= ch) after = mid;\n        else if (styles[mid * 2 + 1] < ch) before = mid + 1;\n        else { type = styles[mid * 2 + 2]; break; }\n      }\n      var cut = type ? type.indexOf(\"cm-overlay \") : -1;\n      return cut < 0 ? type : cut == 0 ? null : type.slice(0, cut - 1);\n    },\n\n    getModeAt: function(pos) {\n      var mode = this.doc.mode;\n      if (!mode.innerMode) return mode;\n      return CodeMirror.innerMode(mode, this.getTokenAt(pos).state).mode;\n    },\n\n    getHelper: function(pos, type) {\n      return this.getHelpers(pos, type)[0];\n    },\n\n    getHelpers: function(pos, type) {\n      var found = [];\n      if (!helpers.hasOwnProperty(type)) return found;\n      var help = helpers[type], mode = this.getModeAt(pos);\n      if (typeof mode[type] == \"string\") {\n        if (help[mode[type]]) found.push(help[mode[type]]);\n      } else if (mode[type]) {\n        for (var i = 0; i < mode[type].length; i++) {\n          var val = help[mode[type][i]];\n          if (val) found.push(val);\n        }\n      } else if (mode.helperType && help[mode.helperType]) {\n        found.push(help[mode.helperType]);\n      } else if (help[mode.name]) {\n        found.push(help[mode.name]);\n      }\n      for (var i = 0; i < help._global.length; i++) {\n        var cur = help._global[i];\n        if (cur.pred(mode, this) && indexOf(found, cur.val) == -1)\n          found.push(cur.val);\n      }\n      return found;\n    },\n\n    getStateAfter: function(line, precise) {\n      var doc = this.doc;\n      line = clipLine(doc, line == null ? doc.first + doc.size - 1: line);\n      return getStateBefore(this, line + 1, precise);\n    },\n\n    cursorCoords: function(start, mode) {\n      var pos, range = this.doc.sel.primary();\n      if (start == null) pos = range.head;\n      else if (typeof start == \"object\") pos = clipPos(this.doc, start);\n      else pos = start ? range.from() : range.to();\n      return cursorCoords(this, pos, mode || \"page\");\n    },\n\n    charCoords: function(pos, mode) {\n      return charCoords(this, clipPos(this.doc, pos), mode || \"page\");\n    },\n\n    coordsChar: function(coords, mode) {\n      coords = fromCoordSystem(this, coords, mode || \"page\");\n      return coordsChar(this, coords.left, coords.top);\n    },\n\n    lineAtHeight: function(height, mode) {\n      height = fromCoordSystem(this, {top: height, left: 0}, mode || \"page\").top;\n      return lineAtHeight(this.doc, height + this.display.viewOffset);\n    },\n    heightAtLine: function(line, mode) {\n      var end = false, lineObj;\n      if (typeof line == \"number\") {\n        var last = this.doc.first + this.doc.size - 1;\n        if (line < this.doc.first) line = this.doc.first;\n        else if (line > last) { line = last; end = true; }\n        lineObj = getLine(this.doc, line);\n      } else {\n        lineObj = line;\n      }\n      return intoCoordSystem(this, lineObj, {top: 0, left: 0}, mode || \"page\").top +\n        (end ? this.doc.height - heightAtLine(lineObj) : 0);\n    },\n\n    defaultTextHeight: function() { return textHeight(this.display); },\n    defaultCharWidth: function() { return charWidth(this.display); },\n\n    setGutterMarker: methodOp(function(line, gutterID, value) {\n      return changeLine(this.doc, line, \"gutter\", function(line) {\n        var markers = line.gutterMarkers || (line.gutterMarkers = {});\n        markers[gutterID] = value;\n        if (!value && isEmpty(markers)) line.gutterMarkers = null;\n        return true;\n      });\n    }),\n\n    clearGutter: methodOp(function(gutterID) {\n      var cm = this, doc = cm.doc, i = doc.first;\n      doc.iter(function(line) {\n        if (line.gutterMarkers && line.gutterMarkers[gutterID]) {\n          line.gutterMarkers[gutterID] = null;\n          regLineChange(cm, i, \"gutter\");\n          if (isEmpty(line.gutterMarkers)) line.gutterMarkers = null;\n        }\n        ++i;\n      });\n    }),\n\n    lineInfo: function(line) {\n      if (typeof line == \"number\") {\n        if (!isLine(this.doc, line)) return null;\n        var n = line;\n        line = getLine(this.doc, line);\n        if (!line) return null;\n      } else {\n        var n = lineNo(line);\n        if (n == null) return null;\n      }\n      return {line: n, handle: line, text: line.text, gutterMarkers: line.gutterMarkers,\n              textClass: line.textClass, bgClass: line.bgClass, wrapClass: line.wrapClass,\n              widgets: line.widgets};\n    },\n\n    getViewport: function() { return {from: this.display.viewFrom, to: this.display.viewTo};},\n\n    addWidget: function(pos, node, scroll, vert, horiz) {\n      var display = this.display;\n      pos = cursorCoords(this, clipPos(this.doc, pos));\n      var top = pos.bottom, left = pos.left;\n      node.style.position = \"absolute\";\n      node.setAttribute(\"cm-ignore-events\", \"true\");\n      this.display.input.setUneditable(node);\n      display.sizer.appendChild(node);\n      if (vert == \"over\") {\n        top = pos.top;\n      } else if (vert == \"above\" || vert == \"near\") {\n        var vspace = Math.max(display.wrapper.clientHeight, this.doc.height),\n        hspace = Math.max(display.sizer.clientWidth, display.lineSpace.clientWidth);\n        // Default to positioning above (if specified and possible); otherwise default to positioning below\n        if ((vert == 'above' || pos.bottom + node.offsetHeight > vspace) && pos.top > node.offsetHeight)\n          top = pos.top - node.offsetHeight;\n        else if (pos.bottom + node.offsetHeight <= vspace)\n          top = pos.bottom;\n        if (left + node.offsetWidth > hspace)\n          left = hspace - node.offsetWidth;\n      }\n      node.style.top = top + \"px\";\n      node.style.left = node.style.right = \"\";\n      if (horiz == \"right\") {\n        left = display.sizer.clientWidth - node.offsetWidth;\n        node.style.right = \"0px\";\n      } else {\n        if (horiz == \"left\") left = 0;\n        else if (horiz == \"middle\") left = (display.sizer.clientWidth - node.offsetWidth) / 2;\n        node.style.left = left + \"px\";\n      }\n      if (scroll)\n        scrollIntoView(this, left, top, left + node.offsetWidth, top + node.offsetHeight);\n    },\n\n    triggerOnKeyDown: methodOp(onKeyDown),\n    triggerOnKeyPress: methodOp(onKeyPress),\n    triggerOnKeyUp: onKeyUp,\n\n    execCommand: function(cmd) {\n      if (commands.hasOwnProperty(cmd))\n        return commands[cmd](this);\n    },\n\n    triggerElectric: methodOp(function(text) { triggerElectric(this, text); }),\n\n    findPosH: function(from, amount, unit, visually) {\n      var dir = 1;\n      if (amount < 0) { dir = -1; amount = -amount; }\n      for (var i = 0, cur = clipPos(this.doc, from); i < amount; ++i) {\n        cur = findPosH(this.doc, cur, dir, unit, visually);\n        if (cur.hitSide) break;\n      }\n      return cur;\n    },\n\n    moveH: methodOp(function(dir, unit) {\n      var cm = this;\n      cm.extendSelectionsBy(function(range) {\n        if (cm.display.shift || cm.doc.extend || range.empty())\n          return findPosH(cm.doc, range.head, dir, unit, cm.options.rtlMoveVisually);\n        else\n          return dir < 0 ? range.from() : range.to();\n      }, sel_move);\n    }),\n\n    deleteH: methodOp(function(dir, unit) {\n      var sel = this.doc.sel, doc = this.doc;\n      if (sel.somethingSelected())\n        doc.replaceSelection(\"\", null, \"+delete\");\n      else\n        deleteNearSelection(this, function(range) {\n          var other = findPosH(doc, range.head, dir, unit, false);\n          return dir < 0 ? {from: other, to: range.head} : {from: range.head, to: other};\n        });\n    }),\n\n    findPosV: function(from, amount, unit, goalColumn) {\n      var dir = 1, x = goalColumn;\n      if (amount < 0) { dir = -1; amount = -amount; }\n      for (var i = 0, cur = clipPos(this.doc, from); i < amount; ++i) {\n        var coords = cursorCoords(this, cur, \"div\");\n        if (x == null) x = coords.left;\n        else coords.left = x;\n        cur = findPosV(this, coords, dir, unit);\n        if (cur.hitSide) break;\n      }\n      return cur;\n    },\n\n    moveV: methodOp(function(dir, unit) {\n      var cm = this, doc = this.doc, goals = [];\n      var collapse = !cm.display.shift && !doc.extend && doc.sel.somethingSelected();\n      doc.extendSelectionsBy(function(range) {\n        if (collapse)\n          return dir < 0 ? range.from() : range.to();\n        var headPos = cursorCoords(cm, range.head, \"div\");\n        if (range.goalColumn != null) headPos.left = range.goalColumn;\n        goals.push(headPos.left);\n        var pos = findPosV(cm, headPos, dir, unit);\n        if (unit == \"page\" && range == doc.sel.primary())\n          addToScrollPos(cm, null, charCoords(cm, pos, \"div\").top - headPos.top);\n        return pos;\n      }, sel_move);\n      if (goals.length) for (var i = 0; i < doc.sel.ranges.length; i++)\n        doc.sel.ranges[i].goalColumn = goals[i];\n    }),\n\n    // Find the word at the given position (as returned by coordsChar).\n    findWordAt: function(pos) {\n      var doc = this.doc, line = getLine(doc, pos.line).text;\n      var start = pos.ch, end = pos.ch;\n      if (line) {\n        var helper = this.getHelper(pos, \"wordChars\");\n        if ((pos.xRel < 0 || end == line.length) && start) --start; else ++end;\n        var startChar = line.charAt(start);\n        var check = isWordChar(startChar, helper)\n          ? function(ch) { return isWordChar(ch, helper); }\n          : /\\s/.test(startChar) ? function(ch) {return /\\s/.test(ch);}\n          : function(ch) {return !/\\s/.test(ch) && !isWordChar(ch);};\n        while (start > 0 && check(line.charAt(start - 1))) --start;\n        while (end < line.length && check(line.charAt(end))) ++end;\n      }\n      return new Range(Pos(pos.line, start), Pos(pos.line, end));\n    },\n\n    toggleOverwrite: function(value) {\n      if (value != null && value == this.state.overwrite) return;\n      if (this.state.overwrite = !this.state.overwrite)\n        addClass(this.display.cursorDiv, \"CodeMirror-overwrite\");\n      else\n        rmClass(this.display.cursorDiv, \"CodeMirror-overwrite\");\n\n      signal(this, \"overwriteToggle\", this, this.state.overwrite);\n    },\n    hasFocus: function() { return this.display.input.getField() == activeElt(); },\n\n    scrollTo: methodOp(function(x, y) {\n      if (x != null || y != null) resolveScrollToPos(this);\n      if (x != null) this.curOp.scrollLeft = x;\n      if (y != null) this.curOp.scrollTop = y;\n    }),\n    getScrollInfo: function() {\n      var scroller = this.display.scroller;\n      return {left: scroller.scrollLeft, top: scroller.scrollTop,\n              height: scroller.scrollHeight - scrollGap(this) - this.display.barHeight,\n              width: scroller.scrollWidth - scrollGap(this) - this.display.barWidth,\n              clientHeight: displayHeight(this), clientWidth: displayWidth(this)};\n    },\n\n    scrollIntoView: methodOp(function(range, margin) {\n      if (range == null) {\n        range = {from: this.doc.sel.primary().head, to: null};\n        if (margin == null) margin = this.options.cursorScrollMargin;\n      } else if (typeof range == \"number\") {\n        range = {from: Pos(range, 0), to: null};\n      } else if (range.from == null) {\n        range = {from: range, to: null};\n      }\n      if (!range.to) range.to = range.from;\n      range.margin = margin || 0;\n\n      if (range.from.line != null) {\n        resolveScrollToPos(this);\n        this.curOp.scrollToPos = range;\n      } else {\n        var sPos = calculateScrollPos(this, Math.min(range.from.left, range.to.left),\n                                      Math.min(range.from.top, range.to.top) - range.margin,\n                                      Math.max(range.from.right, range.to.right),\n                                      Math.max(range.from.bottom, range.to.bottom) + range.margin);\n        this.scrollTo(sPos.scrollLeft, sPos.scrollTop);\n      }\n    }),\n\n    setSize: methodOp(function(width, height) {\n      var cm = this;\n      function interpret(val) {\n        return typeof val == \"number\" || /^\\d+$/.test(String(val)) ? val + \"px\" : val;\n      }\n      if (width != null) cm.display.wrapper.style.width = interpret(width);\n      if (height != null) cm.display.wrapper.style.height = interpret(height);\n      if (cm.options.lineWrapping) clearLineMeasurementCache(this);\n      var lineNo = cm.display.viewFrom;\n      cm.doc.iter(lineNo, cm.display.viewTo, function(line) {\n        if (line.widgets) for (var i = 0; i < line.widgets.length; i++)\n          if (line.widgets[i].noHScroll) { regLineChange(cm, lineNo, \"widget\"); break; }\n        ++lineNo;\n      });\n      cm.curOp.forceUpdate = true;\n      signal(cm, \"refresh\", this);\n    }),\n\n    operation: function(f){return runInOp(this, f);},\n\n    refresh: methodOp(function() {\n      var oldHeight = this.display.cachedTextHeight;\n      regChange(this);\n      this.curOp.forceUpdate = true;\n      clearCaches(this);\n      this.scrollTo(this.doc.scrollLeft, this.doc.scrollTop);\n      updateGutterSpace(this);\n      if (oldHeight == null || Math.abs(oldHeight - textHeight(this.display)) > .5)\n        estimateLineHeights(this);\n      signal(this, \"refresh\", this);\n    }),\n\n    swapDoc: methodOp(function(doc) {\n      var old = this.doc;\n      old.cm = null;\n      attachDoc(this, doc);\n      clearCaches(this);\n      this.display.input.reset();\n      this.scrollTo(doc.scrollLeft, doc.scrollTop);\n      this.curOp.forceScroll = true;\n      signalLater(this, \"swapDoc\", this, old);\n      return old;\n    }),\n\n    getInputField: function(){return this.display.input.getField();},\n    getWrapperElement: function(){return this.display.wrapper;},\n    getScrollerElement: function(){return this.display.scroller;},\n    getGutterElement: function(){return this.display.gutters;}\n  };\n  eventMixin(CodeMirror);\n\n  // OPTION DEFAULTS\n\n  // The default configuration options.\n  var defaults = CodeMirror.defaults = {};\n  // Functions to run when options are changed.\n  var optionHandlers = CodeMirror.optionHandlers = {};\n\n  function option(name, deflt, handle, notOnInit) {\n    CodeMirror.defaults[name] = deflt;\n    if (handle) optionHandlers[name] =\n      notOnInit ? function(cm, val, old) {if (old != Init) handle(cm, val, old);} : handle;\n  }\n\n  // Passed to option handlers when there is no old value.\n  var Init = CodeMirror.Init = {toString: function(){return \"CodeMirror.Init\";}};\n\n  // These two are, on init, called from the constructor because they\n  // have to be initialized before the editor can start at all.\n  option(\"value\", \"\", function(cm, val) {\n    cm.setValue(val);\n  }, true);\n  option(\"mode\", null, function(cm, val) {\n    cm.doc.modeOption = val;\n    loadMode(cm);\n  }, true);\n\n  option(\"indentUnit\", 2, loadMode, true);\n  option(\"indentWithTabs\", false);\n  option(\"smartIndent\", true);\n  option(\"tabSize\", 4, function(cm) {\n    resetModeState(cm);\n    clearCaches(cm);\n    regChange(cm);\n  }, true);\n  option(\"specialChars\", /[\\t\\u0000-\\u0019\\u00ad\\u200b-\\u200f\\u2028\\u2029\\ufeff]/g, function(cm, val, old) {\n    cm.state.specialChars = new RegExp(val.source + (val.test(\"\\t\") ? \"\" : \"|\\t\"), \"g\");\n    if (old != CodeMirror.Init) cm.refresh();\n  });\n  option(\"specialCharPlaceholder\", defaultSpecialCharPlaceholder, function(cm) {cm.refresh();}, true);\n  option(\"electricChars\", true);\n  option(\"inputStyle\", mobile ? \"contenteditable\" : \"textarea\", function() {\n    throw new Error(\"inputStyle can not (yet) be changed in a running editor\"); // FIXME\n  }, true);\n  option(\"rtlMoveVisually\", !windows);\n  option(\"wholeLineUpdateBefore\", true);\n\n  option(\"theme\", \"default\", function(cm) {\n    themeChanged(cm);\n    guttersChanged(cm);\n  }, true);\n  option(\"keyMap\", \"default\", function(cm, val, old) {\n    var next = getKeyMap(val);\n    var prev = old != CodeMirror.Init && getKeyMap(old);\n    if (prev && prev.detach) prev.detach(cm, next);\n    if (next.attach) next.attach(cm, prev || null);\n  });\n  option(\"extraKeys\", null);\n\n  option(\"lineWrapping\", false, wrappingChanged, true);\n  option(\"gutters\", [], function(cm) {\n    setGuttersForLineNumbers(cm.options);\n    guttersChanged(cm);\n  }, true);\n  option(\"fixedGutter\", true, function(cm, val) {\n    cm.display.gutters.style.left = val ? compensateForHScroll(cm.display) + \"px\" : \"0\";\n    cm.refresh();\n  }, true);\n  option(\"coverGutterNextToScrollbar\", false, function(cm) {updateScrollbars(cm);}, true);\n  option(\"scrollbarStyle\", \"native\", function(cm) {\n    initScrollbars(cm);\n    updateScrollbars(cm);\n    cm.display.scrollbars.setScrollTop(cm.doc.scrollTop);\n    cm.display.scrollbars.setScrollLeft(cm.doc.scrollLeft);\n  }, true);\n  option(\"lineNumbers\", false, function(cm) {\n    setGuttersForLineNumbers(cm.options);\n    guttersChanged(cm);\n  }, true);\n  option(\"firstLineNumber\", 1, guttersChanged, true);\n  option(\"lineNumberFormatter\", function(integer) {return integer;}, guttersChanged, true);\n  option(\"showCursorWhenSelecting\", false, updateSelection, true);\n\n  option(\"resetSelectionOnContextMenu\", true);\n  option(\"lineWiseCopyCut\", true);\n\n  option(\"readOnly\", false, function(cm, val) {\n    if (val == \"nocursor\") {\n      onBlur(cm);\n      cm.display.input.blur();\n      cm.display.disabled = true;\n    } else {\n      cm.display.disabled = false;\n      if (!val) cm.display.input.reset();\n    }\n  });\n  option(\"disableInput\", false, function(cm, val) {if (!val) cm.display.input.reset();}, true);\n  option(\"dragDrop\", true, dragDropChanged);\n\n  option(\"cursorBlinkRate\", 530);\n  option(\"cursorScrollMargin\", 0);\n  option(\"cursorHeight\", 1, updateSelection, true);\n  option(\"singleCursorHeightPerLine\", true, updateSelection, true);\n  option(\"workTime\", 100);\n  option(\"workDelay\", 100);\n  option(\"flattenSpans\", true, resetModeState, true);\n  option(\"addModeClass\", false, resetModeState, true);\n  option(\"pollInterval\", 100);\n  option(\"undoDepth\", 200, function(cm, val){cm.doc.history.undoDepth = val;});\n  option(\"historyEventDelay\", 1250);\n  option(\"viewportMargin\", 10, function(cm){cm.refresh();}, true);\n  option(\"maxHighlightLength\", 10000, resetModeState, true);\n  option(\"moveInputWithCursor\", true, function(cm, val) {\n    if (!val) cm.display.input.resetPosition();\n  });\n\n  option(\"tabindex\", null, function(cm, val) {\n    cm.display.input.getField().tabIndex = val || \"\";\n  });\n  option(\"autofocus\", null);\n\n  // MODE DEFINITION AND QUERYING\n\n  // Known modes, by name and by MIME\n  var modes = CodeMirror.modes = {}, mimeModes = CodeMirror.mimeModes = {};\n\n  // Extra arguments are stored as the mode's dependencies, which is\n  // used by (legacy) mechanisms like loadmode.js to automatically\n  // load a mode. (Preferred mechanism is the require/define calls.)\n  CodeMirror.defineMode = function(name, mode) {\n    if (!CodeMirror.defaults.mode && name != \"null\") CodeMirror.defaults.mode = name;\n    if (arguments.length > 2)\n      mode.dependencies = Array.prototype.slice.call(arguments, 2);\n    modes[name] = mode;\n  };\n\n  CodeMirror.defineMIME = function(mime, spec) {\n    mimeModes[mime] = spec;\n  };\n\n  // Given a MIME type, a {name, ...options} config object, or a name\n  // string, return a mode config object.\n  CodeMirror.resolveMode = function(spec) {\n    if (typeof spec == \"string\" && mimeModes.hasOwnProperty(spec)) {\n      spec = mimeModes[spec];\n    } else if (spec && typeof spec.name == \"string\" && mimeModes.hasOwnProperty(spec.name)) {\n      var found = mimeModes[spec.name];\n      if (typeof found == \"string\") found = {name: found};\n      spec = createObj(found, spec);\n      spec.name = found.name;\n    } else if (typeof spec == \"string\" && /^[\\w\\-]+\\/[\\w\\-]+\\+xml$/.test(spec)) {\n      return CodeMirror.resolveMode(\"application/xml\");\n    }\n    if (typeof spec == \"string\") return {name: spec};\n    else return spec || {name: \"null\"};\n  };\n\n  // Given a mode spec (anything that resolveMode accepts), find and\n  // initialize an actual mode object.\n  CodeMirror.getMode = function(options, spec) {\n    var spec = CodeMirror.resolveMode(spec);\n    var mfactory = modes[spec.name];\n    if (!mfactory) return CodeMirror.getMode(options, \"text/plain\");\n    var modeObj = mfactory(options, spec);\n    if (modeExtensions.hasOwnProperty(spec.name)) {\n      var exts = modeExtensions[spec.name];\n      for (var prop in exts) {\n        if (!exts.hasOwnProperty(prop)) continue;\n        if (modeObj.hasOwnProperty(prop)) modeObj[\"_\" + prop] = modeObj[prop];\n        modeObj[prop] = exts[prop];\n      }\n    }\n    modeObj.name = spec.name;\n    if (spec.helperType) modeObj.helperType = spec.helperType;\n    if (spec.modeProps) for (var prop in spec.modeProps)\n      modeObj[prop] = spec.modeProps[prop];\n\n    return modeObj;\n  };\n\n  // Minimal default mode.\n  CodeMirror.defineMode(\"null\", function() {\n    return {token: function(stream) {stream.skipToEnd();}};\n  });\n  CodeMirror.defineMIME(\"text/plain\", \"null\");\n\n  // This can be used to attach properties to mode objects from\n  // outside the actual mode definition.\n  var modeExtensions = CodeMirror.modeExtensions = {};\n  CodeMirror.extendMode = function(mode, properties) {\n    var exts = modeExtensions.hasOwnProperty(mode) ? modeExtensions[mode] : (modeExtensions[mode] = {});\n    copyObj(properties, exts);\n  };\n\n  // EXTENSIONS\n\n  CodeMirror.defineExtension = function(name, func) {\n    CodeMirror.prototype[name] = func;\n  };\n  CodeMirror.defineDocExtension = function(name, func) {\n    Doc.prototype[name] = func;\n  };\n  CodeMirror.defineOption = option;\n\n  var initHooks = [];\n  CodeMirror.defineInitHook = function(f) {initHooks.push(f);};\n\n  var helpers = CodeMirror.helpers = {};\n  CodeMirror.registerHelper = function(type, name, value) {\n    if (!helpers.hasOwnProperty(type)) helpers[type] = CodeMirror[type] = {_global: []};\n    helpers[type][name] = value;\n  };\n  CodeMirror.registerGlobalHelper = function(type, name, predicate, value) {\n    CodeMirror.registerHelper(type, name, value);\n    helpers[type]._global.push({pred: predicate, val: value});\n  };\n\n  // MODE STATE HANDLING\n\n  // Utility functions for working with state. Exported because nested\n  // modes need to do this for their inner modes.\n\n  var copyState = CodeMirror.copyState = function(mode, state) {\n    if (state === true) return state;\n    if (mode.copyState) return mode.copyState(state);\n    var nstate = {};\n    for (var n in state) {\n      var val = state[n];\n      if (val instanceof Array) val = val.concat([]);\n      nstate[n] = val;\n    }\n    return nstate;\n  };\n\n  var startState = CodeMirror.startState = function(mode, a1, a2) {\n    return mode.startState ? mode.startState(a1, a2) : true;\n  };\n\n  // Given a mode and a state (for that mode), find the inner mode and\n  // state at the position that the state refers to.\n  CodeMirror.innerMode = function(mode, state) {\n    while (mode.innerMode) {\n      var info = mode.innerMode(state);\n      if (!info || info.mode == mode) break;\n      state = info.state;\n      mode = info.mode;\n    }\n    return info || {mode: mode, state: state};\n  };\n\n  // STANDARD COMMANDS\n\n  // Commands are parameter-less actions that can be performed on an\n  // editor, mostly used for keybindings.\n  var commands = CodeMirror.commands = {\n    selectAll: function(cm) {cm.setSelection(Pos(cm.firstLine(), 0), Pos(cm.lastLine()), sel_dontScroll);},\n    singleSelection: function(cm) {\n      cm.setSelection(cm.getCursor(\"anchor\"), cm.getCursor(\"head\"), sel_dontScroll);\n    },\n    killLine: function(cm) {\n      deleteNearSelection(cm, function(range) {\n        if (range.empty()) {\n          var len = getLine(cm.doc, range.head.line).text.length;\n          if (range.head.ch == len && range.head.line < cm.lastLine())\n            return {from: range.head, to: Pos(range.head.line + 1, 0)};\n          else\n            return {from: range.head, to: Pos(range.head.line, len)};\n        } else {\n          return {from: range.from(), to: range.to()};\n        }\n      });\n    },\n    deleteLine: function(cm) {\n      deleteNearSelection(cm, function(range) {\n        return {from: Pos(range.from().line, 0),\n                to: clipPos(cm.doc, Pos(range.to().line + 1, 0))};\n      });\n    },\n    delLineLeft: function(cm) {\n      deleteNearSelection(cm, function(range) {\n        return {from: Pos(range.from().line, 0), to: range.from()};\n      });\n    },\n    delWrappedLineLeft: function(cm) {\n      deleteNearSelection(cm, function(range) {\n        var top = cm.charCoords(range.head, \"div\").top + 5;\n        var leftPos = cm.coordsChar({left: 0, top: top}, \"div\");\n        return {from: leftPos, to: range.from()};\n      });\n    },\n    delWrappedLineRight: function(cm) {\n      deleteNearSelection(cm, function(range) {\n        var top = cm.charCoords(range.head, \"div\").top + 5;\n        var rightPos = cm.coordsChar({left: cm.display.lineDiv.offsetWidth + 100, top: top}, \"div\");\n        return {from: range.from(), to: rightPos };\n      });\n    },\n    undo: function(cm) {cm.undo();},\n    redo: function(cm) {cm.redo();},\n    undoSelection: function(cm) {cm.undoSelection();},\n    redoSelection: function(cm) {cm.redoSelection();},\n    goDocStart: function(cm) {cm.extendSelection(Pos(cm.firstLine(), 0));},\n    goDocEnd: function(cm) {cm.extendSelection(Pos(cm.lastLine()));},\n    goLineStart: function(cm) {\n      cm.extendSelectionsBy(function(range) { return lineStart(cm, range.head.line); },\n                            {origin: \"+move\", bias: 1});\n    },\n    goLineStartSmart: function(cm) {\n      cm.extendSelectionsBy(function(range) {\n        return lineStartSmart(cm, range.head);\n      }, {origin: \"+move\", bias: 1});\n    },\n    goLineEnd: function(cm) {\n      cm.extendSelectionsBy(function(range) { return lineEnd(cm, range.head.line); },\n                            {origin: \"+move\", bias: -1});\n    },\n    goLineRight: function(cm) {\n      cm.extendSelectionsBy(function(range) {\n        var top = cm.charCoords(range.head, \"div\").top + 5;\n        return cm.coordsChar({left: cm.display.lineDiv.offsetWidth + 100, top: top}, \"div\");\n      }, sel_move);\n    },\n    goLineLeft: function(cm) {\n      cm.extendSelectionsBy(function(range) {\n        var top = cm.charCoords(range.head, \"div\").top + 5;\n        return cm.coordsChar({left: 0, top: top}, \"div\");\n      }, sel_move);\n    },\n    goLineLeftSmart: function(cm) {\n      cm.extendSelectionsBy(function(range) {\n        var top = cm.charCoords(range.head, \"div\").top + 5;\n        var pos = cm.coordsChar({left: 0, top: top}, \"div\");\n        if (pos.ch < cm.getLine(pos.line).search(/\\S/)) return lineStartSmart(cm, range.head);\n        return pos;\n      }, sel_move);\n    },\n    goLineUp: function(cm) {cm.moveV(-1, \"line\");},\n    goLineDown: function(cm) {cm.moveV(1, \"line\");},\n    goPageUp: function(cm) {cm.moveV(-1, \"page\");},\n    goPageDown: function(cm) {cm.moveV(1, \"page\");},\n    goCharLeft: function(cm) {cm.moveH(-1, \"char\");},\n    goCharRight: function(cm) {cm.moveH(1, \"char\");},\n    goColumnLeft: function(cm) {cm.moveH(-1, \"column\");},\n    goColumnRight: function(cm) {cm.moveH(1, \"column\");},\n    goWordLeft: function(cm) {cm.moveH(-1, \"word\");},\n    goGroupRight: function(cm) {cm.moveH(1, \"group\");},\n    goGroupLeft: function(cm) {cm.moveH(-1, \"group\");},\n    goWordRight: function(cm) {cm.moveH(1, \"word\");},\n    delCharBefore: function(cm) {cm.deleteH(-1, \"char\");},\n    delCharAfter: function(cm) {cm.deleteH(1, \"char\");},\n    delWordBefore: function(cm) {cm.deleteH(-1, \"word\");},\n    delWordAfter: function(cm) {cm.deleteH(1, \"word\");},\n    delGroupBefore: function(cm) {cm.deleteH(-1, \"group\");},\n    delGroupAfter: function(cm) {cm.deleteH(1, \"group\");},\n    indentAuto: function(cm) {cm.indentSelection(\"smart\");},\n    indentMore: function(cm) {cm.indentSelection(\"add\");},\n    indentLess: function(cm) {cm.indentSelection(\"subtract\");},\n    insertTab: function(cm) {cm.replaceSelection(\"\\t\");},\n    insertSoftTab: function(cm) {\n      var spaces = [], ranges = cm.listSelections(), tabSize = cm.options.tabSize;\n      for (var i = 0; i < ranges.length; i++) {\n        var pos = ranges[i].from();\n        var col = countColumn(cm.getLine(pos.line), pos.ch, tabSize);\n        spaces.push(new Array(tabSize - col % tabSize + 1).join(\" \"));\n      }\n      cm.replaceSelections(spaces);\n    },\n    defaultTab: function(cm) {\n      if (cm.somethingSelected()) cm.indentSelection(\"add\");\n      else cm.execCommand(\"insertTab\");\n    },\n    transposeChars: function(cm) {\n      runInOp(cm, function() {\n        var ranges = cm.listSelections(), newSel = [];\n        for (var i = 0; i < ranges.length; i++) {\n          var cur = ranges[i].head, line = getLine(cm.doc, cur.line).text;\n          if (line) {\n            if (cur.ch == line.length) cur = new Pos(cur.line, cur.ch - 1);\n            if (cur.ch > 0) {\n              cur = new Pos(cur.line, cur.ch + 1);\n              cm.replaceRange(line.charAt(cur.ch - 1) + line.charAt(cur.ch - 2),\n                              Pos(cur.line, cur.ch - 2), cur, \"+transpose\");\n            } else if (cur.line > cm.doc.first) {\n              var prev = getLine(cm.doc, cur.line - 1).text;\n              if (prev)\n                cm.replaceRange(line.charAt(0) + \"\\n\" + prev.charAt(prev.length - 1),\n                                Pos(cur.line - 1, prev.length - 1), Pos(cur.line, 1), \"+transpose\");\n            }\n          }\n          newSel.push(new Range(cur, cur));\n        }\n        cm.setSelections(newSel);\n      });\n    },\n    newlineAndIndent: function(cm) {\n      runInOp(cm, function() {\n        var len = cm.listSelections().length;\n        for (var i = 0; i < len; i++) {\n          var range = cm.listSelections()[i];\n          cm.replaceRange(\"\\n\", range.anchor, range.head, \"+input\");\n          cm.indentLine(range.from().line + 1, null, true);\n          ensureCursorVisible(cm);\n        }\n      });\n    },\n    toggleOverwrite: function(cm) {cm.toggleOverwrite();}\n  };\n\n\n  // STANDARD KEYMAPS\n\n  var keyMap = CodeMirror.keyMap = {};\n\n  keyMap.basic = {\n    \"Left\": \"goCharLeft\", \"Right\": \"goCharRight\", \"Up\": \"goLineUp\", \"Down\": \"goLineDown\",\n    \"End\": \"goLineEnd\", \"Home\": \"goLineStartSmart\", \"PageUp\": \"goPageUp\", \"PageDown\": \"goPageDown\",\n    \"Delete\": \"delCharAfter\", \"Backspace\": \"delCharBefore\", \"Shift-Backspace\": \"delCharBefore\",\n    \"Tab\": \"defaultTab\", \"Shift-Tab\": \"indentAuto\",\n    \"Enter\": \"newlineAndIndent\", \"Insert\": \"toggleOverwrite\",\n    \"Esc\": \"singleSelection\"\n  };\n  // Note that the save and find-related commands aren't defined by\n  // default. User code or addons can define them. Unknown commands\n  // are simply ignored.\n  keyMap.pcDefault = {\n    \"Ctrl-A\": \"selectAll\", \"Ctrl-D\": \"deleteLine\", \"Ctrl-Z\": \"undo\", \"Shift-Ctrl-Z\": \"redo\", \"Ctrl-Y\": \"redo\",\n    \"Ctrl-Home\": \"goDocStart\", \"Ctrl-End\": \"goDocEnd\", \"Ctrl-Up\": \"goLineUp\", \"Ctrl-Down\": \"goLineDown\",\n    \"Ctrl-Left\": \"goGroupLeft\", \"Ctrl-Right\": \"goGroupRight\", \"Alt-Left\": \"goLineStart\", \"Alt-Right\": \"goLineEnd\",\n    \"Ctrl-Backspace\": \"delGroupBefore\", \"Ctrl-Delete\": \"delGroupAfter\", \"Ctrl-S\": \"save\", \"Ctrl-F\": \"find\",\n    \"Ctrl-G\": \"findNext\", \"Shift-Ctrl-G\": \"findPrev\", \"Shift-Ctrl-F\": \"replace\", \"Shift-Ctrl-R\": \"replaceAll\",\n    \"Ctrl-[\": \"indentLess\", \"Ctrl-]\": \"indentMore\",\n    \"Ctrl-U\": \"undoSelection\", \"Shift-Ctrl-U\": \"redoSelection\", \"Alt-U\": \"redoSelection\",\n    fallthrough: \"basic\"\n  };\n  // Very basic readline/emacs-style bindings, which are standard on Mac.\n  keyMap.emacsy = {\n    \"Ctrl-F\": \"goCharRight\", \"Ctrl-B\": \"goCharLeft\", \"Ctrl-P\": \"goLineUp\", \"Ctrl-N\": \"goLineDown\",\n    \"Alt-F\": \"goWordRight\", \"Alt-B\": \"goWordLeft\", \"Ctrl-A\": \"goLineStart\", \"Ctrl-E\": \"goLineEnd\",\n    \"Ctrl-V\": \"goPageDown\", \"Shift-Ctrl-V\": \"goPageUp\", \"Ctrl-D\": \"delCharAfter\", \"Ctrl-H\": \"delCharBefore\",\n    \"Alt-D\": \"delWordAfter\", \"Alt-Backspace\": \"delWordBefore\", \"Ctrl-K\": \"killLine\", \"Ctrl-T\": \"transposeChars\"\n  };\n  keyMap.macDefault = {\n    \"Cmd-A\": \"selectAll\", \"Cmd-D\": \"deleteLine\", \"Cmd-Z\": \"undo\", \"Shift-Cmd-Z\": \"redo\", \"Cmd-Y\": \"redo\",\n    \"Cmd-Home\": \"goDocStart\", \"Cmd-Up\": \"goDocStart\", \"Cmd-End\": \"goDocEnd\", \"Cmd-Down\": \"goDocEnd\", \"Alt-Left\": \"goGroupLeft\",\n    \"Alt-Right\": \"goGroupRight\", \"Cmd-Left\": \"goLineLeft\", \"Cmd-Right\": \"goLineRight\", \"Alt-Backspace\": \"delGroupBefore\",\n    \"Ctrl-Alt-Backspace\": \"delGroupAfter\", \"Alt-Delete\": \"delGroupAfter\", \"Cmd-S\": \"save\", \"Cmd-F\": \"find\",\n    \"Cmd-G\": \"findNext\", \"Shift-Cmd-G\": \"findPrev\", \"Cmd-Alt-F\": \"replace\", \"Shift-Cmd-Alt-F\": \"replaceAll\",\n    \"Cmd-[\": \"indentLess\", \"Cmd-]\": \"indentMore\", \"Cmd-Backspace\": \"delWrappedLineLeft\", \"Cmd-Delete\": \"delWrappedLineRight\",\n    \"Cmd-U\": \"undoSelection\", \"Shift-Cmd-U\": \"redoSelection\", \"Ctrl-Up\": \"goDocStart\", \"Ctrl-Down\": \"goDocEnd\",\n    fallthrough: [\"basic\", \"emacsy\"]\n  };\n  keyMap[\"default\"] = mac ? keyMap.macDefault : keyMap.pcDefault;\n\n  // KEYMAP DISPATCH\n\n  function normalizeKeyName(name) {\n    var parts = name.split(/-(?!$)/), name = parts[parts.length - 1];\n    var alt, ctrl, shift, cmd;\n    for (var i = 0; i < parts.length - 1; i++) {\n      var mod = parts[i];\n      if (/^(cmd|meta|m)$/i.test(mod)) cmd = true;\n      else if (/^a(lt)?$/i.test(mod)) alt = true;\n      else if (/^(c|ctrl|control)$/i.test(mod)) ctrl = true;\n      else if (/^s(hift)$/i.test(mod)) shift = true;\n      else throw new Error(\"Unrecognized modifier name: \" + mod);\n    }\n    if (alt) name = \"Alt-\" + name;\n    if (ctrl) name = \"Ctrl-\" + name;\n    if (cmd) name = \"Cmd-\" + name;\n    if (shift) name = \"Shift-\" + name;\n    return name;\n  }\n\n  // This is a kludge to keep keymaps mostly working as raw objects\n  // (backwards compatibility) while at the same time support features\n  // like normalization and multi-stroke key bindings. It compiles a\n  // new normalized keymap, and then updates the old object to reflect\n  // this.\n  CodeMirror.normalizeKeyMap = function(keymap) {\n    var copy = {};\n    for (var keyname in keymap) if (keymap.hasOwnProperty(keyname)) {\n      var value = keymap[keyname];\n      if (/^(name|fallthrough|(de|at)tach)$/.test(keyname)) continue;\n      if (value == \"...\") { delete keymap[keyname]; continue; }\n\n      var keys = map(keyname.split(\" \"), normalizeKeyName);\n      for (var i = 0; i < keys.length; i++) {\n        var val, name;\n        if (i == keys.length - 1) {\n          name = keys.join(\" \");\n          val = value;\n        } else {\n          name = keys.slice(0, i + 1).join(\" \");\n          val = \"...\";\n        }\n        var prev = copy[name];\n        if (!prev) copy[name] = val;\n        else if (prev != val) throw new Error(\"Inconsistent bindings for \" + name);\n      }\n      delete keymap[keyname];\n    }\n    for (var prop in copy) keymap[prop] = copy[prop];\n    return keymap;\n  };\n\n  var lookupKey = CodeMirror.lookupKey = function(key, map, handle, context) {\n    map = getKeyMap(map);\n    var found = map.call ? map.call(key, context) : map[key];\n    if (found === false) return \"nothing\";\n    if (found === \"...\") return \"multi\";\n    if (found != null && handle(found)) return \"handled\";\n\n    if (map.fallthrough) {\n      if (Object.prototype.toString.call(map.fallthrough) != \"[object Array]\")\n        return lookupKey(key, map.fallthrough, handle, context);\n      for (var i = 0; i < map.fallthrough.length; i++) {\n        var result = lookupKey(key, map.fallthrough[i], handle, context);\n        if (result) return result;\n      }\n    }\n  };\n\n  // Modifier key presses don't count as 'real' key presses for the\n  // purpose of keymap fallthrough.\n  var isModifierKey = CodeMirror.isModifierKey = function(value) {\n    var name = typeof value == \"string\" ? value : keyNames[value.keyCode];\n    return name == \"Ctrl\" || name == \"Alt\" || name == \"Shift\" || name == \"Mod\";\n  };\n\n  // Look up the name of a key as indicated by an event object.\n  var keyName = CodeMirror.keyName = function(event, noShift) {\n    if (presto && event.keyCode == 34 && event[\"char\"]) return false;\n    var base = keyNames[event.keyCode], name = base;\n    if (name == null || event.altGraphKey) return false;\n    if (event.altKey && base != \"Alt\") name = \"Alt-\" + name;\n    if ((flipCtrlCmd ? event.metaKey : event.ctrlKey) && base != \"Ctrl\") name = \"Ctrl-\" + name;\n    if ((flipCtrlCmd ? event.ctrlKey : event.metaKey) && base != \"Cmd\") name = \"Cmd-\" + name;\n    if (!noShift && event.shiftKey && base != \"Shift\") name = \"Shift-\" + name;\n    return name;\n  };\n\n  function getKeyMap(val) {\n    return typeof val == \"string\" ? keyMap[val] : val;\n  }\n\n  // FROMTEXTAREA\n\n  CodeMirror.fromTextArea = function(textarea, options) {\n    options = options ? copyObj(options) : {};\n    options.value = textarea.value;\n    if (!options.tabindex && textarea.tabIndex)\n      options.tabindex = textarea.tabIndex;\n    if (!options.placeholder && textarea.placeholder)\n      options.placeholder = textarea.placeholder;\n    // Set autofocus to true if this textarea is focused, or if it has\n    // autofocus and no other element is focused.\n    if (options.autofocus == null) {\n      var hasFocus = activeElt();\n      options.autofocus = hasFocus == textarea ||\n        textarea.getAttribute(\"autofocus\") != null && hasFocus == document.body;\n    }\n\n    function save() {textarea.value = cm.getValue();}\n    if (textarea.form) {\n      on(textarea.form, \"submit\", save);\n      // Deplorable hack to make the submit method do the right thing.\n      if (!options.leaveSubmitMethodAlone) {\n        var form = textarea.form, realSubmit = form.submit;\n        try {\n          var wrappedSubmit = form.submit = function() {\n            save();\n            form.submit = realSubmit;\n            form.submit();\n            form.submit = wrappedSubmit;\n          };\n        } catch(e) {}\n      }\n    }\n\n    options.finishInit = function(cm) {\n      cm.save = save;\n      cm.getTextArea = function() { return textarea; };\n      cm.toTextArea = function() {\n        cm.toTextArea = isNaN; // Prevent this from being ran twice\n        save();\n        textarea.parentNode.removeChild(cm.getWrapperElement());\n        textarea.style.display = \"\";\n        if (textarea.form) {\n          off(textarea.form, \"submit\", save);\n          if (typeof textarea.form.submit == \"function\")\n            textarea.form.submit = realSubmit;\n        }\n      };\n    };\n\n    textarea.style.display = \"none\";\n    var cm = CodeMirror(function(node) {\n      textarea.parentNode.insertBefore(node, textarea.nextSibling);\n    }, options);\n    return cm;\n  };\n\n  // STRING STREAM\n\n  // Fed to the mode parsers, provides helper functions to make\n  // parsers more succinct.\n\n  var StringStream = CodeMirror.StringStream = function(string, tabSize) {\n    this.pos = this.start = 0;\n    this.string = string;\n    this.tabSize = tabSize || 8;\n    this.lastColumnPos = this.lastColumnValue = 0;\n    this.lineStart = 0;\n  };\n\n  StringStream.prototype = {\n    eol: function() {return this.pos >= this.string.length;},\n    sol: function() {return this.pos == this.lineStart;},\n    peek: function() {return this.string.charAt(this.pos) || undefined;},\n    next: function() {\n      if (this.pos < this.string.length)\n        return this.string.charAt(this.pos++);\n    },\n    eat: function(match) {\n      var ch = this.string.charAt(this.pos);\n      if (typeof match == \"string\") var ok = ch == match;\n      else var ok = ch && (match.test ? match.test(ch) : match(ch));\n      if (ok) {++this.pos; return ch;}\n    },\n    eatWhile: function(match) {\n      var start = this.pos;\n      while (this.eat(match)){}\n      return this.pos > start;\n    },\n    eatSpace: function() {\n      var start = this.pos;\n      while (/[\\s\\u00a0]/.test(this.string.charAt(this.pos))) ++this.pos;\n      return this.pos > start;\n    },\n    skipToEnd: function() {this.pos = this.string.length;},\n    skipTo: function(ch) {\n      var found = this.string.indexOf(ch, this.pos);\n      if (found > -1) {this.pos = found; return true;}\n    },\n    backUp: function(n) {this.pos -= n;},\n    column: function() {\n      if (this.lastColumnPos < this.start) {\n        this.lastColumnValue = countColumn(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue);\n        this.lastColumnPos = this.start;\n      }\n      return this.lastColumnValue - (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0);\n    },\n    indentation: function() {\n      return countColumn(this.string, null, this.tabSize) -\n        (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0);\n    },\n    match: function(pattern, consume, caseInsensitive) {\n      if (typeof pattern == \"string\") {\n        var cased = function(str) {return caseInsensitive ? str.toLowerCase() : str;};\n        var substr = this.string.substr(this.pos, pattern.length);\n        if (cased(substr) == cased(pattern)) {\n          if (consume !== false) this.pos += pattern.length;\n          return true;\n        }\n      } else {\n        var match = this.string.slice(this.pos).match(pattern);\n        if (match && match.index > 0) return null;\n        if (match && consume !== false) this.pos += match[0].length;\n        return match;\n      }\n    },\n    current: function(){return this.string.slice(this.start, this.pos);},\n    hideFirstChars: function(n, inner) {\n      this.lineStart += n;\n      try { return inner(); }\n      finally { this.lineStart -= n; }\n    }\n  };\n\n  // TEXTMARKERS\n\n  // Created with markText and setBookmark methods. A TextMarker is a\n  // handle that can be used to clear or find a marked position in the\n  // document. Line objects hold arrays (markedSpans) containing\n  // {from, to, marker} object pointing to such marker objects, and\n  // indicating that such a marker is present on that line. Multiple\n  // lines may point to the same marker when it spans across lines.\n  // The spans will have null for their from/to properties when the\n  // marker continues beyond the start/end of the line. Markers have\n  // links back to the lines they currently touch.\n\n  var nextMarkerId = 0;\n\n  var TextMarker = CodeMirror.TextMarker = function(doc, type) {\n    this.lines = [];\n    this.type = type;\n    this.doc = doc;\n    this.id = ++nextMarkerId;\n  };\n  eventMixin(TextMarker);\n\n  // Clear the marker.\n  TextMarker.prototype.clear = function() {\n    if (this.explicitlyCleared) return;\n    var cm = this.doc.cm, withOp = cm && !cm.curOp;\n    if (withOp) startOperation(cm);\n    if (hasHandler(this, \"clear\")) {\n      var found = this.find();\n      if (found) signalLater(this, \"clear\", found.from, found.to);\n    }\n    var min = null, max = null;\n    for (var i = 0; i < this.lines.length; ++i) {\n      var line = this.lines[i];\n      var span = getMarkedSpanFor(line.markedSpans, this);\n      if (cm && !this.collapsed) regLineChange(cm, lineNo(line), \"text\");\n      else if (cm) {\n        if (span.to != null) max = lineNo(line);\n        if (span.from != null) min = lineNo(line);\n      }\n      line.markedSpans = removeMarkedSpan(line.markedSpans, span);\n      if (span.from == null && this.collapsed && !lineIsHidden(this.doc, line) && cm)\n        updateLineHeight(line, textHeight(cm.display));\n    }\n    if (cm && this.collapsed && !cm.options.lineWrapping) for (var i = 0; i < this.lines.length; ++i) {\n      var visual = visualLine(this.lines[i]), len = lineLength(visual);\n      if (len > cm.display.maxLineLength) {\n        cm.display.maxLine = visual;\n        cm.display.maxLineLength = len;\n        cm.display.maxLineChanged = true;\n      }\n    }\n\n    if (min != null && cm && this.collapsed) regChange(cm, min, max + 1);\n    this.lines.length = 0;\n    this.explicitlyCleared = true;\n    if (this.atomic && this.doc.cantEdit) {\n      this.doc.cantEdit = false;\n      if (cm) reCheckSelection(cm.doc);\n    }\n    if (cm) signalLater(cm, \"markerCleared\", cm, this);\n    if (withOp) endOperation(cm);\n    if (this.parent) this.parent.clear();\n  };\n\n  // Find the position of the marker in the document. Returns a {from,\n  // to} object by default. Side can be passed to get a specific side\n  // -- 0 (both), -1 (left), or 1 (right). When lineObj is true, the\n  // Pos objects returned contain a line object, rather than a line\n  // number (used to prevent looking up the same line twice).\n  TextMarker.prototype.find = function(side, lineObj) {\n    if (side == null && this.type == \"bookmark\") side = 1;\n    var from, to;\n    for (var i = 0; i < this.lines.length; ++i) {\n      var line = this.lines[i];\n      var span = getMarkedSpanFor(line.markedSpans, this);\n      if (span.from != null) {\n        from = Pos(lineObj ? line : lineNo(line), span.from);\n        if (side == -1) return from;\n      }\n      if (span.to != null) {\n        to = Pos(lineObj ? line : lineNo(line), span.to);\n        if (side == 1) return to;\n      }\n    }\n    return from && {from: from, to: to};\n  };\n\n  // Signals that the marker's widget changed, and surrounding layout\n  // should be recomputed.\n  TextMarker.prototype.changed = function() {\n    var pos = this.find(-1, true), widget = this, cm = this.doc.cm;\n    if (!pos || !cm) return;\n    runInOp(cm, function() {\n      var line = pos.line, lineN = lineNo(pos.line);\n      var view = findViewForLine(cm, lineN);\n      if (view) {\n        clearLineMeasurementCacheFor(view);\n        cm.curOp.selectionChanged = cm.curOp.forceUpdate = true;\n      }\n      cm.curOp.updateMaxLine = true;\n      if (!lineIsHidden(widget.doc, line) && widget.height != null) {\n        var oldHeight = widget.height;\n        widget.height = null;\n        var dHeight = widgetHeight(widget) - oldHeight;\n        if (dHeight)\n          updateLineHeight(line, line.height + dHeight);\n      }\n    });\n  };\n\n  TextMarker.prototype.attachLine = function(line) {\n    if (!this.lines.length && this.doc.cm) {\n      var op = this.doc.cm.curOp;\n      if (!op.maybeHiddenMarkers || indexOf(op.maybeHiddenMarkers, this) == -1)\n        (op.maybeUnhiddenMarkers || (op.maybeUnhiddenMarkers = [])).push(this);\n    }\n    this.lines.push(line);\n  };\n  TextMarker.prototype.detachLine = function(line) {\n    this.lines.splice(indexOf(this.lines, line), 1);\n    if (!this.lines.length && this.doc.cm) {\n      var op = this.doc.cm.curOp;\n      (op.maybeHiddenMarkers || (op.maybeHiddenMarkers = [])).push(this);\n    }\n  };\n\n  // Collapsed markers have unique ids, in order to be able to order\n  // them, which is needed for uniquely determining an outer marker\n  // when they overlap (they may nest, but not partially overlap).\n  var nextMarkerId = 0;\n\n  // Create a marker, wire it up to the right lines, and\n  function markText(doc, from, to, options, type) {\n    // Shared markers (across linked documents) are handled separately\n    // (markTextShared will call out to this again, once per\n    // document).\n    if (options && options.shared) return markTextShared(doc, from, to, options, type);\n    // Ensure we are in an operation.\n    if (doc.cm && !doc.cm.curOp) return operation(doc.cm, markText)(doc, from, to, options, type);\n\n    var marker = new TextMarker(doc, type), diff = cmp(from, to);\n    if (options) copyObj(options, marker, false);\n    // Don't connect empty markers unless clearWhenEmpty is false\n    if (diff > 0 || diff == 0 && marker.clearWhenEmpty !== false)\n      return marker;\n    if (marker.replacedWith) {\n      // Showing up as a widget implies collapsed (widget replaces text)\n      marker.collapsed = true;\n      marker.widgetNode = elt(\"span\", [marker.replacedWith], \"CodeMirror-widget\");\n      if (!options.handleMouseEvents) marker.widgetNode.setAttribute(\"cm-ignore-events\", \"true\");\n      if (options.insertLeft) marker.widgetNode.insertLeft = true;\n    }\n    if (marker.collapsed) {\n      if (conflictingCollapsedRange(doc, from.line, from, to, marker) ||\n          from.line != to.line && conflictingCollapsedRange(doc, to.line, from, to, marker))\n        throw new Error(\"Inserting collapsed marker partially overlapping an existing one\");\n      sawCollapsedSpans = true;\n    }\n\n    if (marker.addToHistory)\n      addChangeToHistory(doc, {from: from, to: to, origin: \"markText\"}, doc.sel, NaN);\n\n    var curLine = from.line, cm = doc.cm, updateMaxLine;\n    doc.iter(curLine, to.line + 1, function(line) {\n      if (cm && marker.collapsed && !cm.options.lineWrapping && visualLine(line) == cm.display.maxLine)\n        updateMaxLine = true;\n      if (marker.collapsed && curLine != from.line) updateLineHeight(line, 0);\n      addMarkedSpan(line, new MarkedSpan(marker,\n                                         curLine == from.line ? from.ch : null,\n                                         curLine == to.line ? to.ch : null));\n      ++curLine;\n    });\n    // lineIsHidden depends on the presence of the spans, so needs a second pass\n    if (marker.collapsed) doc.iter(from.line, to.line + 1, function(line) {\n      if (lineIsHidden(doc, line)) updateLineHeight(line, 0);\n    });\n\n    if (marker.clearOnEnter) on(marker, \"beforeCursorEnter\", function() { marker.clear(); });\n\n    if (marker.readOnly) {\n      sawReadOnlySpans = true;\n      if (doc.history.done.length || doc.history.undone.length)\n        doc.clearHistory();\n    }\n    if (marker.collapsed) {\n      marker.id = ++nextMarkerId;\n      marker.atomic = true;\n    }\n    if (cm) {\n      // Sync editor state\n      if (updateMaxLine) cm.curOp.updateMaxLine = true;\n      if (marker.collapsed)\n        regChange(cm, from.line, to.line + 1);\n      else if (marker.className || marker.title || marker.startStyle || marker.endStyle || marker.css)\n        for (var i = from.line; i <= to.line; i++) regLineChange(cm, i, \"text\");\n      if (marker.atomic) reCheckSelection(cm.doc);\n      signalLater(cm, \"markerAdded\", cm, marker);\n    }\n    return marker;\n  }\n\n  // SHARED TEXTMARKERS\n\n  // A shared marker spans multiple linked documents. It is\n  // implemented as a meta-marker-object controlling multiple normal\n  // markers.\n  var SharedTextMarker = CodeMirror.SharedTextMarker = function(markers, primary) {\n    this.markers = markers;\n    this.primary = primary;\n    for (var i = 0; i < markers.length; ++i)\n      markers[i].parent = this;\n  };\n  eventMixin(SharedTextMarker);\n\n  SharedTextMarker.prototype.clear = function() {\n    if (this.explicitlyCleared) return;\n    this.explicitlyCleared = true;\n    for (var i = 0; i < this.markers.length; ++i)\n      this.markers[i].clear();\n    signalLater(this, \"clear\");\n  };\n  SharedTextMarker.prototype.find = function(side, lineObj) {\n    return this.primary.find(side, lineObj);\n  };\n\n  function markTextShared(doc, from, to, options, type) {\n    options = copyObj(options);\n    options.shared = false;\n    var markers = [markText(doc, from, to, options, type)], primary = markers[0];\n    var widget = options.widgetNode;\n    linkedDocs(doc, function(doc) {\n      if (widget) options.widgetNode = widget.cloneNode(true);\n      markers.push(markText(doc, clipPos(doc, from), clipPos(doc, to), options, type));\n      for (var i = 0; i < doc.linked.length; ++i)\n        if (doc.linked[i].isParent) return;\n      primary = lst(markers);\n    });\n    return new SharedTextMarker(markers, primary);\n  }\n\n  function findSharedMarkers(doc) {\n    return doc.findMarks(Pos(doc.first, 0), doc.clipPos(Pos(doc.lastLine())),\n                         function(m) { return m.parent; });\n  }\n\n  function copySharedMarkers(doc, markers) {\n    for (var i = 0; i < markers.length; i++) {\n      var marker = markers[i], pos = marker.find();\n      var mFrom = doc.clipPos(pos.from), mTo = doc.clipPos(pos.to);\n      if (cmp(mFrom, mTo)) {\n        var subMark = markText(doc, mFrom, mTo, marker.primary, marker.primary.type);\n        marker.markers.push(subMark);\n        subMark.parent = marker;\n      }\n    }\n  }\n\n  function detachSharedMarkers(markers) {\n    for (var i = 0; i < markers.length; i++) {\n      var marker = markers[i], linked = [marker.primary.doc];;\n      linkedDocs(marker.primary.doc, function(d) { linked.push(d); });\n      for (var j = 0; j < marker.markers.length; j++) {\n        var subMarker = marker.markers[j];\n        if (indexOf(linked, subMarker.doc) == -1) {\n          subMarker.parent = null;\n          marker.markers.splice(j--, 1);\n        }\n      }\n    }\n  }\n\n  // TEXTMARKER SPANS\n\n  function MarkedSpan(marker, from, to) {\n    this.marker = marker;\n    this.from = from; this.to = to;\n  }\n\n  // Search an array of spans for a span matching the given marker.\n  function getMarkedSpanFor(spans, marker) {\n    if (spans) for (var i = 0; i < spans.length; ++i) {\n      var span = spans[i];\n      if (span.marker == marker) return span;\n    }\n  }\n  // Remove a span from an array, returning undefined if no spans are\n  // left (we don't store arrays for lines without spans).\n  function removeMarkedSpan(spans, span) {\n    for (var r, i = 0; i < spans.length; ++i)\n      if (spans[i] != span) (r || (r = [])).push(spans[i]);\n    return r;\n  }\n  // Add a span to a line.\n  function addMarkedSpan(line, span) {\n    line.markedSpans = line.markedSpans ? line.markedSpans.concat([span]) : [span];\n    span.marker.attachLine(line);\n  }\n\n  // Used for the algorithm that adjusts markers for a change in the\n  // document. These functions cut an array of spans at a given\n  // character position, returning an array of remaining chunks (or\n  // undefined if nothing remains).\n  function markedSpansBefore(old, startCh, isInsert) {\n    if (old) for (var i = 0, nw; i < old.length; ++i) {\n      var span = old[i], marker = span.marker;\n      var startsBefore = span.from == null || (marker.inclusiveLeft ? span.from <= startCh : span.from < startCh);\n      if (startsBefore || span.from == startCh && marker.type == \"bookmark\" && (!isInsert || !span.marker.insertLeft)) {\n        var endsAfter = span.to == null || (marker.inclusiveRight ? span.to >= startCh : span.to > startCh);\n        (nw || (nw = [])).push(new MarkedSpan(marker, span.from, endsAfter ? null : span.to));\n      }\n    }\n    return nw;\n  }\n  function markedSpansAfter(old, endCh, isInsert) {\n    if (old) for (var i = 0, nw; i < old.length; ++i) {\n      var span = old[i], marker = span.marker;\n      var endsAfter = span.to == null || (marker.inclusiveRight ? span.to >= endCh : span.to > endCh);\n      if (endsAfter || span.from == endCh && marker.type == \"bookmark\" && (!isInsert || span.marker.insertLeft)) {\n        var startsBefore = span.from == null || (marker.inclusiveLeft ? span.from <= endCh : span.from < endCh);\n        (nw || (nw = [])).push(new MarkedSpan(marker, startsBefore ? null : span.from - endCh,\n                                              span.to == null ? null : span.to - endCh));\n      }\n    }\n    return nw;\n  }\n\n  // Given a change object, compute the new set of marker spans that\n  // cover the line in which the change took place. Removes spans\n  // entirely within the change, reconnects spans belonging to the\n  // same marker that appear on both sides of the change, and cuts off\n  // spans partially within the change. Returns an array of span\n  // arrays with one element for each line in (after) the change.\n  function stretchSpansOverChange(doc, change) {\n    if (change.full) return null;\n    var oldFirst = isLine(doc, change.from.line) && getLine(doc, change.from.line).markedSpans;\n    var oldLast = isLine(doc, change.to.line) && getLine(doc, change.to.line).markedSpans;\n    if (!oldFirst && !oldLast) return null;\n\n    var startCh = change.from.ch, endCh = change.to.ch, isInsert = cmp(change.from, change.to) == 0;\n    // Get the spans that 'stick out' on both sides\n    var first = markedSpansBefore(oldFirst, startCh, isInsert);\n    var last = markedSpansAfter(oldLast, endCh, isInsert);\n\n    // Next, merge those two ends\n    var sameLine = change.text.length == 1, offset = lst(change.text).length + (sameLine ? startCh : 0);\n    if (first) {\n      // Fix up .to properties of first\n      for (var i = 0; i < first.length; ++i) {\n        var span = first[i];\n        if (span.to == null) {\n          var found = getMarkedSpanFor(last, span.marker);\n          if (!found) span.to = startCh;\n          else if (sameLine) span.to = found.to == null ? null : found.to + offset;\n        }\n      }\n    }\n    if (last) {\n      // Fix up .from in last (or move them into first in case of sameLine)\n      for (var i = 0; i < last.length; ++i) {\n        var span = last[i];\n        if (span.to != null) span.to += offset;\n        if (span.from == null) {\n          var found = getMarkedSpanFor(first, span.marker);\n          if (!found) {\n            span.from = offset;\n            if (sameLine) (first || (first = [])).push(span);\n          }\n        } else {\n          span.from += offset;\n          if (sameLine) (first || (first = [])).push(span);\n        }\n      }\n    }\n    // Make sure we didn't create any zero-length spans\n    if (first) first = clearEmptySpans(first);\n    if (last && last != first) last = clearEmptySpans(last);\n\n    var newMarkers = [first];\n    if (!sameLine) {\n      // Fill gap with whole-line-spans\n      var gap = change.text.length - 2, gapMarkers;\n      if (gap > 0 && first)\n        for (var i = 0; i < first.length; ++i)\n          if (first[i].to == null)\n            (gapMarkers || (gapMarkers = [])).push(new MarkedSpan(first[i].marker, null, null));\n      for (var i = 0; i < gap; ++i)\n        newMarkers.push(gapMarkers);\n      newMarkers.push(last);\n    }\n    return newMarkers;\n  }\n\n  // Remove spans that are empty and don't have a clearWhenEmpty\n  // option of false.\n  function clearEmptySpans(spans) {\n    for (var i = 0; i < spans.length; ++i) {\n      var span = spans[i];\n      if (span.from != null && span.from == span.to && span.marker.clearWhenEmpty !== false)\n        spans.splice(i--, 1);\n    }\n    if (!spans.length) return null;\n    return spans;\n  }\n\n  // Used for un/re-doing changes from the history. Combines the\n  // result of computing the existing spans with the set of spans that\n  // existed in the history (so that deleting around a span and then\n  // undoing brings back the span).\n  function mergeOldSpans(doc, change) {\n    var old = getOldSpans(doc, change);\n    var stretched = stretchSpansOverChange(doc, change);\n    if (!old) return stretched;\n    if (!stretched) return old;\n\n    for (var i = 0; i < old.length; ++i) {\n      var oldCur = old[i], stretchCur = stretched[i];\n      if (oldCur && stretchCur) {\n        spans: for (var j = 0; j < stretchCur.length; ++j) {\n          var span = stretchCur[j];\n          for (var k = 0; k < oldCur.length; ++k)\n            if (oldCur[k].marker == span.marker) continue spans;\n          oldCur.push(span);\n        }\n      } else if (stretchCur) {\n        old[i] = stretchCur;\n      }\n    }\n    return old;\n  }\n\n  // Used to 'clip' out readOnly ranges when making a change.\n  function removeReadOnlyRanges(doc, from, to) {\n    var markers = null;\n    doc.iter(from.line, to.line + 1, function(line) {\n      if (line.markedSpans) for (var i = 0; i < line.markedSpans.length; ++i) {\n        var mark = line.markedSpans[i].marker;\n        if (mark.readOnly && (!markers || indexOf(markers, mark) == -1))\n          (markers || (markers = [])).push(mark);\n      }\n    });\n    if (!markers) return null;\n    var parts = [{from: from, to: to}];\n    for (var i = 0; i < markers.length; ++i) {\n      var mk = markers[i], m = mk.find(0);\n      for (var j = 0; j < parts.length; ++j) {\n        var p = parts[j];\n        if (cmp(p.to, m.from) < 0 || cmp(p.from, m.to) > 0) continue;\n        var newParts = [j, 1], dfrom = cmp(p.from, m.from), dto = cmp(p.to, m.to);\n        if (dfrom < 0 || !mk.inclusiveLeft && !dfrom)\n          newParts.push({from: p.from, to: m.from});\n        if (dto > 0 || !mk.inclusiveRight && !dto)\n          newParts.push({from: m.to, to: p.to});\n        parts.splice.apply(parts, newParts);\n        j += newParts.length - 1;\n      }\n    }\n    return parts;\n  }\n\n  // Connect or disconnect spans from a line.\n  function detachMarkedSpans(line) {\n    var spans = line.markedSpans;\n    if (!spans) return;\n    for (var i = 0; i < spans.length; ++i)\n      spans[i].marker.detachLine(line);\n    line.markedSpans = null;\n  }\n  function attachMarkedSpans(line, spans) {\n    if (!spans) return;\n    for (var i = 0; i < spans.length; ++i)\n      spans[i].marker.attachLine(line);\n    line.markedSpans = spans;\n  }\n\n  // Helpers used when computing which overlapping collapsed span\n  // counts as the larger one.\n  function extraLeft(marker) { return marker.inclusiveLeft ? -1 : 0; }\n  function extraRight(marker) { return marker.inclusiveRight ? 1 : 0; }\n\n  // Returns a number indicating which of two overlapping collapsed\n  // spans is larger (and thus includes the other). Falls back to\n  // comparing ids when the spans cover exactly the same range.\n  function compareCollapsedMarkers(a, b) {\n    var lenDiff = a.lines.length - b.lines.length;\n    if (lenDiff != 0) return lenDiff;\n    var aPos = a.find(), bPos = b.find();\n    var fromCmp = cmp(aPos.from, bPos.from) || extraLeft(a) - extraLeft(b);\n    if (fromCmp) return -fromCmp;\n    var toCmp = cmp(aPos.to, bPos.to) || extraRight(a) - extraRight(b);\n    if (toCmp) return toCmp;\n    return b.id - a.id;\n  }\n\n  // Find out whether a line ends or starts in a collapsed span. If\n  // so, return the marker for that span.\n  function collapsedSpanAtSide(line, start) {\n    var sps = sawCollapsedSpans && line.markedSpans, found;\n    if (sps) for (var sp, i = 0; i < sps.length; ++i) {\n      sp = sps[i];\n      if (sp.marker.collapsed && (start ? sp.from : sp.to) == null &&\n          (!found || compareCollapsedMarkers(found, sp.marker) < 0))\n        found = sp.marker;\n    }\n    return found;\n  }\n  function collapsedSpanAtStart(line) { return collapsedSpanAtSide(line, true); }\n  function collapsedSpanAtEnd(line) { return collapsedSpanAtSide(line, false); }\n\n  // Test whether there exists a collapsed span that partially\n  // overlaps (covers the start or end, but not both) of a new span.\n  // Such overlap is not allowed.\n  function conflictingCollapsedRange(doc, lineNo, from, to, marker) {\n    var line = getLine(doc, lineNo);\n    var sps = sawCollapsedSpans && line.markedSpans;\n    if (sps) for (var i = 0; i < sps.length; ++i) {\n      var sp = sps[i];\n      if (!sp.marker.collapsed) continue;\n      var found = sp.marker.find(0);\n      var fromCmp = cmp(found.from, from) || extraLeft(sp.marker) - extraLeft(marker);\n      var toCmp = cmp(found.to, to) || extraRight(sp.marker) - extraRight(marker);\n      if (fromCmp >= 0 && toCmp <= 0 || fromCmp <= 0 && toCmp >= 0) continue;\n      if (fromCmp <= 0 && (cmp(found.to, from) > 0 || (sp.marker.inclusiveRight && marker.inclusiveLeft)) ||\n          fromCmp >= 0 && (cmp(found.from, to) < 0 || (sp.marker.inclusiveLeft && marker.inclusiveRight)))\n        return true;\n    }\n  }\n\n  // A visual line is a line as drawn on the screen. Folding, for\n  // example, can cause multiple logical lines to appear on the same\n  // visual line. This finds the start of the visual line that the\n  // given line is part of (usually that is the line itself).\n  function visualLine(line) {\n    var merged;\n    while (merged = collapsedSpanAtStart(line))\n      line = merged.find(-1, true).line;\n    return line;\n  }\n\n  // Returns an array of logical lines that continue the visual line\n  // started by the argument, or undefined if there are no such lines.\n  function visualLineContinued(line) {\n    var merged, lines;\n    while (merged = collapsedSpanAtEnd(line)) {\n      line = merged.find(1, true).line;\n      (lines || (lines = [])).push(line);\n    }\n    return lines;\n  }\n\n  // Get the line number of the start of the visual line that the\n  // given line number is part of.\n  function visualLineNo(doc, lineN) {\n    var line = getLine(doc, lineN), vis = visualLine(line);\n    if (line == vis) return lineN;\n    return lineNo(vis);\n  }\n  // Get the line number of the start of the next visual line after\n  // the given line.\n  function visualLineEndNo(doc, lineN) {\n    if (lineN > doc.lastLine()) return lineN;\n    var line = getLine(doc, lineN), merged;\n    if (!lineIsHidden(doc, line)) return lineN;\n    while (merged = collapsedSpanAtEnd(line))\n      line = merged.find(1, true).line;\n    return lineNo(line) + 1;\n  }\n\n  // Compute whether a line is hidden. Lines count as hidden when they\n  // are part of a visual line that starts with another line, or when\n  // they are entirely covered by collapsed, non-widget span.\n  function lineIsHidden(doc, line) {\n    var sps = sawCollapsedSpans && line.markedSpans;\n    if (sps) for (var sp, i = 0; i < sps.length; ++i) {\n      sp = sps[i];\n      if (!sp.marker.collapsed) continue;\n      if (sp.from == null) return true;\n      if (sp.marker.widgetNode) continue;\n      if (sp.from == 0 && sp.marker.inclusiveLeft && lineIsHiddenInner(doc, line, sp))\n        return true;\n    }\n  }\n  function lineIsHiddenInner(doc, line, span) {\n    if (span.to == null) {\n      var end = span.marker.find(1, true);\n      return lineIsHiddenInner(doc, end.line, getMarkedSpanFor(end.line.markedSpans, span.marker));\n    }\n    if (span.marker.inclusiveRight && span.to == line.text.length)\n      return true;\n    for (var sp, i = 0; i < line.markedSpans.length; ++i) {\n      sp = line.markedSpans[i];\n      if (sp.marker.collapsed && !sp.marker.widgetNode && sp.from == span.to &&\n          (sp.to == null || sp.to != span.from) &&\n          (sp.marker.inclusiveLeft || span.marker.inclusiveRight) &&\n          lineIsHiddenInner(doc, line, sp)) return true;\n    }\n  }\n\n  // LINE WIDGETS\n\n  // Line widgets are block elements displayed above or below a line.\n\n  var LineWidget = CodeMirror.LineWidget = function(doc, node, options) {\n    if (options) for (var opt in options) if (options.hasOwnProperty(opt))\n      this[opt] = options[opt];\n    this.doc = doc;\n    this.node = node;\n  };\n  eventMixin(LineWidget);\n\n  function adjustScrollWhenAboveVisible(cm, line, diff) {\n    if (heightAtLine(line) < ((cm.curOp && cm.curOp.scrollTop) || cm.doc.scrollTop))\n      addToScrollPos(cm, null, diff);\n  }\n\n  LineWidget.prototype.clear = function() {\n    var cm = this.doc.cm, ws = this.line.widgets, line = this.line, no = lineNo(line);\n    if (no == null || !ws) return;\n    for (var i = 0; i < ws.length; ++i) if (ws[i] == this) ws.splice(i--, 1);\n    if (!ws.length) line.widgets = null;\n    var height = widgetHeight(this);\n    updateLineHeight(line, Math.max(0, line.height - height));\n    if (cm) runInOp(cm, function() {\n      adjustScrollWhenAboveVisible(cm, line, -height);\n      regLineChange(cm, no, \"widget\");\n    });\n  };\n  LineWidget.prototype.changed = function() {\n    var oldH = this.height, cm = this.doc.cm, line = this.line;\n    this.height = null;\n    var diff = widgetHeight(this) - oldH;\n    if (!diff) return;\n    updateLineHeight(line, line.height + diff);\n    if (cm) runInOp(cm, function() {\n      cm.curOp.forceUpdate = true;\n      adjustScrollWhenAboveVisible(cm, line, diff);\n    });\n  };\n\n  function widgetHeight(widget) {\n    if (widget.height != null) return widget.height;\n    var cm = widget.doc.cm;\n    if (!cm) return 0;\n    if (!contains(document.body, widget.node)) {\n      var parentStyle = \"position: relative;\";\n      if (widget.coverGutter)\n        parentStyle += \"margin-left: -\" + cm.display.gutters.offsetWidth + \"px;\";\n      if (widget.noHScroll)\n        parentStyle += \"width: \" + cm.display.wrapper.clientWidth + \"px;\";\n      removeChildrenAndAdd(cm.display.measure, elt(\"div\", [widget.node], null, parentStyle));\n    }\n    return widget.height = widget.node.offsetHeight;\n  }\n\n  function addLineWidget(doc, handle, node, options) {\n    var widget = new LineWidget(doc, node, options);\n    var cm = doc.cm;\n    if (cm && widget.noHScroll) cm.display.alignWidgets = true;\n    changeLine(doc, handle, \"widget\", function(line) {\n      var widgets = line.widgets || (line.widgets = []);\n      if (widget.insertAt == null) widgets.push(widget);\n      else widgets.splice(Math.min(widgets.length - 1, Math.max(0, widget.insertAt)), 0, widget);\n      widget.line = line;\n      if (cm && !lineIsHidden(doc, line)) {\n        var aboveVisible = heightAtLine(line) < doc.scrollTop;\n        updateLineHeight(line, line.height + widgetHeight(widget));\n        if (aboveVisible) addToScrollPos(cm, null, widget.height);\n        cm.curOp.forceUpdate = true;\n      }\n      return true;\n    });\n    return widget;\n  }\n\n  // LINE DATA STRUCTURE\n\n  // Line objects. These hold state related to a line, including\n  // highlighting info (the styles array).\n  var Line = CodeMirror.Line = function(text, markedSpans, estimateHeight) {\n    this.text = text;\n    attachMarkedSpans(this, markedSpans);\n    this.height = estimateHeight ? estimateHeight(this) : 1;\n  };\n  eventMixin(Line);\n  Line.prototype.lineNo = function() { return lineNo(this); };\n\n  // Change the content (text, markers) of a line. Automatically\n  // invalidates cached information and tries to re-estimate the\n  // line's height.\n  function updateLine(line, text, markedSpans, estimateHeight) {\n    line.text = text;\n    if (line.stateAfter) line.stateAfter = null;\n    if (line.styles) line.styles = null;\n    if (line.order != null) line.order = null;\n    detachMarkedSpans(line);\n    attachMarkedSpans(line, markedSpans);\n    var estHeight = estimateHeight ? estimateHeight(line) : 1;\n    if (estHeight != line.height) updateLineHeight(line, estHeight);\n  }\n\n  // Detach a line from the document tree and its markers.\n  function cleanUpLine(line) {\n    line.parent = null;\n    detachMarkedSpans(line);\n  }\n\n  function extractLineClasses(type, output) {\n    if (type) for (;;) {\n      var lineClass = type.match(/(?:^|\\s+)line-(background-)?(\\S+)/);\n      if (!lineClass) break;\n      type = type.slice(0, lineClass.index) + type.slice(lineClass.index + lineClass[0].length);\n      var prop = lineClass[1] ? \"bgClass\" : \"textClass\";\n      if (output[prop] == null)\n        output[prop] = lineClass[2];\n      else if (!(new RegExp(\"(?:^|\\s)\" + lineClass[2] + \"(?:$|\\s)\")).test(output[prop]))\n        output[prop] += \" \" + lineClass[2];\n    }\n    return type;\n  }\n\n  function callBlankLine(mode, state) {\n    if (mode.blankLine) return mode.blankLine(state);\n    if (!mode.innerMode) return;\n    var inner = CodeMirror.innerMode(mode, state);\n    if (inner.mode.blankLine) return inner.mode.blankLine(inner.state);\n  }\n\n  function readToken(mode, stream, state, inner) {\n    for (var i = 0; i < 10; i++) {\n      if (inner) inner[0] = CodeMirror.innerMode(mode, state).mode;\n      var style = mode.token(stream, state);\n      if (stream.pos > stream.start) return style;\n    }\n    throw new Error(\"Mode \" + mode.name + \" failed to advance stream.\");\n  }\n\n  // Utility for getTokenAt and getLineTokens\n  function takeToken(cm, pos, precise, asArray) {\n    function getObj(copy) {\n      return {start: stream.start, end: stream.pos,\n              string: stream.current(),\n              type: style || null,\n              state: copy ? copyState(doc.mode, state) : state};\n    }\n\n    var doc = cm.doc, mode = doc.mode, style;\n    pos = clipPos(doc, pos);\n    var line = getLine(doc, pos.line), state = getStateBefore(cm, pos.line, precise);\n    var stream = new StringStream(line.text, cm.options.tabSize), tokens;\n    if (asArray) tokens = [];\n    while ((asArray || stream.pos < pos.ch) && !stream.eol()) {\n      stream.start = stream.pos;\n      style = readToken(mode, stream, state);\n      if (asArray) tokens.push(getObj(true));\n    }\n    return asArray ? tokens : getObj();\n  }\n\n  // Run the given mode's parser over a line, calling f for each token.\n  function runMode(cm, text, mode, state, f, lineClasses, forceToEnd) {\n    var flattenSpans = mode.flattenSpans;\n    if (flattenSpans == null) flattenSpans = cm.options.flattenSpans;\n    var curStart = 0, curStyle = null;\n    var stream = new StringStream(text, cm.options.tabSize), style;\n    var inner = cm.options.addModeClass && [null];\n    if (text == \"\") extractLineClasses(callBlankLine(mode, state), lineClasses);\n    while (!stream.eol()) {\n      if (stream.pos > cm.options.maxHighlightLength) {\n        flattenSpans = false;\n        if (forceToEnd) processLine(cm, text, state, stream.pos);\n        stream.pos = text.length;\n        style = null;\n      } else {\n        style = extractLineClasses(readToken(mode, stream, state, inner), lineClasses);\n      }\n      if (inner) {\n        var mName = inner[0].name;\n        if (mName) style = \"m-\" + (style ? mName + \" \" + style : mName);\n      }\n      if (!flattenSpans || curStyle != style) {\n        while (curStart < stream.start) {\n          curStart = Math.min(stream.start, curStart + 50000);\n          f(curStart, curStyle);\n        }\n        curStyle = style;\n      }\n      stream.start = stream.pos;\n    }\n    while (curStart < stream.pos) {\n      // Webkit seems to refuse to render text nodes longer than 57444 characters\n      var pos = Math.min(stream.pos, curStart + 50000);\n      f(pos, curStyle);\n      curStart = pos;\n    }\n  }\n\n  // Compute a style array (an array starting with a mode generation\n  // -- for invalidation -- followed by pairs of end positions and\n  // style strings), which is used to highlight the tokens on the\n  // line.\n  function highlightLine(cm, line, state, forceToEnd) {\n    // A styles array always starts with a number identifying the\n    // mode/overlays that it is based on (for easy invalidation).\n    var st = [cm.state.modeGen], lineClasses = {};\n    // Compute the base array of styles\n    runMode(cm, line.text, cm.doc.mode, state, function(end, style) {\n      st.push(end, style);\n    }, lineClasses, forceToEnd);\n\n    // Run overlays, adjust style array.\n    for (var o = 0; o < cm.state.overlays.length; ++o) {\n      var overlay = cm.state.overlays[o], i = 1, at = 0;\n      runMode(cm, line.text, overlay.mode, true, function(end, style) {\n        var start = i;\n        // Ensure there's a token end at the current position, and that i points at it\n        while (at < end) {\n          var i_end = st[i];\n          if (i_end > end)\n            st.splice(i, 1, end, st[i+1], i_end);\n          i += 2;\n          at = Math.min(end, i_end);\n        }\n        if (!style) return;\n        if (overlay.opaque) {\n          st.splice(start, i - start, end, \"cm-overlay \" + style);\n          i = start + 2;\n        } else {\n          for (; start < i; start += 2) {\n            var cur = st[start+1];\n            st[start+1] = (cur ? cur + \" \" : \"\") + \"cm-overlay \" + style;\n          }\n        }\n      }, lineClasses);\n    }\n\n    return {styles: st, classes: lineClasses.bgClass || lineClasses.textClass ? lineClasses : null};\n  }\n\n  function getLineStyles(cm, line, updateFrontier) {\n    if (!line.styles || line.styles[0] != cm.state.modeGen) {\n      var result = highlightLine(cm, line, line.stateAfter = getStateBefore(cm, lineNo(line)));\n      line.styles = result.styles;\n      if (result.classes) line.styleClasses = result.classes;\n      else if (line.styleClasses) line.styleClasses = null;\n      if (updateFrontier === cm.doc.frontier) cm.doc.frontier++;\n    }\n    return line.styles;\n  }\n\n  // Lightweight form of highlight -- proceed over this line and\n  // update state, but don't save a style array. Used for lines that\n  // aren't currently visible.\n  function processLine(cm, text, state, startAt) {\n    var mode = cm.doc.mode;\n    var stream = new StringStream(text, cm.options.tabSize);\n    stream.start = stream.pos = startAt || 0;\n    if (text == \"\") callBlankLine(mode, state);\n    while (!stream.eol() && stream.pos <= cm.options.maxHighlightLength) {\n      readToken(mode, stream, state);\n      stream.start = stream.pos;\n    }\n  }\n\n  // Convert a style as returned by a mode (either null, or a string\n  // containing one or more styles) to a CSS style. This is cached,\n  // and also looks for line-wide styles.\n  var styleToClassCache = {}, styleToClassCacheWithMode = {};\n  function interpretTokenStyle(style, options) {\n    if (!style || /^\\s*$/.test(style)) return null;\n    var cache = options.addModeClass ? styleToClassCacheWithMode : styleToClassCache;\n    return cache[style] ||\n      (cache[style] = style.replace(/\\S+/g, \"cm-$&\"));\n  }\n\n  // Render the DOM representation of the text of a line. Also builds\n  // up a 'line map', which points at the DOM nodes that represent\n  // specific stretches of text, and is used by the measuring code.\n  // The returned object contains the DOM node, this map, and\n  // information about line-wide styles that were set by the mode.\n  function buildLineContent(cm, lineView) {\n    // The padding-right forces the element to have a 'border', which\n    // is needed on Webkit to be able to get line-level bounding\n    // rectangles for it (in measureChar).\n    var content = elt(\"span\", null, null, webkit ? \"padding-right: .1px\" : null);\n    var builder = {pre: elt(\"pre\", [content]), content: content,\n                   col: 0, pos: 0, cm: cm,\n                   splitSpaces: (ie || webkit) && cm.getOption(\"lineWrapping\")};\n    lineView.measure = {};\n\n    // Iterate over the logical lines that make up this visual line.\n    for (var i = 0; i <= (lineView.rest ? lineView.rest.length : 0); i++) {\n      var line = i ? lineView.rest[i - 1] : lineView.line, order;\n      builder.pos = 0;\n      builder.addToken = buildToken;\n      // Optionally wire in some hacks into the token-rendering\n      // algorithm, to deal with browser quirks.\n      if (hasBadBidiRects(cm.display.measure) && (order = getOrder(line)))\n        builder.addToken = buildTokenBadBidi(builder.addToken, order);\n      builder.map = [];\n      var allowFrontierUpdate = lineView != cm.display.externalMeasured && lineNo(line);\n      insertLineContent(line, builder, getLineStyles(cm, line, allowFrontierUpdate));\n      if (line.styleClasses) {\n        if (line.styleClasses.bgClass)\n          builder.bgClass = joinClasses(line.styleClasses.bgClass, builder.bgClass || \"\");\n        if (line.styleClasses.textClass)\n          builder.textClass = joinClasses(line.styleClasses.textClass, builder.textClass || \"\");\n      }\n\n      // Ensure at least a single node is present, for measuring.\n      if (builder.map.length == 0)\n        builder.map.push(0, 0, builder.content.appendChild(zeroWidthElement(cm.display.measure)));\n\n      // Store the map and a cache object for the current logical line\n      if (i == 0) {\n        lineView.measure.map = builder.map;\n        lineView.measure.cache = {};\n      } else {\n        (lineView.measure.maps || (lineView.measure.maps = [])).push(builder.map);\n        (lineView.measure.caches || (lineView.measure.caches = [])).push({});\n      }\n    }\n\n    // See issue #2901\n    if (webkit && /\\bcm-tab\\b/.test(builder.content.lastChild.className))\n      builder.content.className = \"cm-tab-wrap-hack\";\n\n    signal(cm, \"renderLine\", cm, lineView.line, builder.pre);\n    if (builder.pre.className)\n      builder.textClass = joinClasses(builder.pre.className, builder.textClass || \"\");\n\n    return builder;\n  }\n\n  function defaultSpecialCharPlaceholder(ch) {\n    var token = elt(\"span\", \"\\u2022\", \"cm-invalidchar\");\n    token.title = \"\\\\u\" + ch.charCodeAt(0).toString(16);\n    token.setAttribute(\"aria-label\", token.title);\n    return token;\n  }\n\n  // Build up the DOM representation for a single token, and add it to\n  // the line map. Takes care to render special characters separately.\n  function buildToken(builder, text, style, startStyle, endStyle, title, css) {\n    if (!text) return;\n    var displayText = builder.splitSpaces ? text.replace(/ {3,}/g, splitSpaces) : text;\n    var special = builder.cm.state.specialChars, mustWrap = false;\n    if (!special.test(text)) {\n      builder.col += text.length;\n      var content = document.createTextNode(displayText);\n      builder.map.push(builder.pos, builder.pos + text.length, content);\n      if (ie && ie_version < 9) mustWrap = true;\n      builder.pos += text.length;\n    } else {\n      var content = document.createDocumentFragment(), pos = 0;\n      while (true) {\n        special.lastIndex = pos;\n        var m = special.exec(text);\n        var skipped = m ? m.index - pos : text.length - pos;\n        if (skipped) {\n          var txt = document.createTextNode(displayText.slice(pos, pos + skipped));\n          if (ie && ie_version < 9) content.appendChild(elt(\"span\", [txt]));\n          else content.appendChild(txt);\n          builder.map.push(builder.pos, builder.pos + skipped, txt);\n          builder.col += skipped;\n          builder.pos += skipped;\n        }\n        if (!m) break;\n        pos += skipped + 1;\n        if (m[0] == \"\\t\") {\n          var tabSize = builder.cm.options.tabSize, tabWidth = tabSize - builder.col % tabSize;\n          var txt = content.appendChild(elt(\"span\", spaceStr(tabWidth), \"cm-tab\"));\n          txt.setAttribute(\"role\", \"presentation\");\n          txt.setAttribute(\"cm-text\", \"\\t\");\n          builder.col += tabWidth;\n        } else {\n          var txt = builder.cm.options.specialCharPlaceholder(m[0]);\n          txt.setAttribute(\"cm-text\", m[0]);\n          if (ie && ie_version < 9) content.appendChild(elt(\"span\", [txt]));\n          else content.appendChild(txt);\n          builder.col += 1;\n        }\n        builder.map.push(builder.pos, builder.pos + 1, txt);\n        builder.pos++;\n      }\n    }\n    if (style || startStyle || endStyle || mustWrap || css) {\n      var fullStyle = style || \"\";\n      if (startStyle) fullStyle += startStyle;\n      if (endStyle) fullStyle += endStyle;\n      var token = elt(\"span\", [content], fullStyle, css);\n      if (title) token.title = title;\n      return builder.content.appendChild(token);\n    }\n    builder.content.appendChild(content);\n  }\n\n  function splitSpaces(old) {\n    var out = \" \";\n    for (var i = 0; i < old.length - 2; ++i) out += i % 2 ? \" \" : \"\\u00a0\";\n    out += \" \";\n    return out;\n  }\n\n  // Work around nonsense dimensions being reported for stretches of\n  // right-to-left text.\n  function buildTokenBadBidi(inner, order) {\n    return function(builder, text, style, startStyle, endStyle, title, css) {\n      style = style ? style + \" cm-force-border\" : \"cm-force-border\";\n      var start = builder.pos, end = start + text.length;\n      for (;;) {\n        // Find the part that overlaps with the start of this text\n        for (var i = 0; i < order.length; i++) {\n          var part = order[i];\n          if (part.to > start && part.from <= start) break;\n        }\n        if (part.to >= end) return inner(builder, text, style, startStyle, endStyle, title, css);\n        inner(builder, text.slice(0, part.to - start), style, startStyle, null, title, css);\n        startStyle = null;\n        text = text.slice(part.to - start);\n        start = part.to;\n      }\n    };\n  }\n\n  function buildCollapsedSpan(builder, size, marker, ignoreWidget) {\n    var widget = !ignoreWidget && marker.widgetNode;\n    if (widget) builder.map.push(builder.pos, builder.pos + size, widget);\n    if (!ignoreWidget && builder.cm.display.input.needsContentAttribute) {\n      if (!widget)\n        widget = builder.content.appendChild(document.createElement(\"span\"));\n      widget.setAttribute(\"cm-marker\", marker.id);\n    }\n    if (widget) {\n      builder.cm.display.input.setUneditable(widget);\n      builder.content.appendChild(widget);\n    }\n    builder.pos += size;\n  }\n\n  // Outputs a number of spans to make up a line, taking highlighting\n  // and marked text into account.\n  function insertLineContent(line, builder, styles) {\n    var spans = line.markedSpans, allText = line.text, at = 0;\n    if (!spans) {\n      for (var i = 1; i < styles.length; i+=2)\n        builder.addToken(builder, allText.slice(at, at = styles[i]), interpretTokenStyle(styles[i+1], builder.cm.options));\n      return;\n    }\n\n    var len = allText.length, pos = 0, i = 1, text = \"\", style, css;\n    var nextChange = 0, spanStyle, spanEndStyle, spanStartStyle, title, collapsed;\n    for (;;) {\n      if (nextChange == pos) { // Update current marker set\n        spanStyle = spanEndStyle = spanStartStyle = title = css = \"\";\n        collapsed = null; nextChange = Infinity;\n        var foundBookmarks = [];\n        for (var j = 0; j < spans.length; ++j) {\n          var sp = spans[j], m = sp.marker;\n          if (m.type == \"bookmark\" && sp.from == pos && m.widgetNode) {\n            foundBookmarks.push(m);\n          } else if (sp.from <= pos && (sp.to == null || sp.to > pos || m.collapsed && sp.to == pos && sp.from == pos)) {\n            if (sp.to != null && sp.to != pos && nextChange > sp.to) {\n              nextChange = sp.to;\n              spanEndStyle = \"\";\n            }\n            if (m.className) spanStyle += \" \" + m.className;\n            if (m.css) css = m.css;\n            if (m.startStyle && sp.from == pos) spanStartStyle += \" \" + m.startStyle;\n            if (m.endStyle && sp.to == nextChange) spanEndStyle += \" \" + m.endStyle;\n            if (m.title && !title) title = m.title;\n            if (m.collapsed && (!collapsed || compareCollapsedMarkers(collapsed.marker, m) < 0))\n              collapsed = sp;\n          } else if (sp.from > pos && nextChange > sp.from) {\n            nextChange = sp.from;\n          }\n        }\n        if (collapsed && (collapsed.from || 0) == pos) {\n          buildCollapsedSpan(builder, (collapsed.to == null ? len + 1 : collapsed.to) - pos,\n                             collapsed.marker, collapsed.from == null);\n          if (collapsed.to == null) return;\n          if (collapsed.to == pos) collapsed = false;\n        }\n        if (!collapsed && foundBookmarks.length) for (var j = 0; j < foundBookmarks.length; ++j)\n          buildCollapsedSpan(builder, 0, foundBookmarks[j]);\n      }\n      if (pos >= len) break;\n\n      var upto = Math.min(len, nextChange);\n      while (true) {\n        if (text) {\n          var end = pos + text.length;\n          if (!collapsed) {\n            var tokenText = end > upto ? text.slice(0, upto - pos) : text;\n            builder.addToken(builder, tokenText, style ? style + spanStyle : spanStyle,\n                             spanStartStyle, pos + tokenText.length == nextChange ? spanEndStyle : \"\", title, css);\n          }\n          if (end >= upto) {text = text.slice(upto - pos); pos = upto; break;}\n          pos = end;\n          spanStartStyle = \"\";\n        }\n        text = allText.slice(at, at = styles[i++]);\n        style = interpretTokenStyle(styles[i++], builder.cm.options);\n      }\n    }\n  }\n\n  // DOCUMENT DATA STRUCTURE\n\n  // By default, updates that start and end at the beginning of a line\n  // are treated specially, in order to make the association of line\n  // widgets and marker elements with the text behave more intuitive.\n  function isWholeLineUpdate(doc, change) {\n    return change.from.ch == 0 && change.to.ch == 0 && lst(change.text) == \"\" &&\n      (!doc.cm || doc.cm.options.wholeLineUpdateBefore);\n  }\n\n  // Perform a change on the document data structure.\n  function updateDoc(doc, change, markedSpans, estimateHeight) {\n    function spansFor(n) {return markedSpans ? markedSpans[n] : null;}\n    function update(line, text, spans) {\n      updateLine(line, text, spans, estimateHeight);\n      signalLater(line, \"change\", line, change);\n    }\n    function linesFor(start, end) {\n      for (var i = start, result = []; i < end; ++i)\n        result.push(new Line(text[i], spansFor(i), estimateHeight));\n      return result;\n    }\n\n    var from = change.from, to = change.to, text = change.text;\n    var firstLine = getLine(doc, from.line), lastLine = getLine(doc, to.line);\n    var lastText = lst(text), lastSpans = spansFor(text.length - 1), nlines = to.line - from.line;\n\n    // Adjust the line structure\n    if (change.full) {\n      doc.insert(0, linesFor(0, text.length));\n      doc.remove(text.length, doc.size - text.length);\n    } else if (isWholeLineUpdate(doc, change)) {\n      // This is a whole-line replace. Treated specially to make\n      // sure line objects move the way they are supposed to.\n      var added = linesFor(0, text.length - 1);\n      update(lastLine, lastLine.text, lastSpans);\n      if (nlines) doc.remove(from.line, nlines);\n      if (added.length) doc.insert(from.line, added);\n    } else if (firstLine == lastLine) {\n      if (text.length == 1) {\n        update(firstLine, firstLine.text.slice(0, from.ch) + lastText + firstLine.text.slice(to.ch), lastSpans);\n      } else {\n        var added = linesFor(1, text.length - 1);\n        added.push(new Line(lastText + firstLine.text.slice(to.ch), lastSpans, estimateHeight));\n        update(firstLine, firstLine.text.slice(0, from.ch) + text[0], spansFor(0));\n        doc.insert(from.line + 1, added);\n      }\n    } else if (text.length == 1) {\n      update(firstLine, firstLine.text.slice(0, from.ch) + text[0] + lastLine.text.slice(to.ch), spansFor(0));\n      doc.remove(from.line + 1, nlines);\n    } else {\n      update(firstLine, firstLine.text.slice(0, from.ch) + text[0], spansFor(0));\n      update(lastLine, lastText + lastLine.text.slice(to.ch), lastSpans);\n      var added = linesFor(1, text.length - 1);\n      if (nlines > 1) doc.remove(from.line + 1, nlines - 1);\n      doc.insert(from.line + 1, added);\n    }\n\n    signalLater(doc, \"change\", doc, change);\n  }\n\n  // The document is represented as a BTree consisting of leaves, with\n  // chunk of lines in them, and branches, with up to ten leaves or\n  // other branch nodes below them. The top node is always a branch\n  // node, and is the document object itself (meaning it has\n  // additional methods and properties).\n  //\n  // All nodes have parent links. The tree is used both to go from\n  // line numbers to line objects, and to go from objects to numbers.\n  // It also indexes by height, and is used to convert between height\n  // and line object, and to find the total height of the document.\n  //\n  // See also http://marijnhaverbeke.nl/blog/codemirror-line-tree.html\n\n  function LeafChunk(lines) {\n    this.lines = lines;\n    this.parent = null;\n    for (var i = 0, height = 0; i < lines.length; ++i) {\n      lines[i].parent = this;\n      height += lines[i].height;\n    }\n    this.height = height;\n  }\n\n  LeafChunk.prototype = {\n    chunkSize: function() { return this.lines.length; },\n    // Remove the n lines at offset 'at'.\n    removeInner: function(at, n) {\n      for (var i = at, e = at + n; i < e; ++i) {\n        var line = this.lines[i];\n        this.height -= line.height;\n        cleanUpLine(line);\n        signalLater(line, \"delete\");\n      }\n      this.lines.splice(at, n);\n    },\n    // Helper used to collapse a small branch into a single leaf.\n    collapse: function(lines) {\n      lines.push.apply(lines, this.lines);\n    },\n    // Insert the given array of lines at offset 'at', count them as\n    // having the given height.\n    insertInner: function(at, lines, height) {\n      this.height += height;\n      this.lines = this.lines.slice(0, at).concat(lines).concat(this.lines.slice(at));\n      for (var i = 0; i < lines.length; ++i) lines[i].parent = this;\n    },\n    // Used to iterate over a part of the tree.\n    iterN: function(at, n, op) {\n      for (var e = at + n; at < e; ++at)\n        if (op(this.lines[at])) return true;\n    }\n  };\n\n  function BranchChunk(children) {\n    this.children = children;\n    var size = 0, height = 0;\n    for (var i = 0; i < children.length; ++i) {\n      var ch = children[i];\n      size += ch.chunkSize(); height += ch.height;\n      ch.parent = this;\n    }\n    this.size = size;\n    this.height = height;\n    this.parent = null;\n  }\n\n  BranchChunk.prototype = {\n    chunkSize: function() { return this.size; },\n    removeInner: function(at, n) {\n      this.size -= n;\n      for (var i = 0; i < this.children.length; ++i) {\n        var child = this.children[i], sz = child.chunkSize();\n        if (at < sz) {\n          var rm = Math.min(n, sz - at), oldHeight = child.height;\n          child.removeInner(at, rm);\n          this.height -= oldHeight - child.height;\n          if (sz == rm) { this.children.splice(i--, 1); child.parent = null; }\n          if ((n -= rm) == 0) break;\n          at = 0;\n        } else at -= sz;\n      }\n      // If the result is smaller than 25 lines, ensure that it is a\n      // single leaf node.\n      if (this.size - n < 25 &&\n          (this.children.length > 1 || !(this.children[0] instanceof LeafChunk))) {\n        var lines = [];\n        this.collapse(lines);\n        this.children = [new LeafChunk(lines)];\n        this.children[0].parent = this;\n      }\n    },\n    collapse: function(lines) {\n      for (var i = 0; i < this.children.length; ++i) this.children[i].collapse(lines);\n    },\n    insertInner: function(at, lines, height) {\n      this.size += lines.length;\n      this.height += height;\n      for (var i = 0; i < this.children.length; ++i) {\n        var child = this.children[i], sz = child.chunkSize();\n        if (at <= sz) {\n          child.insertInner(at, lines, height);\n          if (child.lines && child.lines.length > 50) {\n            while (child.lines.length > 50) {\n              var spilled = child.lines.splice(child.lines.length - 25, 25);\n              var newleaf = new LeafChunk(spilled);\n              child.height -= newleaf.height;\n              this.children.splice(i + 1, 0, newleaf);\n              newleaf.parent = this;\n            }\n            this.maybeSpill();\n          }\n          break;\n        }\n        at -= sz;\n      }\n    },\n    // When a node has grown, check whether it should be split.\n    maybeSpill: function() {\n      if (this.children.length <= 10) return;\n      var me = this;\n      do {\n        var spilled = me.children.splice(me.children.length - 5, 5);\n        var sibling = new BranchChunk(spilled);\n        if (!me.parent) { // Become the parent node\n          var copy = new BranchChunk(me.children);\n          copy.parent = me;\n          me.children = [copy, sibling];\n          me = copy;\n        } else {\n          me.size -= sibling.size;\n          me.height -= sibling.height;\n          var myIndex = indexOf(me.parent.children, me);\n          me.parent.children.splice(myIndex + 1, 0, sibling);\n        }\n        sibling.parent = me.parent;\n      } while (me.children.length > 10);\n      me.parent.maybeSpill();\n    },\n    iterN: function(at, n, op) {\n      for (var i = 0; i < this.children.length; ++i) {\n        var child = this.children[i], sz = child.chunkSize();\n        if (at < sz) {\n          var used = Math.min(n, sz - at);\n          if (child.iterN(at, used, op)) return true;\n          if ((n -= used) == 0) break;\n          at = 0;\n        } else at -= sz;\n      }\n    }\n  };\n\n  var nextDocId = 0;\n  var Doc = CodeMirror.Doc = function(text, mode, firstLine) {\n    if (!(this instanceof Doc)) return new Doc(text, mode, firstLine);\n    if (firstLine == null) firstLine = 0;\n\n    BranchChunk.call(this, [new LeafChunk([new Line(\"\", null)])]);\n    this.first = firstLine;\n    this.scrollTop = this.scrollLeft = 0;\n    this.cantEdit = false;\n    this.cleanGeneration = 1;\n    this.frontier = firstLine;\n    var start = Pos(firstLine, 0);\n    this.sel = simpleSelection(start);\n    this.history = new History(null);\n    this.id = ++nextDocId;\n    this.modeOption = mode;\n\n    if (typeof text == \"string\") text = splitLines(text);\n    updateDoc(this, {from: start, to: start, text: text});\n    setSelection(this, simpleSelection(start), sel_dontScroll);\n  };\n\n  Doc.prototype = createObj(BranchChunk.prototype, {\n    constructor: Doc,\n    // Iterate over the document. Supports two forms -- with only one\n    // argument, it calls that for each line in the document. With\n    // three, it iterates over the range given by the first two (with\n    // the second being non-inclusive).\n    iter: function(from, to, op) {\n      if (op) this.iterN(from - this.first, to - from, op);\n      else this.iterN(this.first, this.first + this.size, from);\n    },\n\n    // Non-public interface for adding and removing lines.\n    insert: function(at, lines) {\n      var height = 0;\n      for (var i = 0; i < lines.length; ++i) height += lines[i].height;\n      this.insertInner(at - this.first, lines, height);\n    },\n    remove: function(at, n) { this.removeInner(at - this.first, n); },\n\n    // From here, the methods are part of the public interface. Most\n    // are also available from CodeMirror (editor) instances.\n\n    getValue: function(lineSep) {\n      var lines = getLines(this, this.first, this.first + this.size);\n      if (lineSep === false) return lines;\n      return lines.join(lineSep || \"\\n\");\n    },\n    setValue: docMethodOp(function(code) {\n      var top = Pos(this.first, 0), last = this.first + this.size - 1;\n      makeChange(this, {from: top, to: Pos(last, getLine(this, last).text.length),\n                        text: splitLines(code), origin: \"setValue\", full: true}, true);\n      setSelection(this, simpleSelection(top));\n    }),\n    replaceRange: function(code, from, to, origin) {\n      from = clipPos(this, from);\n      to = to ? clipPos(this, to) : from;\n      replaceRange(this, code, from, to, origin);\n    },\n    getRange: function(from, to, lineSep) {\n      var lines = getBetween(this, clipPos(this, from), clipPos(this, to));\n      if (lineSep === false) return lines;\n      return lines.join(lineSep || \"\\n\");\n    },\n\n    getLine: function(line) {var l = this.getLineHandle(line); return l && l.text;},\n\n    getLineHandle: function(line) {if (isLine(this, line)) return getLine(this, line);},\n    getLineNumber: function(line) {return lineNo(line);},\n\n    getLineHandleVisualStart: function(line) {\n      if (typeof line == \"number\") line = getLine(this, line);\n      return visualLine(line);\n    },\n\n    lineCount: function() {return this.size;},\n    firstLine: function() {return this.first;},\n    lastLine: function() {return this.first + this.size - 1;},\n\n    clipPos: function(pos) {return clipPos(this, pos);},\n\n    getCursor: function(start) {\n      var range = this.sel.primary(), pos;\n      if (start == null || start == \"head\") pos = range.head;\n      else if (start == \"anchor\") pos = range.anchor;\n      else if (start == \"end\" || start == \"to\" || start === false) pos = range.to();\n      else pos = range.from();\n      return pos;\n    },\n    listSelections: function() { return this.sel.ranges; },\n    somethingSelected: function() {return this.sel.somethingSelected();},\n\n    setCursor: docMethodOp(function(line, ch, options) {\n      setSimpleSelection(this, clipPos(this, typeof line == \"number\" ? Pos(line, ch || 0) : line), null, options);\n    }),\n    setSelection: docMethodOp(function(anchor, head, options) {\n      setSimpleSelection(this, clipPos(this, anchor), clipPos(this, head || anchor), options);\n    }),\n    extendSelection: docMethodOp(function(head, other, options) {\n      extendSelection(this, clipPos(this, head), other && clipPos(this, other), options);\n    }),\n    extendSelections: docMethodOp(function(heads, options) {\n      extendSelections(this, clipPosArray(this, heads, options));\n    }),\n    extendSelectionsBy: docMethodOp(function(f, options) {\n      extendSelections(this, map(this.sel.ranges, f), options);\n    }),\n    setSelections: docMethodOp(function(ranges, primary, options) {\n      if (!ranges.length) return;\n      for (var i = 0, out = []; i < ranges.length; i++)\n        out[i] = new Range(clipPos(this, ranges[i].anchor),\n                           clipPos(this, ranges[i].head));\n      if (primary == null) primary = Math.min(ranges.length - 1, this.sel.primIndex);\n      setSelection(this, normalizeSelection(out, primary), options);\n    }),\n    addSelection: docMethodOp(function(anchor, head, options) {\n      var ranges = this.sel.ranges.slice(0);\n      ranges.push(new Range(clipPos(this, anchor), clipPos(this, head || anchor)));\n      setSelection(this, normalizeSelection(ranges, ranges.length - 1), options);\n    }),\n\n    getSelection: function(lineSep) {\n      var ranges = this.sel.ranges, lines;\n      for (var i = 0; i < ranges.length; i++) {\n        var sel = getBetween(this, ranges[i].from(), ranges[i].to());\n        lines = lines ? lines.concat(sel) : sel;\n      }\n      if (lineSep === false) return lines;\n      else return lines.join(lineSep || \"\\n\");\n    },\n    getSelections: function(lineSep) {\n      var parts = [], ranges = this.sel.ranges;\n      for (var i = 0; i < ranges.length; i++) {\n        var sel = getBetween(this, ranges[i].from(), ranges[i].to());\n        if (lineSep !== false) sel = sel.join(lineSep || \"\\n\");\n        parts[i] = sel;\n      }\n      return parts;\n    },\n    replaceSelection: function(code, collapse, origin) {\n      var dup = [];\n      for (var i = 0; i < this.sel.ranges.length; i++)\n        dup[i] = code;\n      this.replaceSelections(dup, collapse, origin || \"+input\");\n    },\n    replaceSelections: docMethodOp(function(code, collapse, origin) {\n      var changes = [], sel = this.sel;\n      for (var i = 0; i < sel.ranges.length; i++) {\n        var range = sel.ranges[i];\n        changes[i] = {from: range.from(), to: range.to(), text: splitLines(code[i]), origin: origin};\n      }\n      var newSel = collapse && collapse != \"end\" && computeReplacedSel(this, changes, collapse);\n      for (var i = changes.length - 1; i >= 0; i--)\n        makeChange(this, changes[i]);\n      if (newSel) setSelectionReplaceHistory(this, newSel);\n      else if (this.cm) ensureCursorVisible(this.cm);\n    }),\n    undo: docMethodOp(function() {makeChangeFromHistory(this, \"undo\");}),\n    redo: docMethodOp(function() {makeChangeFromHistory(this, \"redo\");}),\n    undoSelection: docMethodOp(function() {makeChangeFromHistory(this, \"undo\", true);}),\n    redoSelection: docMethodOp(function() {makeChangeFromHistory(this, \"redo\", true);}),\n\n    setExtending: function(val) {this.extend = val;},\n    getExtending: function() {return this.extend;},\n\n    historySize: function() {\n      var hist = this.history, done = 0, undone = 0;\n      for (var i = 0; i < hist.done.length; i++) if (!hist.done[i].ranges) ++done;\n      for (var i = 0; i < hist.undone.length; i++) if (!hist.undone[i].ranges) ++undone;\n      return {undo: done, redo: undone};\n    },\n    clearHistory: function() {this.history = new History(this.history.maxGeneration);},\n\n    markClean: function() {\n      this.cleanGeneration = this.changeGeneration(true);\n    },\n    changeGeneration: function(forceSplit) {\n      if (forceSplit)\n        this.history.lastOp = this.history.lastSelOp = this.history.lastOrigin = null;\n      return this.history.generation;\n    },\n    isClean: function (gen) {\n      return this.history.generation == (gen || this.cleanGeneration);\n    },\n\n    getHistory: function() {\n      return {done: copyHistoryArray(this.history.done),\n              undone: copyHistoryArray(this.history.undone)};\n    },\n    setHistory: function(histData) {\n      var hist = this.history = new History(this.history.maxGeneration);\n      hist.done = copyHistoryArray(histData.done.slice(0), null, true);\n      hist.undone = copyHistoryArray(histData.undone.slice(0), null, true);\n    },\n\n    addLineClass: docMethodOp(function(handle, where, cls) {\n      return changeLine(this, handle, where == \"gutter\" ? \"gutter\" : \"class\", function(line) {\n        var prop = where == \"text\" ? \"textClass\"\n                 : where == \"background\" ? \"bgClass\"\n                 : where == \"gutter\" ? \"gutterClass\" : \"wrapClass\";\n        if (!line[prop]) line[prop] = cls;\n        else if (classTest(cls).test(line[prop])) return false;\n        else line[prop] += \" \" + cls;\n        return true;\n      });\n    }),\n    removeLineClass: docMethodOp(function(handle, where, cls) {\n      return changeLine(this, handle, where == \"gutter\" ? \"gutter\" : \"class\", function(line) {\n        var prop = where == \"text\" ? \"textClass\"\n                 : where == \"background\" ? \"bgClass\"\n                 : where == \"gutter\" ? \"gutterClass\" : \"wrapClass\";\n        var cur = line[prop];\n        if (!cur) return false;\n        else if (cls == null) line[prop] = null;\n        else {\n          var found = cur.match(classTest(cls));\n          if (!found) return false;\n          var end = found.index + found[0].length;\n          line[prop] = cur.slice(0, found.index) + (!found.index || end == cur.length ? \"\" : \" \") + cur.slice(end) || null;\n        }\n        return true;\n      });\n    }),\n\n    addLineWidget: docMethodOp(function(handle, node, options) {\n      return addLineWidget(this, handle, node, options);\n    }),\n    removeLineWidget: function(widget) { widget.clear(); },\n\n    markText: function(from, to, options) {\n      return markText(this, clipPos(this, from), clipPos(this, to), options, \"range\");\n    },\n    setBookmark: function(pos, options) {\n      var realOpts = {replacedWith: options && (options.nodeType == null ? options.widget : options),\n                      insertLeft: options && options.insertLeft,\n                      clearWhenEmpty: false, shared: options && options.shared,\n                      handleMouseEvents: options && options.handleMouseEvents};\n      pos = clipPos(this, pos);\n      return markText(this, pos, pos, realOpts, \"bookmark\");\n    },\n    findMarksAt: function(pos) {\n      pos = clipPos(this, pos);\n      var markers = [], spans = getLine(this, pos.line).markedSpans;\n      if (spans) for (var i = 0; i < spans.length; ++i) {\n        var span = spans[i];\n        if ((span.from == null || span.from <= pos.ch) &&\n            (span.to == null || span.to >= pos.ch))\n          markers.push(span.marker.parent || span.marker);\n      }\n      return markers;\n    },\n    findMarks: function(from, to, filter) {\n      from = clipPos(this, from); to = clipPos(this, to);\n      var found = [], lineNo = from.line;\n      this.iter(from.line, to.line + 1, function(line) {\n        var spans = line.markedSpans;\n        if (spans) for (var i = 0; i < spans.length; i++) {\n          var span = spans[i];\n          if (!(lineNo == from.line && from.ch > span.to ||\n                span.from == null && lineNo != from.line||\n                lineNo == to.line && span.from > to.ch) &&\n              (!filter || filter(span.marker)))\n            found.push(span.marker.parent || span.marker);\n        }\n        ++lineNo;\n      });\n      return found;\n    },\n    getAllMarks: function() {\n      var markers = [];\n      this.iter(function(line) {\n        var sps = line.markedSpans;\n        if (sps) for (var i = 0; i < sps.length; ++i)\n          if (sps[i].from != null) markers.push(sps[i].marker);\n      });\n      return markers;\n    },\n\n    posFromIndex: function(off) {\n      var ch, lineNo = this.first;\n      this.iter(function(line) {\n        var sz = line.text.length + 1;\n        if (sz > off) { ch = off; return true; }\n        off -= sz;\n        ++lineNo;\n      });\n      return clipPos(this, Pos(lineNo, ch));\n    },\n    indexFromPos: function (coords) {\n      coords = clipPos(this, coords);\n      var index = coords.ch;\n      if (coords.line < this.first || coords.ch < 0) return 0;\n      this.iter(this.first, coords.line, function (line) {\n        index += line.text.length + 1;\n      });\n      return index;\n    },\n\n    copy: function(copyHistory) {\n      var doc = new Doc(getLines(this, this.first, this.first + this.size), this.modeOption, this.first);\n      doc.scrollTop = this.scrollTop; doc.scrollLeft = this.scrollLeft;\n      doc.sel = this.sel;\n      doc.extend = false;\n      if (copyHistory) {\n        doc.history.undoDepth = this.history.undoDepth;\n        doc.setHistory(this.getHistory());\n      }\n      return doc;\n    },\n\n    linkedDoc: function(options) {\n      if (!options) options = {};\n      var from = this.first, to = this.first + this.size;\n      if (options.from != null && options.from > from) from = options.from;\n      if (options.to != null && options.to < to) to = options.to;\n      var copy = new Doc(getLines(this, from, to), options.mode || this.modeOption, from);\n      if (options.sharedHist) copy.history = this.history;\n      (this.linked || (this.linked = [])).push({doc: copy, sharedHist: options.sharedHist});\n      copy.linked = [{doc: this, isParent: true, sharedHist: options.sharedHist}];\n      copySharedMarkers(copy, findSharedMarkers(this));\n      return copy;\n    },\n    unlinkDoc: function(other) {\n      if (other instanceof CodeMirror) other = other.doc;\n      if (this.linked) for (var i = 0; i < this.linked.length; ++i) {\n        var link = this.linked[i];\n        if (link.doc != other) continue;\n        this.linked.splice(i, 1);\n        other.unlinkDoc(this);\n        detachSharedMarkers(findSharedMarkers(this));\n        break;\n      }\n      // If the histories were shared, split them again\n      if (other.history == this.history) {\n        var splitIds = [other.id];\n        linkedDocs(other, function(doc) {splitIds.push(doc.id);}, true);\n        other.history = new History(null);\n        other.history.done = copyHistoryArray(this.history.done, splitIds);\n        other.history.undone = copyHistoryArray(this.history.undone, splitIds);\n      }\n    },\n    iterLinkedDocs: function(f) {linkedDocs(this, f);},\n\n    getMode: function() {return this.mode;},\n    getEditor: function() {return this.cm;}\n  });\n\n  // Public alias.\n  Doc.prototype.eachLine = Doc.prototype.iter;\n\n  // Set up methods on CodeMirror's prototype to redirect to the editor's document.\n  var dontDelegate = \"iter insert remove copy getEditor\".split(\" \");\n  for (var prop in Doc.prototype) if (Doc.prototype.hasOwnProperty(prop) && indexOf(dontDelegate, prop) < 0)\n    CodeMirror.prototype[prop] = (function(method) {\n      return function() {return method.apply(this.doc, arguments);};\n    })(Doc.prototype[prop]);\n\n  eventMixin(Doc);\n\n  // Call f for all linked documents.\n  function linkedDocs(doc, f, sharedHistOnly) {\n    function propagate(doc, skip, sharedHist) {\n      if (doc.linked) for (var i = 0; i < doc.linked.length; ++i) {\n        var rel = doc.linked[i];\n        if (rel.doc == skip) continue;\n        var shared = sharedHist && rel.sharedHist;\n        if (sharedHistOnly && !shared) continue;\n        f(rel.doc, shared);\n        propagate(rel.doc, doc, shared);\n      }\n    }\n    propagate(doc, null, true);\n  }\n\n  // Attach a document to an editor.\n  function attachDoc(cm, doc) {\n    if (doc.cm) throw new Error(\"This document is already in use.\");\n    cm.doc = doc;\n    doc.cm = cm;\n    estimateLineHeights(cm);\n    loadMode(cm);\n    if (!cm.options.lineWrapping) findMaxLine(cm);\n    cm.options.mode = doc.modeOption;\n    regChange(cm);\n  }\n\n  // LINE UTILITIES\n\n  // Find the line object corresponding to the given line number.\n  function getLine(doc, n) {\n    n -= doc.first;\n    if (n < 0 || n >= doc.size) throw new Error(\"There is no line \" + (n + doc.first) + \" in the document.\");\n    for (var chunk = doc; !chunk.lines;) {\n      for (var i = 0;; ++i) {\n        var child = chunk.children[i], sz = child.chunkSize();\n        if (n < sz) { chunk = child; break; }\n        n -= sz;\n      }\n    }\n    return chunk.lines[n];\n  }\n\n  // Get the part of a document between two positions, as an array of\n  // strings.\n  function getBetween(doc, start, end) {\n    var out = [], n = start.line;\n    doc.iter(start.line, end.line + 1, function(line) {\n      var text = line.text;\n      if (n == end.line) text = text.slice(0, end.ch);\n      if (n == start.line) text = text.slice(start.ch);\n      out.push(text);\n      ++n;\n    });\n    return out;\n  }\n  // Get the lines between from and to, as array of strings.\n  function getLines(doc, from, to) {\n    var out = [];\n    doc.iter(from, to, function(line) { out.push(line.text); });\n    return out;\n  }\n\n  // Update the height of a line, propagating the height change\n  // upwards to parent nodes.\n  function updateLineHeight(line, height) {\n    var diff = height - line.height;\n    if (diff) for (var n = line; n; n = n.parent) n.height += diff;\n  }\n\n  // Given a line object, find its line number by walking up through\n  // its parent links.\n  function lineNo(line) {\n    if (line.parent == null) return null;\n    var cur = line.parent, no = indexOf(cur.lines, line);\n    for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {\n      for (var i = 0;; ++i) {\n        if (chunk.children[i] == cur) break;\n        no += chunk.children[i].chunkSize();\n      }\n    }\n    return no + cur.first;\n  }\n\n  // Find the line at the given vertical position, using the height\n  // information in the document tree.\n  function lineAtHeight(chunk, h) {\n    var n = chunk.first;\n    outer: do {\n      for (var i = 0; i < chunk.children.length; ++i) {\n        var child = chunk.children[i], ch = child.height;\n        if (h < ch) { chunk = child; continue outer; }\n        h -= ch;\n        n += child.chunkSize();\n      }\n      return n;\n    } while (!chunk.lines);\n    for (var i = 0; i < chunk.lines.length; ++i) {\n      var line = chunk.lines[i], lh = line.height;\n      if (h < lh) break;\n      h -= lh;\n    }\n    return n + i;\n  }\n\n\n  // Find the height above the given line.\n  function heightAtLine(lineObj) {\n    lineObj = visualLine(lineObj);\n\n    var h = 0, chunk = lineObj.parent;\n    for (var i = 0; i < chunk.lines.length; ++i) {\n      var line = chunk.lines[i];\n      if (line == lineObj) break;\n      else h += line.height;\n    }\n    for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {\n      for (var i = 0; i < p.children.length; ++i) {\n        var cur = p.children[i];\n        if (cur == chunk) break;\n        else h += cur.height;\n      }\n    }\n    return h;\n  }\n\n  // Get the bidi ordering for the given line (and cache it). Returns\n  // false for lines that are fully left-to-right, and an array of\n  // BidiSpan objects otherwise.\n  function getOrder(line) {\n    var order = line.order;\n    if (order == null) order = line.order = bidiOrdering(line.text);\n    return order;\n  }\n\n  // HISTORY\n\n  function History(startGen) {\n    // Arrays of change events and selections. Doing something adds an\n    // event to done and clears undo. Undoing moves events from done\n    // to undone, redoing moves them in the other direction.\n    this.done = []; this.undone = [];\n    this.undoDepth = Infinity;\n    // Used to track when changes can be merged into a single undo\n    // event\n    this.lastModTime = this.lastSelTime = 0;\n    this.lastOp = this.lastSelOp = null;\n    this.lastOrigin = this.lastSelOrigin = null;\n    // Used by the isClean() method\n    this.generation = this.maxGeneration = startGen || 1;\n  }\n\n  // Create a history change event from an updateDoc-style change\n  // object.\n  function historyChangeFromChange(doc, change) {\n    var histChange = {from: copyPos(change.from), to: changeEnd(change), text: getBetween(doc, change.from, change.to)};\n    attachLocalSpans(doc, histChange, change.from.line, change.to.line + 1);\n    linkedDocs(doc, function(doc) {attachLocalSpans(doc, histChange, change.from.line, change.to.line + 1);}, true);\n    return histChange;\n  }\n\n  // Pop all selection events off the end of a history array. Stop at\n  // a change event.\n  function clearSelectionEvents(array) {\n    while (array.length) {\n      var last = lst(array);\n      if (last.ranges) array.pop();\n      else break;\n    }\n  }\n\n  // Find the top change event in the history. Pop off selection\n  // events that are in the way.\n  function lastChangeEvent(hist, force) {\n    if (force) {\n      clearSelectionEvents(hist.done);\n      return lst(hist.done);\n    } else if (hist.done.length && !lst(hist.done).ranges) {\n      return lst(hist.done);\n    } else if (hist.done.length > 1 && !hist.done[hist.done.length - 2].ranges) {\n      hist.done.pop();\n      return lst(hist.done);\n    }\n  }\n\n  // Register a change in the history. Merges changes that are within\n  // a single operation, ore are close together with an origin that\n  // allows merging (starting with \"+\") into a single event.\n  function addChangeToHistory(doc, change, selAfter, opId) {\n    var hist = doc.history;\n    hist.undone.length = 0;\n    var time = +new Date, cur;\n\n    if ((hist.lastOp == opId ||\n         hist.lastOrigin == change.origin && change.origin &&\n         ((change.origin.charAt(0) == \"+\" && doc.cm && hist.lastModTime > time - doc.cm.options.historyEventDelay) ||\n          change.origin.charAt(0) == \"*\")) &&\n        (cur = lastChangeEvent(hist, hist.lastOp == opId))) {\n      // Merge this change into the last event\n      var last = lst(cur.changes);\n      if (cmp(change.from, change.to) == 0 && cmp(change.from, last.to) == 0) {\n        // Optimized case for simple insertion -- don't want to add\n        // new changesets for every character typed\n        last.to = changeEnd(change);\n      } else {\n        // Add new sub-event\n        cur.changes.push(historyChangeFromChange(doc, change));\n      }\n    } else {\n      // Can not be merged, start a new event.\n      var before = lst(hist.done);\n      if (!before || !before.ranges)\n        pushSelectionToHistory(doc.sel, hist.done);\n      cur = {changes: [historyChangeFromChange(doc, change)],\n             generation: hist.generation};\n      hist.done.push(cur);\n      while (hist.done.length > hist.undoDepth) {\n        hist.done.shift();\n        if (!hist.done[0].ranges) hist.done.shift();\n      }\n    }\n    hist.done.push(selAfter);\n    hist.generation = ++hist.maxGeneration;\n    hist.lastModTime = hist.lastSelTime = time;\n    hist.lastOp = hist.lastSelOp = opId;\n    hist.lastOrigin = hist.lastSelOrigin = change.origin;\n\n    if (!last) signal(doc, \"historyAdded\");\n  }\n\n  function selectionEventCanBeMerged(doc, origin, prev, sel) {\n    var ch = origin.charAt(0);\n    return ch == \"*\" ||\n      ch == \"+\" &&\n      prev.ranges.length == sel.ranges.length &&\n      prev.somethingSelected() == sel.somethingSelected() &&\n      new Date - doc.history.lastSelTime <= (doc.cm ? doc.cm.options.historyEventDelay : 500);\n  }\n\n  // Called whenever the selection changes, sets the new selection as\n  // the pending selection in the history, and pushes the old pending\n  // selection into the 'done' array when it was significantly\n  // different (in number of selected ranges, emptiness, or time).\n  function addSelectionToHistory(doc, sel, opId, options) {\n    var hist = doc.history, origin = options && options.origin;\n\n    // A new event is started when the previous origin does not match\n    // the current, or the origins don't allow matching. Origins\n    // starting with * are always merged, those starting with + are\n    // merged when similar and close together in time.\n    if (opId == hist.lastSelOp ||\n        (origin && hist.lastSelOrigin == origin &&\n         (hist.lastModTime == hist.lastSelTime && hist.lastOrigin == origin ||\n          selectionEventCanBeMerged(doc, origin, lst(hist.done), sel))))\n      hist.done[hist.done.length - 1] = sel;\n    else\n      pushSelectionToHistory(sel, hist.done);\n\n    hist.lastSelTime = +new Date;\n    hist.lastSelOrigin = origin;\n    hist.lastSelOp = opId;\n    if (options && options.clearRedo !== false)\n      clearSelectionEvents(hist.undone);\n  }\n\n  function pushSelectionToHistory(sel, dest) {\n    var top = lst(dest);\n    if (!(top && top.ranges && top.equals(sel)))\n      dest.push(sel);\n  }\n\n  // Used to store marked span information in the history.\n  function attachLocalSpans(doc, change, from, to) {\n    var existing = change[\"spans_\" + doc.id], n = 0;\n    doc.iter(Math.max(doc.first, from), Math.min(doc.first + doc.size, to), function(line) {\n      if (line.markedSpans)\n        (existing || (existing = change[\"spans_\" + doc.id] = {}))[n] = line.markedSpans;\n      ++n;\n    });\n  }\n\n  // When un/re-doing restores text containing marked spans, those\n  // that have been explicitly cleared should not be restored.\n  function removeClearedSpans(spans) {\n    if (!spans) return null;\n    for (var i = 0, out; i < spans.length; ++i) {\n      if (spans[i].marker.explicitlyCleared) { if (!out) out = spans.slice(0, i); }\n      else if (out) out.push(spans[i]);\n    }\n    return !out ? spans : out.length ? out : null;\n  }\n\n  // Retrieve and filter the old marked spans stored in a change event.\n  function getOldSpans(doc, change) {\n    var found = change[\"spans_\" + doc.id];\n    if (!found) return null;\n    for (var i = 0, nw = []; i < change.text.length; ++i)\n      nw.push(removeClearedSpans(found[i]));\n    return nw;\n  }\n\n  // Used both to provide a JSON-safe object in .getHistory, and, when\n  // detaching a document, to split the history in two\n  function copyHistoryArray(events, newGroup, instantiateSel) {\n    for (var i = 0, copy = []; i < events.length; ++i) {\n      var event = events[i];\n      if (event.ranges) {\n        copy.push(instantiateSel ? Selection.prototype.deepCopy.call(event) : event);\n        continue;\n      }\n      var changes = event.changes, newChanges = [];\n      copy.push({changes: newChanges});\n      for (var j = 0; j < changes.length; ++j) {\n        var change = changes[j], m;\n        newChanges.push({from: change.from, to: change.to, text: change.text});\n        if (newGroup) for (var prop in change) if (m = prop.match(/^spans_(\\d+)$/)) {\n          if (indexOf(newGroup, Number(m[1])) > -1) {\n            lst(newChanges)[prop] = change[prop];\n            delete change[prop];\n          }\n        }\n      }\n    }\n    return copy;\n  }\n\n  // Rebasing/resetting history to deal with externally-sourced changes\n\n  function rebaseHistSelSingle(pos, from, to, diff) {\n    if (to < pos.line) {\n      pos.line += diff;\n    } else if (from < pos.line) {\n      pos.line = from;\n      pos.ch = 0;\n    }\n  }\n\n  // Tries to rebase an array of history events given a change in the\n  // document. If the change touches the same lines as the event, the\n  // event, and everything 'behind' it, is discarded. If the change is\n  // before the event, the event's positions are updated. Uses a\n  // copy-on-write scheme for the positions, to avoid having to\n  // reallocate them all on every rebase, but also avoid problems with\n  // shared position objects being unsafely updated.\n  function rebaseHistArray(array, from, to, diff) {\n    for (var i = 0; i < array.length; ++i) {\n      var sub = array[i], ok = true;\n      if (sub.ranges) {\n        if (!sub.copied) { sub = array[i] = sub.deepCopy(); sub.copied = true; }\n        for (var j = 0; j < sub.ranges.length; j++) {\n          rebaseHistSelSingle(sub.ranges[j].anchor, from, to, diff);\n          rebaseHistSelSingle(sub.ranges[j].head, from, to, diff);\n        }\n        continue;\n      }\n      for (var j = 0; j < sub.changes.length; ++j) {\n        var cur = sub.changes[j];\n        if (to < cur.from.line) {\n          cur.from = Pos(cur.from.line + diff, cur.from.ch);\n          cur.to = Pos(cur.to.line + diff, cur.to.ch);\n        } else if (from <= cur.to.line) {\n          ok = false;\n          break;\n        }\n      }\n      if (!ok) {\n        array.splice(0, i + 1);\n        i = 0;\n      }\n    }\n  }\n\n  function rebaseHist(hist, change) {\n    var from = change.from.line, to = change.to.line, diff = change.text.length - (to - from) - 1;\n    rebaseHistArray(hist.done, from, to, diff);\n    rebaseHistArray(hist.undone, from, to, diff);\n  }\n\n  // EVENT UTILITIES\n\n  // Due to the fact that we still support jurassic IE versions, some\n  // compatibility wrappers are needed.\n\n  var e_preventDefault = CodeMirror.e_preventDefault = function(e) {\n    if (e.preventDefault) e.preventDefault();\n    else e.returnValue = false;\n  };\n  var e_stopPropagation = CodeMirror.e_stopPropagation = function(e) {\n    if (e.stopPropagation) e.stopPropagation();\n    else e.cancelBubble = true;\n  };\n  function e_defaultPrevented(e) {\n    return e.defaultPrevented != null ? e.defaultPrevented : e.returnValue == false;\n  }\n  var e_stop = CodeMirror.e_stop = function(e) {e_preventDefault(e); e_stopPropagation(e);};\n\n  function e_target(e) {return e.target || e.srcElement;}\n  function e_button(e) {\n    var b = e.which;\n    if (b == null) {\n      if (e.button & 1) b = 1;\n      else if (e.button & 2) b = 3;\n      else if (e.button & 4) b = 2;\n    }\n    if (mac && e.ctrlKey && b == 1) b = 3;\n    return b;\n  }\n\n  // EVENT HANDLING\n\n  // Lightweight event framework. on/off also work on DOM nodes,\n  // registering native DOM handlers.\n\n  var on = CodeMirror.on = function(emitter, type, f) {\n    if (emitter.addEventListener)\n      emitter.addEventListener(type, f, false);\n    else if (emitter.attachEvent)\n      emitter.attachEvent(\"on\" + type, f);\n    else {\n      var map = emitter._handlers || (emitter._handlers = {});\n      var arr = map[type] || (map[type] = []);\n      arr.push(f);\n    }\n  };\n\n  var off = CodeMirror.off = function(emitter, type, f) {\n    if (emitter.removeEventListener)\n      emitter.removeEventListener(type, f, false);\n    else if (emitter.detachEvent)\n      emitter.detachEvent(\"on\" + type, f);\n    else {\n      var arr = emitter._handlers && emitter._handlers[type];\n      if (!arr) return;\n      for (var i = 0; i < arr.length; ++i)\n        if (arr[i] == f) { arr.splice(i, 1); break; }\n    }\n  };\n\n  var signal = CodeMirror.signal = function(emitter, type /*, values...*/) {\n    var arr = emitter._handlers && emitter._handlers[type];\n    if (!arr) return;\n    var args = Array.prototype.slice.call(arguments, 2);\n    for (var i = 0; i < arr.length; ++i) arr[i].apply(null, args);\n  };\n\n  var orphanDelayedCallbacks = null;\n\n  // Often, we want to signal events at a point where we are in the\n  // middle of some work, but don't want the handler to start calling\n  // other methods on the editor, which might be in an inconsistent\n  // state or simply not expect any other events to happen.\n  // signalLater looks whether there are any handlers, and schedules\n  // them to be executed when the last operation ends, or, if no\n  // operation is active, when a timeout fires.\n  function signalLater(emitter, type /*, values...*/) {\n    var arr = emitter._handlers && emitter._handlers[type];\n    if (!arr) return;\n    var args = Array.prototype.slice.call(arguments, 2), list;\n    if (operationGroup) {\n      list = operationGroup.delayedCallbacks;\n    } else if (orphanDelayedCallbacks) {\n      list = orphanDelayedCallbacks;\n    } else {\n      list = orphanDelayedCallbacks = [];\n      setTimeout(fireOrphanDelayed, 0);\n    }\n    function bnd(f) {return function(){f.apply(null, args);};};\n    for (var i = 0; i < arr.length; ++i)\n      list.push(bnd(arr[i]));\n  }\n\n  function fireOrphanDelayed() {\n    var delayed = orphanDelayedCallbacks;\n    orphanDelayedCallbacks = null;\n    for (var i = 0; i < delayed.length; ++i) delayed[i]();\n  }\n\n  // The DOM events that CodeMirror handles can be overridden by\n  // registering a (non-DOM) handler on the editor for the event name,\n  // and preventDefault-ing the event in that handler.\n  function signalDOMEvent(cm, e, override) {\n    if (typeof e == \"string\")\n      e = {type: e, preventDefault: function() { this.defaultPrevented = true; }};\n    signal(cm, override || e.type, cm, e);\n    return e_defaultPrevented(e) || e.codemirrorIgnore;\n  }\n\n  function signalCursorActivity(cm) {\n    var arr = cm._handlers && cm._handlers.cursorActivity;\n    if (!arr) return;\n    var set = cm.curOp.cursorActivityHandlers || (cm.curOp.cursorActivityHandlers = []);\n    for (var i = 0; i < arr.length; ++i) if (indexOf(set, arr[i]) == -1)\n      set.push(arr[i]);\n  }\n\n  function hasHandler(emitter, type) {\n    var arr = emitter._handlers && emitter._handlers[type];\n    return arr && arr.length > 0;\n  }\n\n  // Add on and off methods to a constructor's prototype, to make\n  // registering events on such objects more convenient.\n  function eventMixin(ctor) {\n    ctor.prototype.on = function(type, f) {on(this, type, f);};\n    ctor.prototype.off = function(type, f) {off(this, type, f);};\n  }\n\n  // MISC UTILITIES\n\n  // Number of pixels added to scroller and sizer to hide scrollbar\n  var scrollerGap = 30;\n\n  // Returned or thrown by various protocols to signal 'I'm not\n  // handling this'.\n  var Pass = CodeMirror.Pass = {toString: function(){return \"CodeMirror.Pass\";}};\n\n  // Reused option objects for setSelection & friends\n  var sel_dontScroll = {scroll: false}, sel_mouse = {origin: \"*mouse\"}, sel_move = {origin: \"+move\"};\n\n  function Delayed() {this.id = null;}\n  Delayed.prototype.set = function(ms, f) {\n    clearTimeout(this.id);\n    this.id = setTimeout(f, ms);\n  };\n\n  // Counts the column offset in a string, taking tabs into account.\n  // Used mostly to find indentation.\n  var countColumn = CodeMirror.countColumn = function(string, end, tabSize, startIndex, startValue) {\n    if (end == null) {\n      end = string.search(/[^\\s\\u00a0]/);\n      if (end == -1) end = string.length;\n    }\n    for (var i = startIndex || 0, n = startValue || 0;;) {\n      var nextTab = string.indexOf(\"\\t\", i);\n      if (nextTab < 0 || nextTab >= end)\n        return n + (end - i);\n      n += nextTab - i;\n      n += tabSize - (n % tabSize);\n      i = nextTab + 1;\n    }\n  };\n\n  // The inverse of countColumn -- find the offset that corresponds to\n  // a particular column.\n  function findColumn(string, goal, tabSize) {\n    for (var pos = 0, col = 0;;) {\n      var nextTab = string.indexOf(\"\\t\", pos);\n      if (nextTab == -1) nextTab = string.length;\n      var skipped = nextTab - pos;\n      if (nextTab == string.length || col + skipped >= goal)\n        return pos + Math.min(skipped, goal - col);\n      col += nextTab - pos;\n      col += tabSize - (col % tabSize);\n      pos = nextTab + 1;\n      if (col >= goal) return pos;\n    }\n  }\n\n  var spaceStrs = [\"\"];\n  function spaceStr(n) {\n    while (spaceStrs.length <= n)\n      spaceStrs.push(lst(spaceStrs) + \" \");\n    return spaceStrs[n];\n  }\n\n  function lst(arr) { return arr[arr.length-1]; }\n\n  var selectInput = function(node) { node.select(); };\n  if (ios) // Mobile Safari apparently has a bug where select() is broken.\n    selectInput = function(node) { node.selectionStart = 0; node.selectionEnd = node.value.length; };\n  else if (ie) // Suppress mysterious IE10 errors\n    selectInput = function(node) { try { node.select(); } catch(_e) {} };\n\n  function indexOf(array, elt) {\n    for (var i = 0; i < array.length; ++i)\n      if (array[i] == elt) return i;\n    return -1;\n  }\n  function map(array, f) {\n    var out = [];\n    for (var i = 0; i < array.length; i++) out[i] = f(array[i], i);\n    return out;\n  }\n\n  function nothing() {}\n\n  function createObj(base, props) {\n    var inst;\n    if (Object.create) {\n      inst = Object.create(base);\n    } else {\n      nothing.prototype = base;\n      inst = new nothing();\n    }\n    if (props) copyObj(props, inst);\n    return inst;\n  };\n\n  function copyObj(obj, target, overwrite) {\n    if (!target) target = {};\n    for (var prop in obj)\n      if (obj.hasOwnProperty(prop) && (overwrite !== false || !target.hasOwnProperty(prop)))\n        target[prop] = obj[prop];\n    return target;\n  }\n\n  function bind(f) {\n    var args = Array.prototype.slice.call(arguments, 1);\n    return function(){return f.apply(null, args);};\n  }\n\n  var nonASCIISingleCaseWordChar = /[\\u00df\\u0587\\u0590-\\u05f4\\u0600-\\u06ff\\u3040-\\u309f\\u30a0-\\u30ff\\u3400-\\u4db5\\u4e00-\\u9fcc\\uac00-\\ud7af]/;\n  var isWordCharBasic = CodeMirror.isWordChar = function(ch) {\n    return /\\w/.test(ch) || ch > \"\\x80\" &&\n      (ch.toUpperCase() != ch.toLowerCase() || nonASCIISingleCaseWordChar.test(ch));\n  };\n  function isWordChar(ch, helper) {\n    if (!helper) return isWordCharBasic(ch);\n    if (helper.source.indexOf(\"\\\\w\") > -1 && isWordCharBasic(ch)) return true;\n    return helper.test(ch);\n  }\n\n  function isEmpty(obj) {\n    for (var n in obj) if (obj.hasOwnProperty(n) && obj[n]) return false;\n    return true;\n  }\n\n  // Extending unicode characters. A series of a non-extending char +\n  // any number of extending chars is treated as a single unit as far\n  // as editing and measuring is concerned. This is not fully correct,\n  // since some scripts/fonts/browsers also treat other configurations\n  // of code points as a group.\n  var extendingChars = /[\\u0300-\\u036f\\u0483-\\u0489\\u0591-\\u05bd\\u05bf\\u05c1\\u05c2\\u05c4\\u05c5\\u05c7\\u0610-\\u061a\\u064b-\\u065e\\u0670\\u06d6-\\u06dc\\u06de-\\u06e4\\u06e7\\u06e8\\u06ea-\\u06ed\\u0711\\u0730-\\u074a\\u07a6-\\u07b0\\u07eb-\\u07f3\\u0816-\\u0819\\u081b-\\u0823\\u0825-\\u0827\\u0829-\\u082d\\u0900-\\u0902\\u093c\\u0941-\\u0948\\u094d\\u0951-\\u0955\\u0962\\u0963\\u0981\\u09bc\\u09be\\u09c1-\\u09c4\\u09cd\\u09d7\\u09e2\\u09e3\\u0a01\\u0a02\\u0a3c\\u0a41\\u0a42\\u0a47\\u0a48\\u0a4b-\\u0a4d\\u0a51\\u0a70\\u0a71\\u0a75\\u0a81\\u0a82\\u0abc\\u0ac1-\\u0ac5\\u0ac7\\u0ac8\\u0acd\\u0ae2\\u0ae3\\u0b01\\u0b3c\\u0b3e\\u0b3f\\u0b41-\\u0b44\\u0b4d\\u0b56\\u0b57\\u0b62\\u0b63\\u0b82\\u0bbe\\u0bc0\\u0bcd\\u0bd7\\u0c3e-\\u0c40\\u0c46-\\u0c48\\u0c4a-\\u0c4d\\u0c55\\u0c56\\u0c62\\u0c63\\u0cbc\\u0cbf\\u0cc2\\u0cc6\\u0ccc\\u0ccd\\u0cd5\\u0cd6\\u0ce2\\u0ce3\\u0d3e\\u0d41-\\u0d44\\u0d4d\\u0d57\\u0d62\\u0d63\\u0dca\\u0dcf\\u0dd2-\\u0dd4\\u0dd6\\u0ddf\\u0e31\\u0e34-\\u0e3a\\u0e47-\\u0e4e\\u0eb1\\u0eb4-\\u0eb9\\u0ebb\\u0ebc\\u0ec8-\\u0ecd\\u0f18\\u0f19\\u0f35\\u0f37\\u0f39\\u0f71-\\u0f7e\\u0f80-\\u0f84\\u0f86\\u0f87\\u0f90-\\u0f97\\u0f99-\\u0fbc\\u0fc6\\u102d-\\u1030\\u1032-\\u1037\\u1039\\u103a\\u103d\\u103e\\u1058\\u1059\\u105e-\\u1060\\u1071-\\u1074\\u1082\\u1085\\u1086\\u108d\\u109d\\u135f\\u1712-\\u1714\\u1732-\\u1734\\u1752\\u1753\\u1772\\u1773\\u17b7-\\u17bd\\u17c6\\u17c9-\\u17d3\\u17dd\\u180b-\\u180d\\u18a9\\u1920-\\u1922\\u1927\\u1928\\u1932\\u1939-\\u193b\\u1a17\\u1a18\\u1a56\\u1a58-\\u1a5e\\u1a60\\u1a62\\u1a65-\\u1a6c\\u1a73-\\u1a7c\\u1a7f\\u1b00-\\u1b03\\u1b34\\u1b36-\\u1b3a\\u1b3c\\u1b42\\u1b6b-\\u1b73\\u1b80\\u1b81\\u1ba2-\\u1ba5\\u1ba8\\u1ba9\\u1c2c-\\u1c33\\u1c36\\u1c37\\u1cd0-\\u1cd2\\u1cd4-\\u1ce0\\u1ce2-\\u1ce8\\u1ced\\u1dc0-\\u1de6\\u1dfd-\\u1dff\\u200c\\u200d\\u20d0-\\u20f0\\u2cef-\\u2cf1\\u2de0-\\u2dff\\u302a-\\u302f\\u3099\\u309a\\ua66f-\\ua672\\ua67c\\ua67d\\ua6f0\\ua6f1\\ua802\\ua806\\ua80b\\ua825\\ua826\\ua8c4\\ua8e0-\\ua8f1\\ua926-\\ua92d\\ua947-\\ua951\\ua980-\\ua982\\ua9b3\\ua9b6-\\ua9b9\\ua9bc\\uaa29-\\uaa2e\\uaa31\\uaa32\\uaa35\\uaa36\\uaa43\\uaa4c\\uaab0\\uaab2-\\uaab4\\uaab7\\uaab8\\uaabe\\uaabf\\uaac1\\uabe5\\uabe8\\uabed\\udc00-\\udfff\\ufb1e\\ufe00-\\ufe0f\\ufe20-\\ufe26\\uff9e\\uff9f]/;\n  function isExtendingChar(ch) { return ch.charCodeAt(0) >= 768 && extendingChars.test(ch); }\n\n  // DOM UTILITIES\n\n  function elt(tag, content, className, style) {\n    var e = document.createElement(tag);\n    if (className) e.className = className;\n    if (style) e.style.cssText = style;\n    if (typeof content == \"string\") e.appendChild(document.createTextNode(content));\n    else if (content) for (var i = 0; i < content.length; ++i) e.appendChild(content[i]);\n    return e;\n  }\n\n  var range;\n  if (document.createRange) range = function(node, start, end, endNode) {\n    var r = document.createRange();\n    r.setEnd(endNode || node, end);\n    r.setStart(node, start);\n    return r;\n  };\n  else range = function(node, start, end) {\n    var r = document.body.createTextRange();\n    try { r.moveToElementText(node.parentNode); }\n    catch(e) { return r; }\n    r.collapse(true);\n    r.moveEnd(\"character\", end);\n    r.moveStart(\"character\", start);\n    return r;\n  };\n\n  function removeChildren(e) {\n    for (var count = e.childNodes.length; count > 0; --count)\n      e.removeChild(e.firstChild);\n    return e;\n  }\n\n  function removeChildrenAndAdd(parent, e) {\n    return removeChildren(parent).appendChild(e);\n  }\n\n  var contains = CodeMirror.contains = function(parent, child) {\n    if (child.nodeType == 3) // Android browser always returns false when child is a textnode\n      child = child.parentNode;\n    if (parent.contains)\n      return parent.contains(child);\n    do {\n      if (child.nodeType == 11) child = child.host;\n      if (child == parent) return true;\n    } while (child = child.parentNode);\n  };\n\n  function activeElt() { return document.activeElement; }\n  // Older versions of IE throws unspecified error when touching\n  // document.activeElement in some cases (during loading, in iframe)\n  if (ie && ie_version < 11) activeElt = function() {\n    try { return document.activeElement; }\n    catch(e) { return document.body; }\n  };\n\n  function classTest(cls) { return new RegExp(\"(^|\\\\s)\" + cls + \"(?:$|\\\\s)\\\\s*\"); }\n  var rmClass = CodeMirror.rmClass = function(node, cls) {\n    var current = node.className;\n    var match = classTest(cls).exec(current);\n    if (match) {\n      var after = current.slice(match.index + match[0].length);\n      node.className = current.slice(0, match.index) + (after ? match[1] + after : \"\");\n    }\n  };\n  var addClass = CodeMirror.addClass = function(node, cls) {\n    var current = node.className;\n    if (!classTest(cls).test(current)) node.className += (current ? \" \" : \"\") + cls;\n  };\n  function joinClasses(a, b) {\n    var as = a.split(\" \");\n    for (var i = 0; i < as.length; i++)\n      if (as[i] && !classTest(as[i]).test(b)) b += \" \" + as[i];\n    return b;\n  }\n\n  // WINDOW-WIDE EVENTS\n\n  // These must be handled carefully, because naively registering a\n  // handler for each editor will cause the editors to never be\n  // garbage collected.\n\n  function forEachCodeMirror(f) {\n    if (!document.body.getElementsByClassName) return;\n    var byClass = document.body.getElementsByClassName(\"CodeMirror\");\n    for (var i = 0; i < byClass.length; i++) {\n      var cm = byClass[i].CodeMirror;\n      if (cm) f(cm);\n    }\n  }\n\n  var globalsRegistered = false;\n  function ensureGlobalHandlers() {\n    if (globalsRegistered) return;\n    registerGlobalHandlers();\n    globalsRegistered = true;\n  }\n  function registerGlobalHandlers() {\n    // When the window resizes, we need to refresh active editors.\n    var resizeTimer;\n    on(window, \"resize\", function() {\n      if (resizeTimer == null) resizeTimer = setTimeout(function() {\n        resizeTimer = null;\n        forEachCodeMirror(onResize);\n      }, 100);\n    });\n    // When the window loses focus, we want to show the editor as blurred\n    on(window, \"blur\", function() {\n      forEachCodeMirror(onBlur);\n    });\n  }\n\n  // FEATURE DETECTION\n\n  // Detect drag-and-drop\n  var dragAndDrop = function() {\n    // There is *some* kind of drag-and-drop support in IE6-8, but I\n    // couldn't get it to work yet.\n    if (ie && ie_version < 9) return false;\n    var div = elt('div');\n    return \"draggable\" in div || \"dragDrop\" in div;\n  }();\n\n  var zwspSupported;\n  function zeroWidthElement(measure) {\n    if (zwspSupported == null) {\n      var test = elt(\"span\", \"\\u200b\");\n      removeChildrenAndAdd(measure, elt(\"span\", [test, document.createTextNode(\"x\")]));\n      if (measure.firstChild.offsetHeight != 0)\n        zwspSupported = test.offsetWidth <= 1 && test.offsetHeight > 2 && !(ie && ie_version < 8);\n    }\n    var node = zwspSupported ? elt(\"span\", \"\\u200b\") :\n      elt(\"span\", \"\\u00a0\", null, \"display: inline-block; width: 1px; margin-right: -1px\");\n    node.setAttribute(\"cm-text\", \"\");\n    return node;\n  }\n\n  // Feature-detect IE's crummy client rect reporting for bidi text\n  var badBidiRects;\n  function hasBadBidiRects(measure) {\n    if (badBidiRects != null) return badBidiRects;\n    var txt = removeChildrenAndAdd(measure, document.createTextNode(\"A\\u062eA\"));\n    var r0 = range(txt, 0, 1).getBoundingClientRect();\n    if (!r0 || r0.left == r0.right) return false; // Safari returns null in some cases (#2780)\n    var r1 = range(txt, 1, 2).getBoundingClientRect();\n    return badBidiRects = (r1.right - r0.right < 3);\n  }\n\n  // See if \"\".split is the broken IE version, if so, provide an\n  // alternative way to split lines.\n  var splitLines = CodeMirror.splitLines = \"\\n\\nb\".split(/\\n/).length != 3 ? function(string) {\n    var pos = 0, result = [], l = string.length;\n    while (pos <= l) {\n      var nl = string.indexOf(\"\\n\", pos);\n      if (nl == -1) nl = string.length;\n      var line = string.slice(pos, string.charAt(nl - 1) == \"\\r\" ? nl - 1 : nl);\n      var rt = line.indexOf(\"\\r\");\n      if (rt != -1) {\n        result.push(line.slice(0, rt));\n        pos += rt + 1;\n      } else {\n        result.push(line);\n        pos = nl + 1;\n      }\n    }\n    return result;\n  } : function(string){return string.split(/\\r\\n?|\\n/);};\n\n  var hasSelection = window.getSelection ? function(te) {\n    try { return te.selectionStart != te.selectionEnd; }\n    catch(e) { return false; }\n  } : function(te) {\n    try {var range = te.ownerDocument.selection.createRange();}\n    catch(e) {}\n    if (!range || range.parentElement() != te) return false;\n    return range.compareEndPoints(\"StartToEnd\", range) != 0;\n  };\n\n  var hasCopyEvent = (function() {\n    var e = elt(\"div\");\n    if (\"oncopy\" in e) return true;\n    e.setAttribute(\"oncopy\", \"return;\");\n    return typeof e.oncopy == \"function\";\n  })();\n\n  var badZoomedRects = null;\n  function hasBadZoomedRects(measure) {\n    if (badZoomedRects != null) return badZoomedRects;\n    var node = removeChildrenAndAdd(measure, elt(\"span\", \"x\"));\n    var normal = node.getBoundingClientRect();\n    var fromRange = range(node, 0, 1).getBoundingClientRect();\n    return badZoomedRects = Math.abs(normal.left - fromRange.left) > 1;\n  }\n\n  // KEY NAMES\n\n  var keyNames = {3: \"Enter\", 8: \"Backspace\", 9: \"Tab\", 13: \"Enter\", 16: \"Shift\", 17: \"Ctrl\", 18: \"Alt\",\n                  19: \"Pause\", 20: \"CapsLock\", 27: \"Esc\", 32: \"Space\", 33: \"PageUp\", 34: \"PageDown\", 35: \"End\",\n                  36: \"Home\", 37: \"Left\", 38: \"Up\", 39: \"Right\", 40: \"Down\", 44: \"PrintScrn\", 45: \"Insert\",\n                  46: \"Delete\", 59: \";\", 61: \"=\", 91: \"Mod\", 92: \"Mod\", 93: \"Mod\", 107: \"=\", 109: \"-\", 127: \"Delete\",\n                  173: \"-\", 186: \";\", 187: \"=\", 188: \",\", 189: \"-\", 190: \".\", 191: \"/\", 192: \"`\", 219: \"[\", 220: \"\\\\\",\n                  221: \"]\", 222: \"'\", 63232: \"Up\", 63233: \"Down\", 63234: \"Left\", 63235: \"Right\", 63272: \"Delete\",\n                  63273: \"Home\", 63275: \"End\", 63276: \"PageUp\", 63277: \"PageDown\", 63302: \"Insert\"};\n  CodeMirror.keyNames = keyNames;\n  (function() {\n    // Number keys\n    for (var i = 0; i < 10; i++) keyNames[i + 48] = keyNames[i + 96] = String(i);\n    // Alphabetic keys\n    for (var i = 65; i <= 90; i++) keyNames[i] = String.fromCharCode(i);\n    // Function keys\n    for (var i = 1; i <= 12; i++) keyNames[i + 111] = keyNames[i + 63235] = \"F\" + i;\n  })();\n\n  // BIDI HELPERS\n\n  function iterateBidiSections(order, from, to, f) {\n    if (!order) return f(from, to, \"ltr\");\n    var found = false;\n    for (var i = 0; i < order.length; ++i) {\n      var part = order[i];\n      if (part.from < to && part.to > from || from == to && part.to == from) {\n        f(Math.max(part.from, from), Math.min(part.to, to), part.level == 1 ? \"rtl\" : \"ltr\");\n        found = true;\n      }\n    }\n    if (!found) f(from, to, \"ltr\");\n  }\n\n  function bidiLeft(part) { return part.level % 2 ? part.to : part.from; }\n  function bidiRight(part) { return part.level % 2 ? part.from : part.to; }\n\n  function lineLeft(line) { var order = getOrder(line); return order ? bidiLeft(order[0]) : 0; }\n  function lineRight(line) {\n    var order = getOrder(line);\n    if (!order) return line.text.length;\n    return bidiRight(lst(order));\n  }\n\n  function lineStart(cm, lineN) {\n    var line = getLine(cm.doc, lineN);\n    var visual = visualLine(line);\n    if (visual != line) lineN = lineNo(visual);\n    var order = getOrder(visual);\n    var ch = !order ? 0 : order[0].level % 2 ? lineRight(visual) : lineLeft(visual);\n    return Pos(lineN, ch);\n  }\n  function lineEnd(cm, lineN) {\n    var merged, line = getLine(cm.doc, lineN);\n    while (merged = collapsedSpanAtEnd(line)) {\n      line = merged.find(1, true).line;\n      lineN = null;\n    }\n    var order = getOrder(line);\n    var ch = !order ? line.text.length : order[0].level % 2 ? lineLeft(line) : lineRight(line);\n    return Pos(lineN == null ? lineNo(line) : lineN, ch);\n  }\n  function lineStartSmart(cm, pos) {\n    var start = lineStart(cm, pos.line);\n    var line = getLine(cm.doc, start.line);\n    var order = getOrder(line);\n    if (!order || order[0].level == 0) {\n      var firstNonWS = Math.max(0, line.text.search(/\\S/));\n      var inWS = pos.line == start.line && pos.ch <= firstNonWS && pos.ch;\n      return Pos(start.line, inWS ? 0 : firstNonWS);\n    }\n    return start;\n  }\n\n  function compareBidiLevel(order, a, b) {\n    var linedir = order[0].level;\n    if (a == linedir) return true;\n    if (b == linedir) return false;\n    return a < b;\n  }\n  var bidiOther;\n  function getBidiPartAt(order, pos) {\n    bidiOther = null;\n    for (var i = 0, found; i < order.length; ++i) {\n      var cur = order[i];\n      if (cur.from < pos && cur.to > pos) return i;\n      if ((cur.from == pos || cur.to == pos)) {\n        if (found == null) {\n          found = i;\n        } else if (compareBidiLevel(order, cur.level, order[found].level)) {\n          if (cur.from != cur.to) bidiOther = found;\n          return i;\n        } else {\n          if (cur.from != cur.to) bidiOther = i;\n          return found;\n        }\n      }\n    }\n    return found;\n  }\n\n  function moveInLine(line, pos, dir, byUnit) {\n    if (!byUnit) return pos + dir;\n    do pos += dir;\n    while (pos > 0 && isExtendingChar(line.text.charAt(pos)));\n    return pos;\n  }\n\n  // This is needed in order to move 'visually' through bi-directional\n  // text -- i.e., pressing left should make the cursor go left, even\n  // when in RTL text. The tricky part is the 'jumps', where RTL and\n  // LTR text touch each other. This often requires the cursor offset\n  // to move more than one unit, in order to visually move one unit.\n  function moveVisually(line, start, dir, byUnit) {\n    var bidi = getOrder(line);\n    if (!bidi) return moveLogically(line, start, dir, byUnit);\n    var pos = getBidiPartAt(bidi, start), part = bidi[pos];\n    var target = moveInLine(line, start, part.level % 2 ? -dir : dir, byUnit);\n\n    for (;;) {\n      if (target > part.from && target < part.to) return target;\n      if (target == part.from || target == part.to) {\n        if (getBidiPartAt(bidi, target) == pos) return target;\n        part = bidi[pos += dir];\n        return (dir > 0) == part.level % 2 ? part.to : part.from;\n      } else {\n        part = bidi[pos += dir];\n        if (!part) return null;\n        if ((dir > 0) == part.level % 2)\n          target = moveInLine(line, part.to, -1, byUnit);\n        else\n          target = moveInLine(line, part.from, 1, byUnit);\n      }\n    }\n  }\n\n  function moveLogically(line, start, dir, byUnit) {\n    var target = start + dir;\n    if (byUnit) while (target > 0 && isExtendingChar(line.text.charAt(target))) target += dir;\n    return target < 0 || target > line.text.length ? null : target;\n  }\n\n  // Bidirectional ordering algorithm\n  // See http://unicode.org/reports/tr9/tr9-13.html for the algorithm\n  // that this (partially) implements.\n\n  // One-char codes used for character types:\n  // L (L):   Left-to-Right\n  // R (R):   Right-to-Left\n  // r (AL):  Right-to-Left Arabic\n  // 1 (EN):  European Number\n  // + (ES):  European Number Separator\n  // % (ET):  European Number Terminator\n  // n (AN):  Arabic Number\n  // , (CS):  Common Number Separator\n  // m (NSM): Non-Spacing Mark\n  // b (BN):  Boundary Neutral\n  // s (B):   Paragraph Separator\n  // t (S):   Segment Separator\n  // w (WS):  Whitespace\n  // N (ON):  Other Neutrals\n\n  // Returns null if characters are ordered as they appear\n  // (left-to-right), or an array of sections ({from, to, level}\n  // objects) in the order in which they occur visually.\n  var bidiOrdering = (function() {\n    // Character types for codepoints 0 to 0xff\n    var lowTypes = \"bbbbbbbbbtstwsbbbbbbbbbbbbbbssstwNN%%%NNNNNN,N,N1111111111NNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNbbbbbbsbbbbbbbbbbbbbbbbbbbbbbbbbb,N%%%%NNNNLNNNNN%%11NLNNN1LNNNNNLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLN\";\n    // Character types for codepoints 0x600 to 0x6ff\n    var arabicTypes = \"rrrrrrrrrrrr,rNNmmmmmmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmrrrrrrrnnnnnnnnnn%nnrrrmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmmmmmmNmmmm\";\n    function charType(code) {\n      if (code <= 0xf7) return lowTypes.charAt(code);\n      else if (0x590 <= code && code <= 0x5f4) return \"R\";\n      else if (0x600 <= code && code <= 0x6ed) return arabicTypes.charAt(code - 0x600);\n      else if (0x6ee <= code && code <= 0x8ac) return \"r\";\n      else if (0x2000 <= code && code <= 0x200b) return \"w\";\n      else if (code == 0x200c) return \"b\";\n      else return \"L\";\n    }\n\n    var bidiRE = /[\\u0590-\\u05f4\\u0600-\\u06ff\\u0700-\\u08ac]/;\n    var isNeutral = /[stwN]/, isStrong = /[LRr]/, countsAsLeft = /[Lb1n]/, countsAsNum = /[1n]/;\n    // Browsers seem to always treat the boundaries of block elements as being L.\n    var outerType = \"L\";\n\n    function BidiSpan(level, from, to) {\n      this.level = level;\n      this.from = from; this.to = to;\n    }\n\n    return function(str) {\n      if (!bidiRE.test(str)) return false;\n      var len = str.length, types = [];\n      for (var i = 0, type; i < len; ++i)\n        types.push(type = charType(str.charCodeAt(i)));\n\n      // W1. Examine each non-spacing mark (NSM) in the level run, and\n      // change the type of the NSM to the type of the previous\n      // character. If the NSM is at the start of the level run, it will\n      // get the type of sor.\n      for (var i = 0, prev = outerType; i < len; ++i) {\n        var type = types[i];\n        if (type == \"m\") types[i] = prev;\n        else prev = type;\n      }\n\n      // W2. Search backwards from each instance of a European number\n      // until the first strong type (R, L, AL, or sor) is found. If an\n      // AL is found, change the type of the European number to Arabic\n      // number.\n      // W3. Change all ALs to R.\n      for (var i = 0, cur = outerType; i < len; ++i) {\n        var type = types[i];\n        if (type == \"1\" && cur == \"r\") types[i] = \"n\";\n        else if (isStrong.test(type)) { cur = type; if (type == \"r\") types[i] = \"R\"; }\n      }\n\n      // W4. A single European separator between two European numbers\n      // changes to a European number. A single common separator between\n      // two numbers of the same type changes to that type.\n      for (var i = 1, prev = types[0]; i < len - 1; ++i) {\n        var type = types[i];\n        if (type == \"+\" && prev == \"1\" && types[i+1] == \"1\") types[i] = \"1\";\n        else if (type == \",\" && prev == types[i+1] &&\n                 (prev == \"1\" || prev == \"n\")) types[i] = prev;\n        prev = type;\n      }\n\n      // W5. A sequence of European terminators adjacent to European\n      // numbers changes to all European numbers.\n      // W6. Otherwise, separators and terminators change to Other\n      // Neutral.\n      for (var i = 0; i < len; ++i) {\n        var type = types[i];\n        if (type == \",\") types[i] = \"N\";\n        else if (type == \"%\") {\n          for (var end = i + 1; end < len && types[end] == \"%\"; ++end) {}\n          var replace = (i && types[i-1] == \"!\") || (end < len && types[end] == \"1\") ? \"1\" : \"N\";\n          for (var j = i; j < end; ++j) types[j] = replace;\n          i = end - 1;\n        }\n      }\n\n      // W7. Search backwards from each instance of a European number\n      // until the first strong type (R, L, or sor) is found. If an L is\n      // found, then change the type of the European number to L.\n      for (var i = 0, cur = outerType; i < len; ++i) {\n        var type = types[i];\n        if (cur == \"L\" && type == \"1\") types[i] = \"L\";\n        else if (isStrong.test(type)) cur = type;\n      }\n\n      // N1. A sequence of neutrals takes the direction of the\n      // surrounding strong text if the text on both sides has the same\n      // direction. European and Arabic numbers act as if they were R in\n      // terms of their influence on neutrals. Start-of-level-run (sor)\n      // and end-of-level-run (eor) are used at level run boundaries.\n      // N2. Any remaining neutrals take the embedding direction.\n      for (var i = 0; i < len; ++i) {\n        if (isNeutral.test(types[i])) {\n          for (var end = i + 1; end < len && isNeutral.test(types[end]); ++end) {}\n          var before = (i ? types[i-1] : outerType) == \"L\";\n          var after = (end < len ? types[end] : outerType) == \"L\";\n          var replace = before || after ? \"L\" : \"R\";\n          for (var j = i; j < end; ++j) types[j] = replace;\n          i = end - 1;\n        }\n      }\n\n      // Here we depart from the documented algorithm, in order to avoid\n      // building up an actual levels array. Since there are only three\n      // levels (0, 1, 2) in an implementation that doesn't take\n      // explicit embedding into account, we can build up the order on\n      // the fly, without following the level-based algorithm.\n      var order = [], m;\n      for (var i = 0; i < len;) {\n        if (countsAsLeft.test(types[i])) {\n          var start = i;\n          for (++i; i < len && countsAsLeft.test(types[i]); ++i) {}\n          order.push(new BidiSpan(0, start, i));\n        } else {\n          var pos = i, at = order.length;\n          for (++i; i < len && types[i] != \"L\"; ++i) {}\n          for (var j = pos; j < i;) {\n            if (countsAsNum.test(types[j])) {\n              if (pos < j) order.splice(at, 0, new BidiSpan(1, pos, j));\n              var nstart = j;\n              for (++j; j < i && countsAsNum.test(types[j]); ++j) {}\n              order.splice(at, 0, new BidiSpan(2, nstart, j));\n              pos = j;\n            } else ++j;\n          }\n          if (pos < i) order.splice(at, 0, new BidiSpan(1, pos, i));\n        }\n      }\n      if (order[0].level == 1 && (m = str.match(/^\\s+/))) {\n        order[0].from = m[0].length;\n        order.unshift(new BidiSpan(0, 0, m[0].length));\n      }\n      if (lst(order).level == 1 && (m = str.match(/\\s+$/))) {\n        lst(order).to -= m[0].length;\n        order.push(new BidiSpan(0, len - m[0].length, len));\n      }\n      if (order[0].level == 2)\n        order.unshift(new BidiSpan(1, order[0].to, order[0].to));\n      if (order[0].level != lst(order).level)\n        order.push(new BidiSpan(order[0].level, len, len));\n\n      return order;\n    };\n  })();\n\n  // THE END\n\n  CodeMirror.version = \"5.3.0\";\n\n  return CodeMirror;\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/codemirror/lib/codemirror.js\n ** module id = 65\n ** module chunks = 0\n **/","/* Visual format language definition.\n */\n/*eslint quotes:[2, \"double\"]*/\nvar CodeMirror = require(\"codemirror\");\nrequire(\"codemirror/addon/mode/simple\");\nCodeMirror.defineSimpleMode(\"vfl\", {\n    // The start state contains the rules that are intially used\n    start: [\n        {regex: /^(HV|H|V|Z|C)/, token: \"meta\", push: \"orientation\"},\n        {regex: /\\|/, token: \"keyword\"},\n        {regex: /->/, token: \"def\"},\n        {regex: /-/, token: \"def\", push: \"connection\"},\n        {regex: /~/, token: \"def\", push: \"connection\"},\n        {regex: /\\[/, token: \"bracket\", push: \"view\"},\n        {regex: /\\(/, token: \"atom\", push: \"predicates\"},\n        {regex: /\\w+/, token: \"variable\"},\n        {regex: /\\./, token: \"meta\", push: \"attribute\"},\n        {regex: /.*\\/\\/.*/, token: \"comment\"}\n    ],\n    orientation: [\n        {regex: /:/, token: \"def\", pop: true}\n    ],\n    connection: [\n        {regex: /\\(/, token: \"atom\", push: \"predicates\"},\n        {regex: /[0-9]+/, token: \"number\"},\n        {regex: /\\[/, token: \"bracket\", pop: true, push: \"view\"},\n        {regex: /|/, token: \"bracket\", pop: true},\n        {regex: /-/, token: \"def\", pop: true},\n        {regex: /~/, token: \"def\", pop: true}\n    ],\n    view: [\n        {regex: /\\]/, token: \"bracket\", pop: true},\n        {regex: /\\(/, token: \"atom\", push: \"predicates\"},\n        {regex: /\\w(\\.\\.\\d+)?/, token: \"variable\"}\n    ],\n    predicates: [\n        {regex: /\\)/, token: \"atom\", pop: true},\n        {regex: /[0-9]+/, token: \"number\"},\n        {regex: /[=><]=/, token: \"operator\"},\n        {regex: /[\\*\\/]/, token: \"operator\", push: \"operator\"},\n        {regex: /\\./, token: \"meta\", push: \"attribute\"},\n        {regex: /\\w+/, token: \"variable\"}\n    ],\n    operator: [\n        {regex: /\\d+/, token: \"number\", pop: true}\n    ],\n    attribute: [\n        {regex: /left/, token: \"meta\", pop: true},\n        {regex: /top/, token: \"meta\", pop: true},\n        {regex: /right/, token: \"meta\", pop: true},\n        {regex: /bottom/, token: \"meta\", pop: true},\n        {regex: /width/, token: \"meta\", pop: true},\n        {regex: /height/, token: \"meta\", pop: true},\n        {regex: /centerX/, token: \"meta\", pop: true},\n        {regex: /centerY/, token: \"meta\", pop: true}\n    ]\n});\n\n\n\n\n/** WEBPACK FOOTER **\n ** ./mode/vfl/vfl.js\n **/","// CodeMirror, copyright (c) by Marijn Haverbeke and others\n// Distributed under an MIT license: http://codemirror.net/LICENSE\n\n(function(mod) {\n  if (typeof exports == \"object\" && typeof module == \"object\") // CommonJS\n    mod(require(\"../../lib/codemirror\"));\n  else if (typeof define == \"function\" && define.amd) // AMD\n    define([\"../../lib/codemirror\"], mod);\n  else // Plain browser env\n    mod(CodeMirror);\n})(function(CodeMirror) {\n  \"use strict\";\n\n  CodeMirror.defineSimpleMode = function(name, states) {\n    CodeMirror.defineMode(name, function(config) {\n      return CodeMirror.simpleMode(config, states);\n    });\n  };\n\n  CodeMirror.simpleMode = function(config, states) {\n    ensureState(states, \"start\");\n    var states_ = {}, meta = states.meta || {}, hasIndentation = false;\n    for (var state in states) if (state != meta && states.hasOwnProperty(state)) {\n      var list = states_[state] = [], orig = states[state];\n      for (var i = 0; i < orig.length; i++) {\n        var data = orig[i];\n        list.push(new Rule(data, states));\n        if (data.indent || data.dedent) hasIndentation = true;\n      }\n    }\n    var mode = {\n      startState: function() {\n        return {state: \"start\", pending: null,\n                local: null, localState: null,\n                indent: hasIndentation ? [] : null};\n      },\n      copyState: function(state) {\n        var s = {state: state.state, pending: state.pending,\n                 local: state.local, localState: null,\n                 indent: state.indent && state.indent.slice(0)};\n        if (state.localState)\n          s.localState = CodeMirror.copyState(state.local.mode, state.localState);\n        if (state.stack)\n          s.stack = state.stack.slice(0);\n        for (var pers = state.persistentStates; pers; pers = pers.next)\n          s.persistentStates = {mode: pers.mode,\n                                spec: pers.spec,\n                                state: pers.state == state.localState ? s.localState : CodeMirror.copyState(pers.mode, pers.state),\n                                next: s.persistentStates};\n        return s;\n      },\n      token: tokenFunction(states_, config),\n      innerMode: function(state) { return state.local && {mode: state.local.mode, state: state.localState}; },\n      indent: indentFunction(states_, meta)\n    };\n    if (meta) for (var prop in meta) if (meta.hasOwnProperty(prop))\n      mode[prop] = meta[prop];\n    return mode;\n  };\n\n  function ensureState(states, name) {\n    if (!states.hasOwnProperty(name))\n      throw new Error(\"Undefined state \" + name + \"in simple mode\");\n  }\n\n  function toRegex(val, caret) {\n    if (!val) return /(?:)/;\n    var flags = \"\";\n    if (val instanceof RegExp) {\n      if (val.ignoreCase) flags = \"i\";\n      val = val.source;\n    } else {\n      val = String(val);\n    }\n    return new RegExp((caret === false ? \"\" : \"^\") + \"(?:\" + val + \")\", flags);\n  }\n\n  function asToken(val) {\n    if (!val) return null;\n    if (typeof val == \"string\") return val.replace(/\\./g, \" \");\n    var result = [];\n    for (var i = 0; i < val.length; i++)\n      result.push(val[i] && val[i].replace(/\\./g, \" \"));\n    return result;\n  }\n\n  function Rule(data, states) {\n    if (data.next || data.push) ensureState(states, data.next || data.push);\n    this.regex = toRegex(data.regex);\n    this.token = asToken(data.token);\n    this.data = data;\n  }\n\n  function tokenFunction(states, config) {\n    return function(stream, state) {\n      if (state.pending) {\n        var pend = state.pending.shift();\n        if (state.pending.length == 0) state.pending = null;\n        stream.pos += pend.text.length;\n        return pend.token;\n      }\n\n      if (state.local) {\n        if (state.local.end && stream.match(state.local.end)) {\n          var tok = state.local.endToken || null;\n          state.local = state.localState = null;\n          return tok;\n        } else {\n          var tok = state.local.mode.token(stream, state.localState), m;\n          if (state.local.endScan && (m = state.local.endScan.exec(stream.current())))\n            stream.pos = stream.start + m.index;\n          return tok;\n        }\n      }\n\n      var curState = states[state.state];\n      for (var i = 0; i < curState.length; i++) {\n        var rule = curState[i];\n        var matches = (!rule.data.sol || stream.sol()) && stream.match(rule.regex);\n        if (matches) {\n          if (rule.data.next) {\n            state.state = rule.data.next;\n          } else if (rule.data.push) {\n            (state.stack || (state.stack = [])).push(state.state);\n            state.state = rule.data.push;\n          } else if (rule.data.pop && state.stack && state.stack.length) {\n            state.state = state.stack.pop();\n          }\n\n          if (rule.data.mode)\n            enterLocalMode(config, state, rule.data.mode, rule.token);\n          if (rule.data.indent)\n            state.indent.push(stream.indentation() + config.indentUnit);\n          if (rule.data.dedent)\n            state.indent.pop();\n          if (matches.length > 2) {\n            state.pending = [];\n            for (var j = 2; j < matches.length; j++)\n              if (matches[j])\n                state.pending.push({text: matches[j], token: rule.token[j - 1]});\n            stream.backUp(matches[0].length - (matches[1] ? matches[1].length : 0));\n            return rule.token[0];\n          } else if (rule.token && rule.token.join) {\n            return rule.token[0];\n          } else {\n            return rule.token;\n          }\n        }\n      }\n      stream.next();\n      return null;\n    };\n  }\n\n  function cmp(a, b) {\n    if (a === b) return true;\n    if (!a || typeof a != \"object\" || !b || typeof b != \"object\") return false;\n    var props = 0;\n    for (var prop in a) if (a.hasOwnProperty(prop)) {\n      if (!b.hasOwnProperty(prop) || !cmp(a[prop], b[prop])) return false;\n      props++;\n    }\n    for (var prop in b) if (b.hasOwnProperty(prop)) props--;\n    return props == 0;\n  }\n\n  function enterLocalMode(config, state, spec, token) {\n    var pers;\n    if (spec.persistent) for (var p = state.persistentStates; p && !pers; p = p.next)\n      if (spec.spec ? cmp(spec.spec, p.spec) : spec.mode == p.mode) pers = p;\n    var mode = pers ? pers.mode : spec.mode || CodeMirror.getMode(config, spec.spec);\n    var lState = pers ? pers.state : CodeMirror.startState(mode);\n    if (spec.persistent && !pers)\n      state.persistentStates = {mode: mode, spec: spec.spec, state: lState, next: state.persistentStates};\n\n    state.localState = lState;\n    state.local = {mode: mode,\n                   end: spec.end && toRegex(spec.end),\n                   endScan: spec.end && spec.forceEnd !== false && toRegex(spec.end, false),\n                   endToken: token && token.join ? token[token.length - 1] : token};\n  }\n\n  function indexOf(val, arr) {\n    for (var i = 0; i < arr.length; i++) if (arr[i] === val) return true;\n  }\n\n  function indentFunction(states, meta) {\n    return function(state, textAfter, line) {\n      if (state.local && state.local.mode.indent)\n        return state.local.mode.indent(state.localState, textAfter, line);\n      if (state.indent == null || state.local || meta.dontIndentStates && indexOf(state.state, meta.dontIndentStates) > -1)\n        return CodeMirror.Pass;\n\n      var pos = state.indent.length - 1, rules = states[state.state];\n      scan: for (;;) {\n        for (var i = 0; i < rules.length; i++) {\n          var rule = rules[i];\n          if (rule.data.dedent && rule.data.dedentIfLineStart !== false) {\n            var m = rule.regex.exec(textAfter);\n            if (m && m[0]) {\n              pos--;\n              if (rule.next || rule.push) rules = states[rule.next || rule.push];\n              textAfter = textAfter.slice(m[0].length);\n              continue scan;\n            }\n          }\n        }\n        break;\n      }\n      return pos < 0 ? 0 : state.indent[pos];\n    };\n  }\n});\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/codemirror/addon/mode/simple.js\n ** module id = 67\n ** module chunks = 0\n **/","import View from 'famous/core/View';\nimport InputSurface from 'famous/surfaces/InputSurface';\nimport Surface from 'famous/core/Surface';\nimport LayoutController from 'famous-flex/LayoutController';\nimport vflToLayout from '../vflToLayout';\n\nfunction getParameterByName(name) {\n    name = name.replace(/[\\[]/, '\\\\[').replace(/[\\]]/, '\\\\]');\n    var regex = new RegExp('[\\\\?&]' + name + '=([^&#]*)');\n    var results = regex.exec(location.search);\n    return results === null ? '' : decodeURIComponent(results[1].replace(/\\+/g, ' '));\n}\n\nclass SettingsView extends View {\n    constructor(options) {\n        super(options);\n\n        this._extendedFormat = (getParameterByName('extended') !== '') ? (parseInt(getParameterByName('extended')) !== 0) : 1;\n\n        this._spacing = 8;\n        try {\n            this._spacing = JSON.parse(getParameterByName('spacing'));\n        }\n        catch (err) {\n            //\n        }\n\n        this.renderables = {\n            widthText: new Surface({\n                content: '<div class=\"va\">Width:</div>'\n            }),\n            widthInput: new InputSurface({\n                placeholder: 'auto'\n            }),\n            heightText: new Surface({\n                content: '<div class=\"va\">Height:</div>'\n            }),\n            heightInput: new InputSurface({\n                placeholder: 'auto'\n            }),\n            spacingText: new Surface({\n                content: '<div class=\"va\">Spacing:</div>',\n                classes: ['setting', 'text']\n            }),\n            spacingInput: new InputSurface({\n                value: JSON.stringify(this._spacing),\n                classes: ['setting', 'input']\n            }),\n            extendedText: new Surface({\n                content: '<div class=\"va\">Extended format (EVFL):</div>',\n                classes: ['setting', 'text']\n            }),\n            extendedInput: new InputSurface({\n                type: 'checkbox',\n                classes: ['setting', 'input']\n            })\n        };\n        if (this._extendedFormat) {\n            this.renderables.extendedInput.setAttributes({\n                checked: true\n            });\n        }\n        this.layout = new LayoutController({\n            layout: vflToLayout(`\n|[spacing:[spacingText(spacingInput)]-[spacingInput]]|\n|[extended:[extendedText(extendedInput)]-[extendedInput]]|\nV:|-[spacing(30)]-[extended(30)]\n            `),\n            dataSource: this.renderables\n        });\n        this.add(this.layout);\n        this.renderables.spacingInput.on('change', this._updateSpacing.bind(this));\n        this.renderables.spacingInput.on('keyup', this._updateSpacing.bind(this));\n\n        this.renderables.extendedInput.on('change', this._updateExtended.bind(this));\n    }\n\n    _updateSpacing() {\n        try {\n            const spacing = JSON.parse(this.renderables.spacingInput.getValue());\n            if (spacing !== this._spacing) {\n                this._spacing = spacing;\n                this._eventOutput.emit('update');\n            }\n        }\n        catch (err) {\n            //\n        }\n    }\n\n    _updateExtended() {\n        this._extendedFormat = this.renderables.extendedInput.getAttributes().checked;\n        if (this.renderables.extendedInput._currentTarget) {\n            this._extendedFormat = this.renderables.extendedInput._currentTarget.checked ? true : false;\n        }\n        this._eventOutput.emit('update', true);\n    }\n\n    updateAutoLayoutView(alView) {\n        if (this._spacing !== undefined) {\n            alView.setSpacing(this._spacing);\n        }\n    }\n\n    getExtended() {\n        return this._extendedFormat;\n    }\n}\n\nexport {SettingsView as default};\n\n\n\n/** WEBPACK FOOTER **\n ** ./views/SettingsView.js\n **/","/* This Source Code Form is subject to the terms of the Mozilla Public\n * License, v. 2.0. If a copy of the MPL was not distributed with this\n * file, You can obtain one at http://mozilla.org/MPL/2.0/.\n *\n * @license MPL 2.0\n * @copyright Famous Industries, Inc. 2015\n */\nvar Surface = require('../core/Surface');\nfunction InputSurface(options) {\n    this._placeholder = options.placeholder || '';\n    this._value = options.value || '';\n    this._type = options.type || 'text';\n    this._name = options.name || '';\n    Surface.apply(this, arguments);\n    this.on('click', this.focus.bind(this));\n    window.addEventListener('click', function (event) {\n        if (event.target !== this._currentTarget)\n            this.blur();\n    }.bind(this));\n}\nInputSurface.prototype = Object.create(Surface.prototype);\nInputSurface.prototype.constructor = InputSurface;\nInputSurface.prototype.elementType = 'input';\nInputSurface.prototype.elementClass = 'famous-surface';\nInputSurface.prototype.setPlaceholder = function setPlaceholder(str) {\n    this._placeholder = str;\n    this._contentDirty = true;\n    return this;\n};\nInputSurface.prototype.focus = function focus() {\n    if (this._currentTarget)\n        this._currentTarget.focus();\n    return this;\n};\nInputSurface.prototype.blur = function blur() {\n    if (this._currentTarget)\n        this._currentTarget.blur();\n    return this;\n};\nInputSurface.prototype.setValue = function setValue(str) {\n    this._value = str;\n    this._contentDirty = true;\n    return this;\n};\nInputSurface.prototype.setType = function setType(str) {\n    this._type = str;\n    this._contentDirty = true;\n    return this;\n};\nInputSurface.prototype.getValue = function getValue() {\n    if (this._currentTarget) {\n        return this._currentTarget.value;\n    } else {\n        return this._value;\n    }\n};\nInputSurface.prototype.setName = function setName(str) {\n    this._name = str;\n    this._contentDirty = true;\n    return this;\n};\nInputSurface.prototype.getName = function getName() {\n    return this._name;\n};\nInputSurface.prototype.deploy = function deploy(target) {\n    if (this._placeholder !== '')\n        target.placeholder = this._placeholder;\n    target.value = this._value;\n    target.type = this._type;\n    target.name = this._name;\n};\nmodule.exports = InputSurface;\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/famous/surfaces/InputSurface.js\n ** module id = 69\n ** module chunks = 0\n **/","import View from 'famous/core/View';\nimport Surface from 'famous/core/Surface';\nimport LayoutController from 'famous-flex/LayoutController';\nimport TabBarController from 'famous-flex/widgets/TabBarController';\nimport vflToLayout from '../vflToLayout';\nimport AutoLayout from 'autolayout';\n\nclass OutputView extends View {\n    constructor(options) {\n        super(options);\n\n        this.tabBarController = new TabBarController({\n            tabBarSize: 44,\n            tabBarPosition: TabBarController.Position.TOP,\n            tabBar: {\n                createRenderables: {\n                    selectedItemOverlay: true\n                }\n            }\n        });\n\n        this.constraints = new Surface({\n            classes: ['constraints']\n        });\n        this.logContent = '';\n        this.log = new Surface({\n            classes: ['log']\n        });\n        this.log.commit = function() {\n            const res = Surface.prototype.commit.apply(this.log, arguments);\n            if (this._scrollToBottom) {\n                this._scrollToBottom = false;\n                this.log._currentTarget.scrollTop = Math.max(0, this.log._currentTarget.scrollHeight - this.log._currentTarget.clientHeight);\n            }\n            return res;\n        }.bind(this);\n        this.raw = new Surface({\n            classes: ['raw']\n        });\n        this.tabBarController.setItems([\n            {tabItem: 'Log', view: this.log},\n            {tabItem: 'Constraints', view: this.constraints},\n            {tabItem: 'Raw', view: this.raw}\n        ]);\n\n        this.layout = new LayoutController({\n            layout: vflToLayout(`\n                |[content]|\n                V:|[content]|\n            `),\n            dataSource: {\n                content: this.tabBarController\n            }\n        });\n        this.add(this.layout);\n    }\n\n    _log(message) {\n        this.logContent += message;\n        this.log.setContent(this.logContent);\n        this._scrollToBottom = true;\n    }\n\n    parse(visualFormat, extended) {\n        visualFormat = visualFormat.replace(/[\\\\]/g, '\\n');\n        try {\n            const json = visualFormat.replace(/[\"']/g, '\\\"');\n            visualFormat = JSON.parse(json);\n        } catch (err) {\n            //\n        }\n        try {\n            // update constraints\n            const constraints = AutoLayout.VisualFormat.parse(visualFormat, {extended: extended, strict: false});\n            this.constraints.setContent('<pre>' + JSON.stringify(constraints, undefined, 2) + '</pre>');\n            // update raw\n            const raw = AutoLayout.VisualFormat.parse(visualFormat, {extended: extended, outFormat: 'raw'});\n            this.raw.setContent('<pre>' + JSON.stringify(raw, undefined, 2) + '</pre>');\n            // update log\n            this._log('<code>Visual format parsed successfully.</code><br>');\n            return constraints;\n        }\n        catch (err) {\n            if ((err instanceof SyntaxError) ||\n                (err.name === 'SyntaxError') ||\n                (err.line && err.column)) {\n                this.constraints.setContent('');\n                this.raw.setContent('');\n                let arrow = (err.column > 10) ? ' --->' : '';\n                this._log('<pre style=\"color: red; margin: 0;\">' +\n                    'ERROR: ' +\n                    '<span style=\"color: black;\">' + err.source.substring(0, err.column - 1) + '</span>' +\n                    err.source.substring(err.column - 1) + '\\n' +\n                    'line ' + err.line + arrow + (new Array(2 + err.column - arrow.length - ('' + err.line).length)).join(' ') + '^ ' + err.message +\n                    '</pre>'\n                );\n            }\n            else {\n                this._log('<pre style=\"color: red; margin: 0;\">ERROR: ' + err.toString() + '</pre>');\n            }\n        }\n    }\n}\n\nexport {OutputView as default};\n\n\n\n/** WEBPACK FOOTER **\n ** ./views/OutputView.js\n **/","import View from 'famous/core/View';\nimport Surface from 'famous/core/Surface';\nimport LayoutController from 'famous-flex/LayoutController';\nimport Colors from 'colors.js';\n\nclass VisualOutputView extends View {\n    constructor(options) {\n        super(options);\n\n        this._spacing = undefined;\n        this._viewPort = {};\n        this._colors = {};\n        this._shapes = {};\n        this._intrinsicWidths = {};\n        this._intrinsicHeight = {};\n\n        this.layout = new LayoutController({\n            flow: true,\n            flowOptions: {\n                reflowOnResize: false\n            },\n            layout: (context) => {\n                if (!this.alView) {\n                    return;\n                }\n                if (this._spacing) {\n                    this.alView.setSpacing(this._spacing);\n                }\n                const iw = this._widths;\n                var key;\n                for (key in iw) {\n                    const subView = this.alView.subViews[key];\n                    if (subView) {\n                        subView.intrinsicWidth = iw[key];\n                    }\n                }\n                const ih = this._heights;\n                for (key in ih) {\n                    const subView = this.alView.subViews[key];\n                    if (subView) {\n                        subView.intrinsicHeight = ih[key];\n                    }\n                }\n                const vp = this._viewPort;\n                var contentSize = [\n                    ((vp.width !== undefined) && (vp.width !== true)) ? vp.width : Math.max(Math.min(context.size[0], vp['max-width'] || context.size[0]), vp['min-width'] || 0),\n                    ((vp.height !== undefined) && (vp.height !== true)) ? vp.height : Math.max(Math.min(context.size[1], vp['max-height'] || context.size[1]), vp['min-height'] || 0)\n                ];\n                if ((vp.width === true) && (vp.height === true)) {\n                    contentSize[0] = this.alView.fittingWidth;\n                    contentSize[1] = this.alView.fittingHeight;\n                }\n                else if (vp.width === true) {\n                    this.alView.setSize(undefined, contentSize[1]);\n                    contentSize[0] = this.alView.fittingWidth;\n                    // TODO ASPECT RATIO?\n                }\n                else if (vp.height === true) {\n                    this.alView.setSize(contentSize[0], undefined);\n                    contentSize[1] = this.alView.fittingHeight;\n                    // TODO ASPECT RATIO?\n                }\n                else {\n                    contentSize = vp['aspect-ratio'] ? [\n                        Math.min(contentSize[0], contentSize[1] * vp['aspect-ratio']),\n                        Math.min(contentSize[1], contentSize[0] / vp['aspect-ratio'])\n                    ] : contentSize;\n                    this.alView.setSize(contentSize[0], contentSize[1]);\n                }\n                var left = (context.size[0] - contentSize[0]) / 2;\n                var top = (context.size[1] - contentSize[1]) / 2;\n                for (key in this.alView.subViews) {\n                    const subView = this.alView.subViews[key];\n                    if ((subView.type !== 'stack') && (key.indexOf('_') !== 0)) {\n                        const node = context.get(subView.name);\n                        context.set(node, {\n                            size: [subView.width, subView.height],\n                            translate: [left + subView.left, top + subView.top, subView.zIndex * 5]\n                        });\n                        var color = 204 - (subView.zIndex * 20);\n                        var backgroundColor = this._colors[key] || Colors.rgb2hex(color, color, color);\n                        var textColor = Colors.complement(backgroundColor);\n                        node.renderNode.setProperties({\n                            backgroundColor: backgroundColor,\n                            color: textColor\n                        });\n                    }\n                }\n            }\n        });\n        this.add(this.layout);\n    };\n\n    set view(alView) {\n        this.alView = alView;\n        this.contentRenderables = this.contentRenderables || {};\n        this.contentPool = this.contentPool || {};\n        for (var key in this.contentRenderables) {\n            this.contentPool[key] = this.contentRenderables[key];\n        }\n        this.contentRenderables = {};\n        if (this.alView) {\n            for (var subView in this.alView.subViews) {\n                if (subView.indexOf('_') !== 0) {\n                    this.contentRenderables[subView] = this.contentPool[subView] || new Surface({\n                        content: '<div class=\"va\">' + subView + '</div>',\n                        classes: ['subView']\n                    });\n                }\n            }\n        }\n        this.layout.setDataSource(this.contentRenderables);\n    }\n\n    get view() {\n        return this.alView;\n    }\n\n    get viewPort() {\n        return this._viewPort;\n    }\n\n    set viewPort(value) {\n        this._viewPort = value || {};\n        this.layout.reflowLayout();\n    }\n\n    get spacing() {\n        return this._spacing;\n    }\n\n    set spacing(value) {\n        this._spacing = value;\n        this.layout.reflowLayout();\n    }\n\n    get widths() {\n        return this._widths;\n    }\n\n    set widths(value) {\n        this._widths = value || {};\n        this.layout.reflowLayout();\n    }\n\n    get heights() {\n        return this._heights;\n    }\n\n    set heights(value) {\n        this._heights = value || {};\n        this.layout.reflowLayout();\n    }\n\n    get colors() {\n        return this._colors;\n    }\n\n    set colors(colors) {\n        this._colors = colors || {};\n        this.layout.reflowLayout();\n    }\n\n    get shapes() {\n        return this._shapes;\n    }\n\n    set shapes(shapes) {\n        this._shapes = shapes || {};\n        for (var key in this.contentRenderables) {\n            if (this._shapes[key] === 'circle') {\n                this.contentRenderables[key].addClass('circle');\n            }\n            else {\n                this.contentRenderables[key].removeClass('circle');\n            }\n        }\n    }\n}\n\nexport {VisualOutputView as default};\n\n\n\n/** WEBPACK FOOTER **\n ** ./views/VisualOutputView.js\n **/","global.window = {};\n\nrequire(\"./colors.js\");\n\nmodule.exports = window.Colors;\n\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/colors.js/index.js\n ** module id = 72\n ** module chunks = 0\n **/","/**\n * @license Colors JS Library v1.2.4\n * Copyright 2012-2013 Matt Jordan\n * Licensed under Creative Commons Attribution-ShareAlike 3.0 Unported. (http://creativecommons.org/licenses/by-sa/3.0/)\n * https://github.com/mbjordan/Colors\n */\n\n(function (window) {\n    var Utils = {},\n        Colors = {};\n\n    //## Internal Utilities\n    // ###Render method\n    //\n    // `render(map, type)`\n    //\n    // `map` is an object of data to render, `type` can be RGB, HSV or HSL\n    Utils.render = function (map, type) {\n        var rtn = {},\n            keys;\n        if (typeof map != \"object\") {\n            return;\n        }\n        if (type === \"rgb\") {\n            keys = [\"R\", \"G\", \"B\", \"RGB\"];\n        }\n        if (type === \"hsv\") {\n            keys = [\"H\", \"S\", \"V\", \"HSV\"];\n        }\n        if (type === \"hsl\") {\n            keys = [\"H\", \"S\", \"L\", \"HSL\"];\n        }\n        rtn[keys[0]] = map[0];\n        rtn[keys[1]] = map[1];\n        rtn[keys[2]] = map[2];\n        rtn[keys[3]] = map[0] + \" \" + map[1] + \" \" + map[2];\n        rtn.a = map;\n        return rtn;\n    };\n\n\n\n\n    // ### Padded Hex method\n    //\n    // `paddedHex(number)`\n    //\n    // Creates a hexadecimal number, and adds a zero to the beginning if its only one digit.\n    Utils.paddedHex = function (n) {\n        var hex = ((n < 10) ? \"0\" : \"\") + n.toString(16);\n        return (hex.length === 1) ? \"0\" + hex : hex;\n    };\n\n    Number.prototype.round = function (points) {\n        points = points || 10;\n        return parseFloat(this.toFixed(points));\n    };\n\n\n    // ## The Colors methods\n    // ### rgb2hex method\n    //\n    // Change 3 RGB Ints or a single Int to a Hexadecimal color.\n    //\n    // `rgb2hex( [multiple Ints: R,G,B] or [single Int: COLOR] )`\n    Colors.rgb2hex = function (r, g, b) {\n        r = Utils.paddedHex(r);\n        g = (g !== undefined) ? Utils.paddedHex(g) : r;\n        b = (b !== undefined) ? Utils.paddedHex(b) : r;\n        return \"#\" + r + g + b;\n    };\n\n    // ### hex2rgb method\n    //\n    // Change a hexadecimal color string to an RGB color object.\n    //\n    // `hex2rgb( \"hex color string\" ).[obj R, G, B, RGB or a]`\n    Colors.hex2rgb = function (h) {\n        h = h.replace(\"#\", \"\");\n        if (h.length === 6) {\n            return Utils.render([parseInt(h.substr(0, 2), 16), parseInt(h.substr(2, 2), 16), parseInt(h.substr(4, 2), 16)], \"rgb\");\n        } else {\n            return parseInt(h, 16);\n        }\n    };\n\n    // ### hex2hsv method\n    //\n    // Change a hexadecimal color string to an HSV color object.\n    //\n    // `hex2hsv ( \"hex color string\" ).[obj H, S, V, HSV or a]`\n    Colors.hex2hsv = function (h) {\n        h = (h.charAt(0) == \"#\") ? h.substring(1, 7) : h;\n        var r = parseInt(h.substring(0, 2), 16) / 255,\n            g = parseInt(h.substring(2, 4), 16) / 255,\n            b = parseInt(h.substring(4, 6), 16) / 255,\n            result = {\n                \"h\": 0,\n                \"s\": 0,\n                \"v\": 0\n            },\n            minVal = Math.min(r, g, b),\n            maxVal = Math.max(r, g, b),\n            delta = (maxVal - minVal),\n            del_R, del_G, del_B;\n\n        result.v = maxVal;\n        if (delta === 0) {\n            result.h = 0;\n            result.s = 0;\n        } else {\n            result.s = delta / maxVal;\n            del_R = (((maxVal - r) / 6) + (delta / 2)) / delta;\n            del_G = (((maxVal - g) / 6) + (delta / 2)) / delta;\n            del_B = (((maxVal - b) / 6) + (delta / 2)) / delta;\n            if (r == maxVal) {\n                result.h = del_B - del_G;\n            } else if (g == maxVal) {\n                result.h = (1 / 3) + del_R - del_B;\n            } else if (b == maxVal) {\n                result.h = (2 / 3) + del_G - del_R;\n            }\n            if (result.h < 0) {\n                result.h += 1;\n            }\n            if (result.h > 1) {\n                result.h -= 1;\n            }\n        }\n        return Utils.render([Math.round(result.h * 360), Math.round(result.s * 100), Math.round(result.v * 100)], \"hsv\");\n    };\n\n    // ### hsv2rgb method\n    //\n    // Change an HSV color object or Int string to an RGB color object.\n    //\n    // `hsv2rgb ([obj H, S, V] or [Int H, S, V]).[obj R, G, B, RGB or a]`\n    Colors.hsv2rgb = function (HSV, S, V) {\n        var rgb = [],\n            h, s, v, hi, f, p, q, t;\n\n        if (typeof HSV == \"object\") {\n            h = HSV[0];\n            s = HSV[1];\n            v = HSV[2];\n        } else {\n            h = HSV;\n            s = S;\n            v = V;\n        }\n        s = s / 100;\n        v = v / 100;\n        hi = Math.floor((h / 60) % 6);\n        f = (h / 60) - hi;\n        p = v * (1 - s);\n        q = v * (1 - f * s);\n        t = v * (1 - (1 - f) * s);\n        switch (hi) {\n        case 0:\n            rgb = [v, t, p];\n            break;\n        case 1:\n            rgb = [q, v, p];\n            break;\n        case 2:\n            rgb = [p, v, t];\n            break;\n        case 3:\n            rgb = [p, q, v];\n            break;\n        case 4:\n            rgb = [t, p, v];\n            break;\n        case 5:\n            rgb = [v, p, q];\n        }\n        return Utils.render([Math.min(255, Math.floor(rgb[0] * 256)), Math.min(255, Math.floor(rgb[1] * 256)), Math.min(255, Math.floor(rgb[2] * 256))], \"rgb\");\n    };\n\n    // ### rgb2hsl method\n    //\n    // Change RGB to an HSL object.\n    //\n    // `rgb2hsl(RGB[, G, B])`\n    Colors.rgb2hsl = function (RGB, G, B) {\n        var r, g, b, min, max, h, s, l, d;\n\n        if (typeof RGB === \"object\") {\n            r = RGB[0];\n            g = RGB[1];\n            b = RGB[2];\n        } else {\n            r = RGB;\n            g = G;\n            b = B;\n        }\n\n        r /= 255;\n        g /= 255;\n        b /= 255;\n\n        max = Math.max(r, g, b);\n        min = Math.min(r, g, b);\n        l = (max + min) / 2;\n\n        if (max == min) {\n            h = s = 0;\n        } else {\n            d = max - min;\n            s = l > 0.5 ? d / (2 - max - min) : d / (max + min);\n            switch (max) {\n            case r:\n                h = (g - b) / d + (g < b ? 6 : 0);\n                break;\n            case g:\n                h = (b - r) / d + 2;\n                break;\n            case b:\n                h = (r - g) / d + 4;\n            }\n            h /= 6;\n        }\n\n        return Utils.render([Math.floor(h * 360), (s * 100).round(1), (l * 100).round(1)], \"hsl\");\n    };\n\n    // ### hsv2hsl method\n    //\n    // Change HSV to an HSL object\n    //\n    // `hsv2hsl(HSV[, S, V])`\n    Colors.hsv2hsl = function (H, S, V) {\n        var h, s, l, _H, _S, _L, hsv, r1, g1, b1, maxColor, minColor;\n\n        if (typeof H == \"object\") {\n            h = H[0];\n            s = H[1];\n            l = H[2];\n        } else {\n            h = H;\n            s = S;\n            l = V;\n        }\n\n        hsv = this.hsv2rgb(h, s, l);\n        r1 = hsv.R / 255;\n        g1 = hsv.G / 255;\n        b1 = hsv.B / 255;\n        maxColor = Math.max(r1, g1, b1);\n        minColor = Math.min(r1, g1, b1);\n        _L = (maxColor + minColor) / 2;\n        _S = 0;\n        _H = 0;\n        if (maxColor != minColor) {\n            if (_L < 0.5) {\n                S = (maxColor - minColor) / (maxColor + minColor);\n            } else {\n                S = (maxColor - minColor) / (2.0 - maxColor - minColor);\n            }\n            if (r1 == maxColor) {\n                H = (g1 - b1) / (maxColor - minColor);\n            } else if (g1 == maxColor) {\n                H = 2.0 + (b1 - r1) / (maxColor - minColor);\n            } else {\n                H = 4.0 + (r1 - g1) / (maxColor - minColor);\n            }\n        }\n        _L = _L * 100;\n        _S = _S * 100;\n        _H = _H * 60;\n        if (_H < 0) {\n            _H += 360;\n        }\n        return Utils.render([Math.floor(H), Math.floor(S), Math.floor(V)], \"hsl\");\n    };\n\n    // ### name2hex method\n    //\n    // Get the hexadecimal value of an HTML color name. Must be one of the 176 HTML color names as defined by the HTML & CSS standards.\n    //\n    // `name2hex ( \"color name\" )`\n    Colors.name2hex = function (n) {\n        n = n.toLowerCase();\n        var nar = {\n            \"aliceblue\": \"#f0f8ff\",\n            \"antiquewhite\": \"#faebd7\",\n            \"aqua\": \"#00ffff\",\n            \"aquamarine\": \"#7fffd4\",\n            \"azure\": \"#f0ffff\",\n            \"beige\": \"#f5f5dc\",\n            \"bisque\": \"#ffe4c4\",\n            \"black\": \"#000000\",\n            \"blanchedalmond\": \"#ffebcd\",\n            \"blue\": \"#0000ff\",\n            \"blueviolet\": \"#8a2be2\",\n            \"brown\": \"#a52a2a\",\n            \"burlywood\": \"#deb887\",\n            \"cadetblue\": \"#5f9ea0\",\n            \"chartreuse\": \"#7fff00\",\n            \"chocolate\": \"#d2691e\",\n            \"coral\": \"#ff7f50\",\n            \"cornflowerblue\": \"#6495ed\",\n            \"cornsilk\": \"#fff8dc\",\n            \"crimson\": \"#dc143c\",\n            \"cyan\": \"#00ffff\",\n            \"darkblue\": \"#00008b\",\n            \"darkcyan\": \"#008b8b\",\n            \"darkgoldenrod\": \"#b8860b\",\n            \"darkgray\": \"#a9a9a9\",\n            \"darkgrey\": \"#a9a9a9\",\n            \"darkgreen\": \"#006400\",\n            \"darkkhaki\": \"#bdb76b\",\n            \"darkmagenta\": \"#8b008b\",\n            \"darkolivegreen\": \"#556b2f\",\n            \"darkorange\": \"#ff8c00\",\n            \"darkorchid\": \"#9932cc\",\n            \"darkred\": \"#8b0000\",\n            \"darksalmon\": \"#e9967a\",\n            \"darkseagreen\": \"#8fbc8f\",\n            \"darkslateblue\": \"#483d8b\",\n            \"darkslategray\": \"#2f4f4f\",\n            \"darkslategrey\": \"#2f4f4f\",\n            \"darkturquoise\": \"#00ced1\",\n            \"darkviolet\": \"#9400d3\",\n            \"deeppink\": \"#ff1493\",\n            \"deepskyblue\": \"#00bfff\",\n            \"dimgray\": \"#696969\",\n            \"dimgrey\": \"#696969\",\n            \"dodgerblue\": \"#1e90ff\",\n            \"firebrick\": \"#b22222\",\n            \"floralwhite\": \"#fffaf0\",\n            \"forestgreen\": \"#228b22\",\n            \"fuchsia\": \"#ff00ff\",\n            \"gainsboro\": \"#dcdcdc\",\n            \"ghostwhite\": \"#f8f8ff\",\n            \"gold\": \"#ffd700\",\n            \"goldenrod\": \"#daa520\",\n            \"gray\": \"#808080\",\n            \"grey\": \"#808080\",\n            \"green\": \"#008000\",\n            \"greenyellow\": \"#adff2f\",\n            \"honeydew\": \"#f0fff0\",\n            \"hotpink\": \"#ff69b4\",\n            \"indianred\": \"#cd5c5c\",\n            \"indigo\": \"#4b0082\",\n            \"ivory\": \"#fffff0\",\n            \"khaki\": \"#f0e68c\",\n            \"lavender\": \"#e6e6fa\",\n            \"lavenderblush\": \"#fff0f5\",\n            \"lawngreen\": \"#7cfc00\",\n            \"lemonchiffon\": \"#fffacd\",\n            \"lightblue\": \"#add8e6\",\n            \"lightcoral\": \"#f08080\",\n            \"lightcyan\": \"#e0ffff\",\n            \"lightgoldenrodyellow\": \"#fafad2\",\n            \"lightgray\": \"#d3d3d3\",\n            \"lightgrey\": \"#d3d3d3\",\n            \"lightgreen\": \"#90ee90\",\n            \"lightpink\": \"#ffb6c1\",\n            \"lightsalmon\": \"#ffa07a\",\n            \"lightseagreen\": \"#20b2aa\",\n            \"lightskyblue\": \"#87cefa\",\n            \"lightslategray\": \"#778899\",\n            \"lightslategrey\": \"#778899\",\n            \"lightsteelblue\": \"#b0c4de\",\n            \"lightyellow\": \"#ffffe0\",\n            \"lime\": \"#00ff00\",\n            \"limegreen\": \"#32cd32\",\n            \"linen\": \"#faf0e6\",\n            \"magenta\": \"#ff00ff\",\n            \"maroon\": \"#800000\",\n            \"mediumaquamarine\": \"#66cdaa\",\n            \"mediumblue\": \"#0000cd\",\n            \"mediumorchid\": \"#ba55d3\",\n            \"mediumpurple\": \"#9370d8\",\n            \"mediumseagreen\": \"#3cb371\",\n            \"mediumslateblue\": \"#7b68ee\",\n            \"mediumspringgreen\": \"#00fa9a\",\n            \"mediumturquoise\": \"#48d1cc\",\n            \"mediumvioletred\": \"#c71585\",\n            \"midnightblue\": \"#191970\",\n            \"mintcream\": \"#f5fffa\",\n            \"mistyrose\": \"#ffe4e1\",\n            \"moccasin\": \"#ffe4b5\",\n            \"navajowhite\": \"#ffdead\",\n            \"navy\": \"#000080\",\n            \"oldlace\": \"#fdf5e6\",\n            \"olive\": \"#808000\",\n            \"olivedrab\": \"#6b8e23\",\n            \"orange\": \"#ffa500\",\n            \"orangered\": \"#ff4500\",\n            \"orchid\": \"#da70d6\",\n            \"palegoldenrod\": \"#eee8aa\",\n            \"palegreen\": \"#98fb98\",\n            \"paleturquoise\": \"#afeeee\",\n            \"palevioletred\": \"#d87093\",\n            \"papayawhip\": \"#ffefd5\",\n            \"peachpuff\": \"#ffdab9\",\n            \"peru\": \"#cd853f\",\n            \"pink\": \"#ffc0cb\",\n            \"plum\": \"#dda0dd\",\n            \"powderblue\": \"#b0e0e6\",\n            \"purple\": \"#800080\",\n            \"red\": \"#ff0000\",\n            \"rosybrown\": \"#bc8f8f\",\n            \"royalblue\": \"#4169e1\",\n            \"saddlebrown\": \"#8b4513\",\n            \"salmon\": \"#fa8072\",\n            \"sandybrown\": \"#f4a460\",\n            \"seagreen\": \"#2e8b57\",\n            \"seashell\": \"#fff5ee\",\n            \"sienna\": \"#a0522d\",\n            \"silver\": \"#c0c0c0\",\n            \"skyblue\": \"#87ceeb\",\n            \"slateblue\": \"#6a5acd\",\n            \"slategray\": \"#708090\",\n            \"slategrey\": \"#708090\",\n            \"snow\": \"#fffafa\",\n            \"springgreen\": \"#00ff7f\",\n            \"steelblue\": \"#4682b4\",\n            \"tan\": \"#d2b48c\",\n            \"teal\": \"#008080\",\n            \"thistle\": \"#d8bfd8\",\n            \"tomato\": \"#ff6347\",\n            \"turquoise\": \"#40e0d0\",\n            \"violet\": \"#ee82ee\",\n            \"wheat\": \"#f5deb3\",\n            \"white\": \"#ffffff\",\n            \"whitesmoke\": \"#f5f5f5\",\n            \"yellow\": \"#ffff00\",\n            \"yellowgreen\": \"#9acd32\"\n        },\n            r = nar[n];\n        if (r === undefined) {\n            return \"Invalid Color Name\";\n        }\n\n        return r;\n    };\n\n    // ### name2rgb method\n    //\n    // Get an RGB object value of an HTML named color.\n    //\n    // `name2rgb ( \"color name\" )`\n    Colors.name2rgb = function (n) {\n        var v = this.name2hex(n),\n            t = /^[a-fA-F0-9#]{7}$/,\n            icn = \"Invalid Color Name\";\n\n        if (t.test(v)) {\n            return this.hex2rgb(v);\n        }\n\n        return Utils.render([icn, icn, icn], \"rgb\");\n    };\n\n    // ### name2hsv method\n    //\n    // Get an HSV object value of an HTML named color.\n    //\n    // `name2hsv ( \"color name\" )`\n    Colors.name2hsv = function (n) {\n        var v = this.name2hex(n),\n            t = /^[a-fA-F0-9#]{7}$/,\n            icn = \"Invalid Color Name\";\n        if (t.test(v)) {\n            return this.hex2hsv(v);\n        }\n\n        return Utils.render([icn, icn, icn], \"hsv\");\n    };\n\n    // ### complement method\n    //\n    // Get the complementary value of multiple types of input colors.\n    //\n    // ```complement ( \"#ffffff\" )\n    // complement ( [obj R, G, B] or R, G, B )```\n    Colors.complement = function (c, g, b) {\n        var cval, rtn;\n        if (typeof c == \"string\" && /(#([A-Fa-f0-9]){3}(([A-Fa-f0-9]){3})?)/.test(c)) {\n            c = c.replace(\"#\", \"\");\n            rtn = \"#\";\n            if (c.length === 6) {\n                rtn += Utils.paddedHex(255 - this.hex2rgb(c.substr(0, 2)));\n                rtn += Utils.paddedHex(255 - this.hex2rgb(c.substr(2, 2)));\n                rtn += Utils.paddedHex(255 - this.hex2rgb(c.substr(4, 2)));\n            }\n            if (c.length === 3) {\n                rtn += Utils.paddedHex(255 - this.hex2rgb(c.substr(0, 1) + c.substr(0, 1)));\n                rtn += Utils.paddedHex(255 - this.hex2rgb(c.substr(1, 1) + c.substr(1, 1)));\n                rtn += Utils.paddedHex(255 - this.hex2rgb(c.substr(2, 1) + c.substr(2, 1)));\n            }\n            return rtn;\n        } else {\n            if (c !== undefined && g !== undefined && b !== undefined) {\n                cval = [(255 - c), (255 - g), (255 - b)];\n            }\n            if (typeof c == \"object\") {\n                cval = [(255 - c[0]), (255 - c[1]), (255 - c[2])];\n            }\n            return Utils.render(cval, \"rgb\");\n        }\n    };\n\n    // ### rand method\n    //\n    // Get a random color in either hexadecimal or RGB color modes.\n    //\n    // `rand ( [color mode] )`\n    Colors.rand = function (mode) {\n        var R, G, B;\n\n        if (mode === \"hex\" || mode === undefined) {\n            var chars = \"0123456789abcdef\",\n                string_length = 6,\n                hexStr = \"\",\n                rnum, i;\n\n            for (i = 0; i < string_length; i++) {\n                rnum = Math.floor(Math.random() * chars.length);\n                hexStr += chars.substring(rnum, rnum + 1);\n            }\n            return \"#\" + hexStr;\n        }\n\n        if (mode == \"rgb\") {\n            R = Math.floor(Math.random() * (0 - 255 + 1) + 255);\n            G = Math.floor(Math.random() * (0 - 255 + 1) + 255);\n            B = Math.floor(Math.random() * (0 - 255 + 1) + 255);\n            return Utils.render([R, G, B], \"rgb\");\n        }\n    };\n\n    // Expose the public methods\n    window.Colors = window.$c = Colors;\n\n}(window));\n\n\n\n/*****************\n ** WEBPACK FOOTER\n ** ../~/colors.js/colors.js\n ** module id = 73\n ** module chunks = 0\n **/"],"sourceRoot":""}